ANNEX VI / Harmonisierte Einstufung und Kennzeichnung für bestimmte gefährliche Stoffe
ANHANG VI
Harmonisierte Einstufung und Kennzeichnung für bestimmte gefährliche Stoffe
In Teil 1 dieses Anhangs wird eine Einführung zur Liste der harmonisierten Einstufungen und Kennzeichnungen gegeben, die auch die in Tabelle 3 aufgeführten Informationen je Eintrag und entsprechenden Einstufungen und Gefahrenhinweise umfasst.
In Teil 2 dieses Anhangs werden allgemeine Grundsätze für die Vorbereitung der Dossiers festgelegt, mit denen eine harmonisierte Einstufung und Kennzeichnung von Stoffen auf Unionsebene vorgeschlagen und begründet wird.
In Teil 3 dieses Anhangs sind gefährliche Stoffe aufgeführt, für die eine harmonisierte Einstufung und Kennzeichnung auf Unionsebene erstellt wurde. Die Einstufungen und Kennzeichnungen in Tabelle 3 beruhen auf den Kriterien in Anhang I dieser Verordnung.
1. TEIL 1: EINFÜHRUNG ZUR LISTE DER HARMONISIERTEN EINSTUFUNGEN UND KENNZEICHNUNGEN
1.1. Informationen je Eintrag
1.1.1. Nummerierung der Einträge und Identifizierung eines Stoffes
1.1.1.1. Indexnummern
Die Einträge in Teil 3 sind nach der Ordnungszahl des Elements geordnet, das für die Eigenschaften des jeweiligen Stoffes am kennzeichnendsten ist. Organische Stoffe wurden aufgrund ihrer Vielfältigkeit in Klassen eingeordnet. Die Indexnummer der einzelnen Stoffe besteht aus einer Zeichensequenz nach dem Muster ABC-RST-VW-Y. ABC entspricht der Ordnungszahl des Elements bzw. der organischen Gruppe, das bzw. die am kennzeichnendsten für das Molekül ist. RST ist die laufende Nummer des Stoffes in der ABC-Reihe. VW gibt die Form an, in der der Stoff hergestellt oder in den Verkehr gebracht wird. Y ist die Kontrollziffer, die nach der zehnstelligen ISBN-Methode berechnet wird. Diese Nummer ist in der Spalte „Index No“ angegeben.
1.1.1.2. EG-Nummer
Die EG-Nummer, d. h. die EINECS-, ELINCS- oder NLP-Nummer, ist die offizielle Nummer des Stoffes in der Europäischen Union. Die EINECS-Nummer kann dem Europäischen Verzeichnis der auf dem Markt vorhandenen chemischen Stoffe (EINECS) ( 21 ) entnommen werden. Die ELINCS-Nummer kann der Europäischen Liste der angemeldeten chemischen Stoffe (in der aktuellen Ausgabe) entnommen werden (EUR 22543 EN, Amt für Amtliche Veröffentlichungen der Europäischen Gemeinschaften, 1997, ISBN 1018-5593). Die NLP-Nummer kann der Liste „No-longer-polymers“ (in der aktuellen Ausgabe) entnommen werden (Amt für Amtliche Veröffentlichungen der Europäischen Gemeinschaften, 1997, ISBN 92-827-8995-0). Bei der EG-Nummer handelt es sich um ein System siebenstelliger Nummern nach dem Muster XXX-XXX-X, das bei 200-001-8 (EINECS), 400-010-9 (ELINCS) und 500-001-0 (NLP) beginnt. Diese Nummer ist in der Spalte „EC No“ angegeben.
1.1.1.3. CAS-Nummer
Ferner wird die CAS-Nummer (Chemical Abstracts Service) angegeben, um den Eintrag leichter identifizieren zu können. Es sei darauf hingewiesen, dass ein und dieselbe EINECS-Nummer Stoffe sowohl in ihrer wasserfreien Form als auch in ihrer Hydratform beinhaltet, während es dafür häufig unterschiedliche CAS-Nummern gibt. Die angegebene CAS-Nummer bezeichnet lediglich die wasserfreie Form und beschreibt deshalb den Eintrag nicht immer mit der gleichen Genauigkeit wie die EINECS-Nummer. Diese Nummer ist in der Spalte „CAS No“ angegeben.
1.1.1.4. ►M18 Chemische Bezeichnung ◄
Gefährliche Stoffe werden nach Möglichkeit mit ihren IUPAC-Namen bezeichnet. In EINECS, ELINCS oder in der Liste „No-longer-polymers“ aufgeführte Stoffe werden mit den dort verwendeten Namen bezeichnet. In einigen Fällen sind auch andere Namen, wie z. B. der Trivialname oder der gebräuchliche Name, angegeben. Pflanzenschutzmittel und Biozidwirkstoffe werden nach Möglichkeit mit ihren ISO-Namen bezeichnet.
Verunreinigungen, Zusatzstoffe und unbedeutende Bestandteile werden normalerweise nicht angegeben, es sei denn, sie haben einen wesentlichen Einfluss auf die Einstufung des Stoffes.
Bei einigen Stoffen wird der spezifische Reinheitsgrad prozentual angegeben. Stoffe mit einem höheren Gehalt an Wirkstoffen (z. B. organische Peroxide) als dieser Prozentanteil werden nicht in den Eintrag in Teil 3 aufgenommen und können andere gefährliche Eigenschaften haben (z. B. Explosionsgefahr); sie sollten entsprechend eingestuft und gekennzeichnet werden.
Stoffspezifische Konzentrationsgrenzen beziehen sich auf den Stoff bzw. die Stoffe des Eintrags. Insbesondere bei Einträgen, bei denen es sich um Mischungen von Stoffen oder um Stoffe mit prozentualer Angabe des spezifischen Reinheitsgrades handelt, beziehen sich die Konzentrationsgrenzen nicht auf den reinen, sondern auf den in Teil 3 beschriebenen Stoff.
Für in Teil 3 aufgeführte Stoffe hat der auf dem Kennzeichnungsetikett zu verwendende Stoffname einer der Bezeichnungen zu entsprechen, die dort angegeben sind. Bei bestimmten Stoffen wurden zur leichteren Identifizierung des Stoffes zusätzliche Angaben in eckigen Klammern angefügt. Diese zusätzlichen Informationen brauchen nicht in das Kennzeichnungsetikett aufgenommen zu werden.
Bestimmte Einträge enthalten einen Verweis auf Verunreinigungen; in diesen Fällen steht hinter dem Namen des Stoffes folgender Wortlaut: „(enthält ≥xx % Verunreinigungen)“. Der Verweis in Klammern gilt dann als Bestandteil des Namens und muss in das Kennzeichnungsetikett aufgenommen werden.
1.1.1.5. Einträge für Stoffgruppen
Es werden eine Reihe von Gruppeneinträgen in Teil 3 aufgenommen. In diesen Fällen gelten die Vorschriften für die Einstufung und Kennzeichnung für alle von der Beschreibung erfassten Stoffe.
In einigen Fällen gibt es Einstufungs- und Kennzeichnungsanforderungen für bestimmte Stoffe eines Gruppeneintrags. Dann erfolgt für diesen Stoff ein eigener Eintrag in Anhang VI Teil 3, und beim Gruppeneintrag wird der Vermerk „mit Ausnahme der an einer anderen Stelle dieses Anhangs genannten Stoffe“ hinzugefügt.
In einigen Fällen können bestimmte Stoffe in verschiedenen Gruppeneinträgen erwähnt sein. In diesen Fällen entspricht die Einstufung des Stoffes derjenigen beider Gruppeneinträge. Sind für dieselbe Gefahr verschiedene Einstufungen angegeben, so ist die strengere Einstufung zu verwenden.
Einträge in Teil 3 für Salze (unter jeder Bezeichnung) gelten sowohl für Salze in wasserfreier Form als auch in Hydratform, sofern nicht etwas anderes festgelegt ist.
Bei Einträgen, die mehr als vier einzelne Stoffe umfassen, werden die EG- oder CAS-Nummern in der Regel nicht angegeben.
1.1.2. Informationen über die Einstufung und Kennzeichnung der einzelnen Einträge in Tabelle 3
1.1.2.1. Einstufungskodierungen
1.1.2.1.1.
Die Einstufung für die einzelnen Einträge basiert auf den Kriterien des Anhangs I gemäß Artikel 13 Buchstabe a und wird in Form von Abkürzungen dargestellt, die für die Gefahrenklasse und die Gefahrenkategorie oder Gefahrenkategorien/-unterklassen/-typen innerhalb dieser Gefahrenklasse stehen.
Die Gefahrenklassen und die für die einzelnen Gefahrenkategorien einer Klasse verwendeten Abkürzungen sind in Tabelle 1.1 angegeben.
Tabelle 1.1
|
Gefahrenklasse |
►C4 Kodierungen der Gefahrenklassen und Gefahrenkategorien ◄ |
|
Explosive Stoffe/Gemische und Erzeugnisse mit Explosivstoff |
Unst. Expl. Expl. 1.1 Expl. 1.2 Expl. 1.3 Expl. 1.4 Expl. 1.5 Expl. 1.6 |
|
Entzündbare Gase |
Flam. Gas 1A Flam. Gas 1B Flam. Gas 2 Pyr. Gas Chem. Unstab. Gas A Chem. Unstab. Gas B |
|
Aerosole |
Aerosol 1 Aerosol 2 Aerosol 3 |
|
Oxidierende Gase |
Ox. Gas 1 |
|
Gase unter Druck |
Press. Gas (*1) |
|
Entzündbare Flüssigkeiten |
Flam. Liq. 1 Flam. Liq. 2 Flam. Liq. 3 |
|
Entzündbare Feststoffe |
Flam. Sol. 1 Flam. Sol. 2 |
|
Selbstzersetzliche Stoffe oder Gemische |
Self-react. A Self-react. B Self-react. CD Self-react. EF Self-react. G |
|
Pyrophore Flüssigkeiten |
Pyr. Liq. 1 |
|
Pyrophore Feststoffe |
Pyr. Sol. 1 |
|
Selbsterhitzungsfähige Stoffe oder Gemische |
Self-heat. 1 Self-heat. 2 |
|
►C4 Stoffe oder Gemische, die in Berührung mit Wasser entzündbare Gase entwickeln ◄ |
Water-react. 1 Water-react. 2 Water-react. 3 |
|
Oxidierende Flüssigkeiten |
Ox. Liq. 1 Ox. Liq. 2 Ox. Liq. 3 |
|
Oxidierende Feststoffe |
Ox. Sol. 1 Ox. Sol. 2 Ox. Sol. 3 |
|
Organische Peroxide |
Org. Perox. A Org. Perox. B Org. Perox. CD Org. Perox. EF Org. Perox. G |
|
►C4 Korrosiv gegenüber Metallen ◄ |
Met. Corr. 1 |
|
Desensibilisierte explosive Stoffe/Gemische |
Desen. Expl. 1 Desen. Expl. 2 Desen. Expl. 3 Desen. Expl. 4 |
|
Akute Toxizität |
Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 4 |
|
Ätzwirkung auf die Haut/Hautreizung |
Skin Corr. 1 Skin Corr. 1A Skin Corr. 1 B Skin Corr. 1C Skin Irrit. 2 |
|
Schwere Augenschädigung/Augenreizung; |
Eye Dam. 1 Eye Irrit. 2 |
|
Sensibilisierung der Atemwege/Haut |
|
|
Keimzell-Mutagenität |
Muta. 1A Muta. 1B Muta. 2 |
|
Karzinogenität |
Carc. 1A Carc. 1B Carc. 2 |
|
Reproduktionstoxizität |
Repr. 1A Repr. 1B Repr. 2 Lact. |
|
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
STOT SE 1 STOT SE 2 STOT SE 3 |
|
Spezifische Zielorgan-Toxizität (wiederholte Exposition) |
STOT RE 1 STOT RE 2 |
|
Aspirationsgefahr |
Asp. Tox. 1 |
|
Endokriner Disruptor mit Wirkung auf die menschliche Gesundheit |
ED HH 1 ED HH 2 |
|
Gewässergefährdend |
Aquatic Acute 1 Aquatic Chronic 1 Aquatic Chronic 2 Aquatic Chronic 3 Aquatic Chronic 4 |
|
Endokriner Disruptor mit Wirkung auf die Umwelt |
ED ENV 1 ED ENV 2 |
|
Persistent, bioakkumulierbar und toxisch Sehr persistent und sehr bioakkumulierbar |
PBT vPvB |
|
Persistent, mobil und toxisch Sehr persistent und sehr mobil |
PMT vPvM |
|
Schädigt die Ozonschicht |
|
|
(*1)
Siehe Anmerkung U in Abschnitt 1.1.3. |
|
1.1.2.1.2.
Die gemäß Artikel 13 Buchstabe b zugeordneten Gefahrenhinweise werden gemäß Anhang III angegeben. Darüber hinaus werden dem dreistelligen Gefahrenhinweis-Code bei bestimmten Gefahrenhinweisen Buchstaben zur weiteren Differenzierung angefügt. Es werden die nachstehenden zusätzlichen Codes verwendet:
|
H350i |
Kann bei Einatmen Krebs erzeugen. |
|
H360F |
Kann die Fruchtbarkeit beeinträchtigen. |
|
H360D |
Kann das Kind im Mutterleib schädigen. |
|
H361f |
Kann vermutlich die Fruchtbarkeit beeinträchtigen. |
|
H361d |
Kann vermutlich das Kind im Mutterleib schädigen. |
|
H360FD |
Kann die Fruchtbarkeit beeinträchtigen. Kann das Kind im Mutterleib schädigen. |
|
H361fd |
Kann vermutlich die Fruchtbarkeit beeinträchtigen. Kann vermutlich das Kind im Mutterleib schädigen. |
|
H360Fd |
Kann die Fruchtbarkeit beeinträchtigen. Kann vermutlich das Kind im Mutterleib schädigen. |
|
H360Df |
Kann das Kind im Mutterleib schädigen. Kann vermutlich die Fruchtbarkeit beeinträchtigen. |
1.1.2.2. Kennzeichnungskodierungen
In der Kennzeichnungsspalte werden die folgenden Elemente aufgeführt:
die Kodierungen der Gefahrenpiktogramme gemäß Anhang V und in Übereinstimmung mit den Rangfolgevorschriften in Artikel 26;
die Signalwortkodierung „Gef.“ für „Gefahr“ oder „Achtg.“ für „Achtung“ in Übereinstimmung mit den Rangfolgevorschriften in Artikel 20 Absatz 3;
die Kodierungen der Gefahrenhinweise gemäß Anhang III und entsprechend der Einstufung;
die Kodierungen für die ergänzenden Hinweise gemäß Anhang II Teil 1, die in Übereinstimmung mit Artikel 25 Absatz 1 und den Vorschriften in Anhang II Teil 1 zugeordnet werden.
1.1.2.3. Spezifische Konzentrationsgrenzwerte, Multiplikationsfaktoren und Schätzwerte Akuter Toxizität (ATE)
Im Falle einer Abweichung von den allgemeinen Konzentrationsgrenzwerten des Anhangs I werden für eine bestimmte Kategorie spezifische Konzentrationsgrenzwerte in einer eigenen Spalte zusammen mit der betreffenden Einstufung unter Verwendung der Codes nach Abschnitt 1.1.2.1.1 aufgeführt. In derselben Spalte der Tabelle 3 sind auch harmonisierte ATE angegeben. Hersteller, Einführer oder nachgeschaltete Anwender müssen die spezifischen Konzentrationsgrenzwerte und die harmonisierten ATE für die Einstufung eines diesen Stoff enthaltenden Gemisches verwenden. Wenn ein ATE angewandt wird, ist die Additivitätsformel gemäß Anhang I Abschnitt 3.1.3.6 zu verwenden. Sind für eine bestimmte Kategorie in diesem Anhang keine spezifischen Konzentrationsgrenzwerte angegeben, gelten für die Einstufung von Stoffen, die Verunreinigungen, Zusatzstoffe und einzelne Bestandteile enthalten, und für Gemische die allgemeinen Konzentrationsgrenzwerte von Anhang I. Wenn harmonisierte ATE-Werte für akute Toxizität fehlen, ist der korrekte Wert anhand der verfügbaren Daten festzustellen.
Sofern nicht anders angegeben, sind die aufgeführten Konzentrationsgrenzwerte als Gewichtsprozent, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
Für den Fall, dass ein Multiplikationsfaktor (M-Faktor) für Stoffe harmonisiert wurde, die als gewässergefährdend in die Kategorie „Aquatic Acute 1“ oder „Aquatic Chronic 1“ eingestuft sind, wird dieser M-Faktor in Tabelle 3 in derselben Spalte wie die spezifischen Konzentrationsgrenzwerte angegeben. Falls ein M-Faktor für die Kategorie „Aquatic Acute 1“ oder für die Kategorie „Aquatic Chronic 1“ harmonisiert wurde, ist jeder M-Faktor in derselben Zeile aufzuführen wie seine entsprechende Differenzierung. Wird in Tabelle 3 ein einziger M-Faktor angegeben und ist der Stoff in die Kategorien „Aquatic Acute 1“ und „Aquatic Chronic 1“ eingestuft, so ist dieser M-Faktor vom Hersteller, Einführer oder nachgeschalteten Anwender für die Einstufung eines diesen Stoff enthaltenden Gemisches aufgrund seiner akuten und langfristigen Gewässergefährdung mithilfe der Summierungsmethode zu verwenden. Ist in Tabelle 3 kein M-Faktor angegeben, wird er auf der Grundlage der für den Stoff verfügbaren Daten vom Hersteller, Einführer oder nachgeschalteten Anwender festgelegt. Zur Festlegung und Verwendung des M-Faktors siehe Anhang I Abschnitt 4.1.3.5.5.5.
1.1.3. Einem Eintrag zugeordnete Anmerkungen
Die Anmerkung/-en, die einem Eintrag zugeordnet ist/sind, ist/sind in der Spalte „Notes“ aufgeführt. Der Inhalt der Anmerkungen lautet wie folgt:
1.1.3.1. Anmerkungen zur Identifizierung, Einstufung und Kennzeichnung von Stoffen
:
Der Name des Stoffes muss auf dem Kennzeichnungsetikett mit einer der in der Liste des Teils 3 aufgeführten Bezeichnungen angegeben werden.
In einigen Fällen wird in Teil 3 eine allgemeine Beschreibung wie „…verbindungen“ oder „…salze“ verwendet. In diesem Fall muss der Lieferant auf dem Kennzeichnungsetikett den korrekten Namen angeben und dabei Abschnitt 1.1.1.4. gebührend beachten.
:
Manche Stoffe (Säuren, Basen usw.) werden als wässrige Lösungen in unterschiedlichen Konzentrationen in Verkehr gebracht; dies erfordert auch eine unterschiedliche Einstufung und Kennzeichnung, da von den verschiedenen Konzentrationen unterschiedliche Gefahren ausgehen können.
In Teil 3 haben Einträge mit der Anmerkung B allgemeine Bezeichnungen wie „Salpetersäure ... %“.
In diesem Fall muss der Lieferant die Konzentration in Prozent auf dem Kennzeichnungsetikett angeben. Unter % ist ohne anderslautende Angabe stets der Gewichtsprozentsatz zu verstehen.
:
Manche organischen Stoffe können entweder in einer genau definierten isomeren Form oder als Gemisch mehrerer Isomere in Verkehr gebracht werden.
In diesem Fall muss der Lieferant auf dem Kennzeichnungsetikett angeben, ob es sich um ein bestimmtes Isomer oder um ein Isomerengemisch handelt.
:
Bestimmte Stoffe, die spontan polymerisieren oder sich zersetzen können, werden normalerweise in stabilisierter Form in Verkehr gebracht. Sie werden in dieser Form in Teil 3 aufgeführt.
Allerdings werden solche Stoffe manchmal auch in nicht stabilisierter Form in Verkehr gebracht. In diesem Fall muss der Lieferant auf dem Kennzeichnungsetikett nach dem Namen des Stoffes die Bezeichnung „nicht stabilisiert“ anfügen.
▼M15 —————
:
Dieser Stoff kann einen Stabilisator enthalten. Wenn dieser Stabilisator die mit der Einstufung in Teil 3 angegebenen gefährlichen Eigenschaften des Stoffes verändert, so sollten die Einstufung und die Kennzeichnung des Stoffes in Übereinstimmung mit den Vorschriften für die Einstufung und Kennzeichnung gefährlicher Gemische vorgenommen werden.
:
Diese Stoffe können in einer explosionsgefährlichen Form in Verkehr gebracht werden. In diesem Fall müssen die explosiven Eigenschaften durch entsprechende Prüfmethoden bestimmt werden. Die Einstufung und die Kennzeichnung müssen einen entsprechenden Hinweis auf diese Eigenschaften enthalten.
▼M2 —————
:
Die harmonisierte Einstufung als karzinogen oder keimzellmutagen wird vorgenommen, es sei denn, es kann nachgewiesen werden, dass der Stoff weniger als 0,1 Gewichtsprozent Benzol (Einecs-Nr. 200-753-7) enthält; in diesem Fall ist auch für diese Gefahrenklassen eine Einstufung gemäß Titel II dieser Verordnung vorzunehmen.
:
Die harmonisierte Einstufung als karzinogen oder keimzellmutagen wird vorgenommen, es sei denn, es kann nachgewiesen werden, dass der Stoff weniger als 0,1 Gewichtsprozent 1,3-Butadien (Einecs-Nr. 203-450-8) enthält; in diesem Fall ist auch für diese Gefahrenklassen eine Einstufung gemäß Titel II dieser Verordnung vorzunehmen. Wird der Stoff nicht als karzinogen oder keimzellmutagen eingestuft, so sind zumindest die Sicherheitshinweise (P102-)P210-P403 anzuwenden.
:
Die harmonisierte Einstufung als karzinogen wird vorgenommen, es sei denn, es kann nachgewiesen werden, dass der Stoff weniger als 3 % Dimethylsulfoxid-Extrakt, gemessen nach dem Verfahren IP 346 („Bestimmung der polyzyklischen Aromate in nicht verwendeten Schmierölen und asphaltenfreien Erdölfraktionen — Dimethylsulfoxid-Extraktion-Brechungsindex-Methode“, Institute of Petroleum, London), enthält; in diesem Fall ist auch für diese Gefahrenklasse eine Einstufung nach Titel II dieser Verordnung vorzunehmen.
:
Die harmonisierte Einstufung als karzinogen wird vorgenommen, es sei denn, es kann nachgewiesen werden, dass der Stoff weniger als 0,005 Gewichtsprozent Benzo[a]pyren (Einecs-Nr. 200-028-5) enthält; in diesem Fall ist auch für diese Gefahrenklasse eine Einstufung gemäß Titel II dieser Verordnung vorzunehmen.
:
Die harmonisierte Einstufung als karzinogen wird vorgenommen, es sei denn, der ganze Raffinationsprozess ist bekannt und es kann nachgewiesen werden, dass der Ausgangsstoff nicht karzinogen ist; in diesem Fall ist auch für diese Gefahrenklasse eine Einstufung gemäß Titel II dieser Verordnung vorzunehmen.
:
Die harmonisierte Einstufung als karzinogen oder keimzellmutagen wird vorgenommen, es sei denn, es kann nachgewiesen werden, dass der Stoff weniger als 0,1 Gewichtsprozent Benzol (Einecs-Nr. 200-753-7) enthält; in diesem Fall ist auch für diese Gefahrenklassen eine Einstufung gemäß Titel II dieser Verordnung vorzunehmen.
Wird der Stoff nicht als karzinogen oder keimzellmutagen eingestuft, so sind zumindest die Sicherheitshinweise (P102-)P260-P262-P301 + P310-P331 anzuwenden.
:
Die harmonisierte Einstufung als karzinogen wird vorgenommen, es sei denn, eine der nachstehenden Bedingungen ist erfüllt:
:
Die harmonisierte Einstufung als karzinogen wird vorgenommen außer im Falle von Fasern, bei denen der längengewichtete mittlere geometrische Durchmesser abzüglich der zweifachen geometrischen Standardabweichung, gemessen nach der Prüfmethode A.22 im Anhang der Verordnung (EG) Nr. 440/2008 der Kommission ( *4 ), größer ist als 6 μm.
:
Für diesen Stoff ist gegebenenfalls kein Kennzeichnungsetikett gemäß Artikel 17 erforderlich (siehe Anhang I Abschnitt 1.3) (Tabelle 3).
:
Dieser Stoff kann in einer Form in Verkehr gebracht werden, die nicht die physikalischen Eigenschaften aufweist, wie im Einstufungseintrag in Teil 3 angegeben. Wenn die Ergebnisse der einschlägigen Methode/-n gemäß der Verordnung (EG) Nr. 440/2008 zeigen, dass die betreffende Form des in Verkehr gebrachten Stoffes diese physikalische/-n Eigenschaft/-en nicht aufweist, ist der Stoff gemäß den Ergebnissen dieser Prüfung/-en einzustufen. In das Sicherheitsdatenblatt sind die betreffenden Informationen aufzunehmen, einschließlich der Nennung der einschlägigen Prüfmethode/-n.
(Tabelle 3):
Beim Inverkehrbringen müssen die Gase als „Gase unter Druck“ in eine der Gruppen der verdichteten Gase, der verflüssigten Gase, der tiefgekühlten Gase oder der gelösten Gase eingestuft werden. Die Zuordnung zu einer Gruppe hängt vom Aggregatzustand ab, in dem das Gas verpackt wird, und muss deshalb von Fall zu Fall entschieden werden. Folgende Kodierungen werden zugewiesen:
Aerosole dürfen nicht als Gase unter Druck eingestuft werden (vgl. Anhang I Teil 2 Abschnitt 2.3.2.1 Anmerkung 2).
Anmerkung V:
Soll der Stoff in Form von Fasern in Verkehr gebracht werden (mit Durchmesser < 3 μm, Länge > 5 μm und Seitenverhältnis ≥ 3:1) oder als Stoffpartikel, die die WHO-Kriterien für Fasern erfüllen, oder als Partikel mit veränderter Oberflächenchemie, so müssen ihre gefährlichen Eigenschaften gemäß Titel II dieser Verordnung bewertet werden, um festzustellen, ob eine höhere Kategorie (Carc. 1B oder 1A) und/oder zusätzliche Expositionswege (oral oder dermal) angewandt werden sollten.
Anmerkung W:
Es wurde festgestellt, dass die Gefahr einer karzinogenen Wirkung dieses Stoffes besteht, wenn lungengängiger Staub in Mengen eingeatmet wird, die zu einer signifikanten Beeinträchtigung der natürlichen Reinigungsmechanismen für Partikel in den Lungen führen.
Diese Anmerkung soll die spezifische Toxizität des Stoffes beschreiben und stellt kein Kriterium für die Einstufung gemäß dieser Verordnung dar.
Anmerkung X:
Die Einstufung in die Gefahrenklasse(n) dieses Eintrags beruht ausschließlich auf den gefährlichen Eigenschaften der Stoffbestandteile, die allen Stoffen in diesem Eintrag gemein ist. Die gefährlichen Eigenschaften der Stoffe des Eintrags hängen außerdem von den Eigenschaften der Bestandteile ab, die nicht allen Stoffen der Gruppe gemein sind. Letztere müssen bewertet werden, um festzustellen, ob eine strengere Einstufung (d. h. eine höhere Kategorie) oder eine umfassendere Einstufung (stärkere Differenzierung, Zielorgane und/oder Gefahrenhinweise) in die Gefahrenklasse(n) des Eintrags angewandt werden sollte.
Diese Anmerkung soll die spezifische Toxizität des Stoffes beschreiben und stellt kein Kriterium für die Einstufung gemäß dieser Verordnung dar.
1.1.3.2. Anmerkungen zur Einstufung und Kennzeichnung von Gemischen
:
Die angegebenen Konzentrationen oder — bei Fehlen einer entsprechenden Angabe — die in dieser Verordnung festgelegten allgemeinen Konzentrationen sind als Gewichtsprozent des Metalls, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
:
Die angegebenen Konzentrationen der Isocyanate sind als Gewichtsprozent des freien Monomers, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
:
Die angegebenen Konzentrationen sind als Gewichtsprozent der in Wasser gelösten Chromationen, bezogen auf das Gesamtgewicht des Gemisches, zu verstehen.
:
Die Konzentrationsgrenzwerte für gasförmige Gemische werden in Volumenprozent angegeben.
:
Legierungen, die Nickel enthalten, werden als hautsensibilisierend eingestuft, wenn die Freisetzung 0,5 μg Ni/cm2/Woche, gemessen mit Hilfe des Europäischen Standardreferenzprüfverfahrens EN 1811, übersteigt.
:
Die Einstufung als karzinogen wird vorgenommen, es sei denn, es kann nachgewiesen werden, dass die theoretische Höchstkonzentration an freisetzbarem Formaldehyd, unabhängig von der Quelle, in dem in Verkehr gebrachten Gemisch weniger als 0,1 % beträgt.
:
Die Einstufung als keimzellmutagen wird vorgenommen, es sei denn, es kann nachgewiesen werden, dass die theoretische Höchstkonzentration an freisetzbarem Formaldehyd, unabhängig von der Quelle, in dem in Verkehr gebrachten Gemisch weniger als 1 % beträgt.
:
Die Einstufung als „karzinogen bei Einatmen“ gilt nur für Gemische in Pulverform mit einem Gehalt von mindestens 1 % Titandioxid in Partikelform oder eingebunden in Partikel mit einem aerodynamischen Durchmesser von ≤ 10 μm.
:
Gemische sind als reproduktionstoxisch einzustufen, wenn die Summe der Konzentrationen einzelner als reproduktionstoxisch eingestufter Borverbindungen des Gemischs, wie es in den Verkehr gebracht wird, mindestens 0,3 % beträgt.
:
Gemische sind als reproduktionstoxisch einzustufen, wenn die Summe der Konzentrationen einzelner Stoffe dieses Eintrags in dem Gemisch, wie es in den Verkehr gebracht wird, dem geltenden allgemeinen Konzentrationsgrenzwert für die zugewiesene Kategorie oder einem in diesem Eintrag angegebenen spezifischen Konzentrationsgrenzwert entspricht oder diesen überschreitet.
1.2. Einstufungen und Gefahrenhinweise in Tabelle 3 infolge der Umwandlung von Einstufungen gemäß Anhang I der Richtlinie 67/548/EWG
1.2.1. Mindesteinstufung
Für bestimmte Gefahrenklassen, darunter akute Toxizität und spezifische Zielorgan-Toxizität (wiederholte Exposition), entspricht die Einstufung gemäß den Kriterien der Richtlinie 67/548/EWG nicht direkt der Einstufung in eine Gefahrenklasse und -kategorie gemäß dieser Verordnung. In diesen Fällen gilt die Einstufung in diesem Anhang als Mindesteinstufung. Diese Einstufung gilt, wenn keine der nachstehenden Bedingungen gegeben ist:
Die Mindesteinstufung in Bezug auf eine Kategorie ist in Tabelle 3 in der Spalte „Einstufung“ durch „*“ gekennzeichnet.
Das Zeichen „*“ ist auch in der Spalte „Spezifische Konzentrationsgrenzwerte und M-Faktoren und ATE“ zu finden, wo es anzeigt, dass für den betreffenden Eintrag bestimmte Konzentrationsgrenzwerte für akute Toxizität gemäß der Richtlinie 67/548/EWG gelten. Die Konzentrationsgrenzwerte können allerdings nicht in Konzentrationsgrenzwerte dieser Verordnung umgewandelt werden, was insbesondere im Fall einer Mindesteinstufung ausgeschlossen ist. Wenn das Zeichen „*“ angegeben wird, ist der Einstufung dieses Eintrags als akut toxisch dennoch besondere Beachtung beizumessen.
1.2.2. Expositionsweg kann nicht ausgeschlossen werden
Für bestimmte Gefahrenklassen, z. B. STOT, sollte der Expositionsweg im Gefahrenhinweis nur dann angegeben werden, wenn schlüssig belegt ist, dass diese Gefahr gemäß den Kriterien des Anhangs I bei keinem anderen Expositionsweg besteht. Gemäß der Richtlinie 67/548/EWG wurde der Expositionsweg für Einstufungen als R48 angegeben, wenn Daten vorlagen, die eine Einstufung für diesen Expositionsweg rechtfertigten. Die Einstufung gemäß der Richtlinie 67/548/EWG, bei der der Expositionsweg angegeben ist, wurde in die entsprechende Klasse und Kategorie gemäß dieser Verordnung umgewandelt, jedoch mit einem allgemeinen Gefahrenhinweis ohne Angabe des Expositionswegs, da die erforderlichen Informationen nicht verfügbar sind.
Diese Gefahrenhinweise sind in Tabelle 3 durch „**“ gekennzeichnet.
1.2.3. Gefahrenhinweise für die Reproduktionstoxizität
Die Gefahrenhinweise H360 und H361 zeigen an, dass aufgrund von Wirkungen auf die Fruchtbarkeit und/oder die Entwicklung allgemeiner Anlass zur Besorgnis besteht: „Kann/Kann vermutlich die Fruchtbarkeit beeinträchtigen oder das Kind im Mutterleib schädigen.“ Den Kriterien zufolge kann der allgemeine Gefahrenhinweis ersetzt werden durch den Gefahrenhinweis gemäß Abschnitt 1.1.2.1.2, der die konkrete Wirkung anzeigt, aufgrund deren Anlass zu Besorgnis besteht. Wenn die andere Differenzierung nicht erwähnt wird, so ist das darauf zurückzuführen, dass die Nachweise eine diesbezügliche Wirkung nicht belegen oder keine bzw. keine schlüssigen Daten vorliegen; für diese Differenzierung gelten die Verpflichtungen gemäß Artikel 4 Absatz 3.
Damit keine Informationen aus den harmonisierten Einstufungen für Wirkungen auf Fruchtbarkeit oder Entwicklung gemäß der Richtlinie 67/548/EWG verlorengehen, wurden die Einstufungen nur für Wirkungen übertragen, die bereits im Rahmen dieser Richtlinie eingestuft sind.
Diese Gefahrenhinweise sind in Tabelle 3 durch „***“ gekennzeichnet.
1.2.4. Ordnungsgemäße Einstufung nach physikalischen Gefahren konnte nicht vorgenommen werden
Für einige Einträge konnte eine ordnungsgemäße Einstufung nach physikalischen Gefahren nicht vorgenommen werden, da keine ausreichenden Daten für die Anwendung der Einstufungskriterien dieser Verordnung zur Verfügung stehen. Der betreffende Eintrag kann einer anderen (auch höheren) Kategorie oder sogar einer anderen Gefahrenklasse als den angegebenen Kategorien oder Gefahrenklassen zugeordnet werden. Die ordnungsgemäße Einstufung ist durch Prüfungen zu bestätigen.
Die Einträge mit physikalischen Gefahren, die durch Prüfungen bestätigt werden müssen, werden in Tabelle 3 mit „****“ gekennzeichnet.
2. TEIL 2: DOSSIERS FÜR EINE HARMONISIERTE EINSTUFUNG UND KENNZEICHNUNG
In diesem Teil werden allgemeine Grundsätze für die Vorbereitung der Dossiers festgelegt, mit denen eine harmonisierte Einstufung und Kennzeichnung vorgeschlagen und begründet wird.
Für Methodik und Format der Dossiers sind die einschlägigen Teile der Abschnitte 1, 2 und 3 des Anhangs I der Verordnung (EG) Nr. 1907/2006 zugrunde zu legen.
Für sämtliche Dossiers sind alle relevanten Informationen aus Registrierungsdossiers zu berücksichtigen, und es können weitere verfügbare Informationen verwendet werden. Für Gefahreninformationen, die der Agentur noch nicht unterbreitet wurden, ist dem Dossier eine qualifizierte Studienzusammenfassung beizulegen.
Ein Dossier für die harmonisierte Einstufung und Kennzeichnung muss Folgendes enthalten:
3. TEIL 3: TABELLE ZUR HARMONISIERTEN EINSTUFUNG UND KENNZEICHNUNG
Tabelle 3
Liste der harmonisierten Einstufungen und Kennzeichnungen gefährlicher Stoffe
|
Index-Nr. |
►M18 Chemische Bezeichnung ◄ |
EG-Nr. |
CAS-Nr. |
Einstufung |
Kennzeichnung |
►M18 Spezifische Konzentrationsgrenzen, M-Faktoren und ATE (*1) ◄ |
Anmerkungen |
|||
|
Kodierung der Gefahrenhinweise |
Piktogramm, Kodierung der Signalworte |
Kodierung der Gefahrenhinweise |
Kodierung der ergänzenden Gefahrenmerkmale |
|||||||
|
001-001-00-9 |
Wasserstoff |
215-605-7 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
001-002-00-4 |
Lithiumaluminiumhydrid |
240-877-9 |
Water-react. 1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
|
|
|
|
|
001-003-00-X |
Natriumhydrid |
231-587-3 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
|
|
001-004-00-5 |
Calciumhydrid |
232-189-2 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
|
|
003-001-00-4 |
Lithium |
231-102-5 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
|
003-002-00-X |
n-Hexyllithium |
404-950-0 |
Water-react. 1 Pyr. Sol. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
|
|
|
|
003-003-00-5 |
(2-Methylpropyl)lithium; Isobutyllithium |
440-620-2 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H260 H250 H314 H336 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H260 H250 H314 H336 H410 |
EUH014 |
|
|
|
|
004-001-00-7 |
Beryllium |
231-150-7 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
|
|
004-002-00-2 |
Berylliumverbindungen, ausgenommen Beryllium-Tonerdesilikate, und soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
|
|
A |
|
004-003-00-8 |
Berylliumoxid |
215-133-1 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
|
|
005-001-00-X |
Bortrifluorid |
231-569-5 |
Press. Gas Acute Tox. 2 * Skin Corr. 1A |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
EUH014 |
|
U |
|
|
005-002-00-5 |
Bortrichlorid |
233-658-4 |
Press. Gas Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1B |
H330 H300 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
|
U |
|
|
005-003-00-0 |
Bortribromid |
233-657-9 |
Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A |
H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
|
|
|
|
005-004-00-6 |
Trialkylborane, fest |
— |
— |
Pyr. Sol. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A |
|
005-004-01-3 |
Trialkylborane, flüssig |
— |
— |
Pyr. Liq. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A |
|
005-005-00-1 |
Trimethylborat |
204-468-9 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H312 |
GHS02 GHS07 Wng |
H226 H312 |
|
|
|
|
|
005-006-00-7 |
Dibutylzinnhydrogenborat |
401-040-5 |
Repr. 1B Muta. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H341 H372** H312 H302 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H360FD H341 H372** H312 H302 H318 H317 H410 |
|
|
|
|
|
005-007-00-2 |
Borsäure [1] Borsäure [2] |
233-139-2 [1] 234-343-4 [2] |
10043-35-3 [1] 11113-50-1 [2] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
005-008-00-8 |
Dibortrioxid |
215-125-8 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
|
005-009-00-3 |
Tetrabutylammoniumbutyltriphenylborat |
418-080-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
005-010-00-9 |
N, N-Dimethylanilintetrakis-(pentafluorphenyl)borat |
422-050-6 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H351 H302 H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H351 H302 H315 H318 |
|
|
|
|
|
005-011-00-4 |
Tetrabordinatriumheptaoxid, Hydrat; [1] Dinatriumtetraborat, wasserfrei; [2] Orthoborsäure, Natriumsalz; [3] Dinatriumtetraborat-Decahydrat; [4] Dinatriumtetraborat-Pentahydrat; [5] |
235-541-3 [1] 215-540-4 [2] 237-560-2 [3] 215-540-4 [4] 215-540-4 [5] |
12267-73-1 [1] 1330-43-4 [2] 13840-56-7 [3] 1303-96-4 [4] 12179-04-3 [5] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
005-012-00-X |
Diethyl{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienyliden]cyclohexa-2,5-dienyliden}ammoniumbutyltriphenylborat |
418-070-1 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
005-013-00-5 |
Diethylmethoxyboran |
425-380-9 |
Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H250 H332 H312 H302 H373** H314 H317 H413 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H250 H332 H312 H302 H373** H314 H317 H413 |
|
|
|
|
|
005-014-00-0 |
4-Formylphenylboronsäure |
438-670-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
005-015-00-6 |
1-Chlormethyl-4-fluor-1,4-diazoniabicyclo[2.2.2]octan-bis(tetrafluorborat) |
414-380-4 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
|
|
005-016-00-1 |
Tetrabutylammoniumbutyl-tris(4-tert-butylphenyl)borat |
431-370-5 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
005-017-00-7 |
Natriumperborat [1]; Natriumperoxometaborat [2] Natriumperoxoborat [Gehalt an Partikeln mit aerodynamischem Durchmesser unter 50 μm < 0,1 Gewichtsprozent] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr.1B; H360Df: C ≥9 % Repr.1B; H360 D: 6,5 % ≤ C <9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-017-01-4 |
Natriumperborat [1]; Natriumperoxometaborat [2] Natriumperoxoborat [Gehalt an Partikeln mit aerodynamischem Durchmesser unter 50 μm ≥ 0,1 Gewichtsprozent] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-018-00-2 |
Perborsäure (H3BO2(O2)), Mononatriumsalz-Trihydrat [1]; Perborsäure, Natriumsalz-Tetrahydrat [2]; Perborsäure (HBO(O2)), Natriumsalz-Tetrahydrat [3] Natriumperoxoborat-Hexahydrat [Gehalt an Partikeln mit aerodynamischem Durchmesser unter 50 μm < 0,1 Gewichtsprozent] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B STOT SE 3 Eye Dam. 1 |
H360Df H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H335 H318 |
|
Repr. 1B; H360Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
|
005-018-01-X |
Perborsäure (H3BO2(O2)), Mononatriumsalz-Trihydrat [1]; Perborsäure, Natriumsalz-Tetrahydrat [2]; Perborsäure (HBO(O2)), Natriumsalz-Tetrahydrat [3] Natriumperoxoborat-Hexahydrat [Gehalt an Partikeln mit aerodynamischem Durchmesser unter 50 μm ≥ 0,1 Gewichtsprozent] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H360Df H332 H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H332 H335 H318 |
|
Repr. 1B; H360 Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
|
005-019-00-8 |
Perborsäure, Natriumsalz [1]; Perborsäure, Natriumsalz- Monohydrat [2]; Perborsäure (HBO(O2)), Natriumsalz-Monohydrat [3] Natriumperoxoborat [Gehalt an Partikeln mit aerodynamischem Durchmesser unter 50 μm < 0,1 Gewichtsprozent] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-019-01-5 |
Perborsäure, Natriumsalz [1]; Perborsäure, Natriumsalz-Monohydrat [2]; Perborsäure (HBO(O2)), Natriumsalz-Monohydrat [3] Natriumperoxoborat [Gehalt an Partikeln mit aerodynamischem Durchmesser unter 50 μm ≥ 0,1 Gewichtsprozent] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-020-00-3 |
Dinatriumoctaborat wasserfrei; [1] Dinatriumoctaborat Tetrahydrat [2] |
234-541-0 [1] 234-541-0 [2] |
12008-41-2 [1] 12280-03-4 [2] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
006-001-00-2 |
Kohlenstoffmonoxid; Kohlenmonoxid; Kohlenoxid |
211-128-3 |
Flam. Gas 1 Press. Gas Repr. 1A Acute Tox. 3 * STOT RE 1 |
H220 H360D *** H331 H372 ** |
GHS02 GHS04 GHS06 GHS08 Dgr |
H220 H360D *** H331 H372 ** |
|
|
U |
|
|
006-002-00-8 |
Phosgen; Carbonylchlorid |
200-870-3 |
Press. Gas Acute Tox. 2 * Skin Corr. 1B |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
|
|
U |
|
|
006-003-00-3 |
Kohlenstoffdisulfid; Schwefelkohlenstoff |
200-843-6 |
Flam. Liq. 2 Repr. 2 STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 |
H225 H361fd H372 ** H319 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H361fd H372 ** H319 H315 |
|
Repr. 2; H361fd: C ≥ 1 % STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
|
|
006-004-00-9 |
Calciumcarbid |
200-848-3 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
T |
|
|
006-005-00-4 |
Thiram (ISO); Tetramethylthiuramdisulfid; Bis(dimethyl-thiocarbamoyl)-disulfid |
205-286-2 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H373 ** H319 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H373 ** H319 H315 H317 H410 |
|
M = 10 |
|
|
|
006-006-00-X |
Cyanwasserstoff; Cyanwasserstoffsäure; Blausäuregas |
200-821-6 |
Flam. Liq. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H224 H330 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H224 H330 H410 |
|
|
|
|
|
006-006-01-7 |
Cyanwasserstoff … %; Cyanwasserstoffsäure … %; Blausäure …% |
200-821-6 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
|
B |
|
|
006-007-00-5 |
Salze der Blausäure, ausgenommen komplexe Cyanide, z. B. Cyanoferrate (II) und (III) und Quecksilberoxidcyanid, und soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
EUH032 |
|
A |
|
006-008-00-0 |
Antu (ISO); 1-(1-Naphthyl)-2-thioharnstoff |
201-706-3 |
Acute Tox. 2 * Carc. 2 |
H300 H351 |
GHS06 GHS08 Dgr |
H300 H351 |
|
|
|
|
|
006-009-00-6 |
1-Isopropyl-3-methylpyrazol-5-yldimethylcarbamat; Isolan |
204-318-2 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
006-010-00-1 |
5,5-Dimethyl-3-oxocyclohex-1-enyldimethylcarbamat; 5,5-Dimethyldihydroresorcindimethylcarbamat; Dimetan |
204-525-8 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
|
006-011-00-7 |
Carbaryl (ISO); 1-Naphthylmethylcarbamat |
200-555-0 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H351 H332 H302 H400 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H302 H400 |
|
M=100 |
|
|
|
006-012-00-2 |
Ziram (ISO); Zinkbis(dimethyl-dithiocarbamat) |
205-288-3 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H373 ** H335 H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H302 H373 ** H335 H318 H317 H410 |
|
M = 100 |
|
|
|
006-013-00-8 |
Metam-Natrium (ISO); Natriummethyldithiocarbamat |
205-293-0 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
EUH031 |
|
|
|
|
006-014-00-3 |
Nabam (ISO); Dinatriumethylenbis(N, N'-dithiocarbamat) |
205-547-0 |
Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H317 H410 |
GHS07 GHS09 Wng |
H302 H335 H317 H410 |
|
|
|
|
|
006-015-00-9 |
Diuron (ISO); 3-(3,4-Dichlorphenyl)-1,1-dimethylharnstoff |
206-354-4 |
Carc. 1B STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H373 (Blutkreislauf) H400 H410 |
GHS08 GHS09 Dgr |
H350 H373 (Blutkreislauf) H410 |
|
M = 100 M = 100 |
|
|
|
006-016-00-4 |
Propoxur (ISO); 2-Isopropoxyphenyl-N-methylcarbamat; 2-Isopropoxyphenylmethylcarbamat |
204-043-8 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
|
006-017-00-X |
Aldicarb (ISO); 2-Methyl-2-(methylthio) propanal-O-(N-methylcarbamoyl)oxim |
204-123-2 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
|
|
|
|
006-018-00-5 |
Aminocarb (ISO); 4-Dimethylamino-3-tolylmethylcarbamat |
217-990-7 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
|
006-019-00-0 |
Diallat (ISO); S-(2,3-Dichlorallyl)-N, N-diisopropylthiocarbamat |
218-961-1 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
|
006-020-00-6 |
Barban (ISO); 4-Chlor-2-butinyl(3-chlorphenyl)carbamat |
202-930-4 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
|
006-021-00-1 |
Linuron (ISO); 3-(3,4-Dichlorphenyl)-1-methoxy-1-methylharnstoff |
206-356-5 |
Repr. 1B Carc. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H351 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H351 H302 H373 ** H410 |
|
|
|
|
|
006-022-00-7 |
Decarbofuran (ISO); 2,3-Dihydro-2-methylbenzofuran-7-ylmethylcarbamat |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
006-023-00-2 |
Mercaptodimethur (ISO); Methiocarb (ISO); xylylmethylcarbamat; 3,5-Dimethyl-4- methylthiophenyl-N-methylcarbamat |
217-991-2 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
|
006-024-00-8 |
Proxan-Natrium (ISO); Natrium-O-isopropyldithiocarbonat; Natrium-isopropyl-xanthogenat |
205-443-5 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
|
|
|
|
|
006-025-00-3 |
Allethrin; (RS)-3-Allyl-2-methyl-4-oxocyclopent-2-enyl(1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat; Bioallethrin; (RS)-3-Allyl-2-methyl-4-oxocyclopent-2-enyl(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat [1]; S-Bioallethrin [3]; (S)-3-Allyl-2-methyl-4-oxocyclopent-2-enyl(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat [2] Esbiothrin; (RS)-3-Allyl-2-methyl-4-oxocyclopent-2-enyl(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropancarboxylat |
209-542-4 [1] 249-013-5 [2]- [3] |
584-79-2 [1] 28434-00-6 [2] 84030-86-4 [3] |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
C |
|
006-026-00-9 |
Carbofuran (ISO); 2,3-Dihydro-2,2-dimethylbenzofuran-7-ylmethylcarbamat |
216-353-0 |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
|
|
|
|
|
006-028-00-X |
Dinobuton (ISO); 2-sec-Butyl-4,6-dinitrophenylisopropylcarbonat |
213-546-1 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
|
006-029-00-5 |
Dioxacarb (ISO); 2-(1,3-Dioxolan-2-yl)phenyl-N-methylcarbamat |
230-253-4 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
|
|
006-030-00-0 |
EPTC (ISO); S-Ethyldipropylthiocarbamat |
212-073-8 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-031-00-6 |
Formetanat (ISO); 3-[(EZ)-Dimethylaminomethylenamino]phenylmethylcarbamat |
244-879-0 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
|
|
006-032-00-1 |
Monolinuron (ISO); 3-(4-Chlorphenyl)-1-methoxy-1-methylharnstoff |
217-129-5 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
|
006-033-00-7 |
Metoxuron (ISO); 3-(3-Chlor-4-methoxyphenyl)-1,1-dimethylharnstoff |
243-433-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
006-034-00-2 |
Pebulat (ISO); N-Butyl-N-ethyl-S-propylthiocarbamat; N-Butyl-N-ethyl-S-propylthiocarbamat |
214-215-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-035-00-8 |
Pirimicarb (ISO); 2-(Dimethylamino)-5,6-dimethylpyrimidin-4-yl dimethylcarbamat |
245-430-1 |
Carc. 2 Acute Tox. 3 Acute Tox. 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H301 H317 H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H351 H331 H301 H317 H410 |
|
M = 10 M = 100 |
|
|
|
006-036-00-3 |
Benzthiazuron (ISO); 1-Benzothiazol-2-yl-3-methylharnstoff |
217-685-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-037-00-9 |
Promecarb (ISO); 3-Isopropyl-5- methylphenyl-N-methylcarbamat 3-Isopropyl-5-methylphenyl- N-methylcarbamat |
220-113-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
|
006-038-00-4 |
Sulfallat (ISO); 2-Chlorallyl-N, N-dimethyldithiocarbamat |
202-388-9 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
|
006-039-00-X |
Triallat (ISO); S-2,3,3-Trichlorallyldiisopropylthiocarbamat |
218-962-7 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
|
006-040-00-5 |
3-Methylpyrazol-5-yl- dimethylcarbamat; Monometilan |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
006-041-00-0 |
Dimethylcarbamoylchlorid; Dimethylcarbamidsäurechlorid |
201-208-6 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H350 H331 H302 H319 H335 H315 |
GHS06 GHS08 Dgr |
H350 H331 H302 H319 H335 H315 |
|
Carc. 1B; H350: C ≥ 0,001 % |
|
|
|
006-042-00-6 |
Monuron (ISO); 3-(4-Chlorphenyl)-1,1-dimethylharnstoff |
205-766-1 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
|
006-043-00-1 |
3-(4-Chlorphenyl)-1,1-dimethyluroniumtrichloracetat Monuron-TCA |
— |
Carc. 2 Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H319 H315 H410 |
|
|
|
|
|
006-044-00-7 |
Isoproturon (ISO); 3-(4-Isopropylphenyl)-1,1-dimethylharnstoff |
251-835-4 |
Carc. 2 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H373 (Blut) H400 H410 |
GHS08 GHS09 Wng |
H351 H373 (Blut) H410 |
|
M = 10 M = 10 |
|
|
|
006-045-00-2 |
Methomyl (ISO); 1-(Methylthio)ethylidenamino-N-methylcarbamat |
240-815-0 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
|
M=100 |
|
|
|
006-046-00-8 |
Bendiocarb (ISO); 2,2-Dimethyl-1,3-benzodioxol-4-yl-N-methylcarbamat; 2,2-Dimethyl-1,3-benzodioxol-4-yl-methylcarbamat |
245-216-8 |
Acute Tox. 3 Acute Tox. 3 Acute Tox. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H300 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H300 H410 |
|
M = 10 M = 100 |
|
|
|
006-047-00-3 |
Bufencarb (ISO); Reaktionsmasse aus 3-(1-Methylbutyl)phenyl-N-methylcarbamat und 3-(1-Ethylpropyl)phenyl-N-methylcarbamat |
— |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
|
006-048-00-9 |
Ethiofencarb (ISO); 2-(Ethylthiomethyl)phenyl-N-methylcarbamat |
249-981-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-049-00-4 |
Dixanthogen; O, O-Diethyldithiobis(thioformiat) |
207-944-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-050-00-X |
1,1-Dimethyl-3-phenyluroniumtrichloracetat; Fenuron-TCA |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
006-051-00-5 |
Ferbam (ISO); Eisentris(dimethyldithiocarbamat) |
238-484-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
|
|
|
|
006-052-00-0 |
Formetanathydrochlorid; 3-(N, N-dimethylaminomethylenamino)phenyl-N-methylcarbamat |
245-656-0 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
|
|
006-053-00-6 |
Isoprocarb (ISO); (2-Isopropylphenyl)-N-methylcarbamat; o-Cumenylmethylcarbamat |
220-114-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-054-00-1 |
Mexacarbat (ISO); 3,5-Dimethyl-4-dimethylaminophenyl-N-methylcarbamat |
206-249-3 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
|
006-055-00-7 |
Xylylcarb (ISO); 3,4-Dimethylphenyl-N-methylcarbamat; 3,4-Xylylmethylcarbamat; MPMC |
219-364-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-056-00-2 |
Metolcarb (ISO); m-Tolylmethylcarbamat; MTMC |
214-446-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-057-00-8 |
Nitrapyrin (ISO); 2-Chlor-6-trichlormethylpyridin |
217-682-2 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-058-00-3 |
Noruron (ISO); 1,1-Dimethyl-3-(perhydro-4,7-methanoinden-5-yl)harnstoff |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-059-00-9 |
Oxamyl (ISO); N',N'-Dimethylcarbamoyl(methylthio)methylenamin-N-methylcarbamat |
245-445-3 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Chronic 2 |
H330 H300 H312 H411 |
GHS06 GHS09 Dgr |
H330 H300 H312 H411 |
|
|
|
|
|
006-060-00-4 |
Oxycarboxin (ISO); 2,3-Dihydro-6-methyl-5-(N-phenylcarbamoyl-1,4-oxathiin-4,4-dioxid |
226-066-2 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
006-061-00-X |
S-Ethyl-N-(dimethylaminopropyl)thiocarbamathydrochlorid; Prothiocarb-Hydrochlorid |
243-193-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-062-00-5 |
Methyl-3,4-dichlorphenylcarbanilat; SWEP |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-063-00-0 |
Thiobencarb (ISO); S-4-Chlorbenzyldiethylthiocarbamat |
248-924-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-064-00-6 |
Thiofanox (ISO); 3,3-Dimethyl-1-(methylthio)butanon-O-(N-methylcarbamoyl)oxim |
254-346-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
006-065-00-1 |
3-Chlor-6-cyanobicyclo[2,2,1]heptan-2-on-O-(N-methylcarbamoyl)oxim; Triamid |
— |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Chronic 2 |
H300 H311 H411 |
GHS06 GHS09 Dgr |
H300 H311 H411 |
|
|
|
|
|
006-066-00-7 |
Vernolat (ISO); S-Propyldipropylthiocarbamat |
217-681-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-067-00-2 |
XMC; 3,5-Xylylmethylcarbamat |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-068-00-8 |
Diazomethan |
206-382-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
006-069-00-3 |
Thiophanat-methyl (ISO); Dimethyl-(1,2-phenylendicarbamothioyl)biscarbamat; Dimethyl-4,4’-(o-phenylen)bis(3-thioallophanat) |
245-740-7 |
Carc. 2 Muta. 2 Acute Tox. 4 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H341 H332 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H341 H332 H317 H410 |
|
Einatmen: ATE = 1,7 mg/L (Stäube und Nebel) M = 10 M = 10 |
|
|
|
006-070-00-9 |
Furmecyclox (ISO); N-Cyclohexyl-N-methoxy-2,5-dimethyl-3-furamid |
262-302-0 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
|
006-071-00-4 |
Cyclooct-4-en-1-ylmethylcarbonat |
401-620-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
006-072-00-X |
Prosulfocarb (ISO); S-Benzyl-N, N-dipropylthiocarbamat |
401-730-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
006-073-00-5 |
3-(Dimethylamino)propylharnstoff |
401-950-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
006-074-00-0 |
2-(3-(Prop-1-en-2-yl)phenyl)prop-2-ylisocyanat |
402-440-2 |
Acute Tox. 2 * Skin Corr. 1B STOT RE 2 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H314 H373 ** H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H314 H373 ** H334 H317 H410 |
|
|
|
|
|
006-076-00-1 |
Mancozeb (ISO); Manganethylen-bis(dithiocarbamat) (polymer), Komplex mit Zinksalz |
— |
Carc. 2 Repr. 1B STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360D H373 (Schilddrüse, Nervensystem) H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D H373 (Schilddrüse, Nervensystem) H317 H410 |
|
M = 10 M = 10 |
|
|
|
006-077-00-7 |
Maneb (ISO); Manganethylenbis(dithiocarbamat) (Polymer) |
235-654-8 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d*** H332 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d*** H332 H319 H317 H410 |
|
M=10 |
|
|
|
006-078-00-2 |
Zineb (ISO); Zinkethylenbis(dithiocarbamat) (Polymer) |
235-180-1 |
STOT SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
|
|
|
|
|
006-079-00-8 |
Disulfiram; Tetraethylthiuramdisulfid |
202-607-8 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
|
006-080-00-3 |
Tetramethylthiurammonosulfid |
202-605-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
006-081-00-9 |
Zinkbis(dibutyldithiocarbamat) |
205-232-8 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
|
|
006-082-00-4 |
Zinkbis(diethyldithiocarbamat) |
238-270-9 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H317 H410 |
|
|
|
|
|
006-083-00-X |
Butocarboxim (ISO); 3-(Methylthio)-2-butanon-O-[(methylamino)carbonyl]oxim |
252-139-3 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H331 H311 H301 H319 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H226 H331 H311 H301 H319 H410 |
|
|
|
|
|
006-084-00-5 |
Carbosulfan (ISO); 2,3-Dihydro-2,2-dimethyl-7-benzofuryl[(dibutylamino)thio]methylcarbamat |
259-565-9 |
Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H317 H410 |
|
|
|
|
|
006-085-00-0 |
Fenobucarb (ISO); 2-Butylphenylmethylcarbamat |
223-188-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-086-00-6 |
Fenoxycarb (ISO); Ethyl-[2-(4-phenoxyphenoxy)ethyl]carbamat |
276-696-7 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 1 M = 10 000 |
|
|
|
006-087-00-1 |
Furathiocarb (ISO); 2,3-Dihydro-2,2-dimethyl-7-benzofuryl-2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoat |
265-974-3 |
Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H373** H319 H315 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H301 H373** H319 H315 H317 H410 |
|
M = 100 |
|
|
|
006-088-00-7 |
Benfuracarb (ISO); Ethyl-N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl-β-alaninat |
— |
Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H361f*** H331 H302 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361f*** H331 H302 H410 |
|
|
|
|
|
▼M1 ————— |
||||||||||
|
006-090-00-8 |
2-(3-Iodprop-2-in-1-yloxy)ethylphenylcarbamat |
408-010-0 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H332 H318 H412 |
GHS05 GHS07 Dgr |
H332 H318 H412 |
|
|
|
|
|
006-091-00-3 |
Propineb (ISO); Zinkpropylenbis(dithiocarbamat) (Polymer) |
— |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 |
H332 H373** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H332 H373** H317 H400 |
|
|
|
|
|
006-092-00-9 |
tert-Butyl-(1S)-N-[1-((2S)-2-oxiranyl)-2-phenylethyl]carbamat |
425-420-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
006-093-00-4 |
2,2'-Dithiodi(ethylammonium)-bis(dibenzyldithiocarbamat) |
427-180-7 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
006-094-00-X |
O-Isobutyl-N-ethoxycarbonylthiocarbamat |
434-350-4 |
Flam. Liq. 3 Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H226 H350 H340 H302 H373** H317 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H340 H302 H373** H317 H411 |
|
|
|
|
|
006-095-00-5 |
Fosetyl-Aluminium (ISO); Aluminiumtriethyltriphosphonat |
254-320-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
006-096-00-0 |
Chlorpropham (ISO); Isopropyl-3-chlorcarbanilat |
202-925-7 |
Carc. 2 STOT RE 2 * Aquatic Chronic 2 |
H351 H373** H411 |
GHS08 GHS09 Wng |
H351 H373** H411 |
|
|
|
|
|
006-097-00-6 |
1-Phenyl-3-(p-toluolsulfonyl)harnstoff |
424-620-1 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373** H412 |
GHS08 GHS07 Wng |
H302 H373** H412 |
|
|
|
|
|
006-098-00-1 |
tert-Butyl-(1R,5S)-3-azabicyclo[3.1.0]hex-6-ylcarbamat |
429-170-8 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373** H318 H317 |
|
|
|
|
|
006-099-00-7 |
N-(p-Toluolsulfonyl)-N'-(3-(p-toluolsulfonyloxy)phenyl)harnstoff; 3-({[(4-Methylphenyl)sulfonyl]carbamoyl}amino)phenyl-4- methylbenzolsulfonat |
432-520-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
006-101-00-6 |
Reaktionsmasse aus N, N''-(Methylendi-4,1-phenylen)bis[N'-phenylharnstoff]; N-(4-[[4-[[(Phenylamino)carbonyl]amino]phenylmethyl]phenyl]-N'-cyclohexylharnstoff und N, N''-(Methylendi-4,1-phenylen)bis[N'-cyclohexylharnstoff] |
423-070-8 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
006-102-00-1 |
O-Hexyl-N-ethoxycarbonylthiocarbamat |
432-750-3 |
— |
Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H340 H302 H373** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H302 H373** H317 H411 |
|
|
|
|
006-103-00-7 |
N, N''-(Methylendi-4,1-phenylen)bis[N'-octyl]harnstoff |
445-760-8 |
— |
Eye Dam. 1 Resp. Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H318 H334 H410 |
|
M=100 |
|
|
007-001-00-5 |
Ammoniak, wasserfrei |
231-635-3 |
Flam. Gas 2 Press. Gas Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H221 H331 H314 H400 |
GHS04 GHS06 GHS05 GHS09 Dgr |
H221 H331 H314 H400 |
|
|
U |
|
|
007-001-01-2 |
Ammoniak ….%; Ammoniaklösung … % |
215-647-6 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
STOT SE 3; H335: C ≥ 5 % |
B |
|
|
007-002-00-0 |
Stickstoffdioxid [1]; Distickstofftetraoxid [2] |
233-272-6 [1] 234-126-4 [2] |
10102-44-0 [1] 10544-72-6 [2] |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1B |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
* STOT SE 3; H335: C ≥0,5 % |
5 |
|
007-003-00-6 |
Chlormequatchlorid (ISO); 2-Chlorethyltrimethylammoniumchlorid |
213-666-4 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
007-004-00-1 |
Salpetersäure … % [C > 70 %] |
231-714-2 |
Ox. Liq. 2 Acute Tox. 1 Skin Corr. 1A |
H272 H330 H314 |
GHS03 GHS06 GHS05 Dgr |
H272 H330 H314 |
EUH071 |
Ox. Liq. 2; H272: C ≥ 99 % Ox. Liq. 3; H272: 70 % ≤ C < 99 % |
B |
|
|
007-006-00-2 |
Ethylnitrit |
203-722-6 |
Flam. Gas 1 Press. Gas Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H220 H332 H312 H302 |
GHS02 GHS04 GHS07 Dgr |
H220 H332 H312 H302 |
|
|
U |
|
|
007-007-00-8 |
Ethylnitrat |
210-903-3 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
|
007-008-00-3 |
Hydrazin |
206-114-9 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H350 H331 H311 H301 H314 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H226 H350 H331 H311 H301 H314 H317 H410 |
|
Skin Corr. 1B; H314: C ≥ 10 % Skin Irrit. 2; H315: 3 % ≤ C < 10 % Eye Irrit. 2; H319: 3 % ≤ C < 10 % |
|
|
|
007-009-00-9 |
Dicyclohexylammoniumnitrit |
221-515-9 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
|
|
|
007-010-00-4 |
Natriumnitrit |
231-555-9 |
Ox. Sol. 3 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
|
|
007-011-00-X |
Kaliumnitrit |
231-832-4 |
Ox. Sol. 2 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
|
|
007-012-00-5 |
N,N-Dimethylhydrazin |
200-316-0 |
Flam. Liq. 2 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H225 H350 H331 H301 H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H331 H301 H314 H411 |
|
|
|
|
|
007-013-00-0 |
1,2-Dimethylhydrazin |
— |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H411 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
|
007-014-00-6 |
Salze von Hydrazin |
— |
— |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H311 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H317 H410 |
|
|
A |
|
007-015-00-1 |
O-Ethylhydroxylamin |
402-030-3 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
|
|
|
|
|
007-016-00-7 |
Butylnitrit; n-Butylnitrit |
208-862-1 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * |
H225 H331 H301 |
GHS02 GHS06 Dgr |
H225 H331 H301 |
|
|
|
|
|
007-017-00-2 |
Isobutylnitrit; 2-Methyl-propylnitrit-1 |
208-819-7 |
Flam. Liq. 2 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H341 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H341 H332 H302 |
|
|
|
|
|
007-018-00-8 |
sec-Butylnitrit; 1-Methyl-propylnitrit-1 |
213-104-8 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
|
007-019-00-3 |
tert-Butylnitrit 1,1-Dimethyl-ethylnitrit-1 |
208-757-0 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
|
007-020-00-9 |
Pentylnitrit [1]; „Amylnitrit“, Isomerengemisch [2] |
207-332-7 [1] 203-770-8 [2] |
463-04-7 [1] 110-46-3 [2] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
007-021-00-4 |
Hydrazobenzol; 1,2-Diphenylhydrazin |
204-563-5 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
|
007-022-00-X |
Hydrazinbis(3-carboxy-4-hydroxybenzolsulfonat) |
405-030-1 |
— |
Carc. 1B Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H350 H302 H314 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H350 H302 H314 H317 H412 |
|
|
|
|
007-023-00-5 |
Natrium-3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzolsulfonat |
405-510-0 |
— |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
007-024-00-0 |
2-(Decylthio)ethylammoniumchlorid |
405-640-8 |
STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H315 H318 H410 |
|
|
|
|
|
007-025-00-6 |
(4-Hydrazinphenyl)-N-methylmethansulfonamidhydrochlorid |
406-090-1 |
Muta. 2 Acute Tox. 3 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H301 H372 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H301 H372 ** H317 H410 |
|
|
|
|
|
007-026-00-1 |
Oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazid |
413-230-5 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
007-027-00-7 |
1,6-Bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexan |
420-190-2 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H314 H317 H410 |
|
|
|
|
|
007-028-00-2 |
Hydroxylammoniumnitrat |
236-691-2 |
Expl. 1.1 **** Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H201 H351 H311 H302 H373** H319 H315 H317 H400 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H351 H311 H302 H373** H319 H315 H317 H400 |
|
|
|
|
|
007-029-00-8 |
Diethyldimethylammoniumhydroxid |
419-400-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
|
007-030-00-3 |
Salpetersäure … % [C ≤ 70 %] |
231-714-2 |
Ox. Liq. 3 Acute Tox. 3 Skin Corr. 1A |
H272 H331 H314 |
GHS03 GHS06 GHS05 Dgr |
H272 H331 H314 |
EUH071 |
Ox. Liq. 3; H272: C ≥ 65 % Einatmen: ATE = 2,65 mg/L (Dämpfe) Skin Corr. 1A; H314: C ≥ 20 % Skin Corr. 1B; H314: 5 % ≤ C < 20 % |
B |
|
|
008-001-00-8 |
Sauerstoff |
231-956-9 |
Ox. Gas 1 Press. Gas |
H270 |
GHS03 GHS04 Dgr |
H270 |
|
|
U |
|
|
008-003-00-9 |
Wasserstoffperoxid-Lösung … % |
231-765-0 |
Ox. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H271 H332 H302 H314 |
GHS03 GHS05 GHS07 Dgr |
H271 H332 H302 H314 |
|
Ox. Liq. 1; H271: C ≥ 70 %**** Ox. Liq. 2; H272: 50 % ≤ C < 70 % **** * Skin Corr. 1A; H314: C ≥ 70 % Skin Corr. 1B; H314: 50 % ≤ C < 70 % Skin Irrit. 2; H315: 35 % ≤ C < 50 % Eye Dam. 1; H318: 8 % ≤ C < 50 % Eye Irrit. 2; H319: 5 % ≤ C < 8 % STOT SE 3; H335; C ≥ 35 % |
B |
|
|
009-001-00-0 |
Fluor |
231-954-8 |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1A |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
|
|
|
|
009-002-00-6 |
Fluorwasserstoff; Hydrogenfluorid |
231-634-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
|
|
|
|
009-003-00-1 |
Fluorwasserstoffsäure … % Flusssäure … % |
231-634-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
Skin Corr. 1A; H314: C ≥ 7 % Skin Corr. 1B; H314: 1 % ≤ C < 7 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
B |
|
|
009-004-00-7 |
Natriumfluorid |
231-667-8 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H319 H315 |
GHS06 Dgr |
H301 H319 H315 |
EUH032 |
|
|
|
|
009-005-00-2 |
Kaliumfluorid |
232-151-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
009-006-00-8 |
Ammoniumfluorid |
235-185-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
009-007-00-3 |
Natriumbifluorid; Natriumhydrogendifluorid |
215-608-3 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
|
009-008-00-9 |
Kaliumbifluorid; Kaliumhydrogendifluorid |
232-156-2 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
|
009-009-00-4 |
Ammoniumbifluorid; Ammoniumhydrogendifluorid |
215-676-4 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
|
009-010-00-X |
Borfluorwasserstoffsäure … % Tetrafluorborsäure … % |
240-898-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
|
009-011-00-5 |
Hexafluorokieselsäure … % Kieselfluorwasserstoffsäure … % |
241-034-8 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
B |
|
|
009-012-00-0 |
Alkalihexafluorsilicate(Na) [1];Alkalihexafluorsilicate(K) [2];Alkalihexafluorsilicate(NH4) [3] |
240-934-8 [1] 240-896-2 [2] 240-968-3 [3] |
16893-85-9 [1] 16871-90-2 [2] 16919-19-0 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
* |
A |
|
009-013-00-6 |
Fluorsilicate, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
* |
A |
|
009-014-00-1 |
Bleihexafluorsilikat; Blei(II)-hexafluorsilikat |
247-278-1 |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
|
009-015-00-7 |
Sulfuryldifluorid |
220-281-5 |
Press. Gas Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H373 ** H400 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H331 H373 ** H400 |
|
|
U |
|
|
009-016-00-2 |
Trinatriumhexafluoraluminat [1]; Aluminiumtrinatriumhexafluorid Trinatriumhexafluoraluminat (Kryolit) [2] |
237-410-6 [1] 239-148-8 [2] |
13775-53-6 [1] 15096-52-3 [2] |
STOT RE 1 Acute Tox. 4 Aquatic Chronic 2 |
H372 H332 H411 |
GHS07 GHS08 GHS09 Dgr |
H372 H332 H411 |
|
|
|
|
009-017-00-8 |
Kalium-μ-fluorbis(triethylaluminium) |
400-040-2 |
Flam. Sol. 1 Water-react. 1 Skin Corr. 1A Acute Tox. 4 * |
H228 H270 H314 H332 |
GHS02 GHS05 GHS07 Dgr |
H228 H270 H314 H332 |
EUH014 |
|
T |
|
|
009-018-00-3 |
Magnesiumhexafluorsilicat |
241-022-2 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
* |
|
|
|
011-001-00-0 |
Natrium |
231-132-9 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
|
011-002-00-6 |
Natriumhydroxid; Ätznatron; Natronlauge |
215-185-5 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit.2; H319: 0,5 % ≤ C < 2 % |
|
|
|
011-003-00-1 |
Natriumperoxid |
215-209-4 |
Ox. Sol. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
|
|
|
|
011-004-00-7 |
Natriumazid |
247-852-1 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H400 H410 |
EUH032 |
|
|
|
|
011-005-00-2 |
Natriumcarbonat |
207-838-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
011-006-00-8 |
Natriumcyanat |
213-030-6 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
011-007-00-3 |
Propoxycarbazon-Natrium; Natriumsalz von 2-(4,5-Dihydro-4-methyl-5- oxo-3-propoxy-1H-1,2,4-triazol-1-yl)carboxamidosulfonylbenzoesäure-methylester [CAS 145026-81-9] „MKH 6561“ |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 10 |
|
|
|
012-001-00-3 |
Magnesiumpulver (pyrophor) |
231-104-6 |
Water-react. 1 Pyr. Sol. 1 |
H260 H250 |
GHS02 Dgr |
H260 H250 |
|
|
T |
|
|
012-002-00-9 |
Magnesium, Pulver oder Späne |
231-104-6 |
— |
Flam. Sol. 1 Water-react. 2 Self-heat. 1 |
H228 H261 H252 |
GHS02 Dgr |
H228 H261 H252 |
|
|
T |
|
012-003-00-4 |
Magnesiumalkyle |
— |
— |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
|
A |
|
012-004-00-X |
Aluminium-Magnesium-Carbonat-Hydroxid-Perchlorat-Hydrat |
422-150-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
013-001-00-6 |
Aluminiumpulver (pyrophor) |
231-072-3 |
Water-react. 2 Pyr. Sol. 1 |
H261 H250 |
GHS02 Dgr |
H261 H250 |
|
|
T |
|
|
013-002-00-1 |
Aluminiumpulver (stabilisiert) |
231-072-3 |
Water-react. 2 Flam. Sol. 1 |
H261 H228 |
GHS02 Dgr |
H261 H228 |
|
|
T |
|
|
013-003-00-7 |
Aluminiumchlorid, wasserfrei |
231-208-1 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
013-004-00-2 |
Aluminiumalkyle |
— |
— |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
|
A |
|
013-005-00-8 |
Diethyl(ethyldimethylsilanolato)aluminium |
401-160-8 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
|
|
|
|
013-006-00-3 |
(Ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxy-2-propanolato)aluminium(III), dimerisiert |
402-370-2 |
— |
Flam. Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
|
|
|
|
013-007-00-9 |
Poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) |
403-430-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
013-008-00-4 |
Di-n-octylaluminiumiodid |
408-190-0 |
Pyr. Liq. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H314 H410 |
EUH014 |
|
|
|
|
013-009-00-X |
Natrium(n-butyl)x(ethyl)y-1,5-dihydro)aluminat, x = 0,5; y = 1,5 |
418-720-2 |
— |
Flam. Sol. 1 Water-react. 1 Pyr. Sol. 1 Acute Tox. 4 * Skin Corr. 1A |
H228 H260 H250 H332 H314 |
GHS02 GHS05 GHS07 Dgr |
H228 H260 H250 H332 H314 |
EUH014 |
|
T |
|
013-010-00-5 |
Hydroxylaluminiumbis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d, g][1.3.2]dioxaphosphocin-6-oxid) |
430-650-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
014-001-00-9 |
Trichlorsilan |
233-042-5 |
Flam. Liq. 1 Water-react. 1 Acute Tox. 3 Acute Tox. 4 Skin Corr. 1A Eye Dam. 1 |
H224 H260 H331 H302 H314 H318 |
GHS02 GHS06 GHS05 Dgr |
H224 H260 H331 H302 H314 |
EUH014 EUH029 EUH071 |
Einatmung: ATE = 7,6 mg/L (Dämpfe) Oral: ATE = 1 000 mg/kg KG |
|
|
|
014-002-00-4 |
Siliciumtetrachlorid |
233-054-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
EUH014 |
|
|
|
|
014-003-00-X |
Dimethyldichlorsilan |
200-901-0 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
|
|
|
|
|
014-004-00-5 |
Trichlor(methyl)silan; Methyltrichlorsilan |
200-902-6 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
EUH014 |
Skin Irrit.2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
|
014-005-00-0 |
Tetraethylsilicat; Ethylsilicat; Tetraethoxysilan |
201-083-8 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H226 H332 H319 H335 |
GHS02 GHS07 Wng |
H226 H332 H319 H335 |
|
|
|
|
|
014-006-00-6 |
Bis(4-fluorphenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silanhydrochlorid |
401-380-4 |
— |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
014-007-00-1 |
Triethoxyisobutylsilan |
402-810-3 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
|
014-008-00-7 |
(Chlormethyl)bis(4-fluorphenyl)methylsilan |
401-200-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
014-009-00-2 |
Isobutylisopropyldimethoxysilan |
402-580-4 |
Flam. Liq. 3 Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H315 |
GHS02 GHS07 Wng |
H226 H332 H315 |
|
|
|
|
|
014-010-00-8 |
Dinatriummetasilicat |
229-912-9 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
|
|
014-011-00-3 |
Cyclohexyldimethoxymethylsilan |
402-140-1 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
014-012-00-9 |
Bis(3-(trimethoxysilyl)propyl)amin |
403-480-3 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
014-013-00-4 |
α-Hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxan) |
404-920-7 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H312 H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H411 |
|
|
|
|
014-014-00-X |
Etacelasil (ISO); 6-(2-Chlorethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecan |
253-704-7 |
Repr. 1B Acute Tox. 4 * STOT RE 2 * |
H360D *** H302 H373 ** |
GHS08 GHS07 Dgr |
H360D *** H302 H373 ** |
|
|
|
|
|
014-015-00-5 |
α-Trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilandiyl]-co-oxy(dimethylsilan)) |
406-420-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
014-016-00-0 |
Reaktionsmasse aus: 1,3-Dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxan und 1,3-Dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxan |
406-490-6 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-017-00-6 |
Flusilazol (ISO); Bis(4-fluorphenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silan |
— |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
|
|
014-018-00-1 |
Octamethylcyclotetrasiloxan; [D4] |
209-136-7 |
Repr. 2 Aquatic Chronic 1 |
H361f *** H410 |
GHS08 GHS09 Wng |
H361f *** H410 |
|
M = 10 |
|
|
|
014-019-00-7 |
Reaktionsmasse aus 4-[[Bis(4-fluorphenyl)methylsilyl]methyl]-4H-1,2,4-triazol und 1-[[Bis(4-fluorphenyl)methylsilyl]methyl]-1H-1,2,4-triazol |
403-250-2 |
— |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
|
014-020-00-2 |
Bis(1,1-dimethyl-2-propynyloxy)dimethylsilan |
414-960-7 |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
|
|
014-021-00-8 |
Tris(isopropenyloxy)phenylsilan |
411-340-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H400 H410 |
|
|
|
|
|
014-022-00-3 |
Reaktionsprodukt von (2-Hydroxy-4-(3-propenoxy)benzophenon und Triethoxysilan) mit (Hydrolyseprodukt von Siliciumdioxid und Methyltrimethoxysilan) |
401-530-9 |
— |
Flam. Sol. 1 STOT SE 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H228 H370 ** H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H228 H370 ** H332 H312 H302 |
|
|
T |
|
014-023-00-9 |
α, ω-Dihydroxypoly(hex-5-en-1-ylmethylsiloxan) |
408-160-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
014-024-00-4 |
1-((3-(3-Chlor-4-fluorphenyl)propyl)dimethylsilanyl)-4-ethoxybenzol |
412-620-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
014-025-00-X |
4-[3-(Diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidin |
411-400-3 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H315 H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 H412 |
|
|
|
|
|
014-026-00-5 |
Dichlor-(3-(3-chlor-4-fluorphenyl)propyl)methylsilan |
407-180-3 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
014-027-00-0 |
Chlor(3-(3-chlor-4-fluorphenyl)propyl)dimethylsilan |
410-270-5 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
014-028-00-6 |
α-[3-(1-Oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilylpoly(dimethylsiloxan) |
415-290-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
014-029-00-1 |
O, O'-(Ethenylmethylsilylen)di[(4-methylpentan-2-on)oxim] |
421-870-1 |
Repr. 2 Acute Tox. 4 * STOT RE 2 * |
H361f *** H302 H373 ** |
GHS08 GHS07 Wng |
H361f *** H302 H373 ** |
|
|
|
|
|
014-030-00-7 |
[(Dimethylsilylen)bis((1,2,3,3a,7a-η)-1H-inden-1-yliden)dimethyl]hafnium |
422-060-0 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
|
014-031-00-2 |
Bis(1-methylethyl)-dimethoxysilan |
421-540-7 |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H226 H315 H317 H412 |
GHS02 GHS07 Wng |
H226 H315 H317 H412 |
|
|
|
|
|
014-032-00-8 |
Dicyclopentyldimethoxysilan |
404-370-8 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
|
014-033-00-3 |
2-Methyl-3-(trimethoxysilyl)propyl-2-propenoat, Hydrolyseprodukt mit Siliciumdioxid |
419-030-4 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
|
|
|
|
|
014-034-00-9 |
3-Hexylheptamethyltrisiloxan |
428-700-5 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
|
014-035-00-4 |
2-(3,4-Epoxycyclohexyl)ethyltriethoxysilan |
425-050-4 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
014-036-00-X |
(4-Ethoxyphenyl)(3-(4-fluor-3-phenoxyphenyl)propyl)dimethylsilan |
405-020-7 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360F*** H400 H410 |
GHS08 GHS09 Dgr |
H360F*** H410 |
|
M=1000 |
|
|
|
014-037-00-5 |
2-Butanon-O, O',O''-(phenylsilylidin)trioxim |
433-360-6 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373** H317 H412 |
GHS08 GHS07 Wng |
H373** H317 H412 |
|
|
|
|
|
014-038-00-0 |
S-(3-(Triethoxysilyl)propyl)octanthioat |
436-690-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
014-039-00-6 |
(2,3-Dimethylbut-2-yl)-trimethoxysilan |
439-360-2 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
|
014-041-00-7 |
N, N-Bis(trimethylsilyl)aminopropylmethyldiethoxysilan |
445-890-5 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
|
014-042-00-2 |
Reaktionsmasse aus O,O',O'',O'''-Silantetrayl-tetrakis(4-methyl-2-pentanonoxim) (3 Stereoisomere) |
423-010-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
014-043-00-8 |
Reaktionsprodukt von amorphem Siliciumdioxid (50-85 %), Butyl-(1-methylpropyl)magnesium (3-15 %), Tetraethylorthosilicat (5-15 %) und Titantetrachlorid (5-20 %) |
432-200-2 |
— |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H335 H315 H318 H412 |
GHS05 GHS07 Dgr |
H335 H315 H318 H412 |
|
|
|
|
014-044-00-3 |
3-[(4'-Acetoxy-3'-methoxyphenyl)-propyl]-trimethoxysilan |
433-050-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-045-00-9 |
Magnesium-Natrium-Fluorid-Silicat |
442-650-1 |
— |
STOT RE 2 * |
H373** |
GHS08 Wng |
H373** |
|
|
|
|
014-046-00-4 |
E-Glas-Mikrofasern in repräsentativer Zusammensetzung; [ungerichtete Calcium-Aluminium-Silicat-Fasern mit folgender repräsentativer Zusammensetzung (Angabe in % Massenanteil): SiO2 50,0-56,0 %, Al2O3 13,0-16,0 %, B2O3 5,8-10,0 %, Na2O < 0,6 %, K2O < 0,4 %, CaO 15,0-24,0 %, MgO < 5,5 %, Fe2O3 < 0,5 %, F2 < 1,0 %. Verfahren: Herstellung typischerweise im Düsenblasverfahrenoder im Schleuderverfahren. (Weitere Einzelelemente können in geringen Mengen vorhanden sein. Die Verfahrensliste schließt Innovationen nicht aus).] |
— |
— |
Carc. 1B |
H350i |
GHS08 Dgr |
H350i |
|
|
A |
|
014-047-00-X |
Glas-Mikrofasern in repräsentativer Zusammensetzung; [ungerichtete Calcium-Aluminium-Silicat-Fasern mit folgender Zusammensetzung (Angabe in % Massenanteil): SiO2 55,0-60,0 %, Al2O3 4,0-7,0 %, B2O3 8,0-11,0 %, ZrO2 0,0-4,0 %, Na2O 9,5-13,5 %, K2O 0,0-4,0 %, CaO 1,0-5,0 %, MgO 0,0-2,0 %, Fe2O3 < 0,2 %, ZnO 2,0-5,0 %, BaO 3,0-6,0 %, F2 < 1,0 %. Verfahren: Herstellung typischerweise im Düsenblasverfahren oder im Schleuderverfahren. (Weitere Einzelelemente können in geringen Mengen vorhanden sein. Die Verfahrensliste schließt Innovationen nicht aus).] |
— |
— |
Carc. 2 |
H351 (Einatmen) |
GHS08 Wng |
H351 (Einatmen) |
|
|
A |
|
014-048-00-5 |
Siliciumcarbidfasern (mit Durchmesser < 3 μm, Länge > 5 μm und Seitenverhältnis ≥ 3:1) |
206-991-8 |
Carc. 1B |
H350i |
GHS08 Dgr |
H350i |
|
|
|
|
|
014-049-00-0 |
Trimethoxyvinylsilan; Trimethoxy(vinyl)silan |
220-449-8 |
Skin Sens. 1B |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
014-050-00-6 |
Tris(2-methoxyethoxy)vinylsilan; 6-(2-Methoxyethoxy)-6-vinyl-2,5,7,10-tetraoxa-6-silaundecan |
213-934-0 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
014-052-00-7 |
Silanamin, 1,1,1-Trimethyl-N-(trimethylsilyl)-, Hydrolyseprodukte mit Siliciumdioxid; pyrogenes, synthetisch amorphes, oberflächenbehandeltes Siliciumdioxid in Nanoform |
272-697-1 |
STOT RE 2 |
H373 (Lunge) (Einatmen) |
GHS08 Wng |
H373 (Lunge) (Einatmen) |
EUH066 |
|
|
|
|
015-001-00-1 |
Weißer Phosphor; Tetraphosphor |
231-768-7 |
Pyr. Sol. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H250 H330 H300 H314 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H250 H330 H300 H314 H400 |
|
|
|
|
|
015-002-00-7 |
Roter Phosphor |
231-768-7 |
Flam. Sol. 1 Aquatic Chronic 3 |
H228 H412 |
GHS02 Dgr |
H228 H412 |
|
|
|
|
|
015-003-00-2 |
Calciumphosphid; Tricalciumdiphosphid |
215-142-0 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Eye Dam. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H318 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H260 H300 H311 H330 H318 H400 |
EUH029 EUH032 |
M = 100 |
|
|
|
015-004-00-8 |
Aluminiumphosphid |
244-088-0 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M = 100 |
|
|
|
015-005-00-3 |
Magnesiumphosphid; Trimagnesiumdiphosphid |
235-023-7 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M = 100 |
|
|
|
015-006-00-9 |
Trizinkdiphosphid; Zinkphosphid |
215-244-5 |
Water-react. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H260 H300 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H410 |
EUH029 EUH032 |
M=100 |
T |
|
|
015-007-00-4 |
Phosphortrichlorid |
231-749-3 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Skin Corr. 1A |
H330 H300 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H300 H373 ** H314 |
EUH014 EUH029 |
|
|
|
|
015-008-00-X |
Phosphorpentachlorid |
233-060-3 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B |
H330 H302 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H302 H373 ** H314 |
EUH014 EUH029 |
|
|
|
|
015-009-00-5 |
Phosphoryltrichlorid; Phosphoroxidchlorid; Phosphorylchlorid |
233-046-7 |
Acute Tox. 2 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1A |
H330 H372 ** H302 H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H372 ** H302 H314 |
EUH014 EUH029 |
|
|
|
|
015-010-00-0 |
Phosphorpentoxid |
215-236-1 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
015-011-00-6 |
Phosphorsäure …%, ortho-Phosphorsäure …% |
231-633-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
|
015-012-00-1 |
Tetraphosphortrisulfid; Phosphorsesquisulfid |
215-245-0 |
Flam. Sol. 2 Water-react. 1 Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H302 H400 |
|
|
T |
|
|
015-013-00-7 |
Triethylphosphat |
201-114-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
015-014-00-2 |
Tributylphosphat |
204-800-2 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 |
H351 H302 H315 |
GHS08 GHS07 Wng |
H351 H302 H315 |
|
|
|
|
|
015-015-00-8 |
Trikresylphosphat (o-o-o-, o-o- m-, o-o-p-, o-m-m-, o-m-p-, o-p- p-); Tritolylphosphat (o-o-o-, o-o- m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-) |
201-103-5 |
STOT SE 1 Aquatic Chronic 2 |
H370 ** H411 |
GHS08 GHS09 Dgr |
H370 ** H411 |
|
STOT SE 1; H370: C ≥ 1 % STOT SE 2; H371: 0,2 % ≤ C < 1 % |
C |
|
|
015-016-00-3 |
Trikresylphosphat (m-m-m-, m- m-p-, m-p-p-, p-p-p-); Tritolylphosphat (m-m-m-, m-m-p-, m-p-p-, p-p-p-) |
201-105-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H312 H302 H411 |
GHS07 GHS09 Wng |
H312 H302 H411 |
|
* |
C |
|
|
015-019-00-X |
Dichlorvos (ISO); 2,2-Dichlorvinyldimethylphosphat; Phosphorsäure-2,2-dichlorvinyl-dimethylester |
200-547-7 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 |
H330 H311 H301 H317 H400 |
GHS06 GHS09 Dgr |
H330 H311 H301 H317 H400 |
|
M=1000 |
|
|
|
015-020-00-5 |
Mevinphos (ISO); 2-Methoxycarbonyl-1-methylvinyldimethylphosphat |
232-095-1 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10000 |
|
|
|
015-021-00-0 |
Trichlorfon (ISO); Dimethyl-2,2,2-trichlor-1-hydroxyethylphosphonat |
200-149-3 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H400 H410 |
|
M = 1000 |
|
|
|
015-022-00-6 |
Phosphamidon (ISO); 2-Chlor-2-diethylcarbamoyl-1-methylvinyldimethylphosphat |
236-116-5 |
Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H300 H311 H410 |
|
|
|
|
|
015-023-00-1 |
Pyrazoxon; Diethyl- 3-methylpyrazol-5-ylphosphat |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
|
015-024-00-7 |
Triamiphos (ISO); 5-Amino-3-phenyl-1,2,4-triazol-1-yl-N, N,N',N'-tetramethylphosphonsäurediamid |
— |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-025-00-2 |
TEPP (ISO); Tetraethylpyrophosphat |
203-495-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
|
015-026-00-8 |
Schradan (ISO); Octamethylpyrophosphoramid |
205-801-0 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-027-00-3 |
Sulfotep (ISO); O, O,O, O-Tetraethyldithiopyrophosphat |
222-995-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
|
015-028-00-9 |
Demeton-O (ISO); O,O-diethyl-O-2-(ethylthio)ethyl) phosphorothioat |
206-053-8 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
|
015-029-00-4 |
Demeton-S (ISO); O, O-Diethyl-S-(2-ethylthioethyl) phosphorothioat |
204-801-8 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-030-00-X |
Demeton-O-methyl (ISO); O-2-Ethylthioethyl-O,O-dimethyl phosphorothioat |
212-758-1 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
|
015-031-00-5 |
Demeton-S-methyl (ISO); S-2-Ethylthioethyldimethyl phosphorothioat |
213-052-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H311 H301 H411 |
GHS06 GHS09 Dgr |
H311 H301 H411 |
|
|
|
|
|
015-032-00-0 |
Prothoat (ISO); O,O-Diethylisopropylcarbamoylmethyl phosphorodithioat |
218-893-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 3 |
H310 H300 H412 |
GHS06 Dgr |
H310 H300 H412 |
|
|
|
|
|
015-033-00-6 |
Phorat (ISO); O,O-Diethylethylthiomethyl phosphorodithioat |
206-052-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
|
015-034-00-1 |
Parathion (ISO); O,O-Diethyl-O-4-nitrophenylphosphorothioat |
200-271-7 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H311 H372 ** H410 |
|
M = 100 |
|
|
|
015-035-00-7 |
Parathion-methyl (ISO); O,O-Dimethyl-O-(4-nitrophenyl) phosphorothioat |
206-050-1 |
Flam. Liq. 3 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H330 H300 H311 H373 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H330 H300 H311 H373 ** H410 |
|
M = 100 |
|
|
|
015-036-00-2 |
O-Ethyl-O-4-nitrophenylphenylthiophosphonat; EPN |
218-276-8 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-037-00-8 |
Phenkapton (ISO); S-(2,5-Dichlorphenylthiomethyl)-O, O-diethyldithiophosphat |
218-892-7 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
|
015-038-00-3 |
Coumaphos (ISO); O-3-Chlor-4-methylcumarin-7-yl-O,O-diethylphosphorothioat |
200-285-3 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
|
015-039-00-9 |
Azinphos-methyl (ISO); O,O-Dimethyl-4-oxobenzotriazin-3-ylmethylphosphorodithioat |
201-676-1 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H317 H410 |
|
|
|
|
|
015-040-00-4 |
Diazinon (ISO); O,O-Diethyl-O-2-isopropyl-6-methylpyrimidin-4-ylphosphorothioat |
206-373-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
|
015-041-00-X |
Malathion (ISO); 1,2-Bis(ethoxycarbonyl)-ethyl-O, O-dimethylphosphorodithioat; [Gehalt an Isomalathiongehalt ≤ 0,03 %] |
204-497-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M=1000 |
|
|
|
015-042-00-5 |
Chlorthion; O-(3-Chlor-4-nitrophenyl)-O, O- dimethylphosphorothioat |
207-902-5 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 100 |
|
|
|
015-043-00-0 |
Phosnichlor (ISO); O-(4-Chlor-3-nitrophenyl)-O, O- dimethylphosphorothioat |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
|
|
015-044-00-6 |
Carbophenothion (ISO); 4-Chlorphenylthiomethyl-O, O-diethylphosphorodithioat |
212-324-1 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
|
015-045-00-1 |
Mecarbam (ISO); N-Ethoxycarbonyl-N-methylcarbamoylmethyl-O, O-diethylphosphorodithioat |
219-993-9 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H400 H410 |
|
|
|
|
|
015-046-00-7 |
Oxydemeton-methyl; S-2-(Ethylsulfinyl)-ethyl-O,O-dimethylphosphorothioat |
206-110-7 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H311 H301 H400 |
GHS06 GHS09 Dgr |
H311 H301 H400 |
|
|
|
|
|
015-047-00-2 |
Ethion (ISO); O, O,O',O'-Tetraethyl-S, S'-methylendi(phosphorodithioat); Diethion |
209-242-3 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 10000 |
|
|
|
015-048-00-8 |
Fenthion (ISO); O, O-Dimethyl-O-(4-methylthion-m-tolyl)- phosphorothioat |
200-231-9 |
Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H312 H302 H372** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H312 H302 H372** H410 |
|
M=100 |
|
|
|
015-049-00-3 |
Endothion (ISO); S-5-methoxy-4-oxopyran-2-ylmethyldimethylphosphorothioat |
220-472-3 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
|
015-050-00-9 |
Thiometon (ISO); S-2-Ethylthioethyl-O,O-dimethylphosphorodithioat |
211-362-6 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
|
|
015-051-00-4 |
Dimethoat (ISO); O, O-Dimethylmethylcarbamoylmethylphosphorodithioat |
200-480-3 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
015-052-00-X |
Fenchlorphos (ISO); O, O-Dimethyl-O-2,4,5-trichlorphenylphosphorothioat |
206-082-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
015-053-00-5 |
Menazon (ISO); S-[(4,6-Diamino-1,3,5-triazin-2- yl)-methyl]-O, O-dimethylphosphorodithioat |
201-123-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
015-054-00-0 |
Fenitrothion (ISO); O, O-Dimethyl-O-4-nitro-m-tolylphosphorothioat |
204-524-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
015-055-00-6 |
Naled (ISO); 1,2-Dibrom-2,2-dichlorethyldimethylphosphat |
206-098-3 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 |
H312 H302 H319 H315 H400 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H400 |
|
M = 1000 |
|
|
|
015-056-00-1 |
Azinphos-ethyl (ISO); O,O-Diethyl-4-oxobenzotriazin-3-ylmethylphosphorodithioat |
220-147-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M=100 |
|
|
|
015-057-00-7 |
Formothion (ISO); N-Formyl-N-methylcarbamoylmethyl-O, O-dimethylphosphorodithioat |
219-818-6 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
015-058-00-2 |
Morphothion (ISO); O, O-Dimethyl-S-(morpholinocarbonyl)methylphosphorodithioat |
205-628-0 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
|
015-059-00-8 |
Vamidothion (ISO); O, O-Dimethyl-S-5-(N-methyl-2-methyl-3-thiavaleramid)- phosphorothioat |
218-894-8 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
|
|
015-060-00-3 |
Disulfoton (ISO); O,O-Diethyl-2-ethylthioethylphosphorodithioat |
206-054-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-061-00-9 |
Dimefox (ISO); Tetramethylphosphordiamidsäurefluorid |
204-076-8 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-062-00-4 |
Mipafox (ISO); N, N'-Diisopropyldiamidophosphorsäurefluorid |
206-742-3 |
STOT SE 1 |
H370 ** |
GHS08 Dgr |
H370 ** |
|
|
|
|
|
015-063-00-X |
Dioxathion (ISO); 1,4-Dioxan-2,3-diyl-O,O,O',O'-tetraethyldi(phosphorodithioat) |
201-107-7 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
M = 1000 |
|
|
|
015-064-00-5 |
Bromophos-ethyl (ISO); O-4-Brom-2,5-dichlorphenyl-O,O-diethylphosphorothioat |
225-399-0 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
|
015-065-00-0 |
S-[2-(Ethylsulfinyl)-ethyl]-O,O-dimethylphosphorodithioat |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H330 H310 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
|
|
|
|
|
015-066-00-6 |
Omethoat (ISO); O, O-Dimethyl-S-methylcarbamoylmethylphosphorothioat |
214-197-8 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
|
|
015-067-00-1 |
Phosalon (ISO); S-6-Chlor-2-oxobenzoxazolin-3-ylmethyl)-O, O-diethylphosphordithioat; O, O-Diethyl-S-(6-chlor-2-oxo-benz(b)1,3- oxazolin-3-yl)-methyldithiophosphatdiethylphosphorodithioat |
218-996-2 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H410 |
|
M=1000 |
|
|
|
015-068-00-7 |
Dichlofenthion (ISO); O-2,4-Dichlorphenyl-O,O-diethylphosphorothioat |
202-564-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
|
015-069-00-2 |
Methidathion (ISO); 2,3-Dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O, O-dimethylphosphorodithioat |
213-449-4 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
|
015-070-00-8 |
Cyanthoat (ISO); S-(N-(1-Cyan-1-methylethyl)carbamoylmethyl)-O, O-diethylphosphorothioat |
223-099-4 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
|
015-071-00-3 |
Chlorfenvinphos (ISO); 2-Chlor-1-(2,4-dichlorphenyl)vinyldiethylphosphat |
207-432-0 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
|
015-072-00-9 |
Monocrotophos (ISO); Dimethyl-1-methyl-2-(methylcarbamoyl)vinylphosphat |
230-042-7 |
Muta. 2 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H330 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H330 H300 H311 H410 |
|
|
|
|
|
015-073-00-4 |
Dicrotophos (ISO); (Z)-2-Dimethylcarbamoyl-1-methylvinyldimethylphosphat |
205-494-3 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
|
015-074-00-X |
Crufomat (ISO); 4-tert-Butyl-2-chlorphenylmethylmethylphosphoramidat |
206-083-1 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
015-075-00-5 |
S-2-(Isopropylsulfinyl)ethyl]-O, O-dimethylphosphorothioat |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
015-076-00-0 |
Potasan; O, O-Diethyl-O-(4-methylcumarin-7-yl)- phosphorothioat |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
M = 1000 |
|
|
|
015-077-00-6 |
(2,2-Dichlorvinyl)-2-ethylsulfinyl)ethyl-methylphosphat |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
015-078-00-1 |
Demeton-S-methylsulfon (ISO); S-2-Ethylsulfonylethyl-O, O-dimethylphosphorothioat |
241-109-5 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H301 H312 H411 |
GHS06 GHS09 Dgr |
H301 H312 H411 |
|
|
|
|
|
015-079-00-7 |
Acephat (ISO); O, S-Dimethyl-acetylphosphoramidothioat |
250-241-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
015-080-00-2 |
Amidithion (ISO); 2-Methoxyethylcarbamoylmethyl-O, O-dimethylphosphorodithioat |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
015-081-00-8 |
O, O,O',O'-Tetrapropyldithiopyrophosphat |
221-817-0 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
015-082-00-3 |
Azothoat (ISO); O-4-(4-Chlorphenylazo)phenyl-O, O-dimethylphosphorothioat |
227-419-3 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
|
015-083-00-9 |
Bensulid (ISO); O, O-Diisopropyl-S-2-phenylsulfonylaminoethylphosphorodithioat |
212-010-4 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
015-084-00-4 |
Chlorpyrifos (ISO); O, O-Diethyl-O-3,5,6-Trichlor-2- pyridylphosphorothioat |
220-864-4 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H400 H410 |
|
M = 10000 |
|
|
|
015-085-00-X |
Chlorphoniumchlorid (ISO); Tributyl-(2,4-dichlorbenzyl)phosphoniumchlorid |
204-105-4 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H312 H319 H315 |
GHS06 Dgr |
H301 H312 H319 H315 |
|
|
|
|
|
015-086-00-5 |
Coumithoat (ISO); O, O-Diethyl-O-7,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-ylphosphorothioat |
— |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
|
015-087-00-0 |
Cyanophos (ISO); O-4-Cyanphenyl-O, O-dimethylphosphorothioat |
220-130-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
015-088-00-6 |
Dialifos (ISO); S-[2-Chlor-1-phthalimidoethyl]-O, O-diethylphosphorodithioat |
233-689-3 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H400 H410 |
|
|
|
|
|
015-089-00-1 |
Ethoat-methyl (ISO); Ethylcarbamoylmethyl-O, O-dimethylphosphorodithioat |
204-121-1 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
015-090-00-7 |
Fensulfothion (ISO); O, O-Diethyl-O-4-methylsulfinylphenylphosphorothioat |
204-114-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-091-00-2 |
Fonofos (ISO); O-Ethyl-S-phenylethyl- phosphonodithioat |
213-408-0 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-092-00-8 |
Phosacetim (ISO); O, O-Bis(4-chlorphenyl)-N-acetimidoylphosphoramidothioat |
223-874-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-093-00-3 |
Leptophos (ISO); O-4-Brom-2,5-dichlorphenyl-O-methylphenylphosphorothioat |
244-472-8 |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H370 ** H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H410 |
|
|
|
|
|
015-094-00-9 |
Mephosfolan (ISO); Diethyl-4-methyl-1,3-dithiolan-2-ylidenphosphoramidat |
213-447-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H310 H300 H411 |
GHS06 GHS09 Dgr |
H310 H300 H411 |
|
|
|
|
|
015-095-00-4 |
Methamidophos (ISO); O, S-Dimethylphosphoramidothioat |
233-606-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 |
H330 H300 H311 H400 |
GHS06 GHS09 Dgr |
H330 H300 H311 H400 |
|
|
|
|
|
015-096-00-X |
Oxydisulfoton (ISO); O, O-Diethyl-S-2-ethylsulfinylethylphosphorodithioat |
219-679-1 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 10 |
|
|
|
015-097-00-5 |
Phenthoat (ISO); Ethyl-2-(dimethoxyphosphinothioylthio)-2-phenylacetat |
219-997-0 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
M = 100 |
|
|
|
015-098-00-0 |
Trichloronat (ISO); O-Ethyl-O-2,4,5-trichlorphenylethylphosphonothioat |
206-326-1 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
|
015-099-00-6 |
Pirimiphos-ethyl (ISO); O, O-Diethyl-O-2-diethylamino-6-methylpyrimidin-4-ylphosphorothioat |
245-704-0 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
|
015-100-00-X |
Phoxim (ISO); α-(Diethoxyphosphinothioylimino)phenylacetonitril |
238-887-3 |
Repr. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f*** H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f*** H302 H317 H410 |
|
M=1000 |
|
|
|
015-101-00-5 |
Phosmet (ISO); S-[(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl] O,O-Dimethyldithiophosphat; O,O-Dimethyl-S-phthalimidomethyldithiophosphat |
211-987-4 |
Repr. 2 Acute Tox. 4 Acute Tox. 3 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f H332 H301 H370 (Nervensystem) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H361f H332 H301 H370 (Nervensystem) H410 |
|
M = 100 M = 100 |
|
|
|
015-102-00-0 |
Tris(2-chlorethyl)phosphat |
204-118-5 |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360F*** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F*** H302 H411 |
|
|
|
|
|
015-103-00-6 |
Phosphortribromid |
232-178-2 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
|
015-104-00-1 |
Diphosphorpentasulfid; Phosphorpentasulfid |
215-242-4 |
Flam. Sol. 1 Water-react. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H332 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H332 H302 H400 |
EUH029 |
|
T |
|
|
015-105-00-7 |
Triphenylphosphit |
202-908-4 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
Skin Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % |
|
|
|
015-106-00-2 |
Hexamethylphosphorsäuretriamid; Hexamethylphosphoramid |
211-653-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
|
015-107-00-8 |
Ethoprophos (ISO); Ethyl-S,S-dipropylphosphorodithioat |
236-152-1 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H301 H317 H410 |
|
|
|
|
|
015-108-00-3 |
Bromophos (ISO); O-4-Brom-2,5-dichlorphenyl-O,O-dimethylphosphorothioat |
218-277-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 100 |
|
|
|
015-109-00-9 |
Crotoxyphos (ISO); 1-Phenylethyl-3-(dimethoxyphosphinyloxy)isocrotonat |
231-720-5 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 10 |
|
|
|
015-110-00-4 |
Cyanofenphos (ISO); O-4-Cyanophenyl-O-ethylphenylphosphonothioat |
— |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H301 H370 ** H312 H319 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H319 H411 |
|
|
|
|
|
015-111-00-X |
Phosfolan (ISO); Diethyl-1,3-dithiolan-2-ylidenphosphoramidat |
213-423-2 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-112-00-5 |
Thionazin (ISO); O,O-Diethyl-O-pyrazin-2-ylphosphorothioat |
206-049-6 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-113-00-0 |
Tolclofos-methyl (ISO); O-(2,6-Dichlor-p-tolyl) O,O-dimethylthiophosphat |
260-515-3 |
Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 1 M = 1 |
|
|
|
015-114-00-6 |
Chlormephos (ISO); S-Chlormethyl-O,O-diethylphosphorodithioat |
246-538-1 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10 |
|
|
|
015-115-00-1 |
Chlorthiophos (ISO); [Reaktionsmasse aus Isomeren, in der O-2,5-Dichlorphenyl-4-methylthiophenyl-O, O-diethylphosphorothioat überwiegt] |
244-663-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 1000 |
|
|
|
015-116-00-7 |
Demephion-O (ISO); O, O-Dimethyl-O-2-methylthioethylphosphorothioat |
211-666-9 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
|
015-117-00-2 |
Demephion-S (ISO); O, O-Dimethyl-S-2-methylthioethylphosphorothioat |
219-971-9 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
|
015-118-00-8 |
Demeton |
— |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
|
015-119-00-3 |
Dimethyl-4-(methylthio)-phenylphosphat |
— |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-120-00-9 |
Ditalimfos (ISO); O, O-Diethylphthalimidophosphonothioat |
225-875-8 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
|
015-121-00-4 |
Edifenphos (ISO); O-Ethyl-S, S-diphenylphosphorodithioat |
241-178-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
|
|
|
|
|
015-122-00-X |
Etrimfos (ISO); O-6-Ethoxy-2-ethylpyrimidin-4- yl-O, O-dimethylphosphorothioat |
253-855-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
|
015-123-00-5 |
Fenamiphos (ISO); Ethyl-4-methylthio-m-tolylisopropylphosphoramidat |
244-848-1 |
Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H300 H310 H330 H319 H400 H410 |
GHS06 GHS09 Dgr |
H300 H310 H330 H319 H410 |
|
M = 100 M = 100 |
|
|
|
015-124-00-0 |
Fosthietan (ISO); Diethyl-1,3-dithietan-2-ylidenphosphoramidat |
244-437-7 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-125-00-6 |
Glyphosin (ISO); N,N-Bis(phosphonomethyl)-glycin |
219-468-4 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
015-126-00-1 |
Heptenophos (ISO); 7-Chlorbicyclo(3.2.0)-hepta-2,6-dien-6-yldimethylphosphat |
245-737-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
|
|
015-127-00-7 |
Iprobenfos (ISO); S-Benzyldiisopropylphosphorothioat |
247-449-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
015-128-00-2 |
IPSP; S-Ethylsulfinylmethyl-O,O-diisopropylphosphorodithioat |
— |
Acute Tox. 1 Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H301 H400 H410 |
GHS06 GHS09 Dgr |
H310 H301 H410 |
|
M = 100 |
|
|
|
015-129-00-8 |
Isofenphos (ISO); O-Ethyl-O-2-isopropoxycarbonylphenyl-N-isopropylphosphoramidothioat |
246-814-1 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 100 |
|
|
|
015-130-00-3 |
Isothioat (ISO); S-2-Isopropylthioethyl-O,O-dimethylphosphorodithioat |
— |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
|
015-131-00-9 |
Isoxathion (ISO); O, O-Diethyl-O-5-phenylisoxazol-3-ylphosphorothioat |
242-624-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
|
015-132-00-4 |
S-(Chlorphenylthiomethyl)-O, O-dimethylphosphorodithioat; Methylcarbophenothion |
— |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 1000 |
|
|
|
015-133-00-X |
Piperophos (ISO); S-2-Methylpiperidincarbonylmethyl-O, O-dipropyldphosphorodithioat |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
|
015-134-00-5 |
Pirimiphos-methyl (ISO); O-[2-(Diethylamino)-6-methylpyrimidin-4-yl]O, O-dimethyl phosphorthioat |
249-528-5 |
Acute Tox. 4 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H372 (Nervensystem) H400 H410 |
GHS07 GHS08 GHS09 Dgr |
H302 H372 (Nervensystem) H410 |
|
oral: ATE = 1414 mg/kg KG M = 1000 M = 1000 |
|
|
|
015-135-00-0 |
Profenofos (ISO); O-(4-Brom-2-chlorphenyl)-O-ethyl-S-propylphosphorothioat |
255-255-2 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 1000 |
|
|
|
015-136-00-6 |
Propetamphos (ISO); Isopropyl-3-[[(ethylamino)methoxyphosphinothioyl]oxy]crotonat; Isopropyl-3-[[(ethylamino)methoxyphosphinothioyl]oxy]crotonat; |
250-517-2 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
|
|
015-137-00-1 |
Pyrazophos (ISO); O, O-Diethyl-O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]-pyrimidin-2-yl)thiophosphat; phosphorothioat O, O-Diethyl-O-(6-ethoxycarbonyl-5- methylpyrazolo[2,3-a]pyrimidin-2- yl)thiophosphat |
236-656-1 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
|
|
|
015-138-00-7 |
Quinalphos (ISO); O, O-Diethyl-O-chinoxalin-2-ylphosphorothioat |
237-031-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 1000 |
|
|
|
015-139-00-2 |
Terbufos (ISO); S-tert-Butylthiomethyl-O, O-diethylphosphorodithioat |
235-963-8 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
|
015-140-00-8 |
Triazophos (ISO); O, O-Diethyl-O-(1-phenyl-1H-1,2,4-triazol-3-yl)phosphorothioat |
245-986-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H410 |
|
M=100 |
|
|
|
015-141-00-3 |
Ethylendiammonium-O, O-bis(octyl)phosphorodithioat, Isomerengemisch |
400-520-1 |
— |
Skin Corr. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H314 H302 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H410 |
|
|
|
|
015-142-00-9 |
Butyl(dialkyloxy(dibutoxyphosphoryloxy))titan(trialkyloxy)titanphosphat |
401-100-0 |
— |
Flam. Liq. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H225 H319 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H319 H411 |
|
|
T |
|
015-143-00-4 |
Reaktionsmasse aus 2-Chlorethylchlorpropyl-2-chlorethylphosphonat, Reaktionsmasse aus Isomeren und 2-Chlorethylchlorpropyl-2-chlorpropylphosphonat, Reaktionsmasse aus Isomeren |
401-740-0 |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-144-00-X |
Reaktionsmasse aus Pentylmethylphosphinat und 2-Methylbutylmethylphosphinat |
402-090-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
015-145-00-5 |
Reaktionsmasse aus Kupfer(I)-O, O-diisopropylphosphorodithioat und Kupfer(I)-O-isopropyl-O-(4-methylpent-2-yl) phosphorodithioat und Kupfer(I)-O, O-bis(4-methylpent-2-yl)phosphorodithioat |
401-520-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-146-00-0 |
S-(Tricyclo(5.2.1.02,6)deca-3-en- 8(oder 9)-yl-O-(isopropyl oder isobutyl oder 2-ethylhexyl)-O-(isopropyl oder isobutyl oder 2-ethylhexyl)phosphorodithioat |
401-850-9 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-147-00-6 |
Reaktionsmasse aus C12-14-tert-Alkylammoniumdiphenylphosphorothioat und Dinonylsulfid (oder -disulfid) |
400-930-0 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
015-148-00-1 |
2-(Diphosphonomethyl)bernsteinsäure |
403-070-4 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
|
015-149-00-7 |
Reaktionsmasse aus Hexyldioctylphosphinoxid; Dihexyloctylphosphinoxid; Trioctylphosphinoxid |
403-470-9 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
015-150-00-2 |
(2-(1,3-Dioxolan-2-yl)ethyl)triphenylphosphoniumbromid |
404-940-6 |
Acute Tox. 4 * Eye Dam. 1 STOT RE 2 * Aquatic Chronic 3 |
H302 H318 H373 ** H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H318 H373 ** H412 |
|
|
|
|
|
015-151-00-8 |
Tris(isopropyl/tert-butylphenyl) phosphat |
405-010-2 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
015-152-00-3 |
Dioxabenzofos (ISO); 2-Methoxy-4H-1,3,2-benzodioxaphosphorin-2-sulfid |
223-292-3 |
Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 Aquatic Chronic 2 |
H311 H301 H370 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H311 H301 H370 ** H411 |
|
|
|
|
|
015-153-00-9 |
Isazofos (ISO); O-(5-Chlor-1-isopropyl-1,2,4-triazol-3-yl)-O, O-diethylphosphorothioat |
255-863-8 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H311 H301 H373 ** H317 H410 |
|
|
|
|
|
015-154-00-4 |
Ethephon; 2-Chlorethylphosphonsäure |
240-718-3 |
Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 Skin Corr. 1C Aquatic Chronic 2 |
H311 H332 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H332 H302 H314 H411 |
EUH071 |
|
|
|
|
015-155-00-X |
Glufosinat-Ammonium (ISO); Ammonium-2-amino-4-(hydroxymethylphosphinyl)butyrat |
278-636-5 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H360Fd H332 H312 H302 H373** |
GHS08 GHS07 Dgr |
H360Fd H332 H312 H302 H373** |
|
|
|
|
|
015-156-00-5 |
Methyl-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [1]; Methacrifos (ISO); Methyl-(E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylat [2] |
250-366-9 [1]- [2] |
30864-28-9 [1] 62610-77-9 [2] |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
015-157-00-0 |
Phosphonsäure [1]; Phosphorige Säure [2] |
237-066-7 [1] 233-663-1 [2] |
13598-36-2 [1] 10294-56-1 [2] |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
015-158-00-6 |
(η-Cyclopentadienyl)(η-cumenyl)eisen(1+)hexafluorphosphat(1-) |
402-340-9 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
015-159-00-1 |
Hydroxyphosphonessigsäure |
405-710-8 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 |
H302 H373 ** H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H314 H317 |
|
|
|
|
|
015-160-00-7 |
Vanadylpyrophosphat |
406-260-5 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
|
015-161-00-2 |
Divanadylpyrophosphat |
407-130-0 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
|
015-162-00-8 |
Vanadium(IV)oxidhydrogenphosphat-Hemihydrat, lithium-, zink-, molybdän-, eisen- und chlordotiert |
407-350-7 |
— |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H373 ** H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H373 ** H318 H411 |
|
|
|
|
015-163-00-3 |
Bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxid |
412-010-6 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
015-164-00-9 |
Calcium-P, P'-(1-hydroxyethylen)-bis(hydrogenphosphonat)-dihydrat |
400-480-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
015-165-00-4 |
Reaktionsmasse aus Thiobis(4,1-phenylen)-S, S,S',S'-tetraphenyldisulfoniumbishexafluorphosphat und Diphenyl(4-phenylthiophenyl)sulfoniumhexafluorphosphat |
404-986-7 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
015-166-00-X |
3,9-Bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan |
410-290-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
015-167-00-5 |
3-(Hydroxyphenylphosphinyl)propansäure |
411-200-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
015-168-00-0 |
Fosthiazate (ISO); (RS)-S-sec-Butyl-O-ethyl-2-oxo- 1,3-thiazolidin-3-ylphosphonothioat |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
EUH070 |
|
|
|
|
015-169-00-6 |
Tributyltetradecylphosphoniumtetrafluorborat |
413-520-1 |
— |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H317 H410 |
|
|
|
|
015-170-00-1 |
Reaktionsmasse aus Di-(1-octyl-N, N,N-trimethylammonium)octylphosphat; 1-Octyl-N, N,N-trimethylammoniumdioctylphosphat und 1-Octyl-N, N,N-trimethylammoniumoctylphosphat |
407-490-9 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
015-171-00-7 |
O, O,O-Tris(2(oder 4)-C9-10-isoalkylphenyl) phosphorothioat |
406-940-1 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
015-172-00-2 |
Reaktionsmasse aus Bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphat und Isotridecylammoniumbis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphat |
406-240-6 |
— |
Flam. Liq. 3 Skin Corr. 1B Aquatic Chronic 2 |
H226 H314 H411 |
GHS02 GHS05 GHS09 Dgr |
H226 H314 H411 |
|
|
|
|
015-173-00-8 |
Methyl[2-(1,1-dimethylethyl)-6- methoxypyrimidin-4-yl]ethylphosphonothioat |
414-080-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
015-174-00-3 |
1-Chlor-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramin |
411-370-1 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Chronic 2 |
H301 H318 H411 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H411 |
|
|
|
|
|
015-175-00-9 |
tert-Butyl-(triphenylphosphoranyliden)acetat |
412-880-7 |
Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H301 H373 ** H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H319 H317 H411 |
|
|
|
|
|
015-176-00-4 |
1,3-Bis-(di-ortho-methoxyphenylphosphino)propan; P, P,P',P'-Tetrakis-(o-methoxyphenyl)- propan-1,3-diphosphin |
413-430-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
015-177-00-X |
((4-Phenylbutyl)hydroxyphosphoryl)essigsäure |
412-170-7 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H373 ** H318 H317 |
GHS08 GHS05 Dgr |
H373 ** H318 H317 |
|
|
|
|
|
015-178-00-5 |
(R)-α-Phenylethylammonium-(-)-(1R,2S)-(1,2-epoxypropyl)phosphonatmonohydrat |
418-570-8 |
Repr. 2 Aquatic Chronic 2 |
H361f *** H411 |
GHS08 GHS09 Wng |
H361f *** H411 |
|
|
|
|
|
015-179-00-0 |
UVCB-Kondensationsprodukt aus Tetrakis(hydroxymethyl)phosphoniumchlorid mit Harnstoff und destilliertem hydriertem C16-18-Talgalkylamin |
422-720-8 |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H302 H373 ** H314 H317 H410 |
|
|
|
|
|
015-180-00-6 |
[R-(R*,S*)]-[[2-Methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl]essigsäure, (-)-Cinchonidin (1:1)-Salz |
415-820-8 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
015-181-00-1 |
Phosphin |
232-260-8 |
Flam. Gas 1 Press. Gas Acute Tox. 1 Skin Corr. 1B Aquatic Acute 1 |
H220 H330 H314 H400 |
GHS02 GHS04 GHS06 GHS05 GHS09 Dgr |
H220 H330 H314 H400 |
|
Einatmen: ATE = 10 ppmV (Gase) |
U |
|
|
015-182-00-7 |
Tetrapropan-2-yl (dichlormethandiyl)bisphosphonat |
430-630-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
|
015-183-00-2 |
(1-Hydroxydodecyliden)diphosphonsäure |
425-230-2 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
|
015-184-00-8 |
Salze von Glyphosat, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
A |
|
015-186-00-9 |
Chlorpyrifos-methyl (ISO); O, O-Dimethyl-O-3,5,6-trichlor- 2-pyridylphosphorothioat |
227-011-5 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10000 |
|
|
|
015-187-00-4 |
Reaktionsmasse aus Tetranatrium-(((2-hydroxyethyl)-imino)bis(methylen))bisphosphonat, N-oxid; Trinatrium-((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)methyl)-phosphonate, N-Oxid, P-Oxid |
417-540-1 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
▼M8 ————— |
||||||||||
|
015-189-00-5 |
Phenylbis(2,4,6-trimethylbenzoyl)phosphinoxid |
423-340-5 |
Skin Sens. 1A Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
015-190-00-0 |
Bis(2,4-dicumylphenyl)neopentyldiphosphit; 3,9-Bis[2,4-bis(1-methyl-1-phenylethyl)-phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecan |
421-920-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
015-191-00-6 |
Dodecyldiphenylphosphat |
431-760-5 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
▼M29 ————— |
||||||||||
|
015-193-00-7 |
Triphenyl(phenylmethyl)phosphonium-1,1,2,2,3,3,4,4,4-nonafluor-N-methyl-1-butansulfonamid (1:1) |
442-960-7 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H400 H410 |
GHS05 GHS06 GHS09 Dgr |
H301 H318 H410 |
|
|
|
|
|
015-194-00-2 |
Tetrabutylphosphoniumnonafluorbutan-1-sulfonat |
444-440-5 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
015-195-00-8 |
Reaktionsmasse aus Kalium-o-toluolphosphonat, Kalium-m-toluolphosphonat und Kalium-p-toluolphosphonat |
433-860-4 |
— |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
015-196-00-3 |
Reaktionsmasse aus Dimethyl-(2-(hydroxymethylcarbamoyl)ethyl)phosphonat, Diethyl(2-(hydroxymethylcarbamoyl)ethyl)phosphonat und Methylethyl(2-(hydroxymethyl-carbamoyl)ethyl)phosphonat |
435-960-3 |
— |
Carc. 1B Muta. 1B Skin Sens. 1 |
H350 H340 H317 |
GHS08 GHS07 Dgr |
H350 H340 H317 |
|
|
|
|
015-197-00-9 |
Bis(2,4,4-trimethylpentyl)dithiophosphonsäure |
420-160-9 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H302 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H302 H314 H411 |
|
|
|
|
|
015-198-00-4 |
(4-Phenylbutyl)phosphinsäure |
420-450-5 |
Carc. 2 Eye Dam. 1 |
H351 H318 |
GHS05 GHS08 Dgr |
H351 H318 |
|
|
|
|
|
015-199-00-X |
Tris[2-chlor-1-chlormethyl)-ethyl]phosphat |
237-159-2 |
Carc. 2 |
H351 |
GSH08 Wng |
H351 |
|
|
|
|
|
015-200-00-3 |
Indiumphosphid |
244-959-5 |
Carc. 1B Repr. 2 STOT RE 1 |
H350 H361f H372 (Lunge) |
GHS08 Dgr |
H350 H361f H372 (Lunge) |
|
STOT RE 1; H372: C ≥0,1 % Carc 1B; H350: C ≥0,01 % STOT RE 2; H373: 0,01 % ≤ C < 0,1 % |
|
|
|
015-201-00-9 |
Trixylylphosphat |
246-677-8 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
015-202-00-4 |
Tris(nonylphenyl)phosphit |
247-759-6 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
015-203-00-X |
Diphenyl(2,4,6-trimethylbenzoyl)phosphinoxid |
278-355-8 |
Repr. 1B Skin Sens. 1B |
H360Fd H317 |
GHS08 GHS07 Dgr |
H360Fd H317 |
|
|
|
|
|
015-204-00-5 |
Benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluor-2-(4-hydroxyphenyl)propan-2-yl]phenolat |
479-100-5 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
015-205-00-0 |
Benzyltriphenylphosphonium, Salz mit 4,4’-[2,2,2-Trifluor-1-(trifluormethyl)ethyliden]bis[phenol] (1:1) |
278-305-5 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
015-206-00-6 |
Reaktionsmasse aus 4,4’-[2,2,2-Trifluor-1-(trifluormethyl)ethyliden]diphenol und Benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluor-2-(4-hydroxyphenyl)propan-2-yl]phenolat (1:1) |
— |
— |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
015-207-00-1 |
Reaktionsmasse aus 4,4’-[2,2,2-Trifluor-1-(trifluormethyl)ethyliden]diphenol und Benzyltriphenylphosphonium, Salz mit 4‚4’-[2,2,2-Trifluor-1-(trifluormethyl)ethyliden]diphenol (1:1) |
— |
— |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
015-208-00-7 |
Dimethylpropylphosphonat |
242-555-3 |
Muta. 1B Repr. 1B |
H340 H360Df |
GHS08 Dgr |
H340 H360Df |
|
|
|
|
|
016-001-00-4 |
Schwefelwasserstoff |
231-977-3 |
Flam. Gas 1A Press. Gas Acute Tox. 2 Aquatic Acute 1 |
H220 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H220 H330 H400 |
|
Inhalation: ATE = 440 ppmV (Gase) |
U |
|
|
016-002-00-X |
Bariumsulfid |
244-214-4 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
EUH031 |
|
|
|
|
016-003-00-5 |
Bariumpolysulfide |
256-814-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
|
016-004-00-0 |
Calciumsulfid |
243-873-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
|
016-005-00-6 |
Calciumpolysulfide |
215-709-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
|
016-006-00-1 |
Dikaliumsulfid; Kaliumsulfid |
215-197-0 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
|
|
016-007-00-7 |
Kaliumpolysulfide |
253-390-1 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
|
|
016-008-00-2 |
Ammoniumpolysulfide |
232-989-1 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
EUH031: C ≥ 1 % |
|
|
|
016-009-00-8 |
Dinatriumsulfid; Natriumsulfid |
215-211-5 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H311 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H400 |
|
|
|
|
|
016-010-00-3 |
Natriumpolysulfide; |
215-686-9 |
Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
EUH031 |
|
|
|
|
016-011-00-9 |
Schwefeldioxid |
231-195-2 |
Press. Gas Acute Tox. 3 STOT SE 1 Skin. Corr. 1B |
H331 H370 (Atmungsorgane) (Inhalation) H314 |
GHS04 GHS06 GHS08 GHS05 Dgr |
H331 H370 (Atmungsorgane) (Inhalation) H314 |
|
Inhalation: ATE = 1 000 ppmV (Gase) |
U, 5 |
|
|
016-012-00-4 |
Dischwefeldichlorid; Schwefelmonochlorid |
233-036-2 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H301 H332 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H332 H314 H400 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
|
|
016-013-00-X |
Schwefeldichlorid |
234-129-0 |
Skin Corr. 1B STOT SE 3 Aquatic Acute 1 |
H314 H335 H400 |
GHS05 GHS07 GHS09 Dgr |
H314 H335 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
|
|
016-014-00-5 |
Schwefeltetrachlorid |
— |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
|
|
016-015-00-0 |
Thionyldichlorid; Thionylchlorid |
231-748-8 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H332 H302 H314 |
GHS05 GHS07 Dgr |
H332 H302 H314 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
|
|
016-016-00-6 |
Sulfurylchlorid |
232-245-6 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
|
016-017-00-1 |
Chlorschwefelsäure; Chlorsulfonsäure |
232-234-6 |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
|
016-018-00-7 |
Fluorsulfonsäure |
232-149-4 |
Acute Tox. 4 * Skin Corr. 1A |
H332 H314 |
GHS05 GHS07 Dgr |
H332 H314 |
|
|
|
|
|
016-019-00-2 |
Oleum … % SO3 |
— |
— |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
B |
|
016-020-00-8 |
Schwefelsäure … % |
231-639-5 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 15 % Skin Irrit. 2; H315: 5 % ≤ C < 15 % Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
B |
|
|
016-021-00-3 |
Methanthiol; Methylmercaptan |
200-822-1 |
Flam. Gas. 1 Press. Gas Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H331 H400 H410 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H331 H410 |
|
|
U |
|
|
016-022-00-9 |
Ethanethiol; Ethylmercaptan |
200-837-3 |
Flam. Liq. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H410 |
|
|
|
|
|
016-023-00-4 |
Dimethylsulfat |
201-058-1 |
Carc. 1B Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H350 H341 H330 H301 H314 H317 |
GHS06 GHS08 GHS05 Dgr |
H350 H341 H330 H301 H314 H317 |
|
Carc. 1B; H350: C ≥ 0,01 % Muta. 2 H341: C ≥ 0,01 % STOT SE 3; H335: C ≥ 5 % |
|
|
|
016-024-00-X |
Dimexano (ISO); Bis(methoxythiocarbonyl)disulfide; O, O-Dimethyldithiobis(thioformiat) |
215-993-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
016-025-00-5 |
Disul (ISO); 2-(2,4-Dichlorphenoxy)ethylhydrogensulfat; 2,4-DES |
205-259-5 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H302 H315 H318 |
GHS05 GHS07 Dgr |
H302 H315 H318 |
|
|
|
|
|
016-026-00-0 |
Sulfamidsäure; Sulfaminsäure; AmidosulfonsäureSulfamsäure |
226-218-8 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
|
016-027-00-6 |
Diethylsulfat |
200-589-6 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H340 H332 H312 H302 H314 |
GHS05 GHS08 GHS07 Dgr |
H350 H340 H332 H312 H302 H314 |
|
|
|
|
|
016-028-00-1 |
Natriumdithionit; Natriumhydrosulfit |
231-890-0 |
Self-heat. 1 Acute Tox. 4 * |
H251 H302 |
GHS02 GHS07 Dgr |
H251 H302 |
EUH031 |
|
|
|
|
016-029-00-7 |
p-Toluolsulfonsäure (mit mehr als 5 % H2SO4) |
— |
— |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
|
016-030-00-2 |
p-Toluolsulfonsäure (mit höchstens 5 % H2SO4) |
203-180-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 20 % |
|
|
|
016-031-00-8 |
Tetrahydrothiophen-1,1-dioxid; Sulfolan |
204-783-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
016-032-00-3 |
1,3-Propansulton; 1,2-Oxathiolan-2,2-dioxid |
214-317-9 |
Carc. 1B Acute Tox. 4 * Acute Tox. 4 * |
H350 H312 H302 |
GHS08 GHS07 Dgr |
H350 H312 H302 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
|
016-033-00-9 |
Dimethylsulfamoylchlorid |
236-412-4 |
Carc. 1B Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H330 H312 H302 H314 |
GHS06 GHS05 GHS08 Dgr |
H350 H330 H312 H302 H314 |
|
|
|
|
|
016-034-00-4 |
Tetranatrium-3,3'-(piperazin-1,4-diylbis((6-chlor-1,3,5-triazin-2,4-diyl)imino(2-acetamido)-4,1-phenylenazo))bis(naphthalin-1,5-disulfonat) |
400-010-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-035-00-X |
Pentanatrium-5-anilino-3-(4-(4-(6-chlor-4-(3-sulfonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulfonatophenylazo)-4-hydroxynaphthalin-2,7-disulfonat |
400-120-7 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
016-036-00-5 |
Tetranatrium-5-(4,6-dichlor-5-cyanpyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalin-1,2,5,7-disulfonat |
400-130-1 |
— |
Resp. Sens. 1 Aquatic Chronic 2 |
H334 H411 |
GHS08 GHS09 Dgr |
H334 H411 |
|
|
|
|
016-037-00-0 |
Dinatrium-1-amino-4-(4-benzolsulfonamido-3-sulfonatoanilino)anthrachinon-2- sulfonat |
400-350-8 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
016-038-00-6 |
Dinatrium-6-((4-chlor-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2- (4-methoxy-2-sulfonatophenylazo)naphthalin-3-sulfonat |
400-380-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-039-00-1 |
Tetranatrium-2-(6-chlor-4-(4-(2,5-dimethyl-4-(2,5-disulfonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)-benzol-1,4-disulfonat |
400-430-2 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-040-00-7 |
Reaktionsmasse aus Dinatrium-6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulfonatophenylazo)-4-hydroxynaphthalin-2-sulfonat und Dinatrium-6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulfonatophenylazo)-4-hydroxynaphthalin-2-sulfonat und Trinatrium-6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulfonato-2-naphthylazo)anilino)-3-sulfonatophenylazo)-4-hydroxynaphthalin-2-sulfonat |
400-570-4 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
016-041-00-2 |
Calcium-2,5-dichlor-4-(4-((5-chlor-4-methyl-2-sulfonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzolsulfonat |
400-710-4 |
— |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
|
016-042-00-8 |
Tetranatrium-5-benzamido-3-(5- (4-fluor-6-(1-sulfonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-4-hydroxynaphthalin-2,7-disulfonat |
400-790-0 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
|
016-043-00-3 |
Dilithium-6-acetamido-4-hydroxy-3-(4-((2-sulfonatooxy)-ethylsulfonyl)phenylazo)-naphthalin-2-sulfonat |
401-010-1 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-044-00-9 |
Dinatrium-S,S-hexan-1,6-diyldi(thiosulfat)dihydrat |
401-320-7 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
016-045-00-4 |
Lithiumnatriumhydrogen-4-amino-6-(5-(5-chlor-2,6-difluorpyrimidin-4-ylamino)-2-sulfonatophenylazo)-5-hydroxy-3-(4-(2-(sulfonatooxy)ethylsulfonyl)phenylazo)naphthalin-2,7-disulfonat |
401-560-2 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-046-00-X |
Natriumhydrogensulfat |
231-665-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
016-047-00-5 |
Hexanatrium-7-(4-(4-(4-(2,5-disulfonatoanilino)-6-fluor-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulfonatonaphthylazo)naphthalin-1,3,5-trisulfonat |
401-650-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-048-00-0 |
Natrium-3,5-dichlor-2-(5-cyan-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzolsulfonat |
401-870-8 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
016-049-00-6 |
Calciumoctadecylxylolsulfonat |
402-040-8 |
— |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
|
016-050-00-1 |
Kaliumnatrium-5-(4-chlor-6-(N-(4-(4-chlor-6-(5-hydroxy-2,7-disulfonato-6-(2-sulfonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino)phenyl-N-methyl)-amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulfonatophenylazo)-naphthalin-2,7-disulfonat |
402-150-6 |
— |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
016-051-00-7 |
Trinatrium-7-(4-(6-fluor-4-(2-(2-vinylsulfonylethoxy)-ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)-naphthalin-1,3,6-trisulfonat |
402-170-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-052-00-2 |
Benzyltributylammonium-4-hydroxynaphthalin-1-sulfonat |
402-240-5 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
|
016-053-00-8 |
(C16- oder C18-n-Alkyl)(C16- oder C18-n-Alkyl)ammonium-2-((C16- oder C18-n-Alkyl)(C16- oder C18-n-Alkyl)carbamoyl)benzolsulfonat |
402-460-1 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
016-054-00-3 |
Natrium-4-(2,4,4-trimethylpentylcarbonyloxy)benzolsulfonat |
400-030-8 |
— |
Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Sens. 1 |
H331 H372 ** H302 H319 H335 H317 |
GHS06 GHS08 Dgr |
H331 H372 ** H302 H319 H335 H317 |
|
|
|
|
016-055-00-9 |
Tetranatrium-4-amino-3,6-bis(5-(6-chlor-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalin-2,7-sulfonat (mit > 35 %Natriumchlorid und Natriumacetat) |
400-510-7 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
016-056-00-4 |
Kaliumhydrogensulfat |
231-594-1 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
|
|
016-057-00-X |
Styrol-4-sulfonylchlorid |
404-770-2 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
|
016-058-00-5 |
Thionylchlorid, Reaktionsprodukte mit 1,3,4-Thiadiazol-2,5-dithiol, tert-Nonanthiol und C12-14-tert-Alkylamin |
404-820-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
|
|
|
|
016-059-00-0 |
N, N,N',N'-Tetramethyldithiobis(ethylen)diamindihydrochlorid |
405-300-9 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H317 H410 |
|
|
|
|
|
016-060-00-6 |
Diammoniumperoxodisulfat; Ammoniumpersulfat |
231-786-5 |
Ox. Sol. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H319 H335 H315 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
|
|
|
|
|
016-061-00-1 |
Dikaliumperoxodisulfat; Kaliumpersulfat |
231-781-8 |
Ox. Sol. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H319 H335 H315 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
|
|
|
|
|
016-062-00-7 |
Bensultap (ISO); 1,3-Bis(phenylsulfonylthio)-2-(N,N-dimethylamino)propan |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
016-063-00-2 |
Dinatriumdisulfit; Natrium metabisulfitNatriummetabisulfit |
231-673-0 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
EUH031 |
|
|
|
|
016-064-00-8 |
Natriumhydrogensulfit . . . %; Natriumdisulfit . . . %; Natriumbisulfit … %Natriumbisulfit . . . % |
231-548-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
EUH031 |
|
B |
|
|
016-065-00-3 |
Natrium-1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthrachinon-2-sulfonat |
400-100-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
016-066-00-9 |
Tetranatrium[5-((4-amino-6-chlor-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2-sulfonatobenzylidenhydrazino)benzoat]kupfer(II) |
404-070-7 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
016-067-00-4 |
(4-Methylphenyl)mesitylensulfonat |
407-530-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
016-068-00-X |
Natrium-3,5-bis(tetradecyloxycarbonyl)benzolsulfinat |
407-720-8 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
016-069-00-5 |
3,5-Bis(tetradecyloxycarbonyl)benzolsulfinsäure |
407-990-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
016-070-00-0 |
4-Benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfon |
408-220-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
016-071-00-6 |
Trinatrium-3-amino-6,13-dichlor-10-((3-((4-chlor-6-(2-sulfophenylamino)-1,3,5-triazin- 2-yl)amino)propyl)amino)-4,11-triphenoxydioxazindisulfonat |
410-130-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-072-00-1 |
3-Amino-4-hydroxy-N-(2-methoxyethyl)-benzolsulfonamid |
411-520-6 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
|
016-073-00-7 |
Tetrakis(phenylmethyl)thioperoxydi(carbothioamid) |
404-310-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
016-074-00-2 |
6-Fluor-2-methyl-3-(4-methylthiobenzyl)inden |
405-410-7 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
016-075-00-8 |
2,2'-Diallyl-4,4'-sulfonyldiphenol |
411-570-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
016-076-00-3 |
2,3-Bis((2-mercaptoethyl)thio)-1-propanthiol |
411-290-7 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
|
016-077-00-9 |
2-Chlor-p-toluolsulfochlorid; 2-Chlor-p-toluolsulfochlorid |
412-890-1 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H314 H317 H412 |
GHS05 GHS07 Dgr |
H314 H317 H412 |
|
|
|
|
|
016-078-00-4 |
4-Methyl-N, N-bis(2-(((4-methyl phenyl)sulfonyl)amino)ethyl)benzolsulfonamid |
413-300-5 |
Aquatic Chronic 4 |
H413 |
— |
|
|
|
|
|
|
016-079-00-X |
N, N-Bis(2-(p-toluolsulfonyloxy)ethyl)-p-toluolsulfonamid |
412-920-3 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
016-080-00-5 |
Natrium-2-anilino-5-(2-nitro-4-(N-phenylsulfamoyl))anilinobenzolsulfonat |
412-320-1 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
016-081-00-0 |
Hexahydrocyclopenta[c]pyrrol-1-(1H)-ammonium-N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanid |
418-350-1 |
— |
Muta. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H302 H319 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H319 H317 H411 |
|
|
|
|
016-082-00-6 |
Ethoxysulfuron (ISO); 1-(4,6-Dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)harnstoff |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
016-083-00-1 |
Acibenzolar-S-methyl; Benzo[1,2,3]thiadiazol-7-thiocarbonsäure-S-methylester |
420-050-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
|
|
016-084-00-7 |
Prosulfuron (ISO); 1-(4-Methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluorpropyl)phenylsulfonyl]harnstoff |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M=100 |
|
|
|
016-085-00-2 |
Flazasulfuron (ISO); 1-(4,6-Dimethoxypyrimidin-2-yl)-3-(3-trifluormethyl-2-pyridylsulfonyl)harnstoff |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
016-086-00-8 |
Tetranatrium-10-amino-6,13-dichlor-3-(3-(4-(2,5-disulfonatoanilino)-6-fluor-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacen-4,11-disulfonat |
402-590-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
016-087-00-3 |
Reaktionsmasse aus Thiobis(4,1- phenylen)-S, S,S',S'-tetraphenyldisulfoniumbishexafluorphosphat, Diphenyl(4-phenylthiophenyl)sulfoniumhexafluorphosphat und Propylencarbonat |
403-490-8 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H317 H410 |
|
|
|
|
|
016-088-00-9 |
4-(Bis(4-(diethylamino)phenyl)methyl)benzol-1,2-dimethansulfonsäure |
407-280-7 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
016-089-00-4 |
Reaktionsmasse aus Estern von 5,5',6,6',7,7'-Hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan und 2-Diazo-1,2-dihydro-1-oxo-5-sulfonaphthalin |
413-840-1 |
— |
Self-react. C **** Aquatic Chronic 4 |
H242 H413 |
GHS02 Dgr |
H242 H413 |
|
|
|
|
016-090-00-X |
4-Methyl-N-(methylsulfonyl)benzolsulfonamid |
415-040-8 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
|
|
|
|
|
016-091-00-5 |
C12-14-tert-Alkylammonium-1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonat |
414-110-5 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
016-092-00-0 |
Reaktionsmasse aus 4,7-Bis(mercaptomethyl)-3,6,9-trithia-1,11-undecandithiol, 4,8-Bis(mercaptomethyl)-3,6,9-trithia-1,11-undecandithiol und 5,7-Bis(mercaptomethyl)-3,6,9-trithia-1,11-undecandithiol |
427-050-1 |
— |
Repr. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f H315 H317 H410 |
|
|
|
|
016-093-00-6 |
Reaktionsmasse aus 4-(7-Hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalin-1-sulfonat) und 4-(7-Hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalin-1-sulfonat) (2:1) |
414-770-4 |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
|
|
016-094-00-1 |
Schwefel |
231-722-6 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
|
016-095-00-7 |
Reaktionsmasse aus dem Reaktionsprodukt von 4,4'-Methylenbis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] und 6-Diazo-5,6-dihydro-5-oxo-naphthalinsulfonat (1:2) und dem Reaktionsprodukt von 4,4'-Methylenbis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] und 6-Diazo-5,6-dihydro-5-oxonaphthalinsulfonat (1:3) |
417-980-4 |
— |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
|
016-096-00-2 |
Thifensulfuron-methyl (ISO); Methyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophen-2-carboxylat |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 M = 100 |
|
|
|
016-097-00-8 |
1-Amino-2-methyl-2-propanthiolhydrochlorid |
434-480-1 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H302 H314 H317 H412 |
|
|
|
|
|
016-098-00-3 |
Dimethyldisulfid |
210-871-0 |
Flam. Liq. 2 Acute Tox. 3 Acute Tox. 3 STOT SE 3 STOT SE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H331 H301 H336 H370 (obere Atemwege, Einatmen) H319 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H301 H336 H370 (obere Atemwege, Einatmen) H319 H317 H410 |
|
Einatmen: ATE = 5 mg/L (Dämpfe) oral: ATE = 190 mg/kg KG M = 1 M = 10 |
|
|
|
017-001-00-7 |
Chlor |
231-959-5 |
Ox. Gas 1 Press. Gas Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H270 H331 H319 H335 H315 H400 |
GHS03 GHS04 GHS06 GHS09 Dgr |
H270 H331 H319 H335 H315 H400 |
|
M = 100 |
U |
|
|
017-002-00-2 |
Hydrogenchlorid; Chlorwasserstoff |
231-595-7 |
Press. Gas Acute Tox. 3 * Skin Corr. 1A |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
|
|
U5 |
|
|
017-002-01-X |
Salzsäure … %; Chlorwasserstoffsäure …% |
231-595-7 |
— |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % EyeIrrit. 2; H319: 10 % ≤ C < 25 % STOT SE 3; H335: C ≥ 10 % |
B |
|
017-003-00-8 |
Bariumchlorat |
236-760-7 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H271 H332 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H332 H302 H411 |
|
|
|
|
|
017-004-00-3 |
Kaliumchlorat |
223-289-7 |
Ox. Sol. 1 Acute Tox. 3 |
H271 H301 |
GHS03 GHS06 Dgr |
H271 H301 |
|
Oral: ATE = 100 mg/kg KG |
|
|
|
017-005-00-9 |
Natriumchlorat |
231-887-4 |
Ox. Sol. 1 Acute Tox. 3 |
H271 H301 |
GHS03 GHS06 Dgr |
H271 H301 |
|
Oral: ATE = 100 mg/kg KG |
|
|
|
017-006-00-4 |
Perchlorsäure … % |
231-512-4 |
Ox. Liq. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
Skin Corr. 1A; H314: C ≥ 50 % Skin Corr. 1B; H314: 10 % ≤ C < 50 % Skin Irrit. 2; H315: 1 % ≤ C < 10 % Eye Irrit. 2; H319: 1 % ≤ C < 10 % Ox. Liq. 1; H271: C > 50 %: Ox. Liq. 2; H272: C ≤ 50 %: |
B |
|
|
017-007-00-X |
Bariumperchlorat |
236-710-4 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * |
H271 H332 H302 |
GHS03 GHS07 Dgr |
H271 H332 H302 |
|
|
|
|
|
017-008-00-5 |
Kaliumperchlorat |
231-912-9 |
Ox. Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
|
|
|
|
|
017-009-00-0 |
Ammoniumperchlorat |
232-235-1 |
Expl. 1.1 Ox. Sol. 1 |
H201 H271 |
GHS01 Dgr |
H201 H271 |
|
|
T |
|
|
017-010-00-6 |
Natriumperchlorat |
231-511-9 |
Ox. Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
|
|
|
|
|
017-011-00-1 |
Natriumhypochloritlösung … % Cl aktiv |
231-668-3 |
Skin Corr. 1B Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H318 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
EUH031 |
M = 10 M = 1 EUH031: C ≥ 5 % |
B |
|
|
017-012-00-7 |
Calciumhypochlorit |
231-908-7 |
Ox. Sol. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H272 H302 H314 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H400 |
EUH031 |
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 3 % M = 10 |
T |
|
|
017-013-00-2 |
Calciumchlorid |
233-140-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
017-014-00-8 |
Ammoniumchlorid |
235-186-4 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
|
017-015-00-3 |
(2-(Aminomethyl)phenyl)-acetylchloridhydrochlorid |
417-410-4 |
Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
|
017-016-00-9 |
Methyltriphenylphosphoniumchlorid |
418-400-2 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H411 |
|
|
|
|
|
017-017-00-4 |
(Z)-13-Docosenyl-N,N-bis(2-hydroxyethyl)-N-methylammoniumchlorid |
426-210-6 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
|
017-018-00-X |
N, N,N-Trimethyl-2,3-bis(stearoyloxy)propylammoniumchlorid |
405-660-7 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
017-019-00-5 |
(R)-1,2,3,4-Tetrahydro-6,7-dimethoxy-1-veratrylisochinolinhydrochlorid |
415-110-8 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
017-020-00-0 |
Ethylpropoxyaluminiumchlorid |
421-790-7 |
Water-react. 1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
|
017-021-00-6 |
Behenamidopropyldimethyl(dihydroxypropyl)ammoniumchlorid |
423-420-1 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
|
017-023-00-7 |
[Phosphinyldyntris(oxy)]tris[3-aminopropyl-2-hydroxy-N, N-dimethyl-N-(C6-18)-alkyl]-trichloride |
425-520-9 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
|
017-026-00-3 |
Chlordioxid |
233-162-8 |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 |
H270 H330 H314 H400 |
GHS04 GHS03 GHS06 GHS05 GHS09 Dgr |
H270 H330 H314 H400 |
|
M = 10 |
5 |
|
|
017-026-01-0 |
Chlordioxid … % |
233-162-8 |
Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
|
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,3 % ≤ C < 3 % STOT SE 3; H335: C ≥ 3 % M = 10 |
B |
|
|
019-001-00-2 |
Kalium |
231-119-8 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
|
019-002-00-8 |
Kaliumhydroxid; Ätzkali; Kalilauge |
215-181-3 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
Skin Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314: 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
|
|
|
019-003-00-3 |
Kalium-(E,E)-hexa-2,4-dienoat |
246-376-1 |
Eye Irrit. 2 |
H319 |
GSH07 Wng |
H319 |
|
|
|
|
|
020-001-00-X |
Calcium |
231-179-5 |
Water-react. 2 |
H261 |
GHS02 Dgr |
H261 |
|
|
|
|
|
020-002-00-5 |
Calciumcyanid |
209-740-0 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
EUH032 |
|
|
|
|
020-003-00-0 |
Reaktionsmasse aus Dicalcium-(bis(2-hydroxy-5-tetra-propenylphenylmethyl)-methylamin)dihydroxid, Tricalcium(tris(2-hydroxy-5-tetrapropenylphenylmethyl)-methylamin)trihydroxid und Poly[calcium((2-hydroxy-5-tetrapropenylphenylmethyl)methylamin)hydroxid] |
420-470-4 |
— |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
022-001-00-5 |
Titantetrachlorid; Titan(IV)-chlorid |
231-441-9 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
EUH014 |
|
|
|
|
022-002-00-0 |
Titan(4+)oxalat |
403-260-7 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
022-003-00-6 |
Bis(cyclopentadienid-bis(2,6-difluor-3-[1H-pyrrol-1-yl]phenyl)titan(IV); Bis (η5-cyclopentadienyl)-bis(2,6-difluor- 3-[pyrrol-1-yl]-phenyl)titan) |
412-000-1 |
Flam. Sol. 1 Repr. 2 STOT RE 2 * Aquatic Chronic 2 |
H228 H361f *** H373 ** H411 |
GHS02 GHS08 GHS09 Dgr |
H228 H361f *** H373 ** H411 |
|
|
T |
|
|
022-004-00-1 |
Kaliumtitanoxid (K2Ti6O13) |
432-240-0 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
022-005-00-7 |
[N-(1,1-Dimethylethyl)-1,1-dimethyl-1-[(1,2,3,4,5-η)-2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl]silanaminato(2-)-κN][(1,2,3,4-η)-1,3-pentadien]-titan |
419-840-8 |
Flam. Sol. 1**** Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H228 H314 H317 H413 |
GHS02 GHS05 GHS07 Dgr |
H228 H314 H317 H413 |
|
|
|
|
|
►C12 022-006-00-2 ◄ |
Titandioxid; [in Pulverform mit mindestens 1 % Partikel mit aerodynamischem Durchmesser ≤ 10 μm] |
236-675-5 |
Carc. 2 |
H351 (Einatmen) |
GHS08 Wng |
H351 (Einatmen) |
|
|
V, W, 10 |
|
|
023-001-00-8 |
Divanadiumpentaoxid; Vanadiumpentoxid |
215-239-8 |
Muta. 2 Carc. 1B Repr. 2 Lact. Acute Tox. 3 Acute Tox. 2 STOT SE 3 STOT RE 1 Aquatic Chronic 2 |
H341 H350 H361fd H362 H301 H330 H335 H372 (Atemwege, Einatmen) H411 |
GHS06 GHS08 GHS09 Dgr |
H341 H350 H361fd H362 H301 H330 H335 H372 (Atemwege, Einatmen) H411 |
|
Einatmung: ATE = 0,05 mg/L (Stäube oder Nebel) Oral: ATE = 220 mg/kg KG |
|
|
|
024-001-00-0 |
Chrom(VI)trioxid; Chromsäureanhydrid |
215-607-8 |
Ox. Sol. 1 Carc. 1A Muta. 1B Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350 H340 H361f *** H330 H311 H301 H372 ** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H271 H350 H340 H361f *** H330 H311 H301 H372 ** H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
|
024-002-00-6 |
Kaliumdichromat |
231-906-6 |
Ox. Sol. 2 Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
3 |
|
|
024-003-00-1 |
Ammoniumdichromat |
232-143-1 |
Ox. Sol. 2 **** Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 5 % Resp. Sens.; H334: C ≥0,2 % Skin Sens.; H317:C ≥0,2 % |
G3 |
|
|
024-004-00-7 |
Natriumdichromat |
234-190-3 |
Ox. Sol. 2 Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H312 H372** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS05 GHS08 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H312 H372** H314 H334 H317 H410 |
|
Resp. Sens. 1; H334: C ≥ 0,2 % Skin Sens. 1; H317:C ≥0,2 % STOT SE 3; H335: C ≥ 5 % |
3 |
|
|
▼M1 ————— |
||||||||||
|
024-005-00-2 |
Chromyldichlorid; Chromoxychlorid; Chromdioxiddichlorid |
239-056-8 |
Ox. Liq. 1 Carc. 1B Muta. 1B Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350i H340 H314 H317 H400 H410 |
GHS03 GHS08 GHS05 GHS07 GHS09 Dgr |
H271 H350i H340 H314 H317 H410 |
|
Skin Corr. 1A; H314: C ≥ 10 % Skin Corr. 1B; H314: 5 % ≤ C < 10 % Skin Irrit. 2; H315: 0,5 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 5 % STOT SE 3; H335: 0,5 % ≤ C < 5 % Skin Sens. 1; H317: C ≥ 0,5 % |
T3 |
|
|
024-006-00-8 |
Kaliumchromat |
232-140-5 |
Carc. 1B Muta. 1B Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H340 H319 H335 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H340 H319 H335 H315 H317 H410 |
|
Skin Sens. 1; H317:C ≥ 0,5 % |
3 |
|
|
024-007-00-3 |
Zinkchromate, einschließlich Zinkkaliumchromat |
— |
— |
Carc. 1A Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H410 |
|
|
A |
|
024-008-00-9 |
Calciumchromat |
237-366-8 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
|
024-009-00-4 |
Strontiumchromat |
232-142-6 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H400 H410 |
|
|
|
|
|
024-010-00-X |
Dichromtris(chromat); Chrom(III)chromat; chromsaures Chromoxid; Chrom(III)-Salz der Chrom(VI)-Säure chromic chromate |
246-356-2 |
Ox. Sol. 1 Carc. 1B Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350 H314 H317 H400 H410 |
GHS03 GHS08 GHS05 GHS07 GHS09 Dgr |
H271 H350 H314 H317 H410 |
|
|
T |
|
|
024-011-00-5 |
Ammoniumbis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromat(1-) |
400-110-2 |
Self-react. C **** Aquatic Acute 1 Aquatic Chronic 1 |
H242 H400 H410 |
GHS02 GHS09 Dgr |
H242 H410 |
|
|
|
|
|
024-012-00-0 |
Trinatriumbis(7-acetamido-2-(4- nitro-2-oxidophenylazo)-3-sulfonato-1-naphtholato)-chromat(1-) |
400-810-8 |
— |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
024-013-00-6 |
Trinatrium(6-anilino-2-(5-nitro-2-oxidophenylazo)-3-sulfonato-1-naphtholato)(4-sulfonato-1,1'-azodi-2,2'naphtholato)chromat(1-) |
402-500-8 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
024-014-00-1 |
Trinatriumbis(2-(5-chlor-4-nitro-2-oxidophenylazo)-5-sulfonato-1-naphtholato)chromat(1-) |
402-870-0 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
024-015-00-7 |
Dinatrium(3-methyl-4-(5-nitro-2-oxidophenylazo)-1-phenylpyrazololato)(1-(3-nitro-2-oxido-5-sulfonatophenylazo)-2-naphtholato)chromat(1-) |
404-930-1 |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H318 H411 |
|
|
|
|
024-016-00-2 |
Tetradecylammoniumbis(1-(5-chlor-2-oxidophenylazo)-2-naphtholato)chromat(1-) |
405-110-6 |
STOT RE 2 * Aquatic Chronic 4 |
H373 ** H413 |
GHS08 Wng |
H373 ** H413 |
|
|
|
|
|
024-017-00-8 |
Chrom(VI)-Verbindungen, ausgenommen Bariumchromat, und soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Carc. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H317 H410 |
|
|
A |
|
024-018-00-3 |
Natriumchromat |
231-889-5 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
Resp. Sens.; H334: C ≥ 0,2 % Skin Sens.; H317:C ≥ 0,2 % |
3 |
|
|
024-019-00-9 |
Hauptbestandteil: Acetoessigsäureanilid/3-Amino-1-hydroxybenzol (ATAN-MAP): Trinatrium{6-[(2 oder 3 oder 4)-amino-(4 oder 5 oder 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalin-2-azobenzol-1,2'-diolato}-{6''-[1-(phenylcarbamoyl)ethylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalin-2''-azobenzol-1'',2'''-diolato}chromat(III); Nebenprodukt 1: Acetoessigsäureanilid/Acetoessigsäureanilid (ATAN-ATAN): Trinatriumbis{6-[1-(phenylcarbamoyl)ethylazo]-5'''-(phenylsulfonyl)-3''-sulfonatonaphthalin-2-azobenzol-1,2'-diolato}chromat(III); Nebenprodukt 2: 3-Amino-1-hydroxybenzol/3-Amino-1-hydroxybenzol (MAP-MAP): Trinatriumbis{6-[(2 oder 3 oder 4)-amino-(4 oder 5 oder 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalin-2-azobenzol-1,2'-diolato}chromat(III) |
419-230-1 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
024-020-00-4 |
Trinatriumbis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphthylazonaphtylazo)phenylsulfonylamino]pyrimidin-5-azo)benzol-2',4-diolato)]-chromat(III) |
418-220-4 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
024-021-00-X |
Kaliumtetranatriumbis[(N,N'-n)-1'-(phenylcarbamoyl)-3,5-disulfonatobenzolazo-1'-prop-1'-en-2,2'-diolato]chromat(III) |
425-830-4 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
025-001-00-3 |
Mangandioxid; Braunstein |
215-202-6 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
|
025-002-00-9 |
Kaliumpermanganat |
231-760-3 |
Ox. Sol. 2 Repr. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H272 H361d H302 H400 H410 |
GHS03 GHS08 GHS07 GHS09 Dgr |
H272 H361d H302 H410 |
|
|
|
|
|
025-003-00-4 |
Mangansulfat |
232-089-9 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
|
025-004-00-X |
Bis(N, N',N''-trimethyl-1,4,7-triazacyclononan)-trioxodimangan(IV)-di(hexafluorphosphat)-Monohydrat |
411-760-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
025-005-00-5 |
Reaktionsmasse aus Trinatrium[29H,31H-phthalocyanin-C, C,C-trisulfonato(6-)-N29,N30,N31,N32]manganat(3-), Tetranatrium[29H,31H-phthalocyanin-C, C,C, C-tetrasulfonato(6-)-N29,N30,N31,N32]manganat(3-) und Pentanatrium[29H,31H-phthalocyanin-C, C,C, C,C-pentasulfonato(6-)-N29,N30,N31,N32]manganat(3-) |
417-660-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
026-001-00-6 |
(η-Cumen)-(η-cyclopentadienyl)eisen(II)-hexafluorantimonat |
407-840-0 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
026-002-00-1 |
(η-Cumen)-(η-cyclopentadienyl)eisen(II)-trifluormethansulfonat |
407-880-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
026-003-00-7 |
Eisen(II)-sulfat |
231-753-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
|
026-003-01-4 |
Eisen(II)-sulfat (1:1), Heptahydrat; Schwefelsäure, Eisen(II)-salz (1:1), Heptahydrat; Eisensulfatheptahydrat |
231-753-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
Skin Irrit.2; H315: C ≥ 25 % |
|
|
|
026-004-00-2 |
Kaliumferrit |
430-010-4 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
|
027-001-00-9 |
Cobalt |
231-158-0 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 4 |
H350 H341 H360F H334 H317 H413 |
GHS08 Dgr |
H350 H341 H360F H334 H317 H413 |
|
|
|
|
|
027-002-00-4 |
Cobaltoxid |
215-154-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M=10 |
|
|
|
027-003-00-X |
Cobaltsulfid |
215-273-3 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M=10 |
|
|
|
027-004-00-5 |
Cobaltdichlorid |
231-589-4 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360F*** H302 H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M=10 |
1 |
|
|
027-005-00-0 |
Cobaltsulfat |
233-334-2 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360F*** H302 H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M=10 |
1 |
|
|
027-006-00-6 |
Cobaltdi(acetat) |
200-755-8 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360F*** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
|
027-007-00-1 |
Zinkhexacyanocobaltat(III), tertiärer Butylalkohol/Polypropylenglycol-Komplex |
425-240-7 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
027-008-00-7 |
Cobalt(III)-bis(N-phenyl-4-(5-ethylsulfonyl-2-hydroxyphenylazo)-3-hydroxynaphthylamid)-Komplex, hydriert (n H2O, 2<n<3) |
427-390-9 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
027-009-00-2 |
Cobaltdinitrat |
233-402-1 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360F*** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
|
027-010-00-8 |
Cobaltcarbonat |
208-169-4 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360F*** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M=10 |
1 |
|
|
028-001-00-1 |
Tetracarbonylnickel; Nickeltetracarbonyl |
236-669-2 |
Flam. Liq. 2 Carc. 2 Repr. 1B Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H351 H360D *** H330 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H351 H360D *** H330 H410 |
|
|
|
|
|
028-002-00-7 |
Nickel |
231-111-4 |
Carc. 2 STOT RE 1 Skin Sens. 1 |
H351 H372** H317 |
GHS08 GHS07 Dgr |
H351 H372** H317 |
|
|
S7 |
|
|
028-002-01-4 |
Nickelpulver [Partikeldurchmesser < 1 mm] |
231-111-4 |
Carc. 2 STOT RE 1 Skin Sens. 1 Aquatic Chronic 3 |
H351 H372** H317 H412 |
GHS08 GHS07 Dgr |
H351 H372** H317 H412 |
|
|
|
|
|
028-003-00-2 |
Nickelmonoxid; Nickel(II)-oxid [1]; Nickeloxid [2]; Bunsenit [3] |
215-215-7 [1] 234-323-5 [2] — [3] |
1313-99-1 [1] 11099-02-8 [2] 34492-97-2 [3] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372** H317 H413 |
|
|
|
|
028-004-00-8 |
Nickeldioxid; Nickel(IV)-oxid |
234-823-3 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372** H317 H413 |
|
|
|
|
|
028-005-00-3 |
Dinickeltrioxid; Nickel(III)-oxid |
215-217-8 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372** H317 H413 |
|
|
|
|
|
028-006-00-9 |
Nickel(II)-sulfid [1];] Nickelsulfid [2];] Millerit [3] |
240-841-2 [1] 234-349-7 [2] — [3] |
16812-54-7 [1] 11113-75-0 [2] 1314-04-1 [3] |
Carc. 1A Muta. 2 STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H372** H317 H410 |
|
|
|
|
028-007-00-4 |
Trinickeldisulfid; Nickelsubsulfid; [1] Heazlewoodit [2] |
234-829-6 [1] - [2] |
12035-72-2 [1] 12035-71-1 [2] |
Carc. 1A Muta. 2 Acute Tox. 3 STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H331 H372** H317 H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H350i H341 H331 H372** H317 H410 |
|
Einatmen: ATE = 0,92 mg/L (Stäube oder Nebel) |
|
|
028-008-00-X |
Nickeldihydroxid; Nickel(II)-hydroxid [1]; Nickelhydroxid [2] |
235-008-5 [1] 234-348-1 [2] |
12054-48-7 [1] 11113-74-9 [2] |
Carc. 1A Repr. 1B Muta. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H360D*** H341 H372** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H360D*** H341 H372** H332 H302 H315 H334 H317 H410 |
|
|
|
|
028-009-00-5 |
Nickelsulfat; Nickel(II)-sulfat |
232-104-9 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
|
028-010-00-0 |
Nickelcarbonat; Basisches Nickelcarbonat; Carbonsäure, Nickel(2+)-Salz [1]; Carbonsäure, Nickelsalz [2];] [μ-[Carbonato(2-)-O:O']]-dihydroxytrinickel [3]; [Carbonato(2-)]-tetrahydroxytrinickel [4] |
222-068-2 [1] 240-408-8 [2] 265-748-4 [3] 235-715-9 [4] |
3333-67-3 [1] 16337-84-1 [2] 65405-96-1 [3] 12607-70-4 [4] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H410 |
|
|
|
|
028-011-00-6 |
Nickeldichlorid; Nickelchlorid |
231-743-0 |
Carc. 1A Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H331 H301 H372** H315 H334 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350i H341 H360D*** H331 H301 H372** 315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % < C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
|
028-012-00-1 |
Nickeldinitrat [1]; Salpetersäure, Nickelsalz [2] |
236-068-5 [1] 238-076-4 [2] |
13138-45-9 [1] 14216-75-2 [2] |
Ox. Sol. 2 Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350i H341 H360D*** H372** H332 H302 H315 H318 H334 H317 H400 H410 |
GHS03 GHS05 GHS08 GHS07 GHS09 Dgr |
H272 H350i H341 H360D*** H372** H332 H302 H315 H318 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % < C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317 C ≥0,01 % M = 1 |
|
|
028-013-00-7 |
Nickelmatte |
273-749-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-014-00-2 |
Schleime und Schlämme, elektrolytische Kupferraffination, entkupfert, Nickelsulfat |
295-859-3 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < % Skin Sens. 1; H317:C ≥ 0,01 % M=1 |
|
|
|
028-015-00-8 |
Schleime und Schlämme, elektroyltische Kupferraffination, entkupfert |
305-433-1 |
Carc. 1A Muta. 2 Repr. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
|
|
|
|
028-016-00-3 |
Nickeldiperchlorat; Perchlorsäure, Nickel(II)-Salz |
237-124-1 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H314 H334 H317 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** 14 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
|
|
|
028-017-00-9 |
Nickeldikaliumbis(sulfat) [1]; Diammoniumnickelbis(sulfat) [2] |
237-563-9 [1] 239-793-2 [2] |
13842-46-1 [1] 15699-18-0 [2] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** 332 H302 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M=1 |
|
|
028-018-00-4 |
Nickel-bis(sulfamidat); Nickelsulfamat |
237-396-1 |
Carc. 1A Muta. 2 Repr. 1B Acute Tox. 4 STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H302 H372** H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H302 H372** H334 H317 H410 |
|
Oral: ATE = 853 mg/kg KG (Anhydrat) Oral: ATE = 1098 mg/kg KG (Tetrahydrat) STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
|
028-019-00-X |
Nickelbis(tetrafluorborat) |
238-753-4 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥0,01 % M=1 |
|
|
|
028-021-00-0 |
Nickeldiformiat [1]; Ameisensäure, Nickelsalz [2]; Ameisensäure, Kupfer-Nickelsalz [3] |
222-101-0 [1] 239-946-6 [2] 268-755-0 [3] |
3349-06-2 [1] 15843-02-4 [2] 68134-59-8 [3] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥0,01 % M=1 |
|
|
028-022-00-6 |
Nickeldi(acetat) [1]; Nickelacetat [2] |
206-761-7 [1] 239-086-1 [2] |
373-02-4 [1] 14998-37-9 [2] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥ 0,01 % M = 1 |
|
|
028-024-00-7 |
Nickeldibenzoat |
209-046-8 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥ 0,01 % M=1 |
|
|
|
028-025-00-2 |
Nickelbis(4-cyclohexylbutyrat) |
223-463-2 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥0,01 % M=1 |
|
|
|
028-026-00-8 |
Nickel(II)-stearat; Nickel(II)-octadecanoat |
218-744-1 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317:C;≥0,01 % M=1 |
|
|
|
028-027-00-3 |
Nickeldilactat |
— |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372:C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
|
|
|
028-028-00-9 |
Nickel(II)-octanoat |
225-656-7 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H314 H334 H317 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H314 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
|
|
|
028-029-00-4 |
Nickeldifluorid [1]; Nickeldibromid [2]; Nickeldiiodid [3]; Nickelkaliumfluorid [4] |
233-071-3 [1] 236-665-0 [2] 236-666-6 [3] — [4] |
10028-18-9 [1] 13462-88-9 [2] 13462-90-3 [3] 11132-10-8 [4] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥0,01 % M=1 |
|
|
028-030-00-X |
Nickelhexafluorsilicat |
247-430-7 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** 334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M=1 |
|
|
|
028-031-00-5 |
Nickelselenat |
239-125-2 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥0,01 % M=1 |
|
|
|
028-032-00-0 |
Nickelhydrogenphosphat [1]; Nickelbis(dihydrogenphosphat) [2];] Trinickelbis(orthophosphat) [3];] Dinickeldiphosphat [4]; Nickelbis(phosphinat) [5];] Nickel phosphinat [6];] Phosphorsäure, Calciumnickelsalz [7]; Diphosphorsäure, Nickel(II)- Salz [8] |
238-278-2 [1] 242-522-3 [2] 233-844-5 [3] 238-426-6 [4] 238-511-8 [5] 252-840-4 [6] — [7] — [8] |
14332-34-4 [1] 18718-11-1 [2] 10381-36-9 [3] 14448-18-1 [4] 14507-36-9 [5] 36026-88-7 [6] 17169-61-8 [7] 19372-20-4 [8] |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
028-033-00-6 |
Diammoniumnickelhexacyanoferrat |
— |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
|
028-034-00-1 |
Nickeldicyanid |
209-160-8 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
EUH032 |
|
|
|
|
028-035-00-7 |
Nickelchromat |
238-766-5 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
|
028-036-00-2 |
Nickel(II)-silicat [1]; Dinickelorthosilicat [2]; Nickelsilicat (3:4) [3]; Kieselsäure, Nickelsalz [4]; Trihydrogenhydroxybis[orthosilicato(4-)]trinickelat(3-) [5] |
244-578-4 [1] 237-411-1 [2] 250-788-7 [3] 253-461-7 [4] 235-688-3 [5] |
21784-78-1 [1] 13775-54-7 [2] 31748-25-1 [3] 37321-15-6 [4] 12519-85-6 [5] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
028-037-00-8 |
Dinickelhexacyanoferrat |
238-946-3 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-038-00-3 |
Trinickelbis(arsenat); Nickel(II)-arsenat |
236-771-7 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H372** H317 H410 |
|
|
|
|
|
028-039-00-9 |
Nickeloxalat [1]; Oxalsäure, Nickelsalz [2] |
208-933-7 [1] 243-867-2 [2] |
547-67-1 [1] 20543-06-0 [2] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
028-040-00-4 |
Nickeltellurid |
235-260-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-041-00-X |
Trinickeltetrasulfid |
— |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-042-00-5 |
Trinickelbis(arsenit) |
— |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-043-00-0 |
Cobalt-Nickel-Gray-Periklas; C.I. Pigment Black 25; C.I. 77332 [1]; Cobaltnickeldioxid [2]; Cobaltnickeloxid [3] |
269-051-6 [1] 261-346-8 [2] — [3] |
68186-89-0 [1] 58591-45-0 [2] 12737-30-3 [3] |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
028-044-00-6 |
Nickelzinntrioxid; Nickelstannat |
234-824-9 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
|
028-045-00-1 |
Nickeltriurandecaoxid |
239-876-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
|
028-046-00-7 |
Nickeldithiocyanat |
237-205-1 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
EUH032 |
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥0,01 % M=1 |
|
|
|
028-047-00-2 |
Nickeldichromat |
239-646-5 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372:C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥0,01 % M=1 |
|
|
|
028-048-00-8 |
Nickel(II)-Selenit |
233-263-7 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
|
028-049-00-3 |
Nickelselenid |
215-216-2 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-050-00-9 |
Kieselsäure, Bleinickelsalz |
— |
Carc. 1A Repr. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H360Df H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H360Df H372** H317 H410 |
|
|
|
|
|
028-051-00-4 |
Nickeldiarsenid [1]; Nickelarsenid [2] |
235-103-1 [1] 248-169-1 [2] |
12068-61-0 [1] 27016-75-7 [2] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
028-052-00-X |
Nickel-Barium-Titan-Primel-Priderit; C.I. Pigment Yellow 157; C.I. 77900 |
271-853-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
|
028-053-00-5 |
Nickeldichlorat [1]; Nickeldibromat [2]; Ethylhydrogensulfat, Nickel(II)-Salz [3] |
267-897-0 [1] 238-596-1 [2] 275-897-7 [3] |
67952-43-6 [1] 14550-87-9 [2] 71720-48-4 [3] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < % Skin Sens. 1; H317:C≥0,01 %1 M=1 |
|
|
028-054-00-0 |
Nickel(II)-trifluoracetat [1]; Nickel(II)-propionat [2]; Nickelbis(benzolsulfonat) [3]; Nickel(II)-hydrogencitrat[4]; Zitronensäure, Ammoniumnickelsalz [5]; Zitronensäure, Nickelsalz [6]; Nickelbis(2-ethylhexanoat) [7]; 2-Ethylhexansäure, Nickelsalz [8]; Dimethylhexansäure, Nickelsalz [9]; Nickel(II)-isooctanoat [10]; Nickelisooctanoat [11]; Nickelbis(isononanoat) [12]; Nickel(II)-neononanoat [13]; Nickel(II)-isodecanoat [14]: Nickel(II)-neodecanoat [15]; Neodecansäure, Nickelsalz [16]; Nickel(II)-neoundecanoat [17]; Bis(D-gluconato-O1,O2)nickel [18]; Nickel-3,5-bis(tert-butyl)-4- hydroxybenzoat (1:2) [19]; Nickel(II)-palmitat [20]; (2-Ethylhexanoato-O)(isononanoato-O)-nickel [21]; (Isononanoato-O)(isooctanoato-O)-nickel [22]; (Isooctanoato-O)(neodecanoato-O)-nickel [23]; (2-Ethylhexanoato-O)(isodecanoato-O)-nickel [24]; (2-Ethylhexanoato-O)(neodecanoato-O)-nickel [25];] (Isodecanoato-O)(isooctanoato-O)-nickel [26]; (Isodecanoato-O)(isononanoato-O)-nickel [27]; (Isononanoato-O)(neodecanoato-O)-nickel [28]; Fettsäuren, C6-19-verzweigt, Nickelsalze [29]; Fettsäuren, C8-18- und C18-ungesättigt, Nickelsalze [30]; 2,7-Naphthalindisulfonsäure, Nickel(II)-salz [31] |
240-235-8 [1] 222-102-6 [2] 254-642-3 [3] 242-533-3 [4] 242-161-1 [5] 245-119-0 [6] 224-699-9 [7] 231-480-1 [8] 301-323-2 [9] 249-555-2 [10] 248-585-3 [11] 284-349-6 [12] 300-094-6 [13] 287-468-1 [14] 287-469-7 [15] 257-447-1 [16] 300-093-0 [17] 276-205-6 [18] 258-051-1 [19] 237-138-8 [20] 287-470-2 [21] 287-471-8 [22] 284-347-5 [23] 284-351-7 [24] 285-698-7 [25] 285-909-2 [26] 284-348-0 [27] 287-592-6 [28] 294-302-1 [29] 283-972-0 [30] — [31] |
16083-14-0 [1] 3349-08-4 [2] 39819-65-3 [3] 18721-51-2 [4] 18283-82-4 [5] 22605-92-1 [6] 4454-16-4 [7] 7580-31-6 [8] 93983-68-7 [9] 29317-63-3 [10] 27637-46-3 [11] 84852-37-9 [12] 93920-10-6 [13] 85508-43-6 [14] 85508-44-7 [15] 51818-56-5 [16] 93920-09-3 [17] 71957-07-8 [18] 52625-25-9 [19] 13654-40-5 [20] 85508-45-8 [21] 85508-46-9 [22] 84852-35-7 [23] 84852-39-1 [24] 85135-77-9 [25] 85166-19-4 [26] 84852-36-8 [27] 85551-28-6 [28] 91697-41-5 [29] 84776-45-4 [30] 72319-19-8 [31] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
|
|
028-055-00-6 |
Nickel(II)-sulfit [1]; Nickeltellurtrioxid [2]; Nickeltellurtetraoxid [3];Molybdännickelhydroxidoxidphosphat [4] |
231-827-7 [1] 239-967-0 [2] 239-974-9 [3] 268-585-7 [4] |
7757-95-1 [1] 15851-52-2 [2] 15852-21-8 [3] 68130-36-9 [4] |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
028-056-00-1 |
Nickelborid (NiB) [1]; Dinickelborid [2]; Trinickelborid [3]; Nickelborid [4]; Dinickelsilicid [5]; Nickeldisilicid [6]; Dinickelphosphid [7]; Nickelborphosphid [8] |
234-493-0 [1] 234-494-6 [2] 234-495-1 [3] 235-723-2 [4] 235-033-1 [5] 235-379-3 [6] 234-828-0 [7] — [8] |
12007-00-0 [1] 12007-01-1 [2] 12007-02-2 [3] 12619-90-8 [4] 12059-14-2 [5] 12201-89-7 [6] 12035-64-2 [7] 65229-23-4 [8] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
028-057-00-7 |
Dialuminiumnickeltetraoxid [1]; Nickeltitantrioxid [2]; Nickeltitanoxid [3]; Nickeldivanadiumhexaoxid [4]; Cobaltdimolybdännickeloctaoxid [5]: Nickelzirconiumtrioxid [6]; Molybdännickeltetraoxid [7]; Nickelwolframtetraoxid [8];Olivin, Nickelgrün [9]; Lithiumnickeldioxid [10]; Molybdännickeloxid [11] |
234-454-8 [1] 234-825-4 [2] 235-752-0 [3] 257-970-5 [4] 268-169-5 [5] 274-755-1 [6] 238-034-5 [7] 238-032-4 [8] 271-112-7 [9] — [10] — [11] |
12004-35-2 [1] 12035-39-1 [2] 12653-76-8 [3] 52502-12-2 [4] 68016-03-5 [5] 70692-93-2 [6] 14177-55-0 [7] 14177-51-6 [8] 68515-84-4 [9] 12031-65-1 [10] 12673-58-4 [11] |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
028-058-00-2 |
Cobaltlithiumnickeloxid |
442-750-5 |
— |
Carc. 1A Acute Tox. 2 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H330 H372** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H372** H317 H410 |
|
|
|
|
029-001-00-4 |
Kupferchlorid; Kupfer(I)-chlorid; |
231-842-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
|
029-002-00-X |
Dikupferoxid; Kupfer(I)-oxid |
215-270-7 |
Acute Tox. 4 Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H332 H302 H318 H410 |
|
Einatmen: ATE = 3,34 mg/L (Stäube oder Nebel) oral: ATE = 500 mg/kg KG M = 100 M = 10 |
|
|
|
029-003-00-5 |
Naphthensäuren, Kupfersalze; Kupfernaphthenat |
215-657-0 |
Flam. Liq. 3 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H400 H410 |
GHS02 GHS07 GHS09 Wng |
H226 H302 H410 |
|
|
|
|
|
029-004-00-0 |
Kupfersulfat; Kupfer(II)-sulfat |
231-847-6 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
|
029-005-00-6 |
(Tris(chlormethyl)-phthalocyaninato)-kupfer(II), Reaktionsprodukte mit N-Methylpiperazin und Methoxyessigsäure |
401-260-1 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
029-006-00-1 |
Tris(octadec-9-enylammonium)-(trisulfonatophthalocyaninato)-kupfer(II) |
403-210-4 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
029-007-00-7 |
(Trinatrium-(2-((3-(6-(2-chlor-5- sulfonato)anilino)-4-(3-carboxypyridinio)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)phenylmethylazo)-4-sulfonatobenzoato)kupfer(3-))-hydroxid |
404-670-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
G |
|
|
029-008-00-2 |
Kupfer(II)-methansulfonat |
405-400-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
|
029-009-00-8 |
Phthalocyanin-N-[3-(diethylamino)propyl]-sulfonamid-Kupferkomplex |
413-650-9 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
029-010-00-3 |
Reaktionsmasse aus Verbindungen von (Dodecakis(p-tolylthio)phthalocyaninato)kupfer(II) bis (Hexadecakis(p-tolylthio)phthalocyaninato)kupfer(II) |
407-700-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
029-011-00-9 |
Natrium-[29H,31H-phthalocyaninato-(2-)-N29,N30,N31,N32]-((3-(N-methyl-N-(2-hydroxyethyl)amino)propyl)amino)-sulfonylsulfonato-Kupferkomplex |
412-730-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
029-012-00-4 |
Natrium-((N-(3-trimethylammoniopropyl)-sulfamoyl)methylsulfonatophthalocyaninato)kupfer(II) |
407-340-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
029-013-00-X |
Trinatrium-(2-(α-(3-(4-chlor-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenhydrazino)-4-sulfonatobenzoato)kupfer(II) |
407-580-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
029-014-00-5 |
Reaktionsmasse aus 2,2'-[[cis-1,2-Cyclohexandiyl-bis(nitrilomethyliden)]bis[phenolat]](2-)N, N',O, O'-Kupferkomplex und 2,2'-[[trans-1,2-Cyclohexandiyl-bis(nitrilomethylidin)]bis[phenolat]](2- )N, N',O, O'-Kupferkomplex |
419-610-7 |
STOT RE 2 * Aquatic Chronic 2 |
H373** H411 |
GHS08 GHS09 Wng |
H373** H411 |
|
|
|
|
|
029-015-00-0 |
Kupferthiocyanat |
214-183-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
EUH032 |
M = 10 M = 10 |
|
|
|
029-016-00-6 |
Kupfer(II)-oxid |
215-269-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 M = 10 |
|
|
|
029-017-00-1 |
Dikupferchloridtrihydroxid |
215-572-9 |
Acute Tox. 4 Acute Tox. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H301 H400 H410 |
GHS06 GHS09 Dgr |
H332 H301 H410 |
|
Einatmen: ATE = 2,83 mg/L (Stäube oder Nebel) oral: ATE = 299 mg/kg KG M = 10 M = 10 |
|
|
|
029-018-00-7 |
Tetrakupferhexahydroxidsulfat; [1] Tetrakupferhexahydroxidsulfathydrat [2] |
215-582-3 [1] 215-582-3 [2] |
1333-22-8 [1] 12527-76-3 [2] |
Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
oral: ATE = 500 mg/kg KG M = 10 M = 10 |
|
|
029-019-01-X |
Kupferflocken (mit einem Überzug aus aliphatischer Säure) |
— |
— |
Acute Tox. 3 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H319 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H319 H410 |
|
Einatmen: ATE = 0,733 mg/L (Stäube oder Nebel) oral: ATE = 500 mg/kg KG M = 10 M = 10 |
|
|
029-020-00-8 |
Kupfer(II)-carbonat — Kupfer(II)-hydroxid (1:1) |
235-113-6 |
Acute Tox. 4 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H319 H410 |
|
Einatmen: ATE = 1,2 mg/L (Stäube oder Nebel) oral: ATE = 500 mg/kg KG M = 10 M = 10 |
|
|
|
029-021-00-3 |
Kupferdihydroxid; Kupfer(II)-hydroxid |
243-815-9 |
Acute Tox. 2 Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H302 H318 H410 |
|
Einatmen: ATE = 0,47 mg/L (Stäube oder Nebel) oral: ATE = 500 mg/kg KG M = 10 M = 10 |
|
|
|
029-022-00-9 |
Bordeauxbrühe; Reaktionsprodukte von Kupfersulfat mit Calciumdihydroxid |
— |
Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H332 H318 H410 |
|
Einatmen: ATE = 1,97 mg/L (Stäube oder Nebel) M = 10 M = 1 |
|
|
|
029-023-00-4 |
Kupfersulfat-Pentahydrat |
231-847-6 |
Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H302 H318 H410 |
|
oral: ATE = 481 mg/kg KG M = 10 M = 1 |
|
|
|
029-024-00-X |
Kupfer, granuliert [Partikellänge: von 0,9 mm bis 6,0 mm; Partikelbreite: von 0,494 mm bis 0,949 mm] |
231-159-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
029-025-00-5 |
Bis(N-hydroxy-N-nitrosocyclohexylaminato-O,O’)kupfer; Bis(N-cyclohexyl-diazenium-dioxy)-kupfer; [Cu-HDO] |
239-703-4 |
Flam. Sol. 1 Acute Tox. 4 STOT RE 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H373 (Leber) H318 H400 H410 |
GHS02 GHS07 GHS08 GHS05 GHS09 Dgr |
H228 H302 H373 (Leber) H318 H410 |
|
oral: ATE = 360 mg/kg KG M = 1 M = 1 |
|
|
|
030-001-00-1 |
Zinkpulver — Zinkstaub (pyrophor) |
231-175-3 |
Water-react. 1 Pyr. Sol. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H260 H250 H400 H410 |
GHS02 GHS09 Dgr |
H260 H250 H410 |
|
|
T |
|
|
030-001-01-9 |
Zinkpulver — Zinkstaub (stabilisiert) |
231-175-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
030-003-00-2 |
Zinkchlorid; Zink(II)-chlorid |
231-592-0 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
030-004-00-8 |
Dimethylzink [1]; Diethylzink [2] |
208-884-1 [1] 209-161-3 [2] |
544-97-8 [1] 557-20-0 [2] |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H260 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H260 H314 H410 |
EUH014 |
|
|
|
030-005-00-3 |
Diamindiisocyanatozink |
401-610-3 |
— |
Acute Tox. 4 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 |
H302 H318 H334 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H318 H334 H317 H400 |
|
|
|
|
030-006-00-9 |
Zinksulfat (wasserhaltig) (Mono-, Hexa- und Heptahydrat) [1]; Zinksulfat (wasserfrei) [2] |
231-793-3 [1] 231-793-3 [2] |
7446-19-7 [1] 7733-02-0 [2] |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
030-007-00-4 |
Bis(3,5-Di-tert-butylsalicylato-O1,O2)-zink |
403-360-0 |
Flam. Sol. 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H228 H302 H410 |
|
|
T |
|
|
030-008-00-X |
Hydroxo(2-(benzolsulfonamido)-benzoato)-zink(II) |
403-750-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
|
030-009-00-5 |
Zink-bis(4-(n-octyloxycarbonylamino)salicylat), Dihydrat |
417-130-2 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
030-010-00-0 |
2-Dodec-1-enylbutandisäure, 4-Methylester, Zinksalz |
430-740-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
030-011-00-6 |
Trizinkbis(orthophosphat) |
231-944-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
030-012-00-1 |
Aluminium-Magnesium-Zink-Carbonathydroxid |
423-570-6 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
|
030-013-00-7 |
Zinkoxid |
215-222-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
030-015-00-8 |
Tetrazink(2+)bis(hexacyanocobalt(3+))-diacetat |
440-060-9 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
031-001-00-4 |
Galliumarsenid |
215-114-8 |
Repr. 1B Carc. 1B STOT RE 1 |
H360F H350 H372 (Atmungssystem und hämatopoetisches System) |
GHS08 Dgr |
H360F H350 H372 (Atmungssystem und hämatopoetisches System) |
|
|
|
|
|
033-001-00-X |
Arsen |
231-148-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
|
|
|
|
033-002-00-5 |
Arsenverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
* |
A1 |
|
033-003-00-0 |
Diarsentrioxid; Arsentrioxid |
215-481-4 |
Carc. 1A Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H300 H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H300 H314 H410 |
|
|
|
|
|
033-004-00-6 |
Diarsenpentaoxid; Arsenpentaoxid |
215-116-9 |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
|
|
|
033-005-00-1 |
Arsensäure und ihre Salze, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
A |
|
033-006-00-7 |
Arsin |
232-066-3 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H330 H373 ** H400 H410 |
GHS02 GHS04 GHS06 GHS08 GHS09 Dgr |
H220 H330 H373 ** H410 |
|
|
U |
|
|
033-007-00-2 |
tert-Butylarsin |
423-320-6 |
Pyr. Liq. 1 Acute Tox. 2 * |
H250 H330 |
GHS02 GHS06 Dgr |
H250 H330 |
|
|
|
|
|
034-001-00-2 |
Selen |
231-957-4 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 4 |
H331 H301 H373 ** H413 |
GHS06 GHS08 Dgr |
H331 H301 H373 ** H413 |
|
|
|
|
|
034-002-00-8 |
Selenverbindingen, ausgenommen Cadmiumsulfoselenid und soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H373** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H373** H410 |
|
|
A |
|
034-003-00-3 |
Natriumselenit |
233-267-9 |
Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Chronic 2 |
H300 H331 H317 H411 |
GHS06 GHS09 Dgr |
H300 H331 H317 H411 |
EUH031 |
|
|
|
|
035-001-00-5 |
Brom |
231-778-1 |
Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H330 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H314 H400 |
|
|
|
|
|
035-002-00-0 |
Hydrogenbromid |
233-113-0 |
Press. Gas Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS04 GHS05 GHS07 Dgr |
H314 H335 |
|
|
U |
|
|
035-002-01-8 |
Bromwasserstoffsäure … % |
— |
— |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
Skin Corr. 1B; H314: C ≥ 40 % Skin Irrit. 2; H315: 10 % ≤ C < 40 % Eye Irrit. 2; H319: 10 % ≤ C < 40 % STOT SE 3; H335: C ≥ 10 % |
B |
|
035-003-00-6 |
Kaliumbromat |
231-829-8 |
Ox. Sol. 1 Carc. 1B Acute Tox. 3 * |
H271 H350 H301 |
GHS03 GHS06 GHS08 Dgr |
H271 H350 H301 |
|
|
|
|
|
035-004-00-1 |
2-Hydroxyethylammoniumperbromid |
407-440-6 |
— |
Ox. Sol. 2 **** Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 |
H272 H302 H314 H317 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H317 H400 |
|
|
|
|
035-005-00-7 |
Ammoniumbromid |
235-183-8 |
Repr. 1B Lact. STOT SE 3 STOT RE 1 Eye Irrit. 2 |
H360FD H362 H336 H372 (Nervensystem) H319 |
GHS08 GHS07 Dgr |
H360FD H362 H336 H372 (Nervensystem) H319 |
|
|
|
|
|
040-001-00-3 |
Zirconiumpulver (pyrophor) |
231-176-9 |
Water-react. 1 Pyr. Sol. 1 |
H260 H250 |
GHS02 Dgr |
H260 H250 |
|
|
T |
|
|
040-002-00-9 |
Zirconiumpulver, trocken (nicht pyrophor) |
— |
— |
Self-heat. 1 |
H251 |
GHS02 Dgr |
H251 |
|
|
T |
|
040-003-00-4 |
Reaktionsprodukt von 3,5-Di-tert-butylsalicylsäure und Zirconiumoxychlorid, dehydriert, basisches Zr: DTBS= 1,0: 1,0 bis 1,0: 1,5 |
430-610-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
042-001-00-9 |
Molybdäntrioxid |
215-204-7 |
Carc. 2 Eye Irrit. 2 STOT SE 3 |
H351 H319 H335 |
GHS08 GHS07 Wng |
H351 H319 H335 |
|
|
|
|
|
042-002-00-4 |
Tetrakis(dimethylditetradecylammonium)hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdat(4-) |
404-760-8 |
Acute Tox. 3 * Eye Dam. 1 |
H331 H318 |
GHS06 GHS05 Dgr |
H331 H318 |
|
|
|
|
|
042-003-00-X |
Tetrakis(trimethylhexadecylammonium)hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdat(4-) |
404-860-1 |
Flam. Sol. 1 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H228 H318 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H228 H318 H410 |
|
|
T |
|
|
042-004-00-5 |
Reaktionsprodukt von Ammoniummolybdat und C12-C24-diethoxyliertem Alkylamin (1:5 bis 1:3) |
412-780-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
042-005-00-0 |
Reaktionsmasse aus Mono- und Diglycerolen aus Canolaöl; Canolaölsäureamid aus verzweigtem 1,3-Propandiamin, N-[3-(tridecyloxy)propyl]; N, N-Diorganodithiocarbamat-Molybdänkomplex |
434-240-6 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
046-001-00-X |
Tetraamminpalladium(II)-hydrogencarbonat |
425-270-0 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373** H318 H317 H410 |
|
|
|
|
|
047-001-00-2 |
Silbernitrat |
231-853-9 |
Ox. Sol. 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H272 H314 H400 H410 |
GHS03 GHS05 GHS09 Dgr |
H272 H314 H410 |
|
|
|
|
|
047-002-00-8 |
Polyphosphorsäure, Kupfer- Natrium-, Magnesium-, Calcium-, Silber- und Zinksalz |
416-850-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
047-003-00-3 |
Silber-Zink-Zeolith (Zeolith, Linde Typ A, Oberfläche mit Silber- und Zinkionen modifiziert) [Dieser Eintrag betrifft Zeolith vom Typ LTA (Linde Typ A), dessen Oberfläche mit Silber- und Zinkionen mit einem Gehalt von Ag+ 0,5 %-6 %, Zn2 + 5 %-16 % und möglicherweise Phospor, NH4 +, Mg2 + und/oder Ca2 + jeweils < 3 % modifiziert wurde.] |
— |
Repr. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H361d H315 H318 H410 |
|
M = 100 M = 100 |
|
|
|
048-001-00-5 |
Cadmiumverbindungen, ausgenommen Cadmiumsulfoselenid (xCdS.yCdSe), Reaktionsmasse aus Cadmiumsulfid und Zinksulfid (xCdS.yZnS), Reaktionsmasse aus Cadmiumsulfid mit Quecksilbersulfid (xCdS.yHgS), und soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
A1 |
|
048-002-00-0 |
Cadmium (nicht-pyrophor) [1];] Cadmiumoxid (nicht-pyrophor) [2] |
231-152-8 [1] 215-146-2 [2] |
7440-43-9 [1] 1306-19-0 [2] |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H361fd H330 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361fd H330 H372 ** H410 |
|
|
|
|
048-003-00-6 |
Cadmiumdiformiat; Cadmiumformiat |
224-729-0 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥0,25 % |
|
|
|
048-004-00-1 |
Cadmiumcyanid |
208-829-1 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H351 H373 ** H410 |
EUH032 |
STOT RE 2; H373: C ≥0,1 % EUH032:C≥1 % |
|
|
|
048-005-00-7 |
Cadmiumhexafluorsilicat(2-); Cadmiumfluorsilicat |
241-084-0 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥0,1 % |
|
|
|
048-006-00-2 |
Cadmiumfluorid |
232-222-0 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2: 0,1 % ≤ C <7 % |
|
|
|
048-007-00-8 |
Cadmiumiodid |
232-223-6 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,1 % |
|
|
|
048-008-00-3 |
Cadmiumchlorid |
233-296-7 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373: 0,1 % ≤ C < 7 % |
|
|
|
048-009-00-9 |
Cadmiumsulfat |
233-331-6 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373 0,1 % ≤ C < 7 % |
|
|
|
048-010-00-4 |
Cadmiumsulfid |
215-147-8 |
Carc. 1B Muta. 2 Repr. 2 STOT RE 1 Acute Tox. 4 * Aquatic Chronic 4 |
H350 H341 H361fd H372 ** H302 H413 |
GHS08 GHS07 Dgr |
H350 H341 H361fd H372 ** H302 H413 |
|
* STOT RE 1; H372: C ≥ 10 % STOT RE 2; H373: 0,1 % ≤ C < 10 % |
1 |
|
|
048-011-00-X |
Cadmium (pyrophor) |
231-152-8 |
Pyr. Sol. 1 Carc. 1B Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H250 H350 H341 H361fd H330 H372 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H250 H350 H341 H361fd H330 H372 ** H410 |
|
|
|
|
|
048-012-00-5 |
Cadmiumcarbonat |
208-168-9 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (Nieren, Knochen) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H332 H312 H302 H372 (Nieren, Knochen) H410 |
|
|
A1 |
|
|
048-013-00-0 |
Cadmiumhydroxid; Cadmiumdihydroxid |
244-168-5 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (Nieren, Knochen) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H332 H312 H302 H372 (Nieren, Knochen) H410 |
|
|
A1 |
|
|
048-014-00-6 |
Cadmiumnitrat; Cadmiumdinitrat |
233-710-6 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (Nieren, Knochen) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H332 H312 H302 H372 (Nieren, Knochen) H410 |
|
Carc. 1B; H350: C ≥ 0,01 % |
A1 |
|
|
050-001-00-5 |
Zinntetrachlorid; Stannichlorid; Zinn(IV)-chlorid |
231-588-9 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
STOT SE 3; H335:C≥5 % |
|
|
|
050-002-00-0 |
Cyhexatin (ISO); Hydroxytricyclohexylstannan; Tricyclohexylzinnhydroxid |
236-049-1 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M=1000 |
|
|
|
050-003-00-6 |
Fentinacetat (ISO); Triphenylzinnacetat |
212-984-0 |
Carc. 2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d*** H330 H311 H301 H372** H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H361d*** H330 H311 H301 H372** H335 H315 H318 H410 |
|
M=10 |
|
|
|
050-004-00-1 |
Fentinhydroxid (ISO); Triphenylzinnhydroxid |
200-990-6 |
Carc. 2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d*** H330 H311 H301 H372** H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H361d*** H330 H311 H301 H372** H335 H315 H318 H410 |
|
M=10 |
|
|
|
050-005-00-7 |
Trimethylzinnverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
* |
A1 |
|
050-006-00-2 |
Triethylzinnverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
* |
A1 |
|
050-007-00-8 |
Tripropylzinnverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
* |
A1 |
|
050-008-00-3 |
Tributyl-Zinnverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Repr. 1B Acute Tox. 3 Acute Tox. 4* STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H301 H312 H372** H315 H319 H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360FD H301 H312 H372** H315 H319 H410 |
|
* STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,25 % ≤ C < 1 % Skin Irrit. 2; H315:C ≥ 1 % Eye Irrit. 2; H319:C ≥ 1 % M = 10 |
A 1 |
|
050-009-00-9 |
Fluortripentylstannan [1]; Hexapentyldistannoxan [2] |
243-546-7 [1] 247-143-7 [2] |
20153-49-5 [1] 25637-27-8 [2] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
1 |
|
050-010-00-4 |
Fluortrihexylstannan |
243-547-2 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
1 |
|
|
050-011-00-X |
Triphenylzinnverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
* M=100 |
A1 |
|
050-012-00-5 |
Tetracyclohexylstannan [1]; Chlortricyclohexylstannan [2];Butyltricyclohexylstannan [3] |
215-910-5 [1] 221-437-5 [2] 230-358-5 [3] |
1449-55-4 [1] 3091-32-5 [2] 7067-44-9 [3] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
A1 |
|
050-013-00-0 |
Trioctylzinnverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 4 |
H319 H335 H315 H413 |
GHS07 Wng |
H319 H335 H315 H413 |
|
Skin Irrit. 2; H315: C ≥ 1 % Eye Irrit.2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
A1 |
|
050-017-00-2 |
Fenbutatinoxid (ISO); Bis(tris(2-methyl-2-phenylpropyl)tin)oxid |
236-407-7 |
Acute Tox. 2 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H319 H315 H400 H410 |
GHS06 GHS09 Dgr |
H330 H319 H315 H410 |
|
|
|
|
|
050-018-00-8 |
Zinn(II)-methansulfonat |
401-640-7 |
Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H314 H302 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H317 H411 |
|
|
|
|
|
050-019-00-3 |
Azocyclotin (ISO); 1-(Tricyclohexylstannyl)-1H-1,2,4-triazol |
255-209-1 |
Acute Tox. 2 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H301 H335 H315 H318 H410 |
|
|
|
|
|
050-020-00-9 |
Trioctylstannan |
413-320-4 |
STOT RE 1 Skin Irrit. 2 Aquatic Chronic 4 |
H372 ** H315 H413 |
GHS08 GHS07 Dgr |
H372 ** H315 H413 |
|
|
|
|
|
050-021-00-4 |
Dichlordioctylstannan |
222-583-2 |
Repr. 1B Acute Tox. 2 STOT RE 1 Aquatic Chronic 3 |
H360D H330 H372 ** H412 |
GHS08 GHS06 Dgr |
H360D H330 H372 ** H412 |
|
Repr. 1B; H360 D: C ≥ 0,03 % Einatmen: ATE = 0,098 mg/L (Stäube oder Nebel) |
|
|
|
050-022-00-X |
Dibutylzinndichlorid; (DBTC) |
211-670-0 |
Muta. 2 Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H341 H360FD H330 H301 H312 H372** H314 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H341 H360FD H330 H301 H312 H372** H314 H410 |
|
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 0,01 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,01 % ≤ C < 3 % M=10 |
|
|
|
050-023-00-5 |
Reaktionsmasse aus Bis[(2-ethyl-1-oxohexyl)-oxy]-dioctylstannan; Bis[((2-ethyl-1-oxohexyl)-oxy)-dioctylstannyl]-oxid; Bis(1-phenyl-1,3-decandionyl)-dioctylstannan und ((2-Ethyl-1-oxohexyl)-oxy)-(1-phenyl-1,3-decandionyl)-dioctylstannan |
422-920-5 |
— |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373** H400 H410 |
GHS08 GHS09 Wng |
H373** H410 |
|
M=10 |
|
|
050-024-00-0 |
Reaktionsmasse aus Tri-p-tolylzinnhydroxid; Hexa-p-tolyldistannoxan |
432-230-6 |
— |
STOT RE 1 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H372** H302 H315 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H372** H302 H315 H318 H317 H410 |
|
|
|
|
050-025-00-6 |
Trichlormethylstannan |
213-608-8 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
|
050-026-00-1 |
2-Ethylhexyl-10-ethyl-4-[[2-[(2- ethylhexyl)oxy]-2-oxoethyl]-thio]-4-methyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoat |
260-828-5 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
|
050-027-00-7 |
2-Ethylhexyl-10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoat; [DOTE] |
239-622-4 |
Repr. 1B STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H372 (Immunsystem) H400 H410 |
GHS08 GHS09 Dgr |
H360D H372 (Immunsystem) H410 |
|
|
|
|
|
050-028-00-2 |
2-Ethylhexyl-10-ethyl-4,4-dimethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoat |
260-829-0 |
Repr. 2 Acute Tox. 4 STOT RE 1 Skin Sens. 1A |
H361d H302 H372 (Nervensystem, Immunsystem) H317 |
GHS08 GHS07 Dgr |
H361d H302 H372 (Nervensystem, Immunsystem) H317 |
|
|
|
|
|
050-029-00-8 |
Dimethylzinndichlorid |
212-039-2 |
Repr. 2 Acute Tox. 2 Acute Tox. 3 Acute Tox. 3 STOT RE 1 Skin Corr. 1B |
H361d H330 H301 H311 H372 (Nervensystem, Immunsystem) H314 |
GHS08 GHS06 GHS05 Dgr |
H361d H330 H301 H311 H372 (Nervensystem, Immunsystem) H314 |
EUH071 |
|
|
|
|
050-030-00-3 |
Dibutylzinndilaurat; Dibutyl[bis(dodecanoyloxy)]-stannan |
201-039-8 |
Muta. 2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (Immunsystem) |
GHS08 Dgr |
H341 H360FD H372 (Immunsystem) |
|
|
|
|
|
050-031-00-9 |
Dioctylzinndilaurat [1]; Dioctyl-, Bis(coco-acyloxy)-stannanderivate [2] |
222-883-3 [1] 293-901-5 [2] |
3648-18-8 [1] 91648-39-4 [2] |
Repr. 1B STOT RE 1 |
H360D H372 (Immunsystem) |
GHS08 Dgr |
H360D H372 (Immunsystem) |
|
|
|
|
050-032-00-4 |
Dibutylzinnbis(2-ethylhexanoat) |
220-481-2 |
Muta. 2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (Immunsystem) |
GHS08 Dgr |
H341 H360FD H372 (Immunsystem) |
|
|
|
|
|
050-033-00-X |
Dibutylzinndi(acetat) |
213-928-8 |
Muta 2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (Immunsystem) |
GHS08 Dgr |
H341 H360FD H372 (Immunsystem) |
|
|
|
|
|
050-034-00-5 |
Dibutylzinnmaleat |
201-077-5 |
Muta. 2 Repr. 1B Acute Tox. 2 Acute Tox. 4 STOT RE 1 Skin Corr. 1 Eye Dam. 1 |
H341 H360FD H330 H302 H372 (Immunsystem) H314 H318 |
GHS08 GHS06 GHS05 Dgr |
H341 H360FD H330 H302 H372 (Immunsystem) H314 |
|
Inhalation: ATE = 0,317 mg/L (Stäube oder Nebel) Oral: ATE = 510 mg/kg KG |
|
|
|
050-035-00-0 |
Dibutylzinnoxid |
212-449-1 |
Muta. 2 Repr. 1B Acute Tox. 3 STOT RE 1 Skin Irrit. 2 Eye Dam. 1 |
H341 H360FD H301 H372 (Immunsystem) H315 H318 |
GHS08 GHS06 GHS05 Dgr |
H341 H360FD H301 H372 (Immunsystem) H315 H318 |
|
Oral: ATE = 170 mg/kg KG |
|
|
|
051-001-00-8 |
Antimontrichlorid |
233-047-2 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
STOT SE3; H335: C ≥ 5 % |
|
|
|
051-002-00-3 |
Antimonpentachlorid |
231-601-8 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
051-003-00-9 |
Antimonverbindungen, ausgenommen Diantimontetroxid (Sb2O4), Antimonpentaoxid (Sb2O5), Diantimontrisulfid (Sb2S3), Diantimonpentasulfid (Sb2S5), und soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H302 H411 |
GHS07 GHS09 Wng |
H332 H302 H411 |
|
* |
A1 |
|
051-004-00-4 |
Antimontrifluorid |
232-009-2 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H331 H311 H301 H411 |
GHS06 GHS09 Dgr |
H331 H311 H301 H411 |
|
|
|
|
|
051-005-00-X |
Diantimontrioxid; Antimontrioxid |
215-175-0 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
051-006-00-5 |
Diphenyl(4-phenylthiophenyl)-sulfoniumhexafluorantimonat |
403-500-0 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
051-007-00-0 |
Bis(4-dodecylphenyl)-iodonium hexafluorantimonat |
404-420-9 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
052-001-00-0 |
Tellur |
236-813-4 |
Repr. 1B Lact. |
H360Df H362 |
GHS08 Dgr |
H360Df H362 |
|
|
|
|
|
052-002-00-6 |
Tellurdioxid |
231-193-1 |
Repr. 1B Lact. |
H360Df H362 |
GHS08 Dgr |
H360Df H362 |
|
|
|
|
|
053-001-00-3 |
Iod |
231-442-4 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H312 H400 |
GHS07 GHS09 Wng |
H332 H312 H400 |
|
|
|
|
|
053-002-00-9 |
Hydrogeniodid; Iodwasserstoff |
233-109-9 |
Press. Gas Skin Corr. 1A |
H314 |
GHS04 GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 10 % Skin Corr. 1B; H314: 0,2 % ≤ C < 10 % Skin Irrit. 2; H315: 0,02 % ≤ C < 0,2 % Eye Irrit. 2; H319: 0,02 % ≤ C < 0,2 % STOT SE 3; H335: C ≥0,02 % |
U5 |
|
|
053-002-01-6 |
Iodwasserstoffsäure … % |
— |
— |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
|
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
053-003-00-4 |
Iodylbenzol |
— |
Expl. **** |
**** |
**** |
**** |
|
|
|
|
|
053-004-00-X |
Calciumiodoxybenzoat |
— |
— |
Expl. **** |
**** |
**** |
**** |
|
|
C |
|
053-005-00-5 |
(4-(1-Methylethyl)phenyl)-(4-methylphenyl)iodoniumtetrakis(pentafluorphenyl)borat(1-) |
422-960-3 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H312 H302 H373 ** H410 |
|
|
|
|
|
056-001-00-1 |
Bariumperoxid |
215-128-4 |
Ox. Sol. 2 Acute Tox. 4 * Acute Tox. 4 * |
H272 H332 H302 |
GHS03 GHS07 Dgr |
H272 H332 H302 |
|
|
|
|
|
056-002-00-7 |
Bariumsalze, ausgenommen Bariumsulfat, Salze der 1-Azo-2-hydroxynaphthalenylarylsulfonsäure und die in diesem Anhang gesondert aufgeführten Salze |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
A1 |
|
056-003-00-2 |
Bariumcarbonat |
208-167-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
056-004-00-8 |
Bariumchlorid; Bariumdichlorid |
233-788-1 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H332 |
GHS06 Dgr |
H301 H332 |
|
|
|
|
|
056-005-00-3 |
Bariumdibortetraoxid |
237-222-4 |
Repr. 1B Acute Tox. 4 Acute Tox. 3 |
H360FD H332 H301 |
GHS08 GHS06 Dgr |
H360FD H332 H301 |
|
Einatmung: ATE = 1,5 mg/L (Stäube oder Nebel) Oral: ATE = 100 mg/kg KG |
|
|
|
064-001-00-8 |
Gadolinium(III)-sulfit-Trihydrat |
456-900-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
072-001-00-4 |
Hafniumtetra-n-butoxid |
411-740-2 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
074-001-00-X |
Hexanatriumwolframathydrat |
412-770-9 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
074-002-00-5 |
Reaktionsprodukte von Wolframhexachlorid und 2-Methylpropan-2-ol, Nonylphenol und Pentan-2,4-dion |
408-250-6 |
— |
Flam. Liq. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H314 H317 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H314 H317 H410 |
|
|
|
|
076-001-00-5 |
Osmiumtetroxid; Osmiumsäure |
244-058-7 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1B |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
|
|
|
|
078-001-00-0 |
Tetrachlorplatinate, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
A |
|
078-002-00-6 |
Diammoniumtetrachlorplatinat |
237-499-1 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
|
078-003-00-1 |
Dinatriumtetrachlorplatinat |
233-051-4 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
|
078-004-00-7 |
Dikaliumtetrachlorplatinat |
233-050-9 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
|
078-005-00-2 |
Hexachlorplatinate, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
A |
|
078-006-00-8 |
Dinatriumhexachlorplatinat |
240-983-5 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
|
078-007-00-3 |
Dikaliumhexachlorplatinat |
240-979-3 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
|
078-008-00-9 |
Diammoniumhexachlorplatinat |
240-973-0 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
|
078-009-00-4 |
Hexachlorplatinsäure |
241-010-7 |
Acute Tox. 3 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H301 H314 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H314 H334 H317 |
|
|
|
|
|
078-010-00-X |
Tetraamminplatin(II)-hydrogencarbonat |
426-730-3 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
078-011-00-5 |
Hydroxydisulfitplatin(II)-säure |
423-310-1 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H373 H314 H334 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 H314 H334 H317 H412 |
|
|
|
|
|
078-012-00-0 |
Platin(IV)-nitrat-/salpetersäurelösung |
432-400-1 |
— |
Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
080-001-00-0 |
Quecksilber |
231-106-7 |
Repr. 1B Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D*** H330 H372** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360D*** H330 H372** H410 |
|
|
|
|
|
080-002-00-6 |
Anorganische Quecksilberverbindungen, ausgenommen Quecksilber(II)-sulfid (Zinnober), und soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,1 % |
A1 |
|
080-003-00-1 |
Diquecksilberdichlorid, Quecksilberchlorid; Kalomel; Quecksilber(I)-chlorid |
233-307-5 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
|
|
|
080-004-00-7 |
Organische Quecksilberverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥0,1 % |
A1 |
|
080-005-00-2 |
Quecksilberdifulminat; Quecksilberfulminat; Knallquecksilber |
211-057-8 |
Unst. Expl. Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H200 H331 H311 H301 H373 ** H400 H410 |
|
|
|
|
|
080-005-01-X |
Quecksilberdifulminat; Quecksilberfulminat; Knallquecksilber [≥ 20 % Phlegmatisierungsmittel] |
211-057-8 |
Expl. 1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373 ** H400 H410 |
|
|
|
|
|
080-006-00-8 |
Diquecksilberdicyanidoxid; Quecksilberoxycyanid |
215-629-8 |
Expl. 1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H331 H311 H301 H373** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373** H410 |
|
|
|
|
|
080-007-00-3 |
Dimethylquecksilber [1]; Diethylquecksilber [2] |
209-805-3 [1] 211-000-7 [2] |
593-74-8 [1] 627-44-1 [2] |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥0,05 % |
1 |
|
080-008-00-9 |
Phenylquecksilbernitrat [1];Phenylquecksilberhydroxid [2]; basisches Phenylquecksilbernitrat [3] |
200-242-9 [1] 202-866-7 [2] -[3] |
55-68-5 [1] 100-57-2 [2] 8003-05-2 [3] |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
080-009-00-4 |
2-Methoxyethylquecksilberchlorid |
204-659-7 |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
|
080-010-00-X |
Quecksilberdichlorid; Quecksilberchlorid; Quecksilber(II)-chlorid Sublimat |
231-299-8 |
Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H341 H361f*** H300 H372** H314 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H341 H361f*** H300 H372** H314 H410 |
|
|
|
|
|
080-011-00-5 |
Phenylquecksilberacetat |
200-532-5 |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
|
080-012-00-0 |
Methylquecksilberchlorid |
204-064-2 |
Carc. 2 Repr. 1A Lact. Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360Df H362 H330 H310 H300 H372 (Nervensystem, Nieren) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H351 H360Df H362 H330 H310 H300 H372 (Nervensystem, Nieren) H410 |
|
Einatmen: ATE = 0,05 mg/L (Stäube oder Nebel) Dermal: ATE = 50 mg/kg KG Oral: ATE = 5 mg/kg KG |
1 |
|
|
081-001-00-3 |
Thallium |
231-138-1 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 4 |
H330 H300 H373 ** H413 |
GHS06 GHS08 Dgr |
H330 H300 H373 ** H413 |
|
|
|
|
|
081-002-00-9 |
Thalliumverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H330 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H373 ** H411 |
|
|
A |
|
081-003-00-4 |
Dithalliumsulfat; Thallium(I)-sulfat |
231-201-3 |
Acute Tox. 2 * STOT RE 1 Skin Irrit. 2 Aquatic Chronic 2 |
H300 H372 ** H315 H411 |
GHS06 GHS08 GHS09 Dgr |
H300 H372 ** H315 H411 |
|
|
|
|
|
082-001-00-6 |
Bleiverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
|
Repr.2 H361f: C ≥ 2,5 % * STOT RE 2; H373: C ≥0,5 % |
A1 |
|
082-002-00-1 |
Bleialkyle |
— |
— |
Repr. 1A Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360Df H330 H310 H300 H373 ** H410 |
|
Repr.1A; H360D: C≥ 0,1 % * STOT RE 2; H373: C ≥0,05 % |
A1 |
|
082-003-00-7 |
Bleidiazid; Bleiazid |
236-542-1 |
Unst. Expl. Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H200 H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
|
082-003-01-4 |
Bleidiazid; Bleiazid [≥ 20 % Phlegmatisierungsmittel] |
236-542-1 |
Expl. 1.1 Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H201 H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
|
082-004-00-2 |
Bleichromat |
231-846-0 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373** H410 |
|
|
1 |
|
|
082-005-00-8 |
Blei(II)-acetat |
206-104-4 |
Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
|
|
1 |
|
|
082-006-00-3 |
Triblei-bis(orthophosphat) |
231-205-5 |
Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
|
|
1 |
|
|
082-007-00-9 |
Bleiacetat, basisch |
215-630-3 |
Carc. 2 Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H351 H360Df H373 ** H410 |
|
|
1 |
|
|
082-008-00-4 |
Blei(II)bis(methansulfonat) |
401-750-5 |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H360Df H332 H302 H373 ** H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H360Df H332 H302 H373 ** H315 H318 |
|
|
1 |
|
|
082-009-00-X |
Bleisulfochromatgelb; C.I. Pigment Gelb34; [Dieser Stoff ist im Colour Index unter der Constitution Number C.I. 77603 verzeichnet.] |
215-693-7 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373** H410 |
|
|
1 |
|
|
082-010-00-5 |
Bleichromatmolybdatsulfaterot; C.I. Pigment Rot 104; [Dieser Stoff ist im Colour Index unter der Constitution Number C.I. 77605 verzeichnet.] |
235-759-9 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373** H410 |
|
|
1 |
|
|
082-011-00-0 |
Bleihydrogenarsenat |
232-064-2 |
Carc. 1A Repr. 1A Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H360Df H331 H301 H373 ** H410 |
|
|
1 |
|
|
082-012-00-6 |
Barium-Calcium-Caesium-Blei-Samarium-Strontium-Bromid-Chlorid-Fluorid-Iodid, europiumdotiert |
431-780-4 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373** H411 |
|
|
|
|
|
082-013-00-1 |
Bleipulver; [Partikeldurchmesser < 1 mm] |
231-100-4 |
Repr. 1A Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H362 H400 H410 |
GHS08 GHS09 Dgr |
H360FD H362 H410 |
|
Repr. 1A; H360D: C ≥ 0,03 % M = 10 M = 100 |
|
|
|
082-014-00-7 |
Blei, massiv: [Partikeldurchmesser ≥ 1 mm] |
231-100-4 |
Repr. 1A Lact. Aquatic Chronic 1 |
H360FD H362 H410 |
GHS08 GHS09 Dgr |
H360FD H362 H410 |
|
M = 10 |
|
|
|
092-001-00-8 |
Uran |
231-170-6 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 4 |
H330 H300 H373 ** H413 |
GHS06 GHS08 Dgr |
H330 H300 H373 ** H413 |
|
|
|
|
|
092-002-00-3 |
Uranverbindungen, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 Aquatic Chronic 2 |
H330 H300 H373** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H373** H411 |
|
|
A |
|
601-001-00-4 |
Methan |
200-812-7 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-002-00-X |
Ethan |
200-814-8 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-003-00-5 |
Propan |
200-827-9 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-004-00-0 |
Butan [1]; und Isobutan 2-Methylpropan [2] |
203-448-7 [1] 200-857-2 [2] |
106-97-8 [1] 75-28-5 [2] |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
C U |
|
601-004-01-8 |
Butan (mit ≥ 0,1 % Butadien (203-450-8)) [1]; Isobutan (mit ≥ 0,1 % Butadien (203-450-8)) [2] |
203-448-7 [1] 200-857-2 [2] |
106-97-8 [1] 75-28-5 [2] |
Flam. Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
|
|
C S U |
|
601-005-00-6 |
2,2-Dimethylpropan; Neopentan |
207-343-7 |
Flam. Gas 1 Press. Gas Aquatic Chronic 2 |
H220 H411 |
GHS02 GHS04 GHS09 Dgr |
H220 H411 |
|
|
U |
|
|
601-006-00-1 |
Pentan |
203-692-4 |
Flam. Liq. 2 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H336 H411 |
EUH066 |
|
C |
|
|
601-007-00-7 |
Hexan (mit < 5 % n-Hexan (203-777-6)); 2-Methylpentan [1]; 3-Methylpentan [2]; 2,2-Dimethylbutan [3]; 2,3-Dimethylbutan [4] |
203-523-4 [1] 202-481-4 [2] 200-906-8 [3] 201-193-6 [4] |
107-83-5 [1] 96-14-0 [2] 75-83-2 [3] 79-29-8 [4] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
C |
|
601-008-00-2 |
Heptan; n-Heptan [1]; 2,4-Dimethylpentan [2]; 2,2,3-Trimethylbutan [3]; 3,3-Dimethylpentan [4]; 2,3-Dimethylpentan [5]; 3-Methylhexan [6]; 2,2-Dimethylpentan [7]; 2-Methylhexan [8]; 3-Ethylpentan [9]; Isoheptan [10] |
205-563-8 [1] 203-548-0 [2] 207-346-3 [3] 209-230-8 [4] 209-280-0 [5] 209-643-3 [6] 209-680-5 [7] 209-730-6 [8] 210-529-0 [9] 250-610-8 [10] |
142-82-5 [1] 108-08-7 [2] 464-06-2 [3] 562-49-2 [4] 565-59-3 [5] 589-34-4 [6] 590-35-2 [7] 591-76-4 [8] 617-78-7 [9] 31394-54-4 [10] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
C |
|
601-009-00-8 |
Octan; n-Octan [1]; 2,2,4-Trimethylpentan [2]; 2,3,3-Trimethylpentan [3]; 3,3-Dimethylhexan [4]; 2,2,3-Trimethylpentan [5]; 2,3,4-Trimethylpentan [6]; 3,4-Dimethylhexan [7]; 2,3-Dimethylhexan [8]; 2,4-Dimethylhexan [9]; 4-Methylheptan [10]; 3-Methylheptan [11]; 2,2-Dimethylhexan [12]; 2,5-Dimethylhexan [13]; 2-Methylheptan [14]; 2,2,3,3-Tetramethylbutan [15]; 3-Ethyl-2-methylpentan [16]; 3-Ethylhexan [17]; 3-Ethyl-3-methylpentan [18]; Isooctan [19] |
203-892-1 [1] 208-759-1 [2] 209-207-2 [3] 209-243-9 [4] 209-266-4 [5] 209-292-6 [6] 209-504-7 [7] 209-547-1 [8] 209-649-6 [9] 209-650-1 [10] 209-660-6 [11] 209-689-4 [12] 209-745-8 [13] 209-747-9 [14] 209-855-6 [15] 210-187-2 [16] 210-621-0 [17] 213-923-0 [18] 247-861-0 [19] |
111-65-9 [1] 540-84-1 [2] 560-21-4 [3] 563-16-6 [4] 564-02-3 [5] 565-75-3 [6] 583-48-2 [7] 584-94-1 [8] 589-43-5 [9] 589-53-7 [10] 589-81-1 [11] 590-73-8 [12] 592-13-2 [13] 592-27-8 [14] 594-82-1 [15] 609-26-7 [16] 619-99-8 [17] 1067-08-9 [18] 26635-64-3 [19] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
C |
|
601-010-00-3 |
Ethen; Ethylen |
00-815-3 |
lam. Gas 1 Press. Gas STOT SE 3 |
220 H336 |
HS02 GHS04 GHS07 Dgr |
H220 H336 |
|
|
U |
|
|
601-011-00-9 |
Propen; Propylen |
204-062-1 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-012-00-4 |
But-1-en [1]; Buten, Gemisch von 1- und 2-Isomeren [2]; 2-Methylpropen; Isobuten [3] (Z)-But-2-en [4]; (E)-But-2-en [5] |
203-449-2 [1] 203-452-9 [2] 204-066-3 [3] 209-673-7 [4] 210-855-3 [5] |
106-98-9 [1] 107-01-7 [2] 115-11-7 [3] 590-18-1 [4] 624-64-6 [5] |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
C U |
|
601-013-00-X |
1,3-Butadien; Buta-1,3-dien |
203-450-8 |
Flam. Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
|
|
D U |
|
|
601-014-00-5 |
Isopren (stabilisiert) 2-Methyl-1,3-butadien |
201-143-3 |
Flam. Liq. 1 Carc. 1B Muta. 2 Aquatic Chronic 3 |
H224 H350 H341 H412 |
GHS02 GHS08 Dgr |
H224 H350 H341 H412 |
|
|
D |
|
|
601-015-00-0 |
acetylene; ethyne |
200-816-9 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 ►C8 Gef. ◄ |
H220 |
►M4 — ◄ |
|
U |
|
|
601-016-00-6 |
Cyclopropan |
200-847-8 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-017-00-1 |
Cyclohexan |
203-806-2 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
|
|
|
601-018-00-7 |
Methylcyclohexan |
203-624-3 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
|
|
|
601-019-00-2 |
1,4-Dimethylcyclohexan |
209-663-2 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
|
|
|
601-020-00-8 |
Benzol |
200-753-7 |
Flam. Liq. 2 Carc. 1A Muta. 1B STOT RE 1 Asp. Tox. 1 Eye Irrit. 2 Skin Irrit. 2 |
H225 H350 H340 H372 ** H304 H319 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H340 H372 ** H304 H319 H315 |
|
|
E |
|
|
601-021-00-3 |
Toluol |
203-625-9 |
Flam. Liq. 2 Repr. 2 Asp. Tox. 1 STOT RE 2 * Skin Irrit. 2 STOT SE 3 |
H225 H361d *** H304 H373 ** H315 H336 |
GHS02 GHS08 GHS07 Dgr |
H225 H361d *** H304 H373 ** H315 H336 |
|
|
|
|
|
601-022-00-9 |
o-Xylol [1]; p-Xylol[2]; m-Xylol [3]; Xylol [4] |
202-422-2 [1] 203-396-5 [2] 203-576-3 [3] 215-535-7 [4] |
95-47-6 [1] 106-42-3 [2] 108-38-3 [3] 1330-20-7 [4] |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H312 H315 |
GHS02 GHS07 Wng |
H226 H332 H312 H315 |
|
* |
C |
|
601-023-00-4 |
Ethylbenzol |
202-849-4 |
Flam. Liq. 2 Acute Tox. 4* STOT RE 2 Asp. Tox. 1 |
H225 H332 H373 (Hörorgane) H304 |
GHS02 GHS07 GHS08 Dgr |
H225 H332 H373 (Hörorgane) H304 |
|
|
|
|
|
601-024-00-X |
Cumol |
202-704-5 |
Flam. Liq. 3 Carc. 1B Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H226 H350 H304 H335 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H304 H335 H411 |
|
|
|
|
|
601-025-00-5 |
Mesitylen; 1,3,5-Trimethylbenzol |
203-604-4 |
Flam. Liq. 3 STOT SE 3 Aquatic Chronic 2 |
H226 H335 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H335 H411 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
|
601-026-00-0 |
Styrol |
202-851-5 |
Flam. Liq. 3 Repr. 2 Acute Tox. 4* STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 |
H226 H361d H332 H372 (Hörorgane) H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H226 H361d H332 H372 (Hörorgane) H315 H319 |
|
* |
D |
|
|
601-027-00-6 |
2-Phenylpropen; α-Methylstyrol; Isopropenylbenzol |
202-705-0 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H226 H319 H335 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H319 H335 H411 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
|
601-028-00-1 |
2-Methylstyrol; 2-Vinyltoluol |
210-256-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
|
601-029-00-7 |
Dipenten; Limonen [1] (S)-p-Mentha-1,8-dien; l-Limonen [2] trans-1-Methyl-4-(1-methylvinyl)cyclohexen; [3] (±)-1-Methyl-4-(1-methylvinyl)-cyclohexen [4] |
205-341-0 [1] 227-815-6 [2] 229-977-3 [3] 231-732-0 [4] |
138-86-3 [1] 5989-54-8 [2] 6876-12-6 [3] 7705-14-8 [4] |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H315 H317 H400 H410 |
GHS02 GHS07 GHS09 Wng |
H226 H315 H317 H410 |
|
|
C |
|
601-030-00-2 |
Cyclopentan |
206-016-6 |
Flam. Liq. 2 Aquatic Chronic 3 |
H225 H412 |
GHS02 Dgr |
H225 H412 |
|
|
|
|
|
601-031-00-8 |
2,4,4-Trimethylpent-1-en |
203-486-4 |
Flam. Liq. 2 Aquatic Chronic 2 |
H225 H411 |
GHS02 GHS09 Dgr |
H225 H411 |
|
|
|
|
|
601-032-00-3 |
Benzo[a]pyren; Benzo[def]chrysen |
200-028-5 |
Carc. 1B Muta. 1B Repr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H360FD H317 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
|
601-033-00-9 |
Benzo[a]anthracen |
200-280-6 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
M=100 |
|
|
|
601-034-00-4 |
Benzo[e]acephenanthrylen; Benzo[b]fluoranthen |
205-911-9 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
601-035-00-X |
Benzo[j]fluoranthen |
205-910-3 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
601-036-00-5 |
Benzo[k]fluoranthen |
205-916-6 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
601-037-00-0 |
n-Hexan |
203-777-6 |
Flam. Liq. 2 Repr. 2 Asp. Tox. 1 STOT RE 2 * Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H361f *** H304 H373 ** H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H361f *** H304 H373 ** H315 H336 H411 |
|
STOT RE 2; H373: C ≥ 5 % |
|
|
|
601-041-00-2 |
Dibenzo[a,h]anthracen |
200-181-8 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % M=100 |
|
|
|
601-042-00-8 |
Biphenyl; Diphenyl |
202-163-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
|
|
|
|
601-043-00-3 |
1,2,4-Trimethylbenzol |
202-436-9 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H332 H319 H335 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H319 H335 H315 H411 |
|
|
|
|
|
601-044-00-9 |
3a,4,7,7a-Tetrahydro-4,7-methanoinden; Dicyclopentadien |
201-052-9 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H225 H332 H302 H319 H335 H315 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H302 H319 H335 H315 H411 |
|
|
|
|
|
601-045-00-4 |
1,2,3,4-Tetrahydronaphthalin; Tetralin |
204-340-2 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
EUH019 |
|
|
|
|
601-046-00-X |
7-Methylocta-1,6-dien |
404-210-7 |
Flam. Liq. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H400 H410 |
GHS02 GHS09 Wng |
H226 H410 |
|
|
|
|
|
601-047-00-5 |
m-Mentha-1,3(8)-dien |
404-150-1 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
601-048-00-0 |
Chrysen |
205-923-4 |
Carc. 1B Muta. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H400 H410 |
GHS08 GHS09 Dgr |
H350 H341 H410 |
|
|
|
|
|
601-049-00-6 |
Benzo[e]pyren |
205-892-7 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
601-051-00-7 |
4-Phenylbut-1-en |
405-980-7 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
601-052-00-2 |
Naphthalin |
202-049-5 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
|
601-053-00-8 |
Nonylphenol [1]; 4-Nonylphenol, verzweigt [2] |
246-672-0 [1] 284-325-5 [2] |
25154-52-3 [1] 84852-15-3 [2] |
Repr. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H361fd H302 H314 H410 |
|
|
|
|
601-054-00-3 |
Reaktionsmasse aus Isomeren von Dibenzylbenzol; Dibenzyl(methyl)-benzol; Dibenzyl(dimethyl)-benzol; Dibenzyl(trimethyl)-benzol |
405-570-8 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
601-055-00-9 |
Reaktionsmasse aus Isomeren von Mono-(2-tetradecyl)-naphthalinen, Di-(2-tetradecyl)-naphthalinen und Tri-(2-tetradecyl)-naphthalinen |
410-190-0 |
Eye Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
|
|
|
|
|
601-056-00-4 |
Reaktionsmasse aus Isomeren von Methyldiphenylmethan und Dimethyldiphenylmethan |
405-470-4 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
601-057-00-X |
N-Dodecyl-[3-(4-(dimethylamino)-benzamido)-propyl]-dimethylammoniumtosylat |
421-130-8 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
|
601-058-00-5 |
Di-L-p-menthen Pinolen |
417-870-6 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
|
601-059-00-0 |
Methyl-2-benzyliden-3-oxobutyrat |
420-940-9 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
|
601-060-00-6 |
1,2-Bis[4-fluor-6-{4-sulfo-5-(2-(4-sulfonaphthalin-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalin-7-ylazo)phenylamino}-1,3,5-triazin-2ylamino]-ethane; x-Natrium-, y-Kaliumsalz x = 7,755 y = 0,245 |
417-610-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
601-061-00-1 |
(Ethyl-1,2-ethandiyl)[-2-[[[(2-hydroxyethyl)-methylamino]-acetyl]-propyl]ω-(nonylphenoxy)-poly]-oxy-(methyl-1,2-ethandiyl) |
418-960-8 |
— |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
601-062-00-7 |
Reaktionsmasse aus verzweigtem Triacontan, verzweigtem Dotriacontan, verzweigtem Tetratriacontan und verzweigtem Hexatriacontan |
417-030-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
601-063-00-2 |
Reaktionsmasse aus Isomeren von verzweigtem Tetracosan |
417-060-2 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
|
▼M23 ————— |
||||||||||
|
601-065-00-3 |
Reaktionsmasse aus (1'α,3'α,6'α)-2,2,3',7',7'-Pentamethylspiro(1,3-dioxan-5,2'-norcaran) und (1'α,3'β, 6'α)-2,2,3',7',7'-Penta methylspiro(1,3-dioxan-5,2'-norcaran) |
416-930-9 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
601-066-00-9 |
1-(4-(trans-4-Heptylcyclohexyl)-phenyl)-ethanon |
426-820-2 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
601-067-00-4 |
Triethylarsenat |
427-700-2 |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
|
|
|
601-068-00-X |
1,2-Diacetoxybut-3-en |
421-720-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
601-069-00-5 |
2-Ethyl-1-(2-(1,3-dioxanyl)-ethyl)-pyridinium bromid |
422-680-1 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
601-070-00-0 |
Reaktionsmasse aus verzweigtem Icosan, verzweigtem Docosan und verzweigtem Tetracosan |
417-050-8 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
|
601-071-00-6 |
1-Dimethoxymethyl-2-nitrobenzol |
423-830-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
601-072-00-1 |
Reaktionsmasse aus 1-(4-isopropylphenyl)-1-phenylethan, 1-(3-Isopropylphenyl)-1-phenylethan und 1-(2-Isopropylphenyl)-1-phenylethan |
430-690-2 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
601-073-00-7 |
1-Brom-3,5-difluorbenzol |
416-710-2 |
Flam. Liq. 3 Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H373 ** H315 H317 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Wng |
H226 H302 H373 ** H315 H317 H410 |
|
|
|
|
|
601-074-00-2 |
Reaktionsmasse aus 4-(2,2,3-Trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]-octan, 1-(2,2,3-Trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octan, Spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]-cyclopenta[b]-furan] und Spiro[cyclohex-3-en-1-yl-[4,5,6,6a-tetrahydro-4,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]-cyclopenta[b]]-furan] |
422-040-1 |
— |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
601-075-00-8 |
4,4'-Bis(N-carbamoyl-4-methylbenzolsulfonamid)-diphenylmethan |
418-770-5 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
601-076-00-3 |
Ethinylcyclopropan |
425-430-1 |
Flam. Liq. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H225 H315 H318 H412 |
GHS02 GHS05 Dgr |
H225 H315 H318 H412 |
|
|
|
|
|
601-077-00-9 |
Reaktionsmasse aus 1-Heptyl-4- ethyl-2,6,7-trioxabicyclo[2.2.2]-octan und 1-Nonyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]-octan |
426-510-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
601-078-00-4 |
Reaktionsmasse aus 1,7-dimethyl-2-[(3-methylbicyclo[2.2.1]-hept-2-yl)methyl]-bicyclo[2.2.1]-heptan und 2,3-Dimethyl-2-[(3-methylbicyclo[2.2.1]-hept-2-yl)-methyl]-bicyclo[2.2.1]-heptan |
427-040-5 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
601-079-00-X |
Reaktionsmasse aus trans-trans- Cyclohexadeca-1,9-dien und cis-trans-Cyclohexadeca-1,9-dien |
429-620-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
601-080-00-5 |
Reaktionsmasse aus sec-Butylphenyl(phenyl)-methan, Isomerengemisch, 1-(sec-Butylphenyl(phenyl)-2-phenylethan, Isomerengemisch und 1-(sec-Butylphenyl)-1-phenylethan, Isomerengemisch |
431-100-6 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
601-081-00-0 |
Cyclohexadeca-1,9-dien |
431-730-1 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
|
601-082-00-6 |
Reaktionsmasse aus endo-2-Methyl-exo-3-methyl-exo-2-[(exo-3-methylbicyclo[2.2.1]-hept-exo-2-yl)-methyl]-bicyclo[2.2.1]heptan und exo-2-Methyl-exo-3-methyl-endo-2-[(endo-3-methylbicyclo[2.2.1]-hept-exo-2-yl)-methyl]-bicyclo[2.2.1]-heptan |
434-420-4 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
601-083-00-1 |
5-endo-Hexylbicyclo[2.2.1]-hept-2-en |
435-000-3 |
Asp. Tox. 1 Skin Irrit. 2 Aquatic Chronic 4 |
H304 H315 H413 |
GHS08 GHS07 Dgr |
H304 H315 H413 |
|
|
|
|
|
601-084-00-7 |
Reaktionsmasse aus5-endo-Butylbicyclo[2.2.1]-hept-2-en und 5-exo-Butylbicyclo[2.2.1]-hept-2-en (80:20) |
435-180-3 |
— |
Asp. Tox. 1 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H304 H315 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H304 H315 H410 |
|
|
|
|
601-085-00-2 |
Isopentan; 2-Methylbutan |
201-142-8 |
Flam. Liq. 1 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H224 H304 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H224 H304 H336 H411 |
EUH066 |
|
|
|
|
601-087-00-3 |
2,4,4-Trimethylpenten |
246-690-9 |
Flam. Liq. 2 Asp. Tox. 1 STOT SE 3 |
H225 H304 H336 |
GHS02 GHS07 GHS08 Dgr |
H225 H304 H336 |
|
|
D |
|
|
601-088-00-9 |
4-Vinylcyclohexen |
202-848-9 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
601-089-00-4 |
Muscalur; cis-9-Tricosen |
248-505-7 |
Skin Sens. 1B |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
601-090-00-X |
Benzo[rst]pentaphen |
205-877-5 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
|
|
|
|
601-091-00-5 |
Dibenzo[b,def]chrysen; Dibenzo[a,h]pyren |
205-878-0 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
|
|
|
|
601-092-00-0 |
Dibenzo[def,p]chrysen; Dibenzo[a,l]pyren |
205-886-4 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
Carc. 1B; H350: C ≥ 0,001 % |
|
|
|
601-093-00-6 |
1,4-Dimethylnaphthalin |
209-335-9 |
Acute Tox. 4 Asp. Tox. 1 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 3 |
H302 H304 H319 H400 H412 |
GHS07 GHS08 GHS09 Dgr |
H302 H304 H319 H410 |
|
oral: ATE = 1 300 mg/kg KG M = 1 |
|
|
|
601-094-00-1 |
1-Isopropyl-4-methylbenzol; p-Cymol |
202-796-7 |
Flam. Liq. 3 Acute Tox. 3 Asp. Tox. 1 Aquatic Chronic 2 |
H226 H331 H304 H411 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H331 H304 H411 |
|
Einatmen: ATE = 3 mg/L (Dämpfe) |
|
|
|
601-095-00-7 |
p-Mentha-1,3-dien; 1-Isopropyl-4-methyl-1,3-cyclohexadien; α-Terpinen |
202-795-1 |
Flam. Liq. 3 Acute Tox. 4 Skin Sens. 1 Asp. Tox. 1 Aquatic Chronic 2 |
H226 H302 H317 H304 H411 |
GHS02 GHS07 GHS08 GHS09 Dgr |
H226 H302 H317 H304 H411 |
|
oral: ATE = 1 680 mg/kg KG |
|
|
|
601-096-00-2 |
(R)-p-Mentha-1,8-dien; d-Limonen |
227-813-5 |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1B Asp. Tox. 1 Aquatic Acute 1 Aquatic Chronic 3 |
H226 H315 H317 H304 H400 H412 |
GHS02 GHS07 GHS08 GHS09 Dgr |
H226 H315 H317 H304 H410 |
|
M = 1 |
|
|
|
601-097-00-8 |
Propylbenzol |
203-132-9 |
Flam. Liq. 3 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H226 H304 H335 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H304 H335 H411 |
|
|
|
|
|
602-001-00-7 |
Chlormethan; Methylchlorid |
200-817-4 |
Flam. Gas 1 Press. Gas Carc. 2 STOT RE 2 * |
H220 H351 H373 ** |
GHS02 GHS04 GHS08 Dgr |
H220 H351 H373 ** |
|
|
U |
|
|
602-002-00-2 |
Brommethan; Methylbromid |
200-813-2 |
Press. Gas Muta. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Ozone 1 |
H341 H331 H301 H373** H319 H335 H315 H400 H420 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H341 H331 H301 H373 ** H319 H335 H315 H400 H420 |
|
|
U |
|
|
602-003-00-8 |
Dibrommethan; Methylenbromid |
200-824-2 |
Acute Tox. 4 * Aquatic Chronic 3 |
H332 H412 |
GHS07 Wng |
H332 H412 |
|
* |
|
|
|
602-004-00-3 |
Dichlormethan; Methylenchlorid |
200-838-9 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
602-005-00-9 |
Methyliodid; Iodmethan |
200-819-5 |
Carc. 2 Acute Tox. 4 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 |
H351 H312 H331 H301 H335 H315 |
GHS06 GHS08 Dgr |
H351 H312 H331 H301 H335 H315 |
|
|
|
|
|
602-006-00-4 |
Chloroform; Trichlormethan |
200-663-8 |
Carc. 2 Repr. 2 Acute Tox. 3 Acute Tox. 4 STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 |
H351 H361d H331 H302 H372 H319 H315 |
GHS06 GHS08 Dgr |
H351 H361d H331 H302 H372 H319 H315 |
|
|
|
|
|
602-007-00-X |
Bromoform; Tribrommethan |
200-854-6 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H331 H302 H319 H315 H411 |
GHS06 GHS09 Dgr |
H331 H302 H319 H315 H411 |
|
|
|
|
|
602-008-00-5 |
Kohlenstofftetrachlorid; Tetrachlormethan; Tetrachlorkohlenstoff |
200-262-8 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Chronic 3 Ozone 1 |
H351 H331 H311 H301 H372** H412 H420 |
GHS06 GHS08 Dgr |
H351 H331 H311 H301 H372 ** H412 H420 |
|
* STOT RE 1; H372:C≥1 % STOT RE 2; H373:0,2 % ≤C < 1 % |
|
|
|
602-009-00-0 |
Chlorethan; Ethylchlorid |
200-830-5 |
Flam. Gas 1 Press. Gas Carc. 2 Aquatic Chronic 3 |
H220 H351 H412 |
GHS02 GHS04 GHS08 Dgr |
H220 H351 H412 |
|
|
U |
|
|
602-010-00-6 |
1,2-Dibromethan; Ethylendibromid |
203-444-5 |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H350 H331 H311 H301 H319 H335 H315 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H319 H335 H315 H411 |
|
* |
|
|
|
602-011-00-1 |
1,1-Dichlorethan; Ethylidendichlorid |
200-863-5 |
Flam. Liq. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H225 H302 H319 H335 H412 |
GHS02 GHS07 Dgr |
H225 H302 H319 H335 H412 |
|
* |
|
|
|
602-012-00-7 |
1,2-Dichlorethan; Ethylendichlorid |
203-458-1 |
Flam. Liq. 2 Carc. 1B Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H350 H302 H319 H335 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H302 H319 H335 H315 |
|
|
|
|
|
602-013-00-2 |
1,1,1-Trichlorethan; Methylchloroform |
200-756-3 |
Acute Tox. 4 * Ozone 1 |
H332 H420 |
GHS07 Wng |
H332 H420 |
|
|
F |
|
|
602-014-00-8 |
1,1,2-Trichlorethan |
201-166-9 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H351 H332 H312 H302 |
GHS08 GHS07 Wng |
H351 H332 H312 H302 |
EUH066 |
* |
|
|
|
602-015-00-3 |
1,1,2,2-Tetrachlorethan; Acetylentetrachlorid |
201-197-8 |
Acute Tox. 2 * Acute Tox. 1 Aquatic Chronic 2 |
H330 H310 H411 |
GHS06 GHS09 Dgr |
H330 H310 H411 |
|
|
|
|
|
602-016-00-9 |
1,1,2,2-Tetrabromethan; Acetylentetrabromid |
201-191-5 |
Acute Tox. 2 * Eye Irrit. 2 Aquatic Chronic 3 |
H330 H319 H412 |
GHS06 Dgr |
H330 H319 H412 |
|
|
|
|
|
602-017-00-4 |
Pentachlorethan |
200-925-1 |
Carc. 2 STOT RE 1 Aquatic Chronic 2 |
H351 H372 ** H411 |
GHS08 GHS09 Dgr |
H351 H372 ** H411 |
|
STOT RE 1; H372: C≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
|
|
602-018-00-X |
1-Chlorpropan [1]; 2-Chlorpropan [2] |
208-749-7 [1] 200-858-8 [2] |
540-54-5 [1] 75-29-6 [2] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
C |
|
602-019-00-5 |
1-Brompropan; n-Propylbromid |
203-445-0 |
Flam. Liq. 2 Repr. 1B STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 STOT SE 3 |
H225 H360FD H373 ** H319 H335 H315 H336 |
GHS02 GHS08 GHS07 Dgr |
H225 H360FD H373 ** H319 H335 H315 H336 |
|
|
|
|
|
602-020-00-0 |
1,2-Dichlorpropan; Propylendichlorid |
201-152-2 |
Flam. Liq. 2 Carc. 1B Acute Tox. 4* Acute Tox. 4* |
H225 H350 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H302 |
|
|
|
|
|
602-021-00-6 |
1,2-Dibrom-3-chlorpropan |
202-479-3 |
Carc. 1B Muta. 1B Repr. 1A Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H350 H340 H360F *** H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H350 H340 H360F *** H301 H373 ** H412 |
|
|
|
|
|
602-022-00-1 |
1-Chlorpentan; Amylchlorid-1 [1]; 2-Chlorpentan; Amylchlorid-2 [2]; 3-Chlorpentan; Amylchlorid-3 [3] |
208-846-4 [1] 210-885-7 [2] 210-467-4 [3] |
543-59-9 [1] 625-29-6 [2] 616-20-6 [3] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
C |
|
602-023-00-7 |
Vinylchlorid; Chlorethen |
200-831-0 |
Press. Gas Flam. Gas 1 Carc. 1A |
H220 H350 |
GHS02 GHS08 Dgr |
H220 H350 |
|
|
D U |
|
|
602-024-00-2 |
Bromethen; Vinylbromid |
209-800-6 |
Press. Gas Flam. Gas 1 Carc. 1B |
H220 H350 |
GHS02 GHS08 Dgr |
H220 H350 |
|
|
U |
|
|
602-025-00-8 |
1,1-Dichlorethen; Vinylidenchlorid |
200-864-0 |
Flam. Liq. 1 Carc. 2 Acute Tox. 4 * |
H224 H351 H332 |
GHS02 GHS08 GHS07 Dgr |
H224 H351 H332 |
|
* |
D |
|
|
602-026-00-3 |
1,2-Dichlorethen [1]; cis-Dichlorethen [2]; trans-Dichlorethen [3] |
208-750-2 [1] 205-859-7 [2] 205-860-2 [3] |
540-59-0 [1] 156-59-2 [2] 156-60-5 [3] |
Flam. Liq. 2 Acute Tox. 4 * Aquatic Chronic 3 |
H225 H332 H412 |
GHS02 GHS07 Dgr |
H225 H332 H412 |
|
* |
C |
|
602-027-00-9 |
Trichlorethylen; Trichlorethen |
201-167-4 |
Carc. 1B Muta. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H350 H341 H319 H315 H336 H412 |
GHS08 GHS07 Dgr |
H350 H341 H319 H315 H336 H412 |
|
|
|
|
|
602-028-00-4 |
Tetrachlorethen; Perchlorethylen |
204-825-9 |
Carc. 2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
|
|
|
|
|
602-029-00-X |
3-Chlorpropen; Allylchlorid |
203-457-6 |
Flam. Liq. 2 Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H225 H351 H341 H332 H312 H302 H373 ** H319 H335 H315 H400 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H351 H341 H332 H312 H302 H373 ** H319 H335 H315 H400 |
|
|
D |
|
|
602-030-00-5 |
1,3-Dichlorpropen [1]; (Z)-1,3-Dichlorpropen [2] |
208-826-5 [1] 233-195-8 [2] |
542-75-6 [1] 10061-01-5 [2] |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Asp. Tox. 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H311 H301 H332 H304 H319 H335 H315 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H311 H301 H332 H304 H319 H335 H315 H317 H410 |
|
|
C D |
|
602-031-00-0 |
1,1-Dichlorpropen |
209-253-3 |
Flam. Liq. 2 Acute Tox. 3 * Aquatic Chronic 3 |
H225 H301 H412 |
GHS02 GHS06 Dgr |
H225 H301 H412 |
|
|
|
|
|
602-032-00-6 |
3-Chlor-2-methylpropen; Methallylchlorid; 2-Methylallylchlorid |
209-251-2 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H225 H332 H302 H314 H317 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H302 H314 H317 H411 |
|
|
|
|
|
602-033-00-1 |
Chlorbenzol |
203-628-5 |
Flam. Liq. 3 Acute Tox. 4 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H332 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H315 H411 |
|
|
|
|
|
602-034-00-7 |
1,2-Dichlorbenzol; o-Dichlorbenzol |
202-425-9 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
* |
|
|
|
602-035-00-2 |
1,4-Dichlorbenzol; p-Dichlorbenzol |
203-400-5 |
Carc. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H400 H410 |
GHS08 GHS09 Wng |
H351 H319 H410 |
|
|
|
|
|
602-036-00-8 |
Chloropren (stabilisiert); 2-Chlorbuta-1,3-dien (stabilisiert) |
204-818-0 |
Flam. Liq. 2 Carc. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H350 H332 H302 H373 ** H319 H335 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H302 H373 ** H319 H335 H315 |
|
|
D |
|
|
602-037-00-3 |
α-Chlortoluol; Benzylchlorid |
202-853-6 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H350 H331 H302 H373 ** H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H350 H331 H302 H373 ** H335 H315 H318 |
|
|
|
|
|
602-038-00-9 |
α, α,α-Trichlortoluol; Benzotrichlorid; Trichlormethylbenzol |
202-634-5 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H350 H331 H302 H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H350 H331 H302 H335 H315 H318 |
|
|
|
|
|
602-039-00-4 |
Polychlorierte Biphenyle; PCB |
215-648-1 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
STOT RE 2; H373: C ≥ 0,005 % |
C |
|
|
602-040-00-X |
2-Chlortoluol; o-Chlortoluol [1]; 3-Chlortoluol; m-Chlortoluol [2]; 4-Chlortoluol; p-Chlortoluol [3]; Chlortoluol [4] |
202-424-3 [1] 203-580-5 [2] 203-397-0 [3] 246-698-2 [4] |
95-49-8 [1] 108-41-8 [2] 106-43-4 [3] 25168-05-2 [4] |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
C |
|
602-041-00-5 |
Penthachlornaphthalin |
215-320-8 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H410 |
|
|
C |
|
|
602-042-00-0 |
1,2,3,4,5,6-Hexachlorcyclo-hexane, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H312 H410 |
|
|
A C |
|
602-043-00-6 |
Lindan (ISO); γ-HCH oder γ-BHC; γ-1,2,3,4,5,6-Hexachlorcyclohexan |
200-401-2 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H373 ** H362 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H332 H312 H373 ** H362 H410 |
|
M=10 |
|
|
|
602-044-00-1 |
Camphechlor (ISO); Toxaphen; Chloriertes Camphen |
232-283-3 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H312 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H312 H335 H315 H410 |
|
|
|
|
|
602-045-00-7 |
DDT (ISO); Clofenotan (INN); Dicophan; 1,1,1-Trichlor-2,2-bis(4-chlorphenyl)-ethan; Dichlorodiphenyltrichlorethan |
200-024-3 |
Carc. 2 Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H372 ** H410 |
|
|
|
|
|
602-046-00-2 |
Heptachlor (ISO); 1,4,5,6,7,8,8-Heptachlor-3a,4,7,7a-tetrahydro-4,7-methanoinden |
200-962-3 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H373 ** H410 |
|
|
|
|
|
602-047-00-8 |
Chlordan (ISO); 1,2,4,5,6,7,8,8-Octachlor-3a,4,7,7a-tetrahydro-4,7-methanoindan |
200-349-0 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H312 H302 H410 |
|
|
|
|
|
602-048-00-3 |
Aldrin (ISO) |
206-215-8 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H372 ** H410 |
|
|
|
|
|
602-049-00-9 |
Dieldrin (ISO) |
200-484-5 |
Carc. 2 Acute Tox. 1 Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H310 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H310 H301 H372 ** H410 |
|
|
|
|
|
602-050-00-4 |
Isodrin; (1α,4α,4aβ,5β,8β,8aβ)-1,2,3,4,10,10-Hexachlor-1,4,4a,5,8,8a-hexahydro-1,4:5,8- dimethannaphthalin |
207-366-2 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
M=100 |
|
|
|
602-051-00-X |
Endrin (ISO); 1,2,3,4,10,10-Hexachlor-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalin |
200-775-7 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
|
602-052-00-5 |
Endosulfan (ISO); 1,2,3,4,7,7-Hexachlor-8,9,10-trinorborn-2-en-5,6-ylendimethylensulfit; 1,4,5,6,7,7-Hexachlor-8,9,10-trinorborn-5-en-2,3-ylendimethylensulfit |
204-079-4 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H312 H410 |
|
|
|
|
|
602-053-00-0 |
Isobenzan (ISO); 1,3,4,5,6,7,8,8-Octachlor-1,3,3a,4,7,7a-hexahydro-4,7-methanoisobenzofuran |
206-045-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
|
602-054-00-6 |
3-Iodpropen; Allyliodid |
209-130-4 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
|
602-055-00-1 |
Bromethan; Ethylbromid |
200-825-8 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H351 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H332 H302 |
|
|
|
|
|
602-056-00-7 |
α, α,α-Trifluortoluol; Benzotrifluorid; Trifluormethanbenzol |
202-635-0 |
Flam. Liq. 2 Aquatic Chronic 2 |
H225 H411 |
GHS02 GHS09 Dgr |
H225 H411 |
|
|
|
|
|
602-057-00-2 |
α-Bromtoluol; Benzylbromid |
202-847-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
|
|
|
|
602-058-00-8 |
α, α-Dichlortoluol; Benzylidenchlorid; Benzalchlorid |
202-709-2 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H351 H331 H302 H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H351 H331 H302 H335 H315 H318 |
|
|
|
|
|
602-059-00-3 |
1-Chlorbutan; Butylchlorid |
203-696-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
602-060-00-9 |
Brombenzol |
203-623-8 |
Flam. Liq. 3 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H315 H411 |
|
|
|
|
|
602-061-00-4 |
Hexafluorpropen; Hexafluorpropylen |
204-127-4 |
Press. Gas Acute Tox. 4 * STOT SE 3 |
H332 H335 |
GHS07 Wng |
H332 H335 |
|
|
U |
|
|
602-062-00-X |
1,2,3-Trichlorpropan |
202-486-1 |
Carc. 1B Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H350 H360F *** H332 H312 H302 |
GHS08 GHS07 Dgr |
H350 H360F *** H332 H312 H302 |
|
|
D |
|
|
602-063-00-5 |
Heptachlorepoxid; 2,3-Epoxy-1,4,5,6,7,8,8-heptachlor-3a,4,7,7a-tetrahydro-4,7-methanoindan |
213-831-0 |
Carc. 2 Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H373 ** H410 |
|
|
|
|
|
602-064-00-0 |
1,3-Dichlor-2-propanol |
202-491-9 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * |
H350 H301 H312 |
GHS06 GHS08 Dgr |
H350 H301 H312 |
|
|
|
|
|
602-065-00-6 |
Hexachlorbenzol |
204-273-9 |
Carc. 1B STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H372 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H372 ** H410 |
|
|
|
|
|
602-066-00-1 |
Tetrachlor-p-benzochinon Chloranil |
204-274-4 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
|
602-067-00-7 |
1,3-Dichlorbenzol; m-Dichlorbenzol |
208-792-1 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
602-068-00-2 |
Ethylenbis(trichloracetat) |
219-732-9 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
|
602-069-00-8 |
Dichloracetylen |
— |
Unst. Expl. Carc. 2 STOT RE 2 * |
H200 H351 H373 ** |
GHS01 GHS08 Wng |
H200 H351 H373 ** |
|
|
|
|
|
602-070-00-3 |
3-Chlor-4,5,α, α,α-pentafluortoluol |
401-930-3 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H226 H332 H302 H400 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H302 H400 |
|
|
|
|
|
602-071-00-9 |
Brombenzylbromtoluol, Reaktionsmasse aus Isomeren |
402-210-1 |
STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 ** H317 H410 |
|
|
|
|
|
602-072-00-4 |
Dichlor[(dichlorphenyl)-methyl]-methylbenzol, Reaktionsmasse aus Isomeren; (Dichlorphenyl)(dichlortolyl)-methan, Reaktionsmasse aus Isomeren (IUPAC) |
278-404-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
602-073-00-X |
1,4-Dichlorbut-2-en; 1,4-Dichlorbuten-2 |
212-121-8 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H330 H311 H301 H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H330 H311 H301 H314 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % STOT SE 3; H335:C≥5 % |
|
|
|
602-074-00-5 |
Pentachlorbenzol |
210-172-0 |
Flam. Sol. 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H228 H302 H410 |
|
|
T |
|
|
602-075-00-0 |
4,4,5,5-Tetrachlor-1,3-dioxolan-2-on |
404-060-2 |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H330 H302 H314 |
GHS06 GHS05 Dgr |
H330 H302 H314 |
|
|
|
|
|
602-076-00-6 |
2,3,4-Trichlorbut-1-en; 2,3,4-Trichlor-1-buten |
219-397-9 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H302 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H302 H319 H335 H315 H410 |
|
Carc. 2; H351: C ≥ 0,1 % |
|
|
|
602-077-00-1 |
Dodecachlorpentacyclo [5.2.1.02,6.03,9.05,8] decan; Mirex |
219-196-6 |
Carc. 2 Repr. 2 Lact. Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361fd H362 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361fd H362 H312 H302 H410 |
|
|
|
|
|
602-078-00-7 |
Hexachlorcyclopentadien |
201-029-3 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H302 H314 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H311 H302 H314 H410 |
|
|
|
|
|
602-079-00-2 |
2,3-Dichlorpropen; 2,3-Dichlorpropylen |
201-153-8 |
Flam. Liq. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H225 H341 H332 H312 H302 H335 H315 H318 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H225 H341 H332 H312 H302 H335 H315 H318 H412 |
|
|
|
|
|
602-080-00-8 |
Chloralkane, C10-13; Chlorierte Paraffine, C10-13 |
287-476-5 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
EUH066 |
|
|
|
|
602-081-00-3 |
2-Chlor-4,5-difluorbenzoesäure |
405-380-5 |
— |
Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H312 H302 H318 H317 |
GHS05 GHS07 Dgr |
H312 H302 H318 H317 |
|
|
|
|
602-082-00-9 |
2,2,6,6-Tetrakis(brommethyl)-4- oxaheptan-1,7-diol |
408-020-5 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
602-083-00-4 |
Diphenylether, Pentabromderivat; Pentabromdiphenylether |
251-084-2 |
STOT RE 2 * Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H362 H400 H410 |
GHS08 GHS09 Wng |
H373 ** H362 H410 |
|
|
|
|
|
602-084-00-X |
1,1-Dichlor-1-fluorethan |
404-080-1 |
Aquatic Chronic 3 Ozone 1 |
H412 H420 |
GHS07 Wng |
H412 H420 |
|
|
|
|
|
602-085-00-5 |
2-Brompropan |
200-855-1 |
Flam. Liq. 2 Repr. 1A STOT RE 2 * |
H225 H360F *** H373 ** |
GHS02 GHS08 Dgr |
H225 H360F *** H373 ** |
EUH066 |
|
|
|
|
602-086-00-0 |
Trifluoriodmethan; Trifluormethyliodid |
219-014-5 |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
|
602-087-00-6 |
1,2,4-Trichlorbenzol |
204-428-0 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
602-088-00-1 |
2,3-Dibrompropan-1-ol; 2,3-Dibrom-1-propanol |
202-480-9 |
Carc. 1B Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H350 H361f *** H311 H332 H302 H412 |
GHS08 GHS07 Dgr |
H350 H361f *** H311 H332 H302 H412 |
|
|
|
|
|
602-089-00-7 |
4-Brom-2-chlorfluorbenzol |
405-580-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
602-090-00-2 |
1-Allyl-3-chlor-4-fluorbenzol |
406-630-6 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
602-091-00-8 |
1,3-Dichlor-4-fluorbenzol |
406-160-1 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 |
H302 H373 ** H315 H411 |
GHS08 GHS07 Wng |
H302 H373 ** H315 H411 |
|
|
|
|
|
602-092-00-3 |
1-Brom-3,4,5-trifluorbenzol |
418-480-9 |
Flam. Liq. 3 Carc. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H226 H351 H315 H318 H411 |
GHS02 GHS08 GHS05 GHS09 Dgr |
H226 H351 H315 H318 H411 |
|
|
|
|
|
602-093-00-9 |
α, α,α,4-Tetrachlortoluol; p-Chlorbenzotrichlorid |
226-009-1 |
Carc. 1B Repr. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H350 H361f *** H372 ** H312 H302 H335 H315 |
GHS08 GHS07 Dgr |
H350 H361f *** H372 ** H312 H302 H335 H315 |
|
|
|
|
|
602-094-00-4 |
Diphenylether; Octabrom-Derivat |
251-087-9 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
|
|
|
|
|
602-095-00-X |
Chloralkane, C14-17, chlorierte Paraffine, C14-17 |
287-477-0 |
Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
EUH066 |
|
|
|
|
602-096-00-5 |
Malachitgrün Hydrochlorid; C.I. Basic Green 4 [1]; Malachitgrünoxalat [2] |
209-322-8 [1] 219-441-7 [2] |
569-64-2 [1] 2437-29-8 [2] |
Repr. 2 Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H302 H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H361d *** H302 H318 H410 |
|
|
|
|
602-097-00-0 |
1-Bromo-9-(4,4,5,5,5-pentafluorpentylthio)-nonan |
422-850-5 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
602-098-00-6 |
2-(3-Bromphenoxy)tetrahydro-2H-pyran |
429-030-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
602-099-00-1 |
3-(4-Fluorphenyl)-2-methylpropionylchlorid |
426-370-7 |
— |
Skin Corr. 1A Acute Tox. 4 * Aquatic Chronic 3 |
H314 H302 H412 |
GHS05 GHS07 Dgr |
H314 H302 H412 |
EUH014 EUH029 |
|
|
|
602-100-00-5 |
Reaktionsmasse aus (R, R)-1,1,1,2,2,3,4,5,5,5-Decafluorpentan und (S, S)-1,1,1,2,2,3,4,5,5,5-decafluorpentan |
420-640-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
602-101-00-0 |
2-Chlor-4-fluor-5-nitrophenyl(isobutyl)-carbonat |
427-020-6 |
STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373** H317 H410 |
|
|
|
|
|
602-102-00-6 |
1,1,1,3,3-Pentafluorbutan |
430-250-1 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
602-103-00-1 |
1-(Chlorphenylmethyl)-2-methylbenzol |
431-450-1 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
602-104-00-7 |
1,1,2,2,3,3,4-Heptafluorcyclopentan |
430-710-1 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
602-105-00-2 |
Natrium-1,1,2,2,3,3,4,4,4-nonafluor-1-butansulfinat |
422-100-7 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
602-106-00-8 |
2-Brom-4,6-difluoranilin |
429-430-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
602-107-00-3 |
3,3,4,4-Tetrafluor-4-iod-1-buten |
439-500-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
|
|
|
|
|
602-108-00-9 |
(2,3,5,6-Tetrafluorphenyl)-methanol |
443-840-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
|
602-109-00-4 |
Hexabromcyclododecan [1]; 1,2,5,6,9,10-Hexabromcyclododecan [2] |
247-148-4 [1] 221-695-9[2] |
25637-99-4[1] 3194-55-6[2] |
Repr. 2 Lact. |
H361 H362 |
GHS08 Wng |
H361 H362 |
|
|
|
|
602-110-00-X |
Tetrafluorethylen |
204-126-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
603-001-00-X |
Methanol; Methylalkohol |
200-659-6 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 |
H225 H331 H311 H301 H370 ** |
GHS02 GHS06 GHS08 Dgr |
H225 H331 H311 H301 H370 ** |
|
* STOT SE 1; H370: C≥10 % STOT SE 2; H371: 3 % ≤ C<10 % |
|
|
|
603-002-00-5 |
Ethanol; Ethylalkohol |
200-578-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
603-003-00-0 |
Propan-1-ol; n-Propanol; n-Propylalkohol |
200-746-9 |
Flam. Liq. 2 Eye Dam. 1 STOT SE 3 |
H225 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H225 H318 H336 |
|
|
|
|
|
603-004-00-6 |
Butan-1-ol; n-Butanol; n-Butylalkohol |
200-751-6 |
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 STOT SE 3 |
H226 H302 H335 H315 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H335 H315 H318 H336 |
|
|
|
|
|
603-005-00-1 |
2-Methylpropan-2-ol; tert-Butylalkohol; tert-Butanol |
200-889-7 |
Flam. Liq. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H225 H332 H319 H335 |
GHS02 GHS07 Dgr |
H225 H332 H319 H335 |
|
|
|
|
|
603-006-00-7 |
Pentanolisomere, soweit in diesem Anhang nicht gesondert aufgeführt |
250-378-8 |
|
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 |
H226 H332 H335 |
GHS02 GHS07 Wng |
H226 H332 H335 |
EUH066 |
|
C |
|
603-007-00-2 |
2-Methylbutan-2-ol; tert-Pentanol; tert-Pentylalkohol |
200-908-9 |
Flam. Liq. 2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H225 H332 H335 H315 |
GHS02 GHS07 Dgr |
H225 H332 H335 H315 |
|
|
|
|
|
603-008-00-8 |
4-Methylpentan-2-ol; Methylisobutylcarbinol; Methylamylalkohol |
203-551-7 |
Flam. Liq. 3 STOT SE 3 |
H226 H335 |
GHS02 GHS07 Wng |
H226 H335 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
|
603-009-00-3 |
Cyclohexanol |
203-630-6 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H332 H302 H335 H315 |
GHS07 Wng |
H332 H302 H335 H315 |
|
|
|
|
|
603-010-00-9 |
2-Methylcyclohexanol, Isomerengemisch [1]; cis-2-Methylcyclohexanol [2]; trans-2-Methylcyclohexanol [3]; |
209-512-0 [1] 231-187-9 [2] 231-186-3 [3] |
583-59-5 [1] 7443-70-1 [2] 7443-52-9 [3] |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
C |
|
603-011-00-4 |
2-Methoxyethanol; Methylglycol; Ethylenglykol-monomethylether |
203-713-7 |
Flam. Liq. 3 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H360FD H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H360FD H332 H312 H302 |
|
|
|
|
|
603-012-00-X |
2-Ethoxyethanol; Ethylglycol; Ethylenglykol-monoethylether |
203-804-1 |
Flam. Liq. 3 Repr. 1B Acute Tox. 3 Acute Tox. 4 |
H226 H360FD H331 H302 |
GHS02 GHS08 GHS06 Dgr |
H26 H360FD H331 H302 |
|
|
|
|
|
603-013-00-5 |
2-Isopropoxyethanol; Isopropylglycol; Ethylenglykol-monoisopropylether |
203-685-6 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H332 H312 H319 |
GHS07 Wng |
H332 H312 H319 |
|
|
|
|
|
603-014-00-0 |
2-Butoxyethanol; Ethylenglycolmonobutylether |
203-905-0 |
Acute Tox. 3 Acute Tox. 4 Skin Irrit. 2 Eye Irrit. 2 |
H331 H302 H315 H319 |
GHS06 Dgr |
H331 H302 H315 H319 |
|
Einatmung: ATE = 3 mg/L (Dämpfe) Oral: ATE = 1 200 mg/kg KG |
|
|
|
603-015-00-6 |
Allylalkohol; Prop-2-en-1-ol |
203-470-7 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H225 H331 H311 H301 H319 H335 H315 H400 |
GHS02 GHS06 GHS09 Dgr |
H225 H331 H311 H301 H319 H335 H315 H400 |
|
|
|
|
|
603-016-00-1 |
4-Hydroxy-4-methylpentan-2-on; Diacetonalkohol |
204-626-7 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
Eye Irrit. 2; H319: C≥ 10 % |
|
|
|
603-018-00-2 |
Furfurylalkohol |
202-626-1 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 |
H351 H331 H312 H302 H373** H319 H335 |
GHS06 GHS08 Dgr |
H351 H331 H312 H302 H373** H319 H335 |
|
|
|
|
|
603-019-00-8 |
Dimethylether |
204-065-8 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
603-020-00-3 |
Ethylmethylether |
— |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
603-021-00-9 |
Methylvinylether |
203-475-4 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
D U |
|
|
603-022-00-4 |
Diethylether; Ether |
200-467-2 |
Flam. Liq. 1 Acute Tox. 4 * STOT SE 3 |
H224 H302 H336 |
GHS02 GHS07 Dgr |
H224 H302 H336 |
EUH019 EUH066 |
|
|
|
|
603-023-00-X |
Ethylenoxid; Oxiran |
200-849-9 |
Flam. Gas 1 Press. Gas Carc. 1B Muta. 1B Repr. 1B Acute Tox. 3 Acute Tox. 3 STOT SE 3 STOT SE 3 STOT RE 1 Skin Corr. 1 Eye Dam. 1 |
H220 H350 H340 H360Fd H331 H301 H335 H336 H372 (Nervensystem) H314 H318 |
GHS02 GHS08 GHS06 GHS05 Dgr |
H220 H350 H340 H360Fd H331 H301 H335 H336 H372 (Nervensystem) H314 |
|
Einatmen: ATE = 700 ppm (Gase) Oral: ATE = 100 mg/kg KG |
U |
|
|
603-024-00-5 |
1,4-Dioxan |
204-661-8 |
Flam. Liq. 2 Carc. 1B STOT SE 3 Eye Irrit. 2 |
H225 H350 H335 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H335 H319 |
EUH019 EUH066 |
|
D |
|
|
603-025-00-0 |
Tetrahydrofuran |
203-726-8 |
Flam. Liq. 2 Carc. 2 Eye Irrit. 2 STOT SE 3 |
H225 H351 H319 H335 |
GHS02 GHS07 GHS08 Dgr |
H225 H351 H319 H335 |
EUH019 |
STOT SE 3; H335: C≥25 % Eye Irrit.2; H319: C ≥ 25 % |
|
|
|
603-026-00-6 |
1-Chlor-2,3-epoxypropan; Epichlorhydrin |
203-439-8 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H226 H350 H331 H311 H301 H314 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H350 H331 H311 H301 H314 H317 |
|
* |
|
|
|
603-027-00-1 |
Ethandiol; 1,2-Ethandiol; Ethylenglycol |
203-473-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
603-028-00-7 |
2-Chlorethanol; Ethylenchlorhydrin |
203-459-7 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
|
603-029-00-2 |
Bis(2-chlorethyl)ether; 2,2'-Dichlor-diethylether |
203-870-1 |
Carc. 2 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H351 H330 H310 H300 |
GHS06 GHS08 Dgr |
H351 H330 H310 H300 |
|
|
|
|
|
603-030-00-8 |
2-Aminoethanol; Ethanolamin |
205-483-3 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H332 H312 H302 H314 |
GHS05 GHS07 Dgr |
H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
603-031-00-3 |
1,2-Dimethoxyethan; Ethylenglycoldimethylether; EGDME |
203-794-9 |
Flam. Liq. 2 Repr. 1B Acute Tox. 4 * |
H225 H360FD H332 |
GHS02 GHS08 GHS07 Dgr |
H225 H360FD H332 |
EUH019 |
|
|
|
|
603-032-00-9 |
Ethylendinitrat; Ethylenglycoldinitrat; Glykoldinitrat; Nitroglykol |
211-063-0 |
Unst. Expl. Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 |
H200 H330 H310 H300 H373** |
GHS01 GHS06 GHS08 Dgr |
H200 H330 H310 H300 H373** |
|
|
|
|
|
603-033-00-4 |
Oxydiethylendinitrat; Diethylenglycoldinitrat |
211-745-8 |
Unst. Expl Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H200 H330 H310 H300 H373 ** H412 |
GHS01 GHS06 GHS08 Dgr |
H200 H330 H310 H300 H373 ** H412 |
|
|
|
|
|
603-033-01-1 |
Oxydiethylendinitrat; Diethylenglycoldinitrat; [>25 % Phlegmatisierungsmittel] |
211-745-8 |
Expl. 1.1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H201 H330 H310 H300 H373 ** H412 |
GHS01 GHS06 GHS08 Dgr |
H201 H330 H310 H300 H373 ** H412 |
|
|
|
|
|
603-034-00-X |
Glycerintrinitrat; Nitroglycerin |
200-240-8 |
Unst. Expl. Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H200 H330 H310 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H200 H330 H310 H300 H373 ** H411 |
|
|
|
|
|
603-034-01-7 |
Glycerintrinitrat; Nitroglycerin; [> 40 % Phlegmatisierungsmittel] |
200-240-8 |
Expl. 1.1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H201 H330 H310 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H411 |
|
|
|
|
|
603-035-00-5 |
Pentaerythritoltetranitrat; Pentaerythrittetranitrat; P.E.T.N. |
201-084-3 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
|
603-035-01-2 |
Pentaerythritoltetranitrat; Pentaerythrittetranitrat; P.E.T.N.;[> 20 % Phlegamatisierungsmittel] |
201-084-3 |
Expl. 1.1 |
H201 |
GHS01 Dgr |
H201 |
|
|
T |
|
|
603-036-00-0 |
Mannithexanitrat; Nitromannit |
239-924-6 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
|
603-036-01-8 |
Mannithexanitrat; Nitromannit; [> 40 % Phlegmatisierungsmittel] |
239-924-6 |
Expl. 1.1 |
H201 |
GHS01 Dgr |
H201 |
|
|
|
|
|
603-037-00-6 |
Cellulosenitrat; Nitrocellulose |
— |
— |
Expl. 1.1 |
H201 |
GHS01 Dgr |
H201 |
|
|
T |
|
603-038-00-1 |
Allylglycidylether; Allyl-2,3-epoxypropylether; Prop-2-en-1-yl-2,3-epoxypropylether |
203-442-4 |
Flam. Liq. 3 Carc. 2 Muta. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H226 H351 H341 H361f *** H332 H302 H335 H315 H318 H317 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H351 H341 H361f *** H332 H302 H335 H315 H318 H317 H412 |
|
|
|
|
|
603-039-00-7 |
n-Butylglycidylether; Butylglycidylether; Butyl-2,3-epoxypropylether; 1-Butoxy-2,3-epoxypropan |
219-376-4 |
Flam. Liq. 3 Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Chronic 3 |
H226 H351 H341 H332 H302 H335 H317 H412 |
GHS02 GHS08 GHS07 Wng |
H226 H351 H341 H332 H302 H335 H317 H412 |
|
|
|
|
|
603-040-00-2 |
Natriummethanolat; Natriummethylat; Natriummethoxid [1]; Kaliummethanolat; Kaliummethylat; Kaliummethoxid [2]; Lithiummethanolat; Lithiummethylat; Lithiummethoxid [3] |
204-699-5 [1] 212-736-1 [2] 212-737-7 [3] |
124-41-4 [1] 865-33-8 [2] 865-34-9 [3] |
Self-heat 1 Skin Corr. 1B |
H251 H314 |
GHS02 GHS05 Dgr |
H251 H314 |
EUH014 |
|
T |
|
603-041-00-8 |
Kaliumethanolat; Kaliumethylat; Kaliumethoxid [1]; Natriumethanolat; Natriumethylat; Natriumethoxid [2] |
213-029-0 [1] 205-487-5 [2] |
917-58-8 [1] 141-52-6 [2] |
Self-heat 1 Skin Corr. 1B |
H251 H314 |
GHS02 GHS05 Dgr |
H251 H314 |
EUH014 |
|
T |
|
603-042-00-3 |
Aluminiumtriisopropoxid |
209-090-8 |
Flam. Sol. 1 |
H228 |
GHS02 Dgr |
H228 |
|
|
T |
|
|
603-043-00-9 |
Triarimol (ISO); 2,4-Dichlor-α-(pyrimidin-5-yl)benzhydrylalkohol |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
603-044-00-4 |
Dicofol (ISO); 2,2,2-Trichlor-1,1-bis(4-chlorphenyl)ethanol |
204-082-0 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H315 H317 H410 |
|
|
|
|
|
603-045-00-X |
Diisopropylether [1]; Dipropylether; Di-n-propylether [2] |
203-560-6 [1] 203-869-6 [2] |
108-20-3 [1] 111-43-3 [2] |
Flam. Liq. 2 STOT SE 3 |
H225 H336 |
GHS02 GHS07 Dgr |
H225 H336 |
EUH019 EUH066 |
|
C |
|
603-046-00-5 |
Bis(chlormethyl)ether; Oxybis(chlormethan); Dichlordimethylether, symmetrisch |
208-832-8 |
Flam. Liq. 2 Carc. 1A Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * |
H225 H350 H330 H311 H302 |
GHS02 GHS06 GHS08 Dgr |
H225 H350 H330 H311 H302 |
|
Carc. 1A; H350: C ≥ 0,001 % |
|
|
|
603-047-00-0 |
2-Dimethylaminoethanol; N,N-Dimethylethanolamin |
203-542-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H312 H302 H314 |
|
STOT SE 3; H335: C≥5 % |
|
|
|
603-048-00-6 |
2-Diethylaminoethanol; N,N-diethylethanolamin |
202-845-2 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H314 |
|
STOT SE 3; H335: C≥5 % |
|
|
|
603-049-00-1 |
Chlorfenethol (ISO); 1,1-Bis(4-chlorphenyl)ethanol |
201-246-3 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
603-050-00-7 |
1-(2-Butoxypropoxy)-2-propanol |
246-011-6 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
603-051-00-2 |
2-Ethylbutanol |
202-621-4 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
603-052-00-8 |
3-Butoxypropan-2-ol; Propylenglycolmonobutylether |
225-878-4 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
|
603-053-00-3 |
2-Methyl-2,4-pentandiol |
203-489-0 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
|
603-054-00-9 |
Di-n-butylether; Dibutylether |
205-575-3 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 3 |
H226 H319 H335 H315 H412 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H412 |
|
STOT SE 3; H335: C≥10 % |
|
|
|
603-055-00-4 |
Propylenoxid; 1,2-Epoxypropan; Methyloxiran |
200-879-2 |
Flam. Liq. 1 Carc. 1B Muta. 1B Acute Tox. 3 Acute Tox. 3 Acute Tox. 4 STOT SE 3 Eye Irrit. 2 |
H224 H350 H340 H331 H311 H302 H335 H319 |
GHS02 GHS08 GHS06 Dgr |
H224 H350 H340 H331 H311 H302 H335 H319 |
|
|
|
|
|
603-056-00-X |
[(p-Tolyloxy)methyl]oxiran; [2,3-Epoxypropyl-p-tolylether] [1]; [(m-Tolyloxy)methyl]oxiran [2]; 2,3-Epoxypropyl-o-tolylether [3]; [(Tolyloxy)methyl]oxiran; Kresylglycidylether [4] |
218-574-8 [1] 218-575-3 [2] 218-645-3 [3] 247-711-4 [4] |
2186-24-5 [1] 2186-25-6 [2] 2210-79-9 [3] 26447-14-3 [4] |
Muta. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H315 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H315 H317 H411 |
|
|
C |
|
603-057-00-5 |
Benzylalkohol |
202-859-9 |
Acute Tox. 4 Eye Irrit. 2 Skin Sens. 1B |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
Oral: ATE = 1 200 mg/kg KG |
|
|
|
603-058-00-0 |
1,3-Propylenoxid; Oxetan; 1,3-Epoxypropan |
207-964-3 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
|
|
|
603-059-00-6 |
1-Hexanol |
203-852-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
603-060-00-1 |
2,2'-Bioxiran; 1,2:3,4-Diepoxybutan |
215-979-1 |
Carc. 1B Muta. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H350 H340 H330 H311 H301 H314 |
GHS06 GHS08 GHS05 Dgr |
H350 H340 H330 H311 H301 H314 |
|
|
|
|
|
603-061-00-7 |
Tetrahydro-2-furyl-methanol; Tetrahydrofurfurylalkohol |
202-625-6 |
Repr. 1B Eye Irrit. 2 |
H360Df H319 |
GHS08 GHS07 Dgr |
H360Df H319 |
|
|
|
|
|
603-062-00-2 |
Tetrahydrofuran-2,5-diyldimethanol |
203-239-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥10 % |
|
|
|
603-063-00-8 |
2,3-Epoxypropan-1-ol; Glycidol; Oxiranmethanol |
209-128-3 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H350 H341 H360F *** H331 H312 H302 H319 H335 H315 |
GHS06 GHS08 Dgr |
H350 H341 H360F *** H331 H312 H302 H319 H335 H315 |
|
|
|
|
|
603-064-00-3 |
1-Methoxy-2-propanol; Monopropylenglycolmethylether |
203-539-1 |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
|
|
|
|
|
603-065-00-9 |
m-Bis(2,3-epoxypropoxy)benzol; Resorcinoldiglycidylether |
202-987-5 |
Carc. 1B Muta. 2 Acute Tox. 3 Acute Tox. 4 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H311 H302 H315 H319 H317 H412 |
GHS08 GHS06 Dgr |
H350 H341 H311 H302 H315 H319 H317 H412 |
|
dermal: ATE = 300 mg/kg KG oral: ATE = 500 mg/kg KG |
|
|
|
603-066-00-4 |
7-Oxa-3-oxiranylbicyclo[4.1.0]heptan; 1,2-Epoxy-4-epoxyethylcyclohexan; 4-Vinylcyclohexendiepoxid |
203-437-7 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 Acute Tox. 4 |
H350 H341 H360F H331 H302 |
GHS08 GHS06 Dgr |
H350 H341 H360F H331 H302 |
|
Einatmen: ATE = 0,5 mg/L (Stäube oder Nebel) oral: ATE = 1 847 mg/kg KG |
|
|
|
603-067-00-X |
Phenylglycidylether; 2,3-Epoxypropylphenylether;1,2-Epoxy-3-phenoxypropan |
204-557-2 |
Carc. 1B Muta. 2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H332 H335 H315 H317 H412 |
GHS08 GHS07 Dgr |
H350 H341 H332 H335 H315 H317 H412 |
|
|
|
|
|
603-068-00-5 |
2,3-Epoxypropyl-2-ethylcyclohexylether; Ethylcyclohexylglycidylether; 1-(2-Ethylcyclohexanoxy)-2,3-epoxypropan |
— |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
|
603-069-00-0 |
2,4,6-Tris(dimethylaminomethyl)phenol |
202-013-9 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
|
603-070-00-6 |
2-Amino-2-methylpropanol |
204-709-8 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
|
603-071-00-1 |
2,2'-Iminodiethanol; Diethanolamin |
203-868-0 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H302 H373 ** H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 |
|
|
|
|
|
603-072-00-7 |
1,4-Bis(2,3-epoxypropoxy)butan; 1,4-Butandioldiglycidylether |
219-371-7 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H332 H312 H319 H315 H317 |
GHS07 Wng |
H332 H312 H319 H315 H317 |
|
|
|
|
|
603-073-00-2 |
Bis-[4-(2,3-epoxipropoxi)phenyl]propan; 4,4'-Methylen-diphenyldiglycidylether; Bisphenol-A-diglycidylether |
216-823-5 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
Eye Irrit. 2; H319: C≥ 5 % Skin Irrit. 2; H315: C≥5 % |
|
|
|
603-074-00-8 |
Reaktionsprodukt: Bisphenol-A-Epichlorhydrin; Epoxyharz (durchschnittliches Zahlenmittel des Molekulargewichts ≤ 700) |
500-033-5 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H315 H317 H411 |
|
Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit 2; H315: C≥ 5 % |
|
|
|
603-075-00-3 |
Chlormethylmethylether; Chlordimethylether; Monochlordimethylether |
203-480-1 |
Flam. Liq. 2 Carc. 1A Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H312 H302 |
|
|
|
|
|
603-076-00-9 |
But-2-in-1,4-diol; 2-Butin-1,4-diol |
203-788-6 |
Skin Corr. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 |
H314 H331 H301 H312 H373 ** H317 |
GHS06 GHS05 GHS08 Dgr |
H314 H331 H301 H312 H373 ** H317 |
|
Skin Corr. 1B; H314: C≥50 % Skin Irrit. 2; H315: 25 %≤ C < 50 % Eye Irrit. 2; H319: 25 %≤ C<50 % |
D |
|
|
603-077-00-4 |
1-Dimethylaminopropan-2-ol; Dimepranol (INN) |
203-556-4 |
Flam. Liq. 3 Acute Tox. 4 * Skin Corr. 1B |
H226 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H314 |
|
|
|
|
|
603-078-00-X |
Prop-2-in-1-ol; Propargylalkohol |
203-471-2 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H311 H301 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H311 H301 H314 H411 |
|
|
|
|
|
603-079-00-5 |
2,2'-(Methylimino)diethanol; N-Methyldiethanolamin |
203-312-7 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-080-00-0 |
2-Methylaminoethanol; N-Methylethanolamin; N-Methyl-2-ethanolamin; N-Methyl-2-aminoethanol; 2-(Methylamino)ethanol |
203-710-0 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
STOT SE 3; H335: C≥5 % |
|
|
|
603-081-00-6 |
2,2'-Thiodiethanol; Thiodiglykol |
203-874-3 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-082-00-1 |
1-Aminopropan-2-ol; Isopropanolamin |
201-162-7 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
603-083-00-7 |
1,1'-Iminodipropan-2-ol; Diisopropanolamin |
203-820-9 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-084-00-2 |
Styroloxid; (Epoxyethyl)benzol; Phenyloxiran |
202-476-7 |
Carc. 1B Acute Tox. 4 * Eye Irrit. 2 |
H350 H312 H319 |
GHS08 GHS07 Dgr |
H350 H312 H319 |
|
|
|
|
|
603-085-00-8 |
Bronopol (INN); 2-Brom-2-nitropropan-1,3-diol |
200-143-0 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H312 H302 H335 H315 H318 H400 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H335 H315 H318 H400 |
|
M=10 |
|
|
|
603-086-00-3 |
Ethirimol (ISO); 5-Butyl-2-ethylamino-6-methylpyrimidin-4-ol |
245-949-3 |
Acute Tox. 4 * |
H312 |
GHS07 Wng |
H312 |
|
|
|
|
|
603-087-00-9 |
2-Ethylhexan-1,3-diol; Octylenglycol; Ethoexadiol |
202-377-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
603-088-00-4 |
2-(Octylthio)ethanol; 2-Hydroxyethyloctylsulfid |
222-598-4 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
603-089-00-X |
7,7-Dimethyl-3-oxa-6-azaoctan-1-ol |
400-390-6 |
— |
Skin Corr. 1A Acute Tox. 4 * |
H314 H302 |
GHS05 GHS07 Dgr |
H314 H302 |
|
|
|
|
603-090-00-5 |
2-(2-Bromethoxy)anisol; 2-(2-Bromethoxy)-1-methoxybenzol |
402-010-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
603-091-00-0 |
exo-1-Methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptan-2-ol; exo-4-Isopropyl-1-methyl- 1,4-epoxycyclohexan-2-ol |
402-470-6 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
|
603-092-00-6 |
2-Methyl-4-phenylpentanol |
402-770-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
603-093-00-1 |
Cinmethylin (ISO); exo-(±)-1-Methyl-2-(2-methylbenzyloxy)-4-isopropyl-7-oxabicyclo(2.2.1)heptan |
402-410-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Dgr |
H332 H411 |
|
|
|
|
|
603-094-00-7 |
1,3-Bis(2,3-epoxypropoxy)-2,2- dimethylpropan |
241-536-7 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
|
603-095-00-2 |
2-(Propyloxy)ethanol; EGPE; n-Propylglykol [Ethylenglykol-monopropylether] |
220-548-6 |
Acute Tox. 4 * Eye Irrit. 2 |
H312 H319 |
GHS07 Wng |
H312 H319 |
|
|
|
|
|
603-096-00-8 |
2-(2-Butoxyethoxy)ethanol; Diethylenglykolmonobutylether; Butyldiglykol |
203-961-6 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-097-00-3 |
1,1’,1’-Nitrilotripropan-2-ol; Triisopropanolamin |
204-528-4 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-098-00-9 |
2-Phenoxyethanol |
204-589-7 |
Acute Tox. 4 STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
|
oral: ATE = 1 394 mg/kg KG |
|
|
|
603-099-00-4 |
3-(N-Methyl-N-(4-methylamino-3-nitrophenyl)amino)propan-1,2-diol-hydrochlorid |
403-440-5 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
603-100-00-8 |
1,2-Dimethoxypropan |
404-630-0 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH019 |
|
|
|
|
603-101-00-3 |
Tetrahydro-2-isobutyl-4-methylpyran-4-ol, Isomerengemisch (cis und trans) |
405-040-6 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-102-00-9 |
1,2-Epoxybutan |
203-438-2 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4* Acute Tox. 4* Acute Tox. 4* STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H225 H351 H302 H312 H332 H335 H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H302 H312 H332 H335 H315 H319 |
|
|
|
|
|
603-103-00-4 |
Oxiran, Mono[(C12-14-alkyloxy)methyl]-Derivate; C12-14-Alkylglycidylether |
271-846-8 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
|
603-104-00-X |
Fenarimol (ISO); 2,4'-Dichlor-α-(pyrimidin-5-yl)benzhydrylalkohol |
262-095-7 |
Repr. 2 Lact. Aquatic Chronic 2 |
H361fd H362 H411 |
GHS08 GHS09 Wng |
H361fd H362 H411 |
|
|
|
|
|
603-105-00-5 |
Furan |
203-727-3 |
Flam. Liq. 1 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Aquatic Chronic 3 |
H224 H350 H341 H332 H302 H373 ** H315 H412 |
GHS02 GHS08 GHS07 Dgr |
H224 H350 H341 H332 H302 H373 ** H315 H412 |
EUH019 |
|
|
|
|
603-106-00-0 |
2-Methoxypropanol |
216-455-5 |
Flam. Liq. 3 Repr. 1B STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H360D *** H335 H315 H318 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H360D *** H335 H315 H318 |
|
|
|
|
|
603-107-00-6 |
2-(2-Methoxyethoxy)ethanol; Diethylenglykolmonomethylether |
203-906-6 |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
Repr. 1B; H360D: C ≥ 3 % |
|
|
|
603-108-00-1 |
2-Methyl-1-propanol; Isobutanol; Isobutylalkohol; 2-Methylpropanol-1 |
201-148-0 |
Flam. Liq. 3 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 STOT SE 3 |
H226 H335 H315 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H226 H335 H315 H318 H336 |
|
|
|
|
|
603-109-00-7 |
Reaktionsmasse aus 1-Ethoxy-1,1,2,3,3,3-hexafluor-2-(trifluormethyl)propan und 1-Ethoxy-1,1,2,2,3,3,4,4,4- nonafluorbutan |
425-340-0 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-110-00-2 |
Reaktionsmasse aus cis-2-Isobutyl-5-methyl-1,3-dioxan und trans-2-Isobutyl-5-methyl-1,3-dioxan |
426-130-1 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
603-111-00-8 |
Reaktionsmasse aus 1-(1,1- Dimethylpropyl)-4-ethoxy-cis- cyclohexan und 1-(1,1-Dimethylpropyl)-4-ethoxy-trans-cyclohexan |
426-530-6 |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
603-112-00-3 |
Cyclopentyl-2-phenylethylether |
428-340-9 |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
603-113-00-9 |
6-Glycidyloxynapht-1-yl-oxymethyloxiran |
429-960-2 |
Muta. 2 Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H341 H312 H315 H317 H412 |
GHS08 GHS07 Wng |
H341 H312 H315 H317 H412 |
|
|
|
|
|
603-114-00-4 |
9-(2-Propenyloxy)tri-cyclo[5.2.1.0(2,6)]dec-3(oder-4-)-en |
430-830-2 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
603-115-00-X |
Reaktionsmasse aus O, O',O''-(Methylsilantriyl)tris(4-methyl-2-pentanonoxim) (3 Stereoisomere) |
423-580-0 |
— |
STOT RE 2 * Aquatic Chronic 4 |
H373** H413 |
GHS08 Wng |
H373** H413 |
|
|
|
|
603-116-00-5 |
(Z)-(2,4-Difluorphenyl)piperidin-4-ylmethanonoximmonohydrochlorid |
424-740-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
603-117-00-0 |
2-Propanol; Isopropylalkohol; Isopropanol |
200-661-7 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
|
|
|
|
|
603-118-00-6 |
6-Dimethylaminohexan-1-ol |
404-680-3 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H302 H314 H412 |
|
|
|
|
|
603-119-00-1 |
1,1'-(1,3-Phenylendioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) |
405-840-5 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
603-120-00-7 |
2-Methyl-5-phenylpentanol |
405-890-8 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
|
603-121-00-2 |
4-[4-(1,3-Dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthrachinon |
406-057-1 |
Carc. 2 Skin Sens. 1 Aquatic Chronic 4 |
H351 H317 H413 |
GHS08 GHS07 Wng |
H351 H317 H413 |
|
|
|
|
|
603-122-00-8 |
Natrium-2-ethylhexanolat |
406-150-7 |
Flam. Sol. 1 Skin Corr. 1B Aquatic Chronic 3 |
H228 H314 H412 |
GHS02 GHS05 Dgr |
H228 H314 H412 |
|
|
T |
|
|
603-123-00-3 |
4-Methyl-8-methylen-tricyclo[3.3.1.1 3,7]decan-2-ol |
406-330-5 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
|
603-124-00-9 |
1,4-Bis[2-(vinyloxy)ethoxy]benzol |
406-900-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-125-00-4 |
2-(2,4-Dichlorphenyl)-1-(1H-1,2,4-triazol-1-yl)pent-4-en-2-ol |
407-850-5 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
603-126-00-X |
2-((4-Methyl-2-nitrophenyl)amino)ethanol |
408-090-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
|
603-127-00-5 |
2-Butanol [1]; (S)-Butan-2-ol [2]: (R)-Butan-2-ol [3]; (±)-Butan-2-ol [4]; |
201-158-5 [1] 224-168-1 [2] 238-967-8 [3] 240-029-8 [4] |
78-92-2 [1] 4221-99-2 [2] 14898-79-4 [3] 15892-23-6 [4] |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 STOT SE 3 |
H226 H319 H335 H336 |
GHS02 GHS07 Wng |
H226 H319 H335 H336 |
|
|
C |
|
603-128-00-0 |
2-(Phenylmethoxy)naphthalin |
405-490-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-129-00-6 |
1-tert-Butoxypropan-2-ol |
406-180-0 |
Flam. Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
|
|
|
|
|
603-130-00-1 |
Reaktionsmasse aus Isomeren von α-((Dimethyl)biphenyl)-ω-hydroxy-poly(oxyethylen) |
406-325-8 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-131-00-7 |
Reaktionsmasse aus 1-Deoxy-1-[methyl-(1-oxododecyl)amino]-D-glucitol und 1-Deoxy-1-[methyl-(1-oxotetradecyl)amino]-D-glucitol (3:1) |
407-290-1 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-132-00-2 |
2-Hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decan |
408-200-3 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
|
603-133-00-8 |
Reaktionsmasse aus 3-[(4-Amino-2-chlor-5-nitrophenyl)amino]-propan-1,2-diol und 3,3'-(2-Chlor-5-nitro-1,4-phenylendiimino)bis(propan-1,2-diol) |
408-240-1 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-134-00-3 |
Reaktionsmasse aus substituierten Dodecyl- und/oder Tetradecyldiphenylethern. Der Stoff wird mit der Friedel-Crafts-Reaktion hergestellt. Der Katalysator wird vom Reaktionsprodukt entfernt. Der Diphenylether ist durch C1-C10-Alkylgruppen substituiert. Die Alkylgruppen sind zufällig zwischen C1 und C6 gebunden. Lineare C12 und C14 werden im Verhältnis 50:50 verwendet. |
410-450-3 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-135-00-9 |
Bis[[2,2',2''-nitrilotris-[ethanolato]]-1-N, O]-bis[2-(2-methoxyethoxy)ethoxy]titan |
410-500-4 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
603-136-00-4 |
3-((4-(Bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol |
410-910-3 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
603-137-00-X |
Reaktionsmasse aus 1-Deoxy-1-[methyl-(1-oxohexadecyl)amino]-D-glucitol und 1-Deoxy-1-[methyl-(1-oxooctadecyl)amino]-D-glucitol |
411-130-6 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-138-00-5 |
3-(2,2-Dimethyl-3-hydroxypropyl)toluol; (alt.): 2,2-Dimethyl-3-(3-methylphenyl)propanol |
403-140-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
603-139-00-0 |
Bis(2-methoxyethyl)ether |
203-924-4 |
Flam. Liq. 3 Repr. 1B |
H226 H360FD |
GHS02 GHS08 Dgr |
H226 H360FD |
EUH019 |
|
|
|
|
603-140-00-6 |
2,2'-Oxydiethanol; Diethylenglykol |
203-872-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
603-141-00-1 |
Reaktionsmasse aus Dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]pentadecan und Dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]heptadecan |
413-780-6 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-142-00-7 |
2-(2-(2-Hydroxyethoxy)ethyl)-2-aza-bicyclo[2.2.1]heptan |
407-360-1 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H373 ** H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H312 H302 H373 ** H315 H318 |
|
|
|
|
|
603-143-00-2 |
R-2,3-Epoxy-1-propanol |
404-660-4 |
Self-react. C **** Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H242 H350 H341 H360F *** H331 H312 H302 H314 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H242 H350 H341 H360F *** H331 H312 H302 H314 |
|
|
|
|
|
603-144-00-8 |
Reaktionsmasse aus 2,6,9-Trimethyl-2,5,9-cyclododecatrien-1-ol und 6,9-Dimethyl-2-methylen-5,9-cyclododecadien-1-ol |
413-530-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
603-145-00-3 |
2-Isopropyl-2-(1-methylbutyl)-1,3-dimethoxypropan |
406-970-5 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
603-146-00-9 |
2-[(2-[2-(Dimethylamino)ethoxy]ethyl)methylamino]ethanol |
406-080-7 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H302 H314 H412 |
|
|
|
|
|
603-147-00-4 |
(-)-trans-4-(4'-Fluorphenyl)-3-hydroxymethyl-N-methylpiperidin |
406-030-4 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
603-148-00-X |
1,4-Bis[(vinyloxy)methyl]cyclohexan |
413-370-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
603-149-00-5 |
Reaktionsmasse aus Diastereomeren von 1-(1-Hydroxyethyl)-4-(1-methylethyl)cyclohe xan |
407-640-3 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
|
603-150-00-0 |
(±)-trans-3,3-Dimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)-pent-4-en-2-ol |
411-580-3 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
603-151-00-6 |
(±)-2-(2,4-Dichlorphenyl)-3-(1H-1,2,4-triazol-1-yl)propan-1-ol |
413-570-4 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-152-00-1 |
2-(4-tert-Butylphenyl)ethanol |
410-020-5 |
Repr. 2 STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H361f *** H373 ** H318 H411 |
GHS08 GHS05 GHS09 Dgr |
H361f *** H373 ** H318 H411 |
|
|
|
|
|
603-153-00-7 |
3-((2-Nitro-4-(trifluormethyl)phenyl)amino)propan-1,2-diol |
410-010-0 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
603-154-00-2 |
1-[(2-tert-Butyl)cyclohexyloxy]-2-butanol |
412-300-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
▼M1 ————— |
||||||||||
|
603-156-00-3 |
2-(2,4-Dichlorphenyl)-2-(2-propenyl)oxiran |
411-210-0 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
|
603-157-00-9 |
6,9-Bis(hexadecyloxymethyl)-4,7-dioxanonan-1,2,9-triol |
411-450-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-158-00-4 |
Reaktionsmasse aus 4 Diastereomeren von 2,7-Dimethyl-10-(1-methylethyl)-1-oxaspiro[4.5]deca-3,6-dien |
412-460-3 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
603-159-00-X |
2-Cyclododecylpropan-1-ol |
411-410-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-160-00-5 |
1,2-Diethoxypropan |
412-180-1 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH019 |
|
|
|
|
603-161-00-0 |
1,3-Diethoxypropan |
413-140-6 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
|
603-162-00-6 |
α[2-[[[(2-Hydroxyethyl)methylamino]acetyl]amino]propyl]-ω-nonylphenoxy)-poly-[oxo(methyl-1,2-ethandiyl)] |
413-420-8 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
|
603-163-00-1 |
2-Phenyl-1,3-propandiol |
411-810-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
603-164-00-7 |
2-Butyl-4-chlor-4,5-dihydro-5hydroxymethyl-1-[2'-(2-triphenylmethyl-1,2,3,4-2H-tetrazol-5-yl)-1,1'-biphenyl-4-methyl]-1H-imidazol |
412-420-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-165-00-2 |
Reaktionsmasse aus 4-Allyl-2,6bis(2,3-epoxypropyl)phenol, 4-Allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol, 4-Allyl-6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol und 4-Allyl-6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol |
417-470-1 |
— |
Muta. 2 Skin Sens. 1 |
H341 H317 |
GHS08 GHS07 Wng |
H341 H317 |
|
|
|
|
603-166-00-8 |
R-1-Chlor-2,3-epoxypropan |
424-280-2 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H226 H350 H331 H311 H301 H314 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H350 H331 H311 H301 H314 H317 |
|
|
|
|
|
603-167-00-3 |
3,3',5,5'-Tetra-tert-butylbiphenyl-2,2'-diol |
407-920-5 |
Aquatic Chronic 4 |
H413 |
GHS05 Dgr |
H413 |
|
|
|
|
|
603-168-00-9 |
3-(2-Ethylhexyloxy)propan-1,2-diol |
408-080-2 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
603-169-00-4 |
(±)-trans-4-(4-Fluorphenyl)-3-hydroxymethyl-N-methylpiperidin |
415-550-0 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
603-170-00-X |
Reaktionsmasse aus 2-Methyl-1-(6-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol, 2-Methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol und 2-Methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol |
415-990-3 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
|
603-171-00-5 |
5-Thiazolylmethanol |
414-780-9 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
603-172-00-0 |
Mono-2-[2-(4-dibenzo[b, f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol-trans-butendioat |
415-180-1 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
603-173-00-6 |
4,4-Dimethyl-3,5,8-trioxabicyclo[5.1.0]octan |
421-750-9 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
|
603-174-00-1 |
4-Cyclohexyl-2-methyl-2-butanol |
420-630-3 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
|
603-175-00-7 |
2-(2-Hexyloxyethoxy)ethanol; DEGHE; Diethylenglycolmonohexylether; 3,6-Dioxa-1-dodecanol; Hexylcarbitol; 3,6-Dioxadodecan-1-ol |
203-988-3 |
Acute Tox. 4 * Eye Dam. 1 |
H312 H318 |
GHS05 GHS07 Dgr |
H312 H318 |
|
|
|
|
|
603-176-00-2 |
1,2-Bis(2-methoxyethoxy)ethan; TEGDME; Triethylenglycoldimethylether; Triglyme |
203-977-3 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
EUH019 |
|
|
|
|
603-177-00-8 |
1-Ethoxypropan-2-ol; 2PG1EE; 1-Ethoxy-2-propanol; Propylenglycol-monoethylether; [1]2-Ethoxy-1-methylethylacetat; 2PG1EEA [2] |
216-374-5 [1] 259-370-9 [2] |
1569-02-4 [1] 54839-24-6 [2] |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
|
|
|
|
603-178-00-3 |
2-Hexyloxyethanol; Ethylenglycolmonohexylether; n-Hexylglycol |
203-951-1 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
|
603-179-00-9 |
Ergocalciferol (ISO); Vitamin D2 |
200-014-9 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 |
H330 H311 H301 H372 ** |
GHS06 GHS08 Dgr |
H330 H311 H301 H372 ** |
|
|
|
|
|
603-180-00-4 |
Colecalciferol; Cholecalciferol; Vitamin D3 |
200-673-2 |
Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 STOT RE 1 |
H330 H310 H300 H372 |
GHS06 GHS08 Dgr |
H330 H310 H300 H372 |
|
Einatmung: ATE = 0,05 mg/L (Stäube oder Nebel) Dermal: ATE = 50 mg/kg KG Oral: ATE = 35 mg/kg KG STOT RE 1; H372: C ≥ 3 % STOT RE 2; H373: 0,3 % ≤ C < 3 % |
|
|
|
603-181-00-X |
tert-Butylmethylether; MTBE; 2-Methoxy-2-methylpropan |
216-653-1 |
Flam. Liq. 2 Skin Irrit. 2 |
H225 H315 |
GHS02 GHS07 Dgr |
H225 H315 |
|
|
|
|
|
603-182-00-5 |
Reaktionsprodukt von gesättigten sowie einfach und mehrfach ungesättigten, langkettigen, teilweise veresterten Alkoholen pflanzlichen Ursprungs (Brassica napus L., Brassica rapa L., Helianthus annuus L., Glycine hispida, Gossypium hirsutum L., Cocos nucifera L., Elaeis guineensis) mit O, O-Diisobutyldithiophosphat und 2-Ethylhexylamin und Wasserstoffperoxid |
428-630-5 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
603-183-00-0 |
2-[2-(2-Butoxyethoxy)ethoxy]ethanol; TEGBE; Triethylenglycolmonobutylether; Butoxytriethylenglycol |
205-592-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
Eye Dam.1; H318: C≥30 % Eye Irrit. 2; H319: 20 % ≤C< 30 % |
|
|
|
603-184-00-6 |
2-(Hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl]-1,3-propanediol |
416-380-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-185-00-1 |
2,4-Dichlor-3-ethyl-6-nitrophenol |
420-740-1 |
Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H410 |
|
|
|
|
|
603-186-00-7 |
trans-(5RS,6SR)-6-Amino-2,2-dimethyl-1,3-dioxepan-5-ol |
419-050-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
603-187-00-2 |
2-((4,6-Bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3,5-triazin-2-yl)(2-hydroxyethyl)amino)ethanoldichlorid |
419-360-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-188-00-8 |
Reaktionsmasse aus 6,7-Epoxy-1,2,3,4,5,6,7,8-octahydro-1,1,2,4,4,7-hexamethylnaphthalin und 7,8-Epoxy-1,2,3,4,6,7,8,8a-octahydro-1,1,2,4,4,7-hexamethylnaphthalin |
426-970-9 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
603-189-00-3 |
Reaktionsmasse aus Komplexen vonTitan, 2,2'-Oxydiethanol, Ammoniumlactat, Nitrilotris(2-propanol) und Ethylenglycol |
405-250-8 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-190-00-9 |
8,8-Dimethyl-7-isopropyl-6,10-dioxaspiro[4.5]decan |
424-030-2 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
603-191-00-4 |
2-(4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol |
419-740-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-192-00-X |
(E,E)-3,7,11-Trimethyldodeca-1,4,6,10-tetraen-3-ol |
423-240-1 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
603-193-00-5 |
Dinatrium-9,10-anthracendioxid |
426-030-8 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
603-194-00-0 |
2-(2-Aminoethylamino)ethanol; (AEEA) |
203-867-5 |
Repr. 1B Skin Corr. 1B Skin Sens. 1 |
H360Df H314 H317 |
GHS05 GHS08 GHS07 Dgr |
H360Df H314 H317 |
|
STOT SE 3; H335: C≥5 % |
|
|
|
603-195-00-6 |
2-[4-(4-Methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol |
430-810-3 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
603-196-00-1 |
2-(7-Ethyl-1H-indol-3-yl)ethanol |
431-020-1 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
|
603-197-00-7 |
Tebuconazol (ISO); 1-(4-Chlorphenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol |
403-640-2 |
Repr. 2 Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H361d*** H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d*** H302 H410 |
|
M = 1 M = 10 |
|
|
|
603-199-00-8 |
Etoxazol (ISO); (RS)-5-tert-Butyl-2-[2-(2,6-difluorphenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetol |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 |
|
|
|
603-200-00-1 |
1-Pentanol [1]; 3-Pentanol [2] |
200-752-1 [1] 209-526-7 [2] |
71-41-0 [1] 584-02-1 [2] |
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H226 H332 H335 H315 |
GHS02 GHS07 Wng |
H226 H332 H335 H315 |
|
|
|
|
603-201-00-7 |
(E)-(7R,11R)-3,7,11,15-Tetramethylhexadec-2-en-1-ol |
416-120-5 |
— |
Skin Irrit. 2 Aquatic Chronic 4 |
H315 H413 |
GHS07 Wng |
H315 H413 |
|
|
|
|
603-202-00-2 |
4,4,5,5,5-Pentafluorpentan-1-ol |
421-360-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
603-203-00-8 |
(1R,3S,7R,8R,10R,13R)-5,5,7,9,9,13-Hexamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecan |
427-580-1 |
— |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
603-204-00-3 |
Reaktionsmasse aus 2,2'-(Heptan-1,7-diyl)bis-1,3-dioxolan und 2,2'-(Heptan-1,6-diyl)bis-1,3-dioxolan |
428-110-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-205-00-9 |
(1S-cis)-4-(2-Amino-6-chlor-9H-purin-9-yl)-2-cyclopenten-1-methanolhydrochlorid |
426-200-1 |
STOT RE 1 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H372** H302 H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H372** H302 H318 H317 H412 |
|
|
|
|
|
603-206-00-4 |
2,2-Dichlor-1,3-benzodioxol |
426-850-6 |
Flam. Liq. 3 Skin Corr. 1A Acute Tox. 4 * Skin Sens. 1 |
H226 H314 H302 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H314 H302 H317 |
EUH014 |
|
|
|
|
603-207-00-X |
2-Isobutyl-2-isopropyl-1,3-dimethoxypropan |
430-800-9 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
603-208-00-5 |
1,2-Diethoxyethan |
211-076-1 |
Flam. Liq. 2 Repr. 1A Eye Irrit. 2 |
H225 H360Df H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H360Df H319 |
EUH019 |
|
|
|
|
603-209-00-0 |
Spinosad (ISO) (Reaktionsmasse aus Spinosyn A und Spinosyn D im Verhältnis von 95:5 bis 50:50); Reaktionsmasse aus 50-95 % (2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-2-(6-Deoxy-2,3,4-tri-O-methyl-α-l-mannopyranosyloxy)-13-(4-dimethyl amino-2,3,4,6-tetradeoxy-β-d-erythropyranosyloxy)-9-ethyl-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-14-methyl-1H-8-oxacyclododeca[b]as-indacen-7,15-dion und 50-5 % (2S,3aR,5aS,5bS,9S,13S,14R,16aS,16bS)-2-(6-Deoxy-2,3,4-tri-O-methyl-α-l-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-d-erythropyranosyloxy)-9-ethyl-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-4,14-dimethyl-1H-8-oxacyclododeca[b]as-indacen-7,15- dion [1]; Spinosyn A [2]; Spinosyn D [3] |
- [1] - [2] - [3] |
- [1] 131929-60-7 [2] 131929-63-0 [3] |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M=10 |
|
|
603-210-00-6 |
2,4-Diethyl-1,5-pentandiol |
429-310-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
603-211-00-1 |
2,3-Epoxypropyltrimethylammoniumchlorid … %; Glycidyltrimethylammoniumchlorid … % |
221-221-0 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H361f*** H312 H302 H373** H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H350 H341 H361f*** H312 H302 H373** H318 H317 H412 |
|
|
B |
|
|
603-212-00-7 |
1,3,4,6,7,8-Hexahydro-4,6,6,7,8,8-hexamethylindeno[5,6-c]pyran; Galaxolid; (HHCB) |
214-946-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-213-00-2 |
2-Methoxy-2-methylbutan; tert-Amylmethylether |
213-611-4 |
Flam. Liq. 2 Acute Tox. 4 * STOT SE 3 |
H225 H302 H336 |
GHS02 GHS07 Dgr |
H225 H302 H336 |
|
|
|
|
|
603-214-00-8 |
1,1-Diisopropoxycyclohexan |
413-740-8 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
603-215-00-3 |
1-Hydroxy-4-fluor-1,4-diazoniabicyclo[2.2.2]octanbis(tetrafluorborat) |
418-330-2 |
Expl. 1.1**** Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H302 H373** H318 H317 H400 H410 |
GHS01 GHS05 GHS08 GHS07 GHS09 Dgr |
H201 H302 H373** H318 H317 H410 |
|
|
|
|
|
603-216-00-9 |
cis-1-Amino-2,3-dihydro-1H-inden-2-ol |
422-660-2 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
603-217-00-4 |
2,4,6-Tri-tert-butylphenyl-2-butyl-2-ethyl-1,3-propandiolphosphit |
423-560-1 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
603-220-00-0 |
1-{Benzyl[2-(2-methoxyphenoxy)ethyl]amino}-3-(9H-carbazol-4-yloxy)propan-2-ol |
432-890-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-221-00-6 |
1-(2-Amino-5-chlorphenyl)-2,2,2-trifluor-1,1-ethandiol, Hydrochlorid; [Gehalt an 4-Chloranilin (EG-Nr. 203-401-0) < 0,1 %] |
433-580-2 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
|
|
|
|
|
603-221-01-3 |
1-(2-Amino-5-chlorphenyl)-2,2,2-trifluor-1,1-ethandiol, Hydrochlorid; [Gehalt an 4-Chloranilin (EG-Nr. 203-401-0) ≥ 0,1 %] |
433-580-2 |
Carc. 1B Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H350 H302 H314 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H350 H302 H314 H411 |
|
|
|
|
|
603-222-00-1 |
(2R,3S,4R,5R,7R,9R,10R,11S,12S,13R)-10-[(4-Dimethylamino-3-hydroxy-6-methyltetrahydropyran-2-yl)oxy]-2-ethyl-3,4,12-trihydroxy-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradecan |
433-820-6 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-223-00-7 |
2-Cyclopentyliden-cyclopentanol; 1,1'-Bi(cyclopentyliden)-2-ol |
434-270-1 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
|
603-224-00-2 |
3-Ethoxy-1,1,1,2,3,4,4,5,5,6,6,6- dodecafluor-2-(trifluormethyl)-hexan |
435-790-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-225-00-8 |
Erythromycin A9-oxim (E); (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-4-((2,6-didesoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopiranosyl)oxy)-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexamethyl-6-((3,4,6-tridesoxy-3-dimethylamino-β-d-xylohexapiranosyl)oxy)oxacyclotetradecan-2-ona-10-oxim (E) |
437-070-0 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
603-226-00-3 |
4,4'(4-(4-Methoxyphenyl)-1,3,5-triazin-2,4-diyl)bisbenzol-1,3-diol |
444-500-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
603-227-00-9 |
α-Hydro-ω-[[[(1,1-dimethylethyl)dioxy]carbonyl]oxy]-poly[oxy(methyl-1,2-ethandiyl)]ether mit 2,2-Bis(hydroxymethyl)-1,3-propandiol (4:1); Reaktionsprodukt von: α-Hydro-ω-((chlorcarbonyl)oxy)-poly(oxy(methyl-1,2-ethandiyl))ether mit 2,2-Bis(hydroxymethyl)-1,3-propandiol mit Kalium-1,1-dimethylethylperoxalat |
445-060-2 |
**** Aquatic Acute 1 Aquatic Chronic 1 |
**** H400 H410 |
**** GHS09 Wng |
**** H410 |
|
|
|
|
|
603-228-00-4 |
(+/–)-(R*,R*)-6-Fluor-3,4-dihydro-2-oxiranyl-2H-1-benzopyran; 6-Fluor-2-(2-oxiranyl)chroman |
419-620-1 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
603-229-00-X |
Natrium-(Z)-3-chlor-3-(4-chlorphenyl)-1-hydroxy-2-propen-1-sulfonat |
420-800-7 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
603-230-00-5 |
2,6,6,7,8,8-Hexamethyldecahydro-2H-indeno[4,5-b]furan |
440-030-5 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 4 |
H315 H318 H413 |
GHS05 Dgr |
H315 H318 H413 |
|
|
|
|
603-231-00-0 |
(S)-1,1-Diphenyl-1,2-propandiol |
443-220-6 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-232-00-6 |
3,3,8,8,10,10-Hexamethyl-9-[1-(4-oxiranylmethoxyphenyl)ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecan |
444-420-6 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-233-00-1 |
Reaktionsmasse aus 4-(1,3a,4,6,7,7a-Hexahydro-4,7-methanoinden-5-yliden)-3-methylbutan-2-ol, 4-(3,3a,4,6,7,7a-Hexahydro-4,7-methanoinden-5-yliden)-3-methylbutan-2-ol; 1-(1,3a,4,6,7,7a-Hexahydro-4,7-methanoinden-5-yliden)pentan-3-ol; 1-(3,3a,4,6,7,7a-Hexahydro-4,7-methanoinden-5-yliden)pentan-3-ol; (E)-4-(3a,4,5,6,7,7a-Hexahydro-1H-4,7-methanoinden-5-yl)-3-methylbut-3-en-2-ol; (E)-4-(3a,4,5,6,7,7a-Hexahydro-3H-4,7-methanoinden-5-yl)-3-methylbut-3-en-2-ol |
444-430-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-234-00-7 |
(1R,4R)-4-Methoxy-2,2,7,7-tetramethyltricyclo(6.2.1.0(1,6))undec-5-en |
444-480-3 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
603-235-00-2 |
Linalool: 3,7-Dimethyl-1,6-octadien-3-ol; DL-Linalool; [1] Coriandrol; (S)-3,7-Dimethyl-1,6-octadien-3-ol; D-Linalool; [2] Licareol; (R)-3,7-Dimethyl-1,6-octadien-3-ol; L-Linalool [3] |
201-134-4 [1] 204-810-7 [2] 204-811-2 [3] |
78-70-6 [1] 126-90-9 [2] 126-91-0 [3] |
Skin Sens. 1B |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
603-236-00-8 |
Ethanol, 2,2’-Iminobis-, N-(verzweigte und lineare C13-15-Akyl)-Derivate |
308-208-6 |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
|
|
|
|
603-237-00-3 |
Ipconazol (ISO); (1RS,2SR,5RS;1RS,2SR,5SR)-2-(4-chlorbenzyl)-5-isopropyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
— |
Repr. 1B Acute Tox. 4 STOT RE 2 Aquatic Chronic 1 |
H360D H302 H373 (Augen, Haut, Leber) H410 |
GHS08 GHS07 GHS09 Dgr |
H360D H302 H373 (Augen, Haut, Leber) H410 |
|
oral: ATE = 500 mg/kg KG M = 100 |
|
|
|
603-238-00-9 |
Bis(2-(2-methoxyethoxy)ethyl)ether; Tetraethylenglycoldimethylether |
205-594-7 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
603-239-00-4 |
Paclobutrazol (ISO); (2RS,3RS)-1-(4-Chlorphenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pentan-3-ol |
— |
Repr. 2 Acute Tox. 4 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H332 H302 H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H332 H302 H319 H410 |
|
Einatmen: ATE = 3,13 mg/L (Stäube oder Nebel) oral: ATE = 490 mg/kg KG M = 10 M = 10 |
|
|
|
603-240-00-X |
2,2-Bis(brommethyl)propan-1,3-diol |
221-967-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
|
|
|
603-241-00-5 |
Geraniol; (2E)-3,7-Dimethylocta-2,6-dien-1-ol |
203-377-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
603-243-00-6 |
2,2-Dimethylpropan-1-ol, Tribromderivat; 3-Brom-2,2-bis(brommethyl)propan-1-ol; |
253-057-0 — |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
|
|
|
|
603-244-00-1 |
Reaktionsmasse aus 1-(2,3-Epoxypropoxy)-2,2-bis ((2,3-Epoxypropoxy)methyl)butan und 1-(2,3-Epoxypropoxy)-2-((2,3-Epoxypropoxy)methyl)-2-hydroxymethylbutan |
— |
— |
Muta. 2 Repr. 1B |
H341 H360F |
GHS08 Dgr |
H341 H360F |
|
|
|
|
603-245-00-7 |
2,2’-[[3-methyl-4-[(4-nitrophenyl)azo]phenyl]imino]bisethanol |
221-665-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
603-246-00-2 |
3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoroctan-1-ol |
211-477-1 |
STOT RE 2 Aquatic Chronic 1 |
H373 (Zähne, Knochen) H410 |
GHS08 GHS09 Wng |
H373 (Zähne, Knochen) H410 |
|
M = 1 |
|
|
|
604-001-00-2 |
Phenol; Carbolsäure; Monohydroxybenzol; Phenylalcohol |
203-632-7 |
Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Corr. 1B |
H341 H331 H311 H301 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H341 H331 H311 H301 H373 ** H314 |
|
* Skin Corr. 1B; H314: C ≥ 3 % Skin Irrit. 2; H315 1 % ≤ C<3 % Eye Irrit. 2; H319:1 % ≤C<3 % |
|
|
|
604-002-00-8 |
Pentachlorphenol; PCP |
201-778-6 |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H311 H301 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H330 H311 H301 H319 H335 H315 H410 |
|
|
|
|
|
604-003-00-3 |
Natriumpentachlorphenolat [1]; Kaliumpentachlorphenolat [2] |
205-025-2 [1] 231-911-3 [2] |
131-52-2 [1] 7778-73-6 [2] |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H311 H301 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H330 H311 H301 H319 H335 H315 H410 |
|
|
|
|
604-004-00-9 |
m-Kresol [1]; o-Kresol [2]; p-Kresol [3]; gemischtes Kresol Methylphenol [4] |
203-577-9 [1] 202-423-8 [2] 203-398-6 [3] 215-293-2 [4] |
108-39-4 [1] 95-48-7 [2] 106-44-5 [3] 1319-77-3 [4] |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H311 H301 H314 |
GHS06 GHS05 Dgr |
H311 H301 H314 |
|
* |
C |
|
604-005-00-4 |
1,4-Dihydroxybenzol; Hydrochinon; Chinol |
204-617-8 |
Carc. 2 Muta. 2 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H341 H302 H318 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H351 H341 H302 H318 H317 H400 |
|
M=10 |
|
|
|
604-006-00-X |
3,4-Xylenol; 2,3-Dimethylphenol [1]; 2,5-Xylenol; 2,5-Dimethylphenol [2]; 2,4-Xylenol; 2,4-Dimethylphenol [3]; 2,3-Xylenol [4]; 2,6-Xylenol; 2,6-Dimethylphenol [5]; Xylenol [6]; 2,4-(oder 2,5)-Xylenol [7] |
202-439-5 [1] 202-461-5 [2] 203-321-6 [3] 208-395-3 [4] 209-400-1 [5] 215-089-3 [6] 276-245-4 [7] |
95-65-8 [1] 95-87-4 [2] 105-67-9 [3] 526-75-0 [4] 576-26-1 [5] 1300-71-6 [6] 71975-58-1 [7] |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H311 H301 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H301 H314 H411 |
|
|
C |
|
604-007-00-5 |
2-Naphthol; β-Naphthol |
205-182-7 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
|
|
|
|
|
604-008-00-0 |
2-Chlorphenol; o-Chlorophenol [1]; 4-Chlorphenol; p-Chlorophenol [2]; 3-Chlorphenol; m-Chlorophenol [3]; Chlorphenol [4] |
202-433-2 [1] 203-402-6 [2] 203-582-6 [3] 246-691-4 [4] |
95-57-8 [1] 106-48-9 [2] 108-43-0 [3] 25167-80-0 [4] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H312 H302 H411 |
GHS07 GHS09 Wng |
H332 H312 H302 H411 |
|
|
C |
|
604-009-00-6 |
Pyrogallol; 1,2,3-Trihydroxybenzol |
201-762-9 |
Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H341 H332 H312 H302 H412 |
GHS08 GHS07 Wng |
H341 H332 H312 H302 H412 |
|
* |
|
|
|
604-010-00-1 |
Resorcin; 1,3-Dihydroxybenzol |
203-585-2 |
Acute Tox. 4 STOT SE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1B Aquatic Acute 1 |
H302 H370 (Nervensystem) H315 H319 H317 H400 |
GHS07 GHS08 GHS09 Dgr |
H302 H370 (Nervensystem) H315 H319 H317 H400 |
|
Oral: ATE = 500 mg/kg KG M = 1 |
|
|
|
604-011-00-7 |
2,4-Dichlorphenol |
204-429-6 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H311 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H411 |
|
|
|
|
|
604-012-00-2 |
4-Chlor-o-kresol; 4-Chlor-2-methylphenol |
216-381-3 |
Acute Tox. 3 * Skin Corr. 1A Aquatic Acute 1 |
H331 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H314 H400 |
|
STOT SE 3; H335: C≥1 % |
|
|
|
604-013-00-8 |
2,3,4,6-Tetrachlorphenol |
200-402-8 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H319 H315 H400 H410 |
GHS06 GHS09 Dgr |
H301 H319 H315 H410 |
|
* Eye Irrit. 2; H319:C≥5 % Skin Irrit. 2; H315: C≥5 % |
|
|
|
604-014-00-3 |
Chlorkresol; 4-Chlor-m-kresol; 4-Chlor-3-methylphenol |
200-431-6 |
Acute Tox. 4 Skin Corr. 1C Eye Dam. 1 STOT SE 3 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 3 |
H302 H314 H318 H335 H317 H400 H412 |
GHS07 GHS05 GHS09 Dgr |
H302 H314 H335 H317 H410 |
|
M = 1 |
|
|
|
604-015-00-9 |
2,2'-Methylenbis(3,4,6-trichlorphenol); Hexachlorophen |
200-733-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
* |
|
|
|
604-016-00-4 |
1,2-Dihydroxybenzol; Brenzcatechin |
204-427-5 |
Carc. 1Β Muta. 2 Acute Tox. 3 Acute Tox. 3 Skin Irrit. 2 Eye Irrit. 2 |
H350 H341 H311 H301 H315 H319 |
GHS08 GHS06 Dgr |
H350 H341 H311 H301 H315 H319 |
|
Oral: ATE = 300 mg/kg KG Dermal: ATE = 600 mg/kg KG |
|
|
|
604-017-00-X |
2,4,5-Trichlorphenol |
202-467-8 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
* Eye Irrit. 2; H319: C≥5 % Skin Irrit.2; H315: C ≥5 % |
|
|
|
604-018-00-5 |
2,4,6-Trichlorphenol |
201-795-9 |
Carc. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H319 H315 H410 |
|
|
|
|
|
604-019-00-0 |
Dichlorophen (ISO); 2,2'-Methylenbis(4-chlorphenol) |
202-567-1 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
|
604-020-00-6 |
2-Phenylphenol (ISO); Biphenyl-2-ol; 2-Hydroxybiphenyl |
201-993-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
|
|
|
|
|
604-021-00-1 |
Natrium-2-biphenylat; 2-Phenylphenol, Natriumsalz |
205-055-6 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H302 H335 H315 H318 H400 |
GHS05 GHS07 GHS09 Wng |
H302 H335 H315 H318 H400 |
|
|
|
|
|
604-022-00-7 |
2,2-Dimethyl-1,3-benzodioxol-4-ol |
400-900-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
604-023-00-2 |
2,4-Dichlor-3-ethylphenol |
401-060-4 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
604-024-00-8 |
4,4-Isobutylethylidendiphenol |
401-720-1 |
Repr. 1B Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360F *** H319 H400 H410 |
GHS08 GHS09 Dgr |
H360F *** H319 H410 |
|
|
|
|
|
604-025-00-3 |
2,5-Bis(1,1-dimethylbutyl)hydrochinon |
400-220-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-026-00-9 |
2,2-Spirobi(6-hydroxy-4,4,7-trimethylchroman) |
400-270-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-027-00-4 |
2-Methyl-5-(1,1,3,3-tetramethylbutyl)hydrochinon |
400-530-6 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
604-028-00-X |
4-Amino-3-fluorphenol |
402-230-0 |
Carc. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H302 H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H411 |
|
|
|
|
|
604-029-00-5 |
1-Naphtol |
201-969-4 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H335 H315 H318 |
GHS05 GHS07 Dgr |
H312 H302 H335 H315 H318 |
|
|
|
|
|
604-030-00-0 |
4,4’-Isopropylidendiphenol; Bisphenol A |
201-245-8 |
Repr. 1B STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360F H335 H318 H317 H400 H410 |
GHS08 GHS07 GHS05 GHS09 Dgr |
H360F H335 H318 H317 H410 |
|
M = 1 M = 10 |
|
|
|
604-031-00-6 |
Guajakol; 2-Methoxyphenol |
201-964-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
|
604-032-00-1 |
Thymol |
201-944-8 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
|
|
|
|
|
604-033-00-7 |
Isobutylbut-3-enoat; Butensäureisobutylester |
401-170-2 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
|
604-034-00-2 |
4,4'-Thiodi-o-kresol |
403-330-7 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
|
604-035-00-8 |
4-Nonylphenol, Reaktionsprodukte mit Formaldehyd und Dodecan-1-thiol |
404-160-6 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
604-036-00-3 |
4,4'-Oxybis(ethylenthio)diphenol |
404-590-4 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
604-037-00-9 |
3,5-Xylenol; 3,5-Dimethylphenol |
203-606-5 |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H311 H301 H314 |
GHS06 GHS05 Dgr |
H311 H301 H314 |
|
|
|
|
|
604-038-00-4 |
4-Chlor-3,5-dimethylphenol; 4-Chlor-3,5-dimethylphenol [1]; Chlorxylenol [2] |
201-793-8 [1] 215-316-6 [2] |
88-04-0 [1] 1321-23-9 [2] |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H302 H319 H315 H317 |
GHS07 Wng |
H302 H319 H315 H317 |
|
|
|
|
604-039-00-X |
Ethyl-2-[4-[(6-chlorbenzoxazol-2-yl)oxy]phenoxy]propionat; Fenoxaprop-ethyl |
266-362-9 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
604-040-00-5 |
Fomesafen (ISO); 5-[2-Chlor-4-(trifluormethyl)phenoxy]-N-(methylsulfonyl)-2-nitrobenzamid |
276-439-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
604-041-00-0 |
Acifluorfen (ISO); 5-[2-Chlor-4-(trifluormethyl)phenoxy]-2-nitrobenzoesäure [1]; Natrium-5-[2-chlor-4-(trifluormethyl) phenoxy]-2-nitrobenzoat; Acifluorfen-Natrium [2] |
256-634-5 [1] 263-560-7 [2] |
50594-66-6 [1] 62476-59-9 [2] |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
|
|
604-042-00-6 |
4-Nitrosophenol |
203-251-6 |
Muta. 2 Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H341 H302 H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H341 H302 H318 H411 |
|
|
|
|
|
604-043-00-1 |
Monobenzon; 4-Hydroxyphenylbenzylether; Hydrochinonmonobenzylether |
203-083-3 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
|
604-044-00-7 |
Mequinol; 4-Methoxyphenol; Hydrochinonmonomethylether |
205-769-8 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
|
604-045-00-2 |
2,3,5-Trimethylhydrochinon |
211-838-3 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H335 H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H332 H335 H315 H318 H317 H410 |
|
|
|
|
|
604-046-00-8 |
4-(4-Isopropoxyphenylsulfonyl)phenol |
405-520-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
604-047-00-3 |
4-(4-Tolyloxy)biphenyl |
405-730-7 |
STOT RE 2 * Aquatic Chronic 4 |
H373 ** H413 |
GHS08 Wng |
H373 ** H413 |
|
|
|
|
|
604-048-00-9 |
4,4',4''-(Ethan-1,1,1-triyl)triphenol |
405-800-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
604-049-00-4 |
4-4'-Methylenbis(oxyethylenthio)diphenol |
407-480-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
604-051-00-5 |
3,5-Bis((3,5-di-tert-butyl-4-hydroxy)benzyl)-2,4,6-trimethylphenol |
401-110-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
604-052-00-0 |
2,2'-Methylenbis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol) |
403-800-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
604-053-00-6 |
2-Methyl-4-(1,1-dimethylethyl)-6-(1-methylpentadecyl)phenol |
410-760-9 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
|
604-054-00-1 |
Reaktionsmasse aus 2-Methoxy-4-(tetrahydro-4-methylen-2H-pyran-2-yl)-phenol; 4-(3,6-Dihydro-4-methyl-2H-pyran-2-yl)-2-methoxyphenol |
412-020-0 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
604-055-00-7 |
2,2'-((3,3',5,5'-Tetramethyl-(1,1'-biphenyl)-4,4'-diyl)-bis(oxymethylen))bisoxiran |
413-900-7 |
Carc. 2 Skin Sens. 1 |
H351 H317 |
GHS08 GHS07 Wng |
H351 H317 |
|
|
|
|
|
604-056-00-2 |
2-(2-Hydroxy-3,5-dinitroanilin)ethanol |
412-520-9 |
Flam. Sol. 2 Repr. 2 Acute Tox. 4 * |
H228 H361f *** H302 |
GHS02 GHS07 GHS08 Dgr |
H228 H361f *** H302 |
|
|
|
|
|
604-057-00-8 |
Reaktionsmasse aus Isomeren von 2-(2H-Benzotriazol-2-yl)-4-methyl-(n)-dodecylphenol; Isomeren von 2-(2H-Benzotriazol-2-yl)-4-methyl-(n)-tetracosylphenol; Isomeren von 2-(2H-Benzotriazol-2-yl)-4-methyl-5,6-didodecylphenol; n = 5 oder 6 |
401-680-5 |
— |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
604-058-00-3 |
1,2-Bis(3-methylphenoxy)ethan |
402-730-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
604-059-00-9 |
2-n-Hexadecylhydrochinon |
406-400-5 |
— |
STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H373 ** H315 H317 H413 |
GHS08 GHS07 Wng |
H373 ** H315 H317 H413 |
|
|
|
|
604-060-00-4 |
9,9-Bis(4-hydroxyphenyl)fluoren |
406-950-6 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
|
604-061-00-X |
Reaktionsmasse aus 2-Chlor-5-sec-tetradecylhydrochinonen mit sec-Tetradecyl= 1-Methyltridecyl; 1-Ethyldodecyl; 1-Propylundecyl; 1-Butyldecyl; 1-Pentylnonyl; 1-Hexyloctyl |
407-740-7 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
|
|
|
|
604-062-00-5 |
2,4-Dimethyl-6-(1-methylpentadecyl)phenol |
411-220-5 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
604-063-00-0 |
5,6-Dihydroxyindol |
412-130-9 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
604-064-00-6 |
2-(4,6-Diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)phenol |
411-380-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
604-065-00-1 |
4,4',4''-(1-Methylpropan-1-yl-3-yliden)tris(2-cyclohexyl-5-methylphenol) |
407-460-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
604-066-00-7 |
Reaktionsmasse aus Phenol, 6-(1,1-Dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-Verbindung) und Methan, 2,2'-Bis[6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenyl)] (C45-Verbindung); 2,6-Bis(1,1-dimethylethyl)-4-tetra-propylphenol und 2-(1,1-Dimethylethyl)-4-tetrapropylphenol; 2,6-Bis[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol und 2-[(6-(1,1-Dimethylethyl)-1-hydroxy-4-tetrapropylphenylmethyl]-6-[1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol |
414-550-8 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
604-067-00-2 |
Reaktionsmasse aus 2,2'-[[(2-Hydroxyethyl)imino]bis(methylen)bis[4-dodecylphenol]; Formaldehyd, Oligomer mit 4-Dodecylphenol und 2-Aminoethanol (n = 2); Formaldehyd, Oligomer mit 4-Dodecylphenol und 2-Aminoethanol (n = 3, 4 und höher) |
414-520-4 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
604-068-00-8 |
(±)-4-[2-[[3-(4-Hydroxyphenyl)-1-methylpropyl]amino]-1-hydroxyethyl]phenolhydrochlorid |
415-170-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 |
H332 H302 H317 |
GHS07 Wng |
H332 H302 H317 |
|
|
|
|
|
604-069-00-3 |
2-(1-Methylpropyl)-4-tert-butylphenol |
421-740-4 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
|
|
604-070-00-9 |
Triclosan; 2,4,4'-Trichlor-2'-hydroxydiphenylether; 5-Chlor-2-(2,4-dichlorphenoxy)phenol |
222-182-2 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
M = 100 |
|
|
|
604-071-00-4 |
4,4'-(1-{4-[1-(4-Hydroxyphenyl)-1-methylethyl]phenyl}ethyliden)diphenol |
425-600-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
604-072-00-X |
1,2-Bis(phenoxymethyl)benzol |
428-620-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
604-073-00-5 |
(E)-3-[1-[4-[2-(Dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
428-010-4 |
Carc. 2 Repr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360F*** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F*** H317 H410 |
|
|
|
|
|
604-074-00-0 |
2,2‘,6,6’-Tetrabrom-4,4’-isopropylidenediphenol; Tetrabrombisphenol-A |
201-236-9 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
604-075-00-6 |
4-(1,1,3,3-Tetramethylbutyl)phenol; 4-tert-Octylphenol |
205-426-2 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
M=10 |
|
|
|
604-076-00-1 |
Phenolphthalein |
201-004-7 |
Carc. 1B Muta. 2 Repr. 2 |
H350 H341 H361f*** |
GHS08 Dgr |
H350 H341 H361f*** |
|
Carc. 1B; H350: C ≥1 % |
|
|
|
604-077-00-7 |
2-Benzotriazol-2-yl-4-methyl-6-(2-methylallyl)phenol |
419-750-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
604-079-00-8 |
4,4'-(1,3-Phenylen-bis(1-methylethyliden))bisphenol |
428-970-4 |
Repr. 2 Skin Sens. 1 Aquatic Chronic 2 |
H361f*** H317 H411 |
GHS08 GHS07 GHS09 Wng |
H361f*** H317 H411 |
|
|
|
|
|
604-080-00-3 |
4-Fluor-3-trifluormethylphenol |
432-560-0 |
Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 Aquatic Chronic 2 |
H332 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H314 H317 H411 |
|
|
|
|
|
604-081-00-9 |
1,1-Bis(4-hydroxyphenyl)-1-phenylethan |
433-130-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
604-082-00-4 |
2-Chlor-6-fluorphenol |
433-890-8 |
Muta. 1B Repr. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H340 H361f*** H302 H314 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H340 H361f*** H302 H314 H317 H411 |
|
|
|
|
|
▼M22 ————— |
||||||||||
|
604-084-00-5 |
1-Ethoxy-2,3-difluorbenzol |
441-000-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
604-087-00-1 |
Reaktionsmasse aus 1,2-Naphthochinondiazid-5-sulfonylchlorid (oder Sulfonsäure)monoester mit 4,4'-(1-(4-(1-(4-Hydroxyphenyl)-1-methylethyl)phenyl)ethyliden)bisphenol; 1,2-Naphthochinondiazid-5-sulfonylchlorid (oder Sulfonylsäure)diester mit 4,4'-(1-(4-(1-(4-Hydroxyphenyl)-1-methylethyl)phenyl)ethyliden)bisphenol; 1,2-Naphthochinondiazid-5-sulfonylchlorid (oder Sulfonsäure)triester with 4,4'-(1-(4-(1-(4-Hydroxyphenyl)-1-methylethyl)phenyl)ethyliden)bisphenol |
433-640-8 |
— |
Pyr. Sol. 1 Aquatic Chronic 4 |
H250 H413 |
GHS02 Dgr |
H250 H413 |
EUH044 |
|
|
|
604-089-00-2 |
2-Methyl-5-tert-butylthiophenol |
444-970-7 |
— |
Flam. Liq. 3 Repr. 2 STOT RE 2 * Asp. Tox. 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H361d*** H373** H304 H319 H315 H317 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H361d*** H373** H304 H319 H315 H317 H336 H410 |
|
|
|
|
604-090-00-8 |
4-tert-Butylphenol |
202-679-0 |
Repr. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 1 |
H361f H315 H318 H410 |
GHS08 GHS05 GHS09 Dgr |
H361f H315 H318 H410 |
|
M = 1 |
|
|
|
604-091-00-3 |
Etofenprox (ISO); 2-(4-Ethoxyphenyl)-2-methylpropyl-3-phenoxybenzylether |
407-980-2 |
Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
|
M = 100 M = 1 000 |
|
|
|
604-092-00-9 |
Phenol, dodecyl-, verzweigt; [1] Phenol, 2-dodecyl-, verzweigt; [2] Phenol, 3-dodecyl-, verzweigt; [3] Phenol, 4-dodecyl-, verzweigt; [4] Phenol, (tetrapropenyl) Derivate [5] |
310-154-3 [1] [2] [3] [4] [5] |
121158-58-5 [1] [2] [3] 210555-94-5 [4] 74499-35-7 [5] |
Repr. 1B Skin Corr. 1C Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360F H314 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H360F H314 H410 |
|
M = 10 M = 10 |
|
|
604-093-00-4 |
Clorofen; Chlorophen; 2-Benzyl-4-chlorphenol |
204-385-8 |
Carc. 2 Repr. 2 Acute Tox. 4 Skin Irrit. 2 Skin Sens. 1 Eye Dam. 1 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361f H332 H315 H317 H318 H373 (Nieren) H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H361f H332 H315 H317 H318 H373 (Nieren) H410 |
|
M = 1 M = 100 |
|
|
|
604-094-00-X |
Isoeugenol; [1] (E)-2-Methoxy-4-(prop-1-enyl)phenol; [2] (Z)-2-Methoxy-4-(prop-1-enyl)phenol [3] |
202-590-7 [1] 227-678-2 [2] 227-633-7 [3] |
97-54-1 [1] 5932-68-3 [2] 5912-86-7 [3] |
Skin Sens. 1A |
H317 |
GHS07 Wng |
H317 |
|
Skin Sens. 1A; H317: C ≥ 0,01 % |
|
|
604-095-00-5 |
6,6’-Di-tert-butyl-2,2’-methylendi-p-kresol; [DBMK] |
204-327-1 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
604-096-00-0 |
Piperonylbutoxid (ISO); 2-(2-Butoxyethoxy)ethyl-6-propylpiperonylether |
200-076-7 |
STOT SE 3 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H319 H400 H410 |
GHS07 GHS09 Wng |
H335 H319 H410 |
EUH066 |
M = 1 M = 1 |
|
|
|
604-097-00-6 |
2,4,6-Tri-tert-butylphenol |
211-989-5 |
Repr. 1B Acute Tox. 4 STOT RE 2 Skin Sens. 1B |
H360D H302 H373 (Leber) H317 |
GHS08 GHS07 Dgr |
H360D H302 H373 (Leber) H317 |
|
Oral: ATE = 500 mg/kg KG |
|
|
|
604-098-00-1 |
4,4’-Sulfonyldiphenol; Bisphenol S |
201-250-5 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
604-099-00-7 |
4,4’-[2,2,2-Trifluor-1-(trifluormethyl)ethyliden]diphenol; Bisphenol AF |
216-036-7 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
604-100-00-0 |
Nonylphenol, verzweigt und linear, ethoxyliert (mit durchschnittlicher Molmasse ≤ 1 540 g/mol) [einschließlich Ortho-, Meta-, Para-Isomeren oder einer beliebigen Kombination daraus] |
500-315-8 500-024-6 500-045-0 500-209-1 248-762-5 243-816-4 248-291-5 — 230-770-5 248-743-1 247-555-7 248-293-6 — und andere |
1119449-38-5 7311-27-5 27942-27-4 26264-02-8 27177-05-5 14409-72-4 und andere |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 1 M = 10 |
|
|
605-001-00-5 |
Formaldehyd …% |
200-001-8 |
Carc. 1B Muta. 2 Acute Tox. 3* Acute Tox. 3* Acute Tox. 3* Skin Corr. 1B Skin Sens. 1 |
H350 H341 H301 H311 H331 H314 H317 |
GHS08 GHS06 GHS05 Dgr |
H350 H341 H301 H311 H331 H314 H317 |
|
* Skin Corr. 1B; H314: C ≥25 % Skin Irrit. 2; H315: 5 % ≤C < 25 % Eye Irrit. 2; H319: 5 % ≤ C <25 % STOT SE 3; H335: C ≥ 5 % SkinSens.; H317: C ≥ 0,2 % |
B, D |
|
|
605-002-00-0 |
1,3,5-Trioxan; Trioxymethylen |
203-812-5 |
Flam. Sol. 1 Repr. 2 STOT SE 3 |
H228 H361d *** H335 |
GHS02 GHS08 GHS07 Dgr |
H228 H361d *** H335 |
|
|
T |
|
|
605-003-00-6 |
Acetaldehyd; Ethanal |
200-836-8 |
Flam. Liq. 1 Carc. 1B Muta. 2 STOT SE 3 Eye Irrit. 2 |
H224 H350 H341 H335 H319 |
GHS02 GHS08 GHS07 Dgr |
H224 H350 H341 H335 H319 |
|
|
|
|
|
605-004-00-1 |
2,4,6-Trimethyl-1,3,5-trioxan; Paraldehyd |
204-639-8 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
|
605-005-00-7 |
Metaldehyd (ISO); 2,4,6,8-Tetramethyl-1,3,5,7-tetraoxacyclooctan |
203-600-2 |
Flam. Sol. 2 Repr. 2 Acute Tox. 3 Aquatic Chronic 3 |
H228 H361f H301 H412 |
GHS02 GHS08 GHS06 Dgr |
H228 H361f H301 H412 |
|
Oral: ATE = 283 mg/kg KG |
|
|
|
605-006-00-2 |
Butyraldehyd; Butanal |
204-646-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
605-007-00-8 |
1,1-Dimethoxyethan; Dimethylacetal |
208-589-8 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
605-008-00-3 |
Acrolein; Prop-2-enal; Acrylaldehyd; Propenal |
203-453-4 |
Flam. Liq. 2 Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H225 H330 H300 H311 H314 H400 H410 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H225 H330 H300 H311 H314 H410 |
EUH071 |
Skin Corr. 1B; H314:C≥ 0,1 % M = 100 M = 1 |
D |
|
|
605-009-00-9 |
Crotonaldehyd; 2-Butenal [1]; (E)-2-Butenal; (E)-Crotonaldehyd [2] |
224-030-0 [1] 204-647-1 [2] |
4170-30-3 [1] 123-73-9 [2] |
Flam. Liq. 2 Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H225 H341 H330 H311 H301 H373 ** H335 H315 H318 H400 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H341 H330 H311 H301 H373 ** H335 H315 H318 H400 |
|
|
|
|
605-010-00-4 |
2-Furaldehyd; Furfural; 2-Furylmethanal |
202-627-7 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H351 H331 H301 H312 H319 H335 H315 |
GHS06 GHS08 Dgr |
H351 H331 H301 H312 H319 H335 H315 |
|
|
|
|
|
605-011-00-X |
2-Chlorbenzaldehyd; o-Chlorbenzaldehyd |
201-956-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
605-012-00-5 |
Benzaldehyd |
202-860-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
605-013-00-0 |
Chloralose (INN); (R)-1,2-O-(2,2,2-Trichlorethyliden)-α-D-glucofuranose; Glucochloralose; Anhydroglucochloral |
240-016-7 |
Acute Tox. 4* Acute Tox. 3 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H301 H336 H400 H410 |
GHS06 GHS09 Dgr |
H332 H301 H336 H410 |
|
M = 10 M = 10 |
C |
|
|
605-014-00-6 |
Chloralhydrat; 2,2,2-Trichlorethan-1,1-diol |
206-117-5 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H319 H315 |
GHS06 Dgr |
H301 H319 H315 |
|
|
|
|
|
605-015-00-1 |
1,1-Diethoxyethan; Acetal |
203-310-6 |
Flam. Liq. 2 Eye Irrit. 2 Skin Irrit. 2 |
H225 H319 H315 |
GHS02 GHS07 Dgr |
H225 H319 H315 |
|
|
|
|
|
605-016-00-7 |
Glyoxal …%; Ethandial …% |
203-474-9 |
Muta. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H341 H332 H319 H315 H317 |
GHS07 GHS08 Wng |
H341 H332 H319 H315 H317 |
|
* |
B |
|
|
605-017-00-2 |
1,3-Dioxolan |
211-463-5 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
605-018-00-8 |
Propanal; Propionaldehyd |
204-623-0 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
|
|
|
|
|
605-019-00-3 |
Citral; 3,7-Dimethyl-2,6-octadienal |
226-394-6 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
|
605-020-00-9 |
Safrol; 5-Allyl-1,3-benzodioxol; 5-(2-Propenyl)-1,3-benzodioxol |
202-345-4 |
Carc. 1B Muta. 2 Acute Tox. 4 * |
H350 H341 H302 |
GHS08 GHS07 Dgr |
H350 H341 H302 |
|
|
|
|
|
605-021-00-4 |
Formaldehyd, Reaktionsprodukte mit Butylphenol |
294-145-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
605-022-00-X |
Glutaral; Glutaraldehyd; 1,5-Pentandial |
203-856-5 |
Acute Tox. 2 Acute Tox. 3 STOT SE 3 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 A Aquatic Acute 1 Aquatic Chronic 2 |
H330 H301 H335 H314 H334 H317 H400 H411 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H330 H301 H335 H314 H334 H317 H410 |
EUH071 |
STOT SE 3; H335: 0,5 % ≤ C < 5 % M = 1 |
|
|
|
605-023-00-5 |
5-Chlor-2-(4-chlorphenoxy)phenol; [DCPP] |
429-290-0 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
M = 10 M = 10 |
|
|
|
605-024-00-0 |
2-Brom-5-hydroxy-4-methoxybenzaldehyd |
426-540-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
605-025-00-6 |
Chloracetaldehyd |
203-472-8 |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H351 H330 H311 H301 H314 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H330 H311 H301 H314 H400 |
|
STOT SE 3; H335: C≥ 5 % |
|
|
|
605-026-00-1 |
2,5,7,7-Tetramethyloctanal |
405-690-0 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
|
605-027-00-7 |
Reaktionsmasse aus 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H- inden-6-carboxaldehyd; 3a,4,5,6,7,7a-Hexahydro-4,7-methano-1H-inden-5-carboxaldehyd |
410-480-7 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
605-028-00-2 |
β-Methyl-3-(1-methylethyl)-benzolpropanal |
412-050-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
605-029-00-8 |
2-Cyclohexylpropanal |
412-270-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
605-030-00-3 |
1-(p-Methoxyphenyl)acetaldehydoxim |
411-510-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
605-031-00-9 |
Reaktionsmasse aus 2,2-Dimethoxyethanal [diese Komponente gilt in Bezug auf Identität, Struktur und Zusammensetzung als wasserfrei. 2,2-Dimethoxyethanal existiert jedoch in wasserhaltiger Form. 60 % wasserfrei entspricht 70,4 % wasserhaltig; Wasser (einschließlich freiem Wasser und Wasser in hydriertem 2,2-Dimethoxyethanal)] |
421-890-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
605-032-00-4 |
3-[3-(4-Fluorphenyl)-1-(1-methylethyl)-1H-indol-2-yl]-(E)-2-propenal |
425-370-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
605-033-00-X |
Reaktionsmasse aus 3,7,11-Trimethyl-cis-6,10-dodecadienal und 3,7,11-Trimethyl-trans-6,10-dodecadienal |
425-910-9 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
605-034-00-5 |
Reaktionsmasse aus (1RS,2RS,3SR,6RS,9SR)-9-Methoxytricyclo[5.2.1.0(2,6)]decan-3-carbaldehyd; (1RS,2RS,3RS,6RS,8SR)-8-Methoxytricyclo[5.2.1.0(2,6)]decan-3-carbaldehyd und (1RS,2RS,4SR,6RS,8SR)-8-Methoxytricyclo[5.2.1.0(2,6)]decan-4-carbaldehyd |
429-860-9 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
605-035-00-0 |
(E)-3-(4-(4-Fluorphenyl)-5-methoxymethyl-2,6-bis(1-methoxymethyl)pyridin-3-yl)prop-2-enal |
426-330-9 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H319 H317 H413 |
GHS07 Wng |
H319 H317 H413 |
|
|
|
|
|
605-036-00-6 |
2-Brommalonaldehyd |
430-470-6 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
|
605-037-00-1 |
trans-3-[2-(7-Chlor-2-chinolinyl)vinyl]benzaldehyd; 3-[(E)-2-(7-Chlor-2-chinolinyl)vinyl]benzaldehyd |
421-800-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
605-038-00-7 |
3-Methyl-5-phenylpentan-1-al |
433-900-0 |
Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H302 H315 H317 H411 |
GHS07 GHS09 Wng |
H302 H315 H317 H411 |
|
|
|
|
|
605-039-00-2 |
3,4-Dihydroxy-5-nitrobenzaldehyd |
441-810-8 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
|
605-040-00-8 |
Hydroxyisohexyl-3-cyclohexencarboxaldehyd (INCI); Reaktionsmasse von 4-(4-Hydroxy-4-methylpentyl)cyclohex-3-en-1-carbaldehyd und 3-(4-Hydroxy-4-methylpentyl)cyclohex-3-en-1-carbaldehyd; [1] 4-(4-Hydroxy-4-methylpentyl)cyclohex-3-en-1-carbaldehyd; [2] 3-(4-Hydroxy-4-methylpentyl)cyclohex-3-en-1-carbaldehyd; [3] |
- [1] 250-863-4 [2] 257-187-9 [3] |
130066-44-3 [1] 31906-04-4 [2] 51414-25-6 [3] |
Skin Sens. 1 A |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
605-041-00-3 |
2-(4-tert-Butylbenzyl)propionaldehyd |
201-289-8 |
Repr. 1B |
H360Fd |
GHS08 Dgr |
H360Fd |
|
|
|
|
|
606-001-00-8 |
Aceton; Propan-2-on; Propanon |
200-662-2 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
|
606-002-00-3 |
Butanon; Ethylmethylketon |
201-159-0 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
|
606-003-00-9 |
Heptan-3-on; Butylethylketon |
203-388-1 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 |
H226 H332 H319 |
GHS02 GHS07 Wng |
H226 H332 H319 |
|
|
|
|
|
606-004-00-4 |
4-Methylpentan-2-on; Isobutylmethylketon |
203-550-1 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4 STOT SE 3 Eye Irrit. 2 |
H225 H351 H332 H336 H319 |
GHS02 GHS07 GHS08 Dgr |
H225 H351 H332 H336 H319 |
EUH066 |
Einatmen: ATE = 11 mg/L (Dämpfe) |
|
|
|
606-005-00-X |
2,6-Dimethylheptan-4-on; Diisobutylketon |
203-620-1 |
Flam. Liq. 3 STOT SE 3 |
H226 H335 |
GHS02 GHS07 Wng |
H226 H335 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
606-006-00-5 |
3-Pentanon; Diethylketon |
202-490-3 |
Flam. Liq. 2 STOT SE 3 STOT SE 3 |
H225 H335 H336 |
GHS02 GHS07 Dgr |
H225 H335 H336 |
EUH066 |
|
|
|
|
606-007-00-0 |
3-Methylbutan-2-on; Methylisopropylketon |
209-264-3 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
606-009-00-1 |
4-Methylpent-3-en-2-on; Mesityloxid |
205-502-5 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H312 H302 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 |
|
* |
|
|
|
606-010-00-7 |
Cyclohexanon |
203-631-1 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-011-00-2 |
2-Methylcyclohexanon |
209-513-6 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-012-00-8 |
3,5,5-Trimethylcyclohex-2-enon; Isophoron; 3,5,5-Trimethylcyclohex-2-en-1-on |
201-126-0 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H351 H312 H302 H319 H335 |
GHS08 GHS07 Wng |
H351 H312 H302 H319 H335 |
|
STOT SE 3; H335: C ≥10 % |
|
|
|
606-013-00-3 |
p-Benzochinon; Chinon |
203-405-2 |
Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H331 H301 H319 H335 H315 H400 |
GHS06 GHS09 Dgr |
H331 H301 H319 H335 H315 H400 |
|
M=10 |
|
|
|
606-014-00-9 |
Chlorphacinon (ISO); 2-[(4-Chlorphenyl)(phenyl)acetyl]-1H-inden-1,3(2H)-dion |
223-003-0 |
Repr. 1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (Blut) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (Blut) H410 |
|
Repr. 1B; H360D: C ≥ 0,003 % STOT RE 1; H372 (Blut): C ≥ 0,1 % STOT RE 2; H373 (Blut): 0,01 % ≤ C < 0,1 % M = 1 M = 1 |
|
|
|
606-016-00-X |
Pindon (ISO); 2-Pivaloylindan-1,3-dion |
201-462-8 |
Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H372 ** H410 |
|
|
|
|
|
606-017-00-5 |
Diketen; 4-Methylen-2-oxetanon |
211-617-1 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
D |
|
|
606-018-00-0 |
Dichlon (ISO); 2,3-Dichlor-1,4-naphthochinon |
204-210-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
|
606-019-00-6 |
Chlordecon (ISO); Decachlorpentacyclo(5,2,1,02,6,03,9,05,8)decan-4-on |
205-601-3 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H410 |
|
|
|
|
|
606-020-00-1 |
5-Methyl-3-heptanon |
208-793-7 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 |
H226 H319 H335 |
GHS02 GHS07 Wng |
H226 H319 H335 |
|
STOT SE 3; H335: C≥10 % |
|
|
|
606-021-00-7 |
N-Methyl-2-pyrrolidon; 1-Methyl-2-pyrrolidon |
212-828-1 |
Repr. 1B STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H360D*** H335 H315 H319 |
GHS08 GHS07 Dgr |
H360D*** H335 H315 H319 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
606-022-00-2 |
1-Phenyl-3-pyrazolidon |
202-155-1 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
606-023-00-8 |
4-Methoxy-4-methylpentan-2-on; Diacetonalkoholmethylether |
203-512-4 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-024-00-3 |
2-Heptanon; Methylpentylketon; Methylamylketon |
203-767-1 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H302 |
GHS02 GHS07 Wng |
H226 H332 H302 |
|
|
|
|
|
606-025-00-9 |
Cyclopentanon |
204-435-9 |
Flam. Liq. 3 Eye Irrit. 2 Skin Irrit. 2 |
H226 H319 H315 |
GHS02 GHS07 Wng |
H226 H319 H315 |
|
|
|
|
|
606-026-00-4 |
5-Methylhexan-2-on; Isoamylmethylketon |
203-737-8 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-027-00-X |
4-Heptanon; Di-n-propylketon |
204-608-9 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-028-00-5 |
2,4-Dimethylpentan-3-on; Diisopropylketon |
209-294-7 |
Flam. Liq. 2 Acute Tox. 4 * |
H225 H332 |
GHS02 GHS07 Dgr |
H225 H332 |
|
|
|
|
|
606-029-00-0 |
2,4-Pentandion; Acetylaceton |
204-634-0 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H302 |
GHS02 GHS07 Wng |
H226 H302 |
|
|
|
|
|
606-030-00-6 |
2-Hexanon; Methylbutylketon; Butylmethylketon; Methyl-n-butylketon |
209-731-1 |
Flam. Liq. 3 Repr. 2 STOT RE 1 STOT SE 3 |
H226 H361f *** H372 ** H336 |
GHS02 GHS08 GHS07 Dgr |
H226 H361f *** H372 ** H336 |
|
|
|
|
|
606-031-00-1 |
3-Propanolid; 1,3-Propiolacton |
200-340-1 |
Carc. 1B Acute Tox. 2 * Eye Irrit. 2 Skin Irrit. 2 |
H350 H330 H319 H315 |
GHS06 GHS08 Dgr |
H350 H330 H319 H315 |
|
|
|
|
|
606-032-00-7 |
Hexachloraceton |
204-129-5 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
606-033-00-2 |
2-(3,4-Dichlorphenyl)-4-methyl-1,2,4-oxadiazolidindion; Methazol |
243-761-6 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H312 H302 H319 H315 H411 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H411 |
|
|
|
|
|
606-034-00-8 |
Metribuzin (ISO); 4-Amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-on; 4-Amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-on |
244-209-7 |
Acute Tox. 4 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 (Blutkreislauf) H400 H410 |
GHS07 GHS08 GHS09 Wng |
H302 H373 (Blutkreislauf) H410 |
|
Oral: ATE = 320 mg/kg KG M = 10 M = 10 |
|
|
|
606-035-00-3 |
Chloridazon (ISO); 5-Amino-4-chlor-2-phenylpyridazin-3-(2H)-on; Pyrazon |
216-920-2 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
606-036-00-9 |
Chinomethionat (ISO); 6-Methyl-1,3-dithiolo(4,5-b)chinoxalin-2-on |
219-455-3 |
Repr. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H332 H312 H302 H373 ** H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f *** H332 H312 H302 H373 ** H319 H317 H410 |
|
|
|
|
|
606-037-00-4 |
Triadimefon (ISO); 1-(4-Chlorphenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanon |
256-103-8 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
606-038-00-X |
Diphacinon (ISO); 2-Diphenylacetylindan-1,3-dion |
201-434-5 |
Acute Tox. 2 * STOT RE 1 |
H300 H372 ** |
GHS06 GHS08 Dgr |
H300 H372 ** |
|
|
|
|
|
606-039-00-5 |
5(oder 6)-tert-Butyl-2'-chlor-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthen)-3-on |
400-680-2 |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H400 H410 |
GHS07 GHS09 Wng |
H332 H410 |
|
|
|
|
606-040-00-0 |
(N-Benzyl-N-ethyl)amino-3-hydroxyacetophenonhydrochlorid |
401-840-4 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
|
606-041-00-6 |
2-Methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-on |
400-600-6 |
Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H360FD H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H360FD H302 H411 |
|
|
|
|
|
606-042-00-1 |
Acetophenon; Methyl-phenylketon |
202-708-7 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
|
606-043-00-7 |
2,4-Di-tert-butylcyclohexanon |
405-340-7 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
606-044-00-2 |
2,4,6-Trimethylbenzophenon |
403-150-9 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
|
606-045-00-8 |
Oxadiazon (ISO); 3-[2,4-Dichlor-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-on |
243-215-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-046-00-3 |
Reaktionsmasse aus cis- und trans-Cyclohexadec-8-en-1-on |
401-700-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-047-00-9 |
2-Benzyl-2-dimethylamino-4′-morpholinobutyrophenon |
404-360-3 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D H400 H410 |
GHS08 GHS09 Dgr |
H360D H41 |
|
|
|
|
|
606-048-00-4 |
2'-Anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-on |
406-480-1 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-049-00-X |
4-(trans-4-Propylcyclohexyl)acetophenon |
406-700-6 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-050-00-5 |
6-Anilino-1-benzoyl-4-(4-tert-pentylphenoxy)naphto[1,2,3-de]chinolin-2,7-(3H)-dion |
412-480-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-051-00-0 |
4-Pentylcyclohexanon |
406-670-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-052-00-6 |
4-(N,N-Dibutylamino)-2-hydroxy-2'-carboxybenzophenon |
410-410-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
606-053-00-1 |
Flurtamon (ISO); (RS)-5-Methylamino-2-phenyl-4-(α, α,α-trifluor-m-tolyl)furan-3(2H)-on |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-054-00-7 |
Isoxaflutol (ISO); 5-Cyclopropyl-1,2-oxazol-4-yl α,α,α-trifluor-2-mesyl-p-tolyl keton |
— |
Repr. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d*** H400 H410 |
GHS08 GHS09 Wng |
H361d*** H410 |
|
M = 10 M = 100 |
|
|
|
606-055-00-2 |
1-(2,3-Dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)ethanon |
411-180-9 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
|
606-056-00-8 |
4-Chlor-3',4'-dimethoxybenzophenon |
404-610-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-057-00-3 |
4-Propylcyclohexanon |
406-810-4 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
606-058-00-9 |
4'-Fluor-2,2-dimethoxyacetophenon |
407-500-1 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
606-059-00-4 |
2,4-Difluor-α-(1H-1,2,4-triazol-1-yl)acetophenonhydrochlorid |
412-390-3 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
|
606-060-00-X |
Reaktionsmasse aus trans-2,4-Dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethylnaphthalin-2-yl)-1,3-dioxolan; cis-2,4-Dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethylnaphthalin-2-yl)-1,3-dioxolan |
412-950-7 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-061-00-5 |
(3-Chlorphenyl)-(4-methoxy-3-nitrophenyl)methanon |
423-290-4 |
Muta. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H400 H410 |
GHS08 GHS09 Wng |
H341 H410 |
|
|
|
|
|
606-062-00-0 |
Tetrahydrothiopyran-3-carboxaldehyd |
407-330-8 |
Repr. 1B Eye Dam. 1 Aquatic Chronic 3 |
H360D *** H318 H412 |
GHS08 GHS05 Dgr |
H360D *** H318 H412 |
|
|
|
|
|
606-063-00-6 |
(E)-3-(2-Chlorphenyl)-2-(4-fluorphenyl)propenal |
410-980-5 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
|
606-064-00-1 |
Pregn-5-en-3,20-dionbis(ethylenketal) |
407-450-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-065-00-7 |
1-(4-Morpholinophenyl)butan-1-on |
413-790-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-066-00-2 |
(E)-5[(4-Chlorphenyl)methylen]-2,2-dimethylcyclopentanon |
410-440-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-067-00-8 |
Reaktionsmasse aus 1-(2,3,6,7,8,9-Hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanon; 1-(2,3,5,6,7,8-Hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanon; 1-(2,3,6,7,8,9-Hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanon; 1-(2,3,6,7,8,9-Hexahydro-3,3-dimethyl-1H-benz(g)inden-5-yl)ethanon |
414-870-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-068-00-3 |
2,7,11-Trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al |
415-770-7 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373 ** H317 H412 |
GHS08 GHS07 Wng |
H373 ** H317 H412 |
|
|
|
|
|
606-069-00-9 |
Spiro[1,3-dioxolan-2,5'-(4',4',8',8'-Tetramethylhexahydro-3',9'-methannaphthalin)] |
415-460-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-070-00-4 |
Butroxydim (ISO); 5-(3-Butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-on |
414-790-3 |
Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361fd H302 H315 H410 |
|
|
|
|
|
606-071-00-X |
17-Spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-dien-3-on |
421-050-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-072-00-5 |
3-Acetyl-1-phenylpyrrolidin-2,4-dion |
421-600-2 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
|
606-073-00-0 |
4,4'-Bis(dimethylamino)benzophenon; Michlers Keton |
202-027-5 |
Carc. 1B Muta. 2 Eye Dam. 1 |
H350 H341 H318 |
GHS08 GHS05 Dgr |
H350 H341 H318 |
|
|
|
|
|
606-074-00-6 |
Reaktionsmasse aus (1R*,2S*)-2-Acetyl-1,2,3,4,5,6,7,8-octahydro-1,2,8,8-tetramethylnaphthalin und (2R*,3S*)-2-Acetyl-1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethylnaphthalin |
425-570-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-075-00-1 |
1-Benzyl-5-ethoxyimidazolidin-2,4-dion |
417-340-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
606-076-00-7 |
1-((2-Chinolinylcarbonyl)oxy)-2,5-pyrrolidindion |
418-630-3 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
606-077-00-2 |
(3S,4S)-3-Hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanon |
418-650-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-078-00-8 |
1-Octylazepin-2-on |
420-040-6 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
|
606-079-00-3 |
2-n-Butylbenzo[d]isothiazol-3-on |
420-590-7 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
|
▼M1 ————— |
||||||||||
|
606-081-00-4 |
(3β,5α,6β)-3-(Acetyloxy)-5-brom-6-hydroxyandrostan-17-on |
419-790-7 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
606-082-00-X |
Reaktionsmasse aus Butan-2-on-oxim und syn-O,O'-Di(butan-2-on-oxim)diethoxysilan |
406-930-7 |
|
STOT RE 1 Skin Sens. 1 Aquatic Chronic 3 |
H372 ** H317 H412 |
GHS08 GHS07 Dgr |
H372 ** H317 H412 |
|
|
|
|
606-083-00-5 |
2-Chlor-5-sec-hexadecylhydrochinon |
407-750-1 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H315 H317 H412 |
GHS07 Wng |
H319 H315 H317 H412 |
|
|
|
|
|
606-084-00-0 |
1-(4-Methoxy-5-benzofuranyl)-3-phenyl-1,3-propandion |
414-540-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-085-00-6 |
(1R,4S)-2-Azabicyclo[2.2.1]hept-5-en-3-on |
418-530-1 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
|
606-086-00-1 |
1-(3,3-Dimethylcyclohexyl)pent-4-en-1-on |
422-330-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-087-00-7 |
6-Ethyl-5-fluor-4(3H)-pyrimidon |
422-460-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
606-088-00-2 |
2,4,4,7-Tetramethyl-6-octen-3-on |
422-520-0 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
606-089-00-8 |
Reaktionsmasse aus 1,4-Diamino-2-chlor-3-phenoxyanthrachinon und 1,4-Diamino-2,3-bis-phenoxyanthrachinon |
423-220-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-090-00-3 |
1-[3-[(Dimethylamino)methyl]-4-hydroxyphenyl]ethanon |
430-920-1 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
606-091-00-9 |
6-Chlor-5-(2-chlorethyl)-1,3-dihydroindol-2-on |
421-320-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-092-00-4 |
Reaktionsmasse aus (E)-Oxacyclohexadec-12-en-2-on; (E)-Oxacyclohexadec-13-en-2-on; a) (Z)-Oxacyclohexadec-(12)-en-2-on und b) (Z)-Oxacyclohexadec-(13)-en-2-on |
422-320-3 |
|
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-093-00-X |
5-Ethyl-2,4-dihydro-4-(2-phenoxyethyl)-3H-1,2,4-triazol-3-on |
414-470-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
606-094-00-5 |
N-[Ethyl(3-methylbutyl)amino]-3-methyl-1-phenylspiro[[1]benzo-pyrano[2,3-c]pyrazol-4(1H),1'(3'H)-isobenzofuran]-3'-on |
417-460-7 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-095-00-0 |
(R, S)-2-Azabicyclo[2.2.1]hept-5-en-3-on |
421-830-3 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
|
606-096-00-6 |
3-(6-O-(6-Desoxy-α-l-mannopyranosyl-O-(α-D-glucopyranosyl)-(β-D-glucopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-on |
424-170-4 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
606-097-00-1 |
2,2''-Dihydroxy-4,4''-(2-hydroxy-propan-1,3-diyldioxy)dibenzophenon |
424-210-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-098-00-7 |
1-Benzyl-5-(hexadecyloxy)-2,4-imidazolidindion |
431-220-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-099-00-2 |
5-Methoxy-4'-(trifluormethyl)valerophenon |
425-000-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-100-00-6 |
2-Butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-on |
425-150-8 |
Repr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H360F*** H302 H317 H412 |
GHS08 GHS07 Dgr |
H360F*** H302 H317 H412 |
|
|
|
|
|
606-101-00-1 |
Reaktionsmasse aus 1,5-Bis[(2-ethylhexyl)amino]-9,10-anthracendion; 1-[(2-Ethylhexyl)amino]-5-[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracendion; 1,5-Bis[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracendion; 1-[(2-Ethylhexyl)amino]-5-[(3-methoxypropyl)amino]-9,10-anthracendion; 1-[3-[(2-Ethylhexyl)oxy]propyl]amino-5-[(3-methoxypropyl)amino]-9,10-anthracendion und 1,5-Bis[(3-methyloxypropyl)amino]-9,10-anthracendion |
426-050-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-102-00-7 |
4-(3-Triethoxysilylpropoxy)-2-hydroxybenzophenon |
431-490-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-103-00-2 |
1-(4-(trans-4-Ethylcyclohexyl)phenyl)ethanon |
426-460-6 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
606-104-00-8 |
1-(4-(trans-4-Pentylcyclohexyl)phenyl)ethanon |
426-830-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-105-00-3 |
3,4,3',4'-Tetraphenyl-1,1'-ethandiylbispyrol-2,5-dion |
431-500-0 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-106-00-9 |
1-(4-(trans-4-Butylcyclohexyl)phenyl)ethanon |
427-320-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-107-00-4 |
8-Azaspiro[4.5]decan-7,9-dion |
427-770-4 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
|
|
606-108-00-X |
1,1,1,2,2,4,5,5,5-Nonafluor-4-(trifluormethyl)-3-pentanon |
436-710-6 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
606-109-00-5 |
2-(4-Methyl-3-pentenyl)anthrachinon |
428-320-1 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 4 |
H302 H317 H413 |
GHS07 Wng |
H302 H317 H413 |
|
|
|
|
|
606-110-00-0 |
5-Ethoxy-5H-furan-2-on |
428-330-4 |
Skin Corr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 |
H314 H312 H302 H373** H317 |
GHS05 GHS08 GHS07 Dgr |
H314 H312 H302 H373** H317 |
|
|
|
|
|
606-111-00-6 |
5-Amino-6-methyl-1,3-dihydrobenzoimidazol-2-on |
428-410-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
606-112-00-1 |
(4aR*,8aR*)-4a,5,9,10,11,12-Hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-on |
428-690-2 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 3 |
H302 H319 H412 |
GHS07 Wng |
H302 H319 H412 |
|
|
|
|
|
606-113-00-7 |
1-[4-(4-Benzoylphenylsulfanyl)phenyl]-2-methyl-2-(4-methylphenylsulfonyl)propan-1-on |
429-040-0 |
Eye Dam. 1 Aquatic Chronic 4 |
H318 H413 |
GHS05 Dgr |
H318 H413 |
|
|
|
|
|
606-114-00-2 |
4,4',5,5',6,6',7,7'-Octachlor-(2,2')biisoindolyl-1,1',3,3'-tetraon |
429-150-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-115-00-8 |
Profoxydim (ISO); 2-{(EZ)-1-[(2RS)-2-(4-Chlorphenoxy)propoxyimino]butyl}-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-on |
— |
Carc. 2 Repr. 2 Skin Sens. 1 |
H351 H361d H317 |
GHS08 GHS07 Wng |
H351 H361d H317 |
|
|
|
|
|
606-116-00-3 |
Tepraloxydim (ISO); (RS)-(EZ)-2-{1-[(2E)-3-Chlorallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-on |
— |
Carc. 2 Repr. 2 |
H351 H361fd |
GHS08 Wng |
H351 H361fd |
|
|
|
|
|
606-117-00-9 |
2,6-Bis(1,1-dimethylethyl)-4-(phenylenmethylen)cyclohexa-2,5-dien-1-on |
429-460-4 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-118-00-4 |
N-(1,3-Dimethylbutyl)-N'-(phenyl)-1,4-benzochinondiimin |
429-640-2 |
Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
|
|
|
|
|
606-119-00-X |
(E)-3-Methyl-5-cyclopentadecen-1-on |
429-900-5 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
606-120-00-5 |
2,5-Dihydroxy-5-methyl-3-(morpholin-4-yl)-2-cyclopenten-1-on |
430-170-5 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
606-121-00-0 |
(+)-(1S,2S,3S,5R)-2,6,6-Trimethylbicyclo[3.1.1]heptan-3-spiro-1'-(cyclohex-2'-en-4'-on) |
430-460-1 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
|
606-122-00-6 |
3-(2-Brompropionoyl)-4,4-dimethyl-1,3-oxazolan-2-on |
430-820-8 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373** H315 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373** H315 H318 H317 H410 |
|
|
|
|
|
606-123-00-1 |
4-Hexadecyl-1-phenylpyrazolidin-3-on |
430-840-7 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
606-124-00-7 |
1-Cyclopropyl-3-(2-methylthio-4-trifluormethylphenyl)-1,3-propandion |
421-080-7 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373** H400 H410 |
GHS08 GHS09 Wng |
H373** H410 |
|
|
|
|
|
606-125-00-2 |
1-Benzylimidazolidin-2,4-dion |
421-340-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
606-126-00-8 |
1,4-Bis(2,3-dihydroxypropylamino)anthrachinon |
421-470-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-128-00-9 |
2,2'-(1,3-Phenylen)bis[5-chlor-1H-isoindol]-1,3(2H)-dion |
422-650-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-129-00-4 |
5-Amino-[2S-di(methylphenyl)amino]-1,6-diphenyl-4Z-hexen-3-on; (2S,4Z)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-on |
423-090-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-130-00-X |
4-(1,4-Dioxa-spiro[4.5]dec-8-yl)-cyclohexanon |
423-860-2 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
606-131-00-5 |
3-(1,2-Ethandiylacetal)-estra-5(10),9(11)-dien-3,17-dion, zyklisch |
427-230-8 |
Repr. 1B STOT RE 2 * Aquatic Chronic 2 |
H360F*** H373** H411 |
GHS08 GHS09 Dgr |
H360F*** H373** H411 |
|
|
|
|
|
606-132-00-0 |
(6β)-6,19-Epoxyandrost-4-en-3,17-dion |
433-490-3 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
606-134-00-1 |
Androsta-1,4,9(11)-trien-3,17-dion |
433-560-3 |
Repr. 2 |
H361f*** |
GHS08 Wng |
H361f*** |
|
|
|
|
|
606-135-00-7 |
Cyclohexadecanon |
438-930-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-136-00-2 |
(3S,6R,9S,12R,15S,18R,21S,24R)-6,18-Dibenzyl-3,9,15,21-tetraisobutyl-4,10,12,16,22,24-hexamethyl-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclotetracosan-2,5,8,11,14,17,20,23-octaon |
444-350-6 |
Eye Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
|
|
|
|
|
606-137-00-8 |
trans-7,7'-Dimethyl-(4H,4H')-(2,2')bi[benzo[1,4]thiazinyliden]-3,3'-dion |
444-750-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-138-00-3 |
(2-Butyl-5-nitrobenzofuran-3-yl)[4-(3-dibutylaminopropoxy)phenyl]methanon |
444-800-1 |
Flam. Liq. 3 Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H373** H315 H318 H317 H400 H410 |
GHS02 GHS05 GHS08 GHS07 GHS09 Dgr |
H226 H302 H373** H315 H318 H317 H410 |
|
M=10 |
|
|
|
606-139-00-9 |
(S)-4-(3,4-Dichlorphenyl)-3,4-dihydro-2H-naphthalen-1-on |
444-830-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-140-00-4 |
2-Hydroxy-1-(4-(4-(2-hydroxy-2-methylpropionyl)benzyl)phenyl)-2-methylpropan-1-on |
444-860-9 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373** H400 H410 |
GHS08 GHS09 Wn |
H373** H410 |
|
|
|
|
|
606-141-00-X |
Natrium-3-(methoxycarbonyl)-4-oxo-3,4,5,6-tetrahydro-2-pyridinolat |
418-410-7 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
606-142-00-5 |
Reaktionsmasse aus (1RS,2SR,7SR,8SR, E)-9 und 10-Ethyliden-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-on; (1RS,2SR,7SR,8SR, Z)-10-Ethyliden-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-on; (1RS,2SR,7SR,8SR, Z)-9-Ethyliden-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-on |
434-290-9 |
— |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
606-143-00-0 |
Abamectin (Kombination von Avermectin B1a und Avermectin B1b) (ISO) [1]; Avermectin B1a (Reinheit ≥ 80 %); [2] |
_ [1] 265-610-3 [2] |
71751-41-2 [1] 65195-55-3 [2] |
Repr. 2 Acute Tox. 2 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H300 H330 H372 (Nerven-system) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d H300 H330 H372 (Nerven-system) H410 |
|
STOT RE 1; H372: C ≥ 5 % STOT RE 2; H373: 0,5 % ≤C< 5 % M = 10 000 |
|
|
606-144-00-6 |
Acequinocyl (ISO); 3-Dodecyl-1,4-dioxo-1,4-dihydronaphthalin-2-ylacetat |
— |
Skin Sens. 1 STOT SE 1 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H370 (Lunge) (Einatmen) H373 (Blutkreislauf) H400 H410 |
GHS07 GHS08 GHS09 Dgr |
H317 H370 (Lunge) (Einatmen) H373 (Blutkreislauf) H410 |
|
M = 1 000 |
|
|
|
606-145-00-1 |
Sulcotrion (ISO); 2-[2-Chlor-4-(methylsulfonyl)benzoyl]cyclohexan-1,3-dion |
|
Repr. 2 STOT RE 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H361d H373 (Nieren) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H373 (Nieren) H317 H410 |
|
M = 1 M = 10 |
|
|
|
606-146-00-7 |
Tralkoxydim (ISO); 2-(N-Ethoxypropanimidoyl)-3-hydroxy-5-mesitylcyclohex-2-en-1-on |
— |
Carc. 2 Acute Tox. 4 Aquatic Chronic 2 |
H351 H302 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H411 |
|
|
|
|
|
606-147-00-2 |
Cycloxydim (ISO); 2-(N-Ethoxybutanimidoyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)cyclohex-2-en-1-on |
405-230-9 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
|
606-148-00-8 |
Carvon (ISO); 2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-on; [1] d-Carvon; (5S)-2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-on; [2] l-Carvon; (5R)-2-Methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-on [3] |
202-759-5 [1] 218-827-2 [2] 229-352-5 [3] |
99-49-0 [1] 2244-16-8 [2] 6485-40-1 [3] |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
606-149-00-3 |
Tembotrion (ISO); 2-{2-Chlor-4-(methylsulfonyl)-3-[(2,2,2-trifluorethoxy)methyl]benzoyl}cyclohexan-1,3-dion |
— |
Repr. 2 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H373 (Augen, Nieren, Leber) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H373 (Augen, Nieren, Leber) H317 H410 |
|
M = 100 M = 10 |
|
|
|
606-150-00-9 |
Clethodim (ISO); (5RS)-2-{(1EZ)-1-[(2E)-3-Chlorallyloxyimino]propyl}-5-[(2RS)-2-(ethylthio)propyl]-3-hydroxycyclohex-2-en-1-on |
— |
Acute Tox. 4 Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
EUH066 |
|
|
|
|
606-151-00-4 |
Anthrachinon |
201-549-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
606-152-00-X |
(5-Chlor-2-methoxy-4-methyl-3-pyridyl)(4,5,6-trimethoxy-o-tolyl)methanon; Pyriofenon |
— |
Carc. 2 Aquatic Chronic 1 |
H351 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 1 |
|
|
|
606-153-00-5 |
Benzophenon |
204-337-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
606-154-00-0 |
Quinoclamin (ISO); 2-Amino-3-chlor-1,4-naphthochinon |
220-529-2 |
Carc. 2 Repr. 2 Acute Tox. 4 STOT RE 2 Eye Irrit. 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d H302 H373 (Blutkreislauf, Nieren) H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361d H302 H373 (Blutkreislauf, Nieren) H319 H317 H410 |
|
Oral: ATE = 500 mg/kg KG M = 10 M = 10 |
|
|
|
606-155-00-6 |
Zimtaldehyd; 3-Phenylprop-2-enal; Zimtaldehyd; Cinnamal; [1] (2E)-3-phenylprop-2-enal [2] |
203-213-9 [1] — [2] |
104-55-2 [1] 14371-10-9 [2] |
Skin Sens. 1A |
H317 |
GHS07 Wng |
H317 |
|
►C21 Skin Sens. 1A; H317: C ≥ 0,01 % ◄ |
|
|
607-001-00-0 |
Ameisensäure … % |
200-579-1 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 90 % Skin Corr. 1B; H314: 10 % ≤ C < 90 % Skin Irrit. 2; H315: 2 % ≤C < 10 % Eye Irrit. 2; H319: 2 %≤ <10 % |
B |
|
|
607-002-00-6 |
Essigsäure … % |
200-580-7 |
Flam. Liq. 3 Skin Corr. 1A |
H226 H314 |
GHS02 GHS05 Dgr |
H226 H314 |
|
Skin Corr. 1A; H314: C ≥90 % Skin Corr. 1B; H314: 25 %≤ C <90 % Skin Irrit. 2; H315: 10 % ≤C <25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
|
607-003-00-1 |
Chloressigsäure |
201-178-4 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H331 H311 H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H400 |
|
STOT SE 3; H335: C≥ 5 % |
|
|
|
607-004-00-7 |
TCA (ISO); Trichloressigsäure |
200-927-2 |
Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
|
607-005-00-2 |
TCA-Natrium (ISO); Natriumtrichloracetat; Trichloressigsäure, Natriumsalz |
211-479-2 |
STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H400 H410 |
GHS07 GHS09 Wng |
H335 H410 |
|
|
|
|
|
607-006-00-8 |
Oxalsäure |
205-634-3 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
* |
|
|
|
607-007-00-3 |
Salze der Oxalsäure, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
* |
A |
|
607-008-00-9 |
Essigsäureanhydrid |
203-564-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H302 H314 |
|
Skin Corr. 1B; H314: C ≥ 2 % Skin Irrit. 2; H315: 5 % ≤C < 25 % Eye Dam. 1; H318: 5 % ≤ C < 25 % Eye Irrit. 2; H319: 1 % ≤C < 5 % STOT SE 3; H335: C ≥ 5 % |
|
|
|
607-009-00-4 |
Phthalsäureanhydrid |
201-607-5 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H335 H315 H318 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H335 H315 H318 H334 H317 |
|
|
|
|
|
607-010-00-X |
Propionsäureanhydrid |
204-638-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
|
|
607-011-00-5 |
Acetylchlorid; Essigsäurechlorid |
200-865-6 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
EUH014 |
|
|
|
|
607-012-00-0 |
Benzoylchlorid |
202-710-8 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H332 H312 H302 H314 H317 |
GHS05 GHS07 Dgr |
H332 H312 H302 H314 H317 |
|
|
|
|
|
607-013-00-6 |
Dimethylcarbonat |
210-478-4 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
607-014-00-1 |
Methylformiat; Ameisensäuremethylester |
203-481-7 |
Flam. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H224 H332 H302 H319 H335 |
GHS02 GHS07 Dgr |
H224 H332 H302 H319 H335 |
|
|
|
|
|
607-015-00-7 |
Ethylformiat; Ameisensäureethylester |
203-721-0 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H225 H332 H302 H319 H335 |
GHS02 GHS07 Dgr |
H225 H332 H302 H319 H335 |
|
|
|
|
|
607-016-00-2 |
Propylformiat; Ameisensäure-n-propylester [1]; Isopropylformiat Ameisensäureisopropylester [2] |
203-798-0 [1] 210-901-2 [2] |
110-74-7 [1] 625-55-8 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 STOT SE 3 |
H225 H319 H335 H336 |
GHS02 GHS07 Dgr |
H225 H319 H335 H336 |
|
|
C |
|
607-017-00-8 |
Butylformiat [1]; tert-Butylformiat [2]; Isobutylformiat [3] |
209-772-5 [1] 212-105-0 [2] 208-818-1 [3] |
592-84-7 [1] 762-75-4 [2] 542-55-2 [3] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H335 |
GHS02 GHS07 Dgr |
H225 H319 H335 |
|
|
C |
|
607-018-00-3 |
Isopentylformiat; 3-Methylbutylformiat [1]; 2-Methylbutylformiat [2] |
203-769-2 [1] 252-343-2 [2] |
110-45-2 [1] 35073-27-9 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H335 |
GHS02 GHS07 Dgr |
H225 H319 H335 |
|
|
C |
|
607-019-00-9 |
Methylchlorformiat; Chlorameisensäuremethylester |
201-187-3 |
Flam. Liq. 2 Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H330 H312 H302 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H330 H312 H302 H314 |
|
|
|
|
|
607-020-00-4 |
Ethylchlorformiat; Chlorameisensäureethylester |
208-778-5 |
Flam. Liq. 2 Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H225 H330 H302 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H330 H302 H314 |
|
|
|
|
|
607-021-00-X |
Methylacetat; Essigsäuremethylester |
201-185-2 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
|
607-022-00-5 |
Ethylacetat; Essigsäureethylester |
205-500-4 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
|
607-023-00-0 |
Vinylacetat |
203-545-4 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4 STOT SE 3 |
H225 H351 H332 H335 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H332 H335 |
|
|
D |
|
|
607-024-00-6 |
Propylacetat [1]; Isopropylacetat [2] |
203-686-1 [1] 203-561-1 [2] |
109-60-4 [1] 108-21-4 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
C |
|
607-025-00-1 |
n-Butylacetat |
204-658-1 |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
EUH066 |
|
|
|
|
607-026-00-7 |
sec-Butylacetat; 1-Methylpropylacetat [1]; Isobutylacetat; 2-Methylpropylacetat [2]; tert-Butylacetat 1,1-Dimethylethylacetat [3] |
203-300-1 [1] 203-745-1 [2] 208-760-7 [3] |
105-46-4 [1] 110-19-0 [2] 540-88-5 [3] |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH066 |
|
C |
|
607-027-00-2 |
Methylpropionat; Propionsäuremethylester |
209-060-4 |
Flam. Liq. 2 Acute Tox. 4 * |
H225 H332 |
GHS02 GHS07 Dgr |
H225 H332 |
|
|
|
|
|
607-028-00-8 |
Ethylpropionat; Propionsäureethylester |
203-291-4 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
607-029-00-3 |
n-Butylpropionat [1]; sec-Butylpropionat; Propionsäure-(1-methylpropyl)ester [2]; Isobutylpropionat [3] |
209-669-5 [1] - [2] 208-746-0 [3] |
590-01-2 [1] 591-34-4 [2] 540-42-1 [3] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
607-030-00-9 |
Propylpropionat |
203-389-7 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
607-031-00-4 |
Butylbutyrat |
203-656-8 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
|
607-032-00-X |
Ethylacrylat |
205-438-8 |
Flam. Liq. 2 Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H225 H331 H312 H302 H335 H315 H319 H317 |
GHS02 GHS06 Dgr |
H225 H331 H312 H302 H335 H315 H319 H317 |
|
Inhalation: ATE = 9 mg/L (Dämpfe) dermal: ATE = 1 800 mg/kg KG Oral: ATE = 1 120 mg/kg KG STOT SE 3; H335: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % |
D |
|
|
607-033-00-5 |
n-Butylmethacrylat |
202-615-1 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H226 H319 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H317 |
|
|
D |
|
|
607-034-00-0 |
Methylacrylat; Methlproenoat |
202-500-6 |
Flam. Liq. 2 Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H225 H331 H312 H302 H335 H315 H319 H317 |
GHS02 GHS06 Dgr |
H225 H331 H312 H302 H335 H315 H319 H317 |
|
Inhalation: ATE = 3 mg/L (Dämpfe) dermal: ATE = 1 100 mg/kg KG Oral: ATE = 500 mg/kg KG |
D |
|
|
607-035-00-6 |
Methylmethacrylat; Methyl-2-methylprop-2-enoat; Methyl-2-methylpropenoat |
201-297-1 |
Flam. Liq. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H335 H315 H317 |
|
|
D |
|
|
607-036-00-1 |
2-Methoxyethylacetat; Methylglycolacetat |
203-772-9 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H360FD H332 H312 H302 |
GHS08 GHS07 Dgr |
H360FD H332 H312 H302 |
|
|
|
|
|
607-037-00-7 |
2-Ethoxyethylacetat; Ethylglycolacetat |
203-839-2 |
Flam. Liq. 3 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H360FD H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H360FD H332 H312 H302 |
|
|
|
|
|
607-038-00-2 |
2-Butoxyethylacetat; Butylglycolacetat |
203-933-3 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 |
GHS07 Wng |
H332 H312 |
|
|
|
|
|
607-039-00-8 |
2,4-D (ISO); 2,4-Dichlorphenoxyessigsäure |
202-361-1 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H335 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H335 H318 H317 H412 |
|
|
|
|
|
607-040-00-3 |
Salze der 2,4-D |
— |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
A |
|
607-041-00-9 |
2,4,5-T (ISO); 2,4,5-Trichlorphenoxyessigsäure |
202-273-3 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
|
|
|
607-042-00-4 |
Salze und Ester der 2,4,5-T; Salze und Ester der 2,4,5-Trichlorphenoxyessigsäure |
— |
— |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
A |
|
607-043-00-X |
Dicamba (ISO); 2,5-Dichlor-6-methoxybenzoesäure; 3,6-Dichlor-2-methoxybenzoesäure |
217-635-6 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
607-044-00-5 |
3,6-Dichlor-o-anissäure, Verbindung mit Dimethylamin (1:1) [1]; Kalium-3,6-dichlor-o-anisat [2] |
218-951-7 [1] 233-002-7 [2] |
2300-66-5 [1] 10007-85-9 [2] |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
607-045-00-0 |
Dichlorprop (ISO); 2-(2,4-Dichlorphenoxy)propionsäure |
204-390-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H315 H318 |
GHS05 GHS07 Dgr |
H312 H302 H315 H318 |
|
|
|
|
|
607-046-00-6 |
Salze von Dichlorprop |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
A |
|
607-047-00-1 |
Fenoprop (ISO); 2-(2,4,5-Trichlorphenoxy)propionsäure |
202-271-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
607-048-00-7 |
Salze von Fenoprop; Salze der 2-(2,4,5-Trichlorphenoxy)propionsäure |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
A |
|
607-049-00-2 |
Mecoprop (ISO); 2-(4-Chlor-o-tolyloxy)propionsäure; (RS)-2-(4-chlor-o-tolyloxy)propionsäure [1]; 2-(4-Chlor-2-methylphenoxy)propionsäure [2] |
230-386-8 [1] 202-264-4 [2] |
7085-19-0 [1] 708519-0 [2] |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
M=100 |
|
|
607-050-00-8 |
Salze von Mecoprop |
— |
— |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
A |
|
607-051-00-3 |
MCPA (ISO); 4-Chlor-o-tolyloxyessigsäure |
202-360-6 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
|
|
|
607-052-00-9 |
Salze und Ester von MCPA |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
A |
|
607-053-00-4 |
MCPB (ISO); 4-(4-Chlor-o-tolyloxy)buttersäure |
202-365-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-054-00-X |
Salze und Ester von MCPB |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
A |
|
607-055-00-5 |
Endothal-Natrium (ISO); Dinatrium-7-oxabicyclo(2,2,1)heptan-2,3-dicarboxylat |
204-959-8 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H301 H312 H319 H335 H315 |
GHS06 Dgr |
H301 H312 H319 H335 H315 |
|
|
|
|
|
607-056-00-0 |
Warfarin (ISO); 4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-on; [1] (S)-4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyron; [2] (R)-4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyron; [3] |
201-377-6 [1] 226-907-3 [2] 226-908-9 [3] |
81-81-2 [1] [2] [3] |
Repr. 1 A Acute Tox. 1 Acute Tox. 1 Acute Tox. 2 STOT RE 1 Aquatic Chronic 2 |
H360D H330 H310 H300 H372 (Blut) H411 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (Blut) H411 |
|
Repr. 1 A; H360D: C ≥ 0,003 % STOT RE 1; H372 (Blut): C ≥ 0,5 % STOT RE 2; H373 (Blut): 0,05 % ≤ C < 0,5 % |
|
|
607-057-00-6 |
Coumachlor (ISO); 3-[1-(4-Chlorphenyl)-3-oxobutyl]-4-hydroxycoumarin |
201-378-1 |
STOT RE 2 * Aquatic Chronic 3 |
H373 ** H412 |
GHS08 Wng |
H373 ** H412 |
|
|
|
|
|
607-058-00-1 |
Coumafuryl (ISO); Fumarin; (RS)-3-(1-(2-Furyl)-3-oxobutyl)4-hydroxycumarin; 4-Hydroxy-3-[3-oxo-1-(2-furyl)butyl]cumarin |
204-195-5 |
Acute Tox. 3 * STOT RE 1 Aquatic Chronic 3 |
H301 H372 ** H412 |
GHS06 GHS08 Dgr |
H301 H372 ** H412 |
|
|
|
|
|
607-059-00-7 |
Coumatetralyl (ISO); 4-Hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)cumarin |
227-424-0 |
Repr. 1B Acute Tox. 2 Acute Tox. 3 Acute Tox. 2 STOT RE 1 Aquatic Chronic 1 |
H360D H330 H311 H300 H372 (Blut) H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H311 H300 H372 (Blut) H410 |
|
Repr. 1B; H360D: C ≥ 0,003 % STOT RE 1; H372 (Blut): C ≥ 1,0 % STOT RE 2; H373 (Blut) 0,1 % ≤ C < 1,0 % M = 10 |
|
|
|
607-060-00-2 |
Dicoumarol; 4,4'-Dihydroxy-3,3'-methylenbis(2H-chromen-2-on) |
200-632-9 |
STOT RE 1 Acute Tox. 4 * Aquatic Chronic 2 |
H372 ** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H372 ** H302 H411 |
|
|
|
|
|
607-061-00-8 |
Acrylsäure; Prop-2-ensäure |
201-177-9 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H226 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H314 H400 |
|
STOT SE 3; H335: C ≥ 1 % |
D |
|
|
607-062-00-3 |
n-Butylacrylat |
205-480-7 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H226 H319 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H317 |
|
|
D |
|
|
607-063-00-9 |
Isobuttersäure; Methylpropansäure |
201-195-7 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
607-064-00-4 |
Benzylchlorformiat; Chlorameisensäurebenzylester |
207-925-0 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
607-065-00-X |
Bromessigsäure |
201-175-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 |
H331 H311 H301 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H317 H400 |
|
|
|
|
|
607-066-00-5 |
Dichloressigsäure |
201-207-0 |
Skin Corr. 1A Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
|
|
|
|
607-067-00-0 |
Dichloracetylchlorid; α, α-Dichloressigsäurechlorid |
201-199-9 |
Skin Corr. 1A Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
|
|
|
|
607-068-00-6 |
Iodessigsäure |
200-590-1 |
Acute Tox. 3 * Skin Corr. 1A |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
|
|
|
|
607-069-00-1 |
Bromessigsäureethylester; Bromessigsäureethylester; Ethylbromoacetat |
203-290-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
|
607-070-00-7 |
Chloressigsäureethylester; Chloressigsäureethylester; Ethylchloracetat |
203-294-0 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H331 H311 H301 H400 |
GHS06 GHS09 Dgr |
H331 H311 H301 H400 |
|
|
|
|
|
607-071-00-2 |
Methacrylsäureethylester |
202-597-5 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H319 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 H317 |
|
|
D |
|
|
607-072-00-8 |
2-Hydroxyethylacrylat |
212-454-9 |
Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 |
H311 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H314 H317 H400 |
|
* Skin Sens. 1; H317: C ≥ 0,2 % |
D |
|
|
607-073-00-3 |
4-CPA (ISO); 4-Chlorphenoxyessigsäure |
204-581-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-074-00-9 |
Chlorfenac (ISO); 2,3,6-Trichlorphenylessigsäure |
201-599-3 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-075-00-4 |
Chlorfenprop-methyl (ISO); Methyl-2-chlor-3-(4-chlorphenyl)propionat |
238-413-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
607-076-00-X |
Dodine (ISO); Dodecylguanidiniumacetat |
219-459-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
|
607-077-00-5 |
Erbon (ISO); 2-(2,4,5-Trichlorphenoxy)ethyl-2,2-dichlorpropionat |
— |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-078-00-0 |
Fluenetil (ISO); 2-Fluorethylbiphenyl-4-ylacetat |
— |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
607-079-00-6 |
Kelevan (ISO); Ethyl-5-(perchlor-5-hydroxypentacyclo[5,3,0,02,6,03,9,04,8]decan-5-yl)-4-oxopentanoat; Ethyl-5-(1,2,3,5,6,7,8,9,10,10-decachlor-4-hydroxypentacyclo(5,2,1,02,6,03,9,05,8)dec-4-yl)-4-oxovalerat |
— |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H311 H302 H411 |
GHS06 GHS09 Dgr |
H311 H302 H411 |
|
|
|
|
|
607-080-00-1 |
Chloracetylchlorid; α-Chloressigsäurechlorid |
201-171-6 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1A Aquatic Acute 1 |
H331 H311 H301 H372 ** H314 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H311 H301 H372 ** H314 H400 |
EUH014 EUH029 |
|
|
|
|
607-081-00-7 |
Fluoressigsäure; Monofluoressigsäure |
205-631-7 |
Acute Tox. 2 * Aquatic Acute 1 |
H300 H400 |
GHS06 GHS09 Dgr |
H300 H400 |
|
|
|
|
|
607-082-00-2 |
Monofluoracetate, lösliche |
— |
— |
Acute Tox. 2 * Aquatic Acute 1 |
H300 H400 |
GHS06 GHS09 Dgr |
H300 H400 |
|
|
A |
|
607-083-00-8 |
2,4-DB (ISO); 4-(2,4-Dichlorphenoxy)buttersäure |
202-366-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-084-00-3 |
Salze von 2,4-DB |
— |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
A |
|
607-085-00-9 |
Benzylbenzoat; Benzoesäurebenzylester |
204-402-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-086-00-4 |
Diallylphthalat |
205-016-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-088-00-5 |
Methacrylsäure; 2-Methylpropensäure |
201-204-4 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 1 % |
D |
|
|
607-089-00-0 |
Propionsäure … % |
201-176-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H319 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % STOT SE 3; H335: C ≥ 10 % |
B |
|
|
607-090-00-6 |
Thioglycolsäure; Mercaptoessigsäure; Thiolessigsäure |
200-677-4 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H331 H311 H301 H314 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 |
|
* |
|
|
|
607-091-00-1 |
Trifluoressigsäure … % |
200-929-3 |
Acute Tox. 4 * Skin Corr. 1A Aquatic Chronic 3 |
H332 H314 H412 |
GHS05 GHS07 Dgr |
H332 H314 H412 |
|
* |
B |
|
|
607-092-00-7 |
Methyllactat [1]; Methyl-(±)-lactat [2]; Methyl-(R)-lactat [3]; Methyl-(S)-(-)-lactat [4] |
208-930-0 [1] 218-449-8 [2] 241-420-6 [3] 248-704-9 [4] |
547-64-8 [1] 2155-30-8 [2] 17392-83-5 [3] 27871-49-4 [4] |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 |
H226 H319 H335 |
GHS02 GHS07 Wng |
H226 H319 H335 |
|
|
C |
|
607-093-00-2 |
Propionylchlorid; Propionsäurechlorid |
201-170-0 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
EUH014 |
|
B D |
|
|
607-094-00-8 |
Peressigsäure … % |
201-186-8 |
Flam. Liq. 3 Org. Perox. D **** Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H226 H242 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H242 H332 H312 H302 H314 H400 |
|
* STOT SE 3; H335: C ≥ 1 % |
B D |
|
|
607-095-00-3 |
Maleinsäure |
203-742-5 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H302 H319 H335 H315 H317 |
GHS07 Wng |
H302 H319 H335 H315 H317 |
|
Skin Sens. 1; H317: C ≥0,1 % |
|
|
|
607-096-00-9 |
Maleinsäureanhydrid |
203-571-6 |
Acute Tox. 4 STOT RE 1 Skin Corr. 1B Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1A |
H302 H372 (Atmungsorgane) (Einatmung) H314 H318 H334 H317 |
GHS07 GHS08 GHS05 Dgr |
H302 H372 (Atmungsorgane) (Einatmung) H314 H334 H317 |
EUH071 |
Skin Sens. 1A; H317: C ≥ 0,001 % |
|
|
|
607-097-00-4 |
1,2,4-Benzoltricarbonsäure-1,2-anhydrid; Trimellitsäureanhydrid |
209-008-0 |
STOT SE 3 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H335 H318 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H335 H318 H334 H317 |
|
|
|
|
|
607-098-00-X |
1,2,4,5-Benzoltetracarbonsäuredianhydrid; Pyromellitsäuredianhydrid |
201-898-9 |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
|
|
|
607-099-00-5 |
1,2,3,6-Tetrahydrophthaleinsäureanhydrid [1]; cis-1,2,3,6-Tetrahydrophthaleinsäureanhydrid [2]; 3,4,5,6-Tetrahydrophthalein-säureanhydrid [3]; Tetrahydrophthaleinsäureanhydrid [4] |
201-605-4 [1] 213-308-7 [2] 219-374-3 [3] 247-570-9 [4] |
85-43-8 [1] 935-79-5 [2] 2426-02-0 [3] 26266-63-7 [4] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H334 H317 H412 |
GHS08 GHS05 Dgr |
H318 H334 H317 H412 |
|
|
C |
|
607-100-00-9 |
3,3',4,4'-Benzophenontetracarbonsäuredianhydrid; 4,4'-Carbonyldiphthaleinsäureanhydrid |
219-348-1 |
Eye Irrit. 2 STOT SE 3 |
H319 H335 |
GHS07 Wng |
H319 H335 |
|
Eye Irrit 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
|
607-101-00-4 |
1,4,5,6,7,7-Hexachlorbicyclo-[2,2,1]hept-5-en-2,3-dicarbonsäureanhydrid; Chlorendicanhydrid |
204-077-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
Skin Irrit.2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
|
607-102-00-X |
Cyclohexan-1,2-dicarbonsäureanhydrid [1]; cis-Cyclohexan-1,2-dicarbonsäureanhydrid [2]; trans-Cyclohexan-1,2-dicarbonsäureanhydrid [3] |
201-604-9 [1] 236-086-3 [2] 238-009-9 [3] |
85-42-7 [1] 13149-00-3 [2] 14166-21-3 [3] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-103-00-5 |
Bernsteinsäureanhydrid |
203-570-0 |
Acute Tox. 4 Skin Corr. 1 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H314 H318 H334 H317 |
GHS07 GHS05 GHS08 Dgr |
H302 H314 H334 H317 |
EUH071 |
|
|
|
|
607-104-00-0 |
1,2,3,4-Cyclopentantetracarbonsäuredianhydrid |
227-964-7 |
Eye Irrit. 2 STOT SE 3 |
H319 H335 |
GHS07 Wng |
H319 H335 |
|
Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
|
607-105-00-6 |
endo-3,6-Methylen-1,2,3,6-tetrahydrophthalsäureanhydrid [1]; 1,2,3,6-tetrahydro-3,6-methanophthalsäureanhydrid [2]; exo-3,6-Methylen-1,2,3,6-tetrahydrophthalsäureanhydrid [3] |
204-957-7 [1] 212-557-9 [2] 220-384-5 [3] |
129-64-6 [1] 826-62-0 [2] 2746-19-2 [3] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-106-00-1 |
8,9-Dinorborn-5-en-2,3-dicarbonsäureanhydrid |
— |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H302 H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H302 H319 H335 H315 H334 |
|
STOT SE 3; H335: C ≥ 10 % |
C |
|
|
607-107-00-7 |
2-Ethylhexylacrylat; Hexamethylendiacrylat |
203-080-7 |
STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H335 H315 H317 |
GHS07 Wng |
H335 H315 H317 |
|
|
D |
|
|
607-108-00-2 |
2-Hydroxy-1-methylethylacrylat [1]; 2-Hydroxypropylacrylat [2]; Acrylsäure, Monoester mit Propan-1,2-diol [3] |
220-852-9 [1] 213-663-8 [2] 247-118-0 [3] |
2918-23-2 [1] 999-61-1 [2] 25584-83-2 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H331 H311 H301 H314 H317 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 H317 |
|
* Skin Sens. 1; H317:C ≥0,2 % |
C D |
|
607-109-00-8 |
Hexamethylendiacrylat; Hexan-1,6-dioldiacrylat |
235-921-9 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-110-00-3 |
Pentaerythritoltriacrylat |
222-540-8 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-111-00-9 |
2-Ethyl-2-[[(1-oxoallyl)oxy]methyl]-1,3-propandiyldiacrylat; 2,2-Bis(acryloyloxymethyl)butylacrylat; Trimethylolpropantriacrylat |
239-701-3 |
Carc. 2 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H315 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H315 H319 H317 H410 |
|
M = 1 M = 1 |
D |
|
|
607-112-00-4 |
2,2-Dimethylpropandiol-1,3-diacrylat; Neopentylglycoldiacrylat |
218-741-5 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H311 H319 H315 H317 |
GHS06 Dgr |
H311 H319 H315 H317 |
|
* |
D |
|
|
607-113-00-X |
Isobutylmethacrylat |
202-613-0 |
Flam. Liq. 3 STOT SE 3 Skin Irrit. 2 Skin Sens. 1B |
H226 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H335 H315 H317 |
|
|
D |
|
|
607-114-00-5 |
Ethylendimethacrylat; Ethylenglykoldimethacrylat |
202-617-2 |
STOT SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
|
STOT SE 3; H335: C ≥ 10 % |
D |
|
|
607-115-00-0 |
Isobutylacrylat; 2-Methylpropylacrylat |
203-417-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 |
H226 H332 H312 H315 H317 |
GHS02 GHS07 Wng |
H226 H332 H312 H315 H317 |
|
|
D |
|
|
607-116-00-6 |
Cyclohexylacrylat |
221-319-3 |
STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H335 H315 H411 |
GHS07 GHS09 Wng |
H335 H315 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
D |
|
|
607-117-00-1 |
2,3-Epoxypropylacrylat; Glycidylacrylat |
203-440-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H331 H311 H301 H314 H317 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 H317 |
|
* Skin Sens. 1; H317:C ≥0,2 % |
D |
|
|
607-118-00-7 |
Butan-1,3-diyldiacrylat |
243-105-9 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H314 H317 |
GHS05 GHS07 Dgr |
H312 H314 H317 |
|
|
D |
|
|
607-119-00-2 |
1,4-Butandiyldiacrylat |
213-979-6 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H314 H317 |
GHS05 GHS07 Dgr |
H312 H314 H317 |
|
|
D |
|
|
607-120-00-8 |
OxydiethylendiacrylatDiethylenglycoldiacrylat; 2,2'-Oxydiethyldiacrylat |
223-791-6 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H311 H319 H315 H317 |
GHS06 Dgr |
H311 H319 H315 H317 |
|
* Skin Sens. 1; H317:C≥0,2 % |
D |
|
|
607-121-00-3 |
2-Norbornylacrylat; Bicyclo[2.2.1]-2-ylacrylat |
— |
Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 |
H312 H315 H317 |
GHS07 Wng |
H312 H315 H317 |
|
|
D |
|
|
607-122-00-9 |
Pentaerythritoltetraacrylat |
225-644-1 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-123-00-4 |
2,3-Epoxypropylmethacrylat; Glycidylmethacrylat |
203-441-9 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 Acute Tox. 4 STOT SE 3 STOT RE 1 Eye Dam. 1 Skin Corr. 1C Skin Sens. 1 |
H350 H341 H360F H311 H302 H335 H372 (Atemwege) (Einatmung) H318 H314 H317 |
GHS08 GHS06 GHS05 Dgr |
H350 H341 H360F H311 H302 H335 H372 (Atemwege) (Einatmung) H314 H317 |
|
|
D |
|
|
607-124-00-X |
2-Hydroxyethylmethacrylat |
212-782-2 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-125-00-5 |
2-Hydroxypropylmethacrylat [1]; 3-Hydroxypropylmethacrylat [2] |
213-090-3 [1] 220-426-2 [2] |
923-26-2 [1] 2761-09-3 [2] |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
C D |
|
607-126-00-0 |
Triethylenglycoldiacrylat |
216-853-9 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-127-00-6 |
2-Diethylaminoethylmethacrylat |
203-275-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H332 H319 H315 H317 |
GHS07 Wng |
H332 H319 H315 H317 |
|
|
D |
|
|
607-128-00-1 |
2-tert-Butylaminoethylmethacrylat |
223-228-4 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-129-00-7 |
Ethyllactat; Ethyl-DL-lactat [1]; Ethyl-(S)-2-hydroxypropionat; Ethyl-L-lactat; Ethyl-(S)-lactat [2] |
202-598-0 [1] 211-694-1 [2] |
97-64-3 [1] 687-47-8 [2] |
Flam. Liq. 3 STOT SE 3 Eye Dam. 1 |
H226 H335 H318 |
GHS02 GHS05 GHS07 Dgr |
H226 H335 H318 |
|
|
C |
|
607-130-00-2 |
Pentylacetat; Amylacetat [1]; Isopentylacetat; 3-Methylbutylacetat [2]; 1-Methylbutylacetat [3]; 2-Methylbutylacetat [4]; 2(oder 3)-Methylbutylacetat [5] |
211-047-3 [1] 204-662-3 [2] 210-946-8 [3] 210-843-8 [4] 282-263-3 [5] |
628-63-7 [1] 123-92-2 [2] 626-38-0 [3] 624-41-9 [4] 84145-37-9 [5] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
EUH066 |
|
C |
|
607-131-00-8 |
Isopentylpropionat; Propionsäure-3-methylbutylester [1]; Pentylpropionat; Amylpropionat [2]; 2-Methylbutylpropionat [3] |
203-322-1 [1] 210-852-7 [2] 219-449-0 [3] |
105-68-0 [1] 624-54-4 [2] 2438-20-2 [3] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
607-132-00-3 |
2-Dimethylaminoethylmethacrylat |
220-688-8 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H312 H302 H319 H315 H317 |
GHS07 Wng |
H312 H302 H319 H315 H317 |
|
|
D |
|
|
607-133-00-9 |
Monoalkyl- oder Monoaryl- oder Monoalkylarylester der Acrylsäure, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H335 H315 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
A |
|
607-134-00-4 |
Monoalkyl- oder Monoaryl- oder Monoalkyarylester der Methacrylsäure, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOTSE 3; H335: C ≥ 10 % |
A |
|
607-135-00-X |
Buttersäure; Butansäure |
203-532-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
607-136-00-5 |
Butyrylchlorid; Buttersäurechlorid |
205-498-5 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
|
607-137-00-0 |
Methylacetoacetat; Acetessigsäuremethylester |
203-299-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-138-00-6 |
Butylchlorformiat; Chlorameisensäurebutylester |
209-750-5 |
Flam. Liq. 3 Acute Tox. 3 * Skin Corr. 1B |
H226 H331 H314 |
GHS02 GHS06 GHS05 Dgr |
H226 H331 H314 |
|
|
|
|
|
607-139-00-1 |
2-Chlorpropionsäure |
209-952-3 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
|
607-140-00-7 |
Isobutyrylchlorid; Isobuttersäurechlorid |
201-194-1 |
Flam. Liq. 2 Skin Corr. 1A |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
|
607-141-00-2 |
Oxydiethylenbis(chlorformiat) |
203-430-9 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H411 |
|
|
|
|
|
607-142-00-8 |
Propylchlorformiat; Chlorameisensäurepropylester; n-Propylchlorformiat |
203-687-7 |
Flam. Liq. 2 Acute Tox. 3 * Skin Corr. 1B |
H225 H331 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H331 H314 |
|
|
|
|
|
607-143-00-3 |
Valeriansäure; Pentansäure |
203-677-2 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
|
|
|
|
607-144-00-9 |
Adipinsäure |
204-673-3 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-145-00-4 |
Methansulfonsäure |
200-898-6 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
607-146-00-X |
Fumarsäure |
203-743-0 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-147-00-5 |
Oxalsäurediethylester; Diethyloxalat |
202-464-1 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
|
607-148-00-0 |
Guanidiniumchlorid; Guanadinhydrochlorid |
200-002-3 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
|
607-149-00-6 |
Urethan (INN); Ethylcarbamat |
200-123-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
607-150-00-1 |
Endothal (ISO);7-Oxabicyclo(2,2,1)heptan-2,3-dicarbonsäure |
205-660-5 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H301 H312 H319 H335 H315 |
GHS06 Dgr |
H301 H312 H319 H335 H315 |
|
|
|
|
|
607-151-00-7 |
Propargit (ISO); 2-(4-tert-Butylphenoxy)cyclohexylprop-2-ynylsulfit |
219-006-1 |
Carc. 2 Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H315 H318 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H331 H315 H318 H410 |
|
M = 10 |
|
|
|
607-152-00-2 |
2,3,6-TBA (ISO); 2,3,6-Trichlorbenzoesäure |
200-026-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-153-00-8 |
Benazolin (ISO); 4-Chlor-2-oxobenzothiazolin-3-ylessigsäure |
223-297-0 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
|
607-154-00-3 |
Ethyl-N-benzoyl-N-(3,4-dichlorphenyl)-DL-alaninat; Benzoylprop-ethyl (ISO) |
244-845-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-155-00-9 |
3-(3-Amino-5-(1-methylguanidino)-1-oxopentylamino-6-(4-amino-2-oxo-2,3-dihydro-pyrimidin-1-yl)-2,3-dihydro-(6H)-pyran-2-carbonsäure; Blasticidin-s |
— |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
|
607-156-00-4 |
Chlorfenson (ISO); 4-Chlorphenyl-4-chlorbenzolsulfonat |
201-270-4 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
607-157-00-X |
Difenacoum (ISO); 3-(3-Biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycumarin |
259-978-4 |
Repr. 1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (Blut) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (Blut) H410 |
|
Repr. 1B; H360D: C ≥ 0,003 % STOT RE 1; H372 (Blut): C ≥ 0,02 % STOT RE 2; H373 (Blut): 0,002 % ≤ C < 0,02 % M = 10 M = 10 |
|
|
|
607-158-00-5 |
Natriumsalz der Chloressigsäure, Natriumchloracetat |
223-498-3 |
Acute Tox. 3 * Skin Irrit. 2 Aquatic Acute 1 |
H301 H315 H400 |
GHS06 GHS09 Dgr |
H301 H315 H400 |
|
|
|
|
|
607-159-00-0 |
Chlorobenzilat (ISO); Ethyl-4,4'-dichlorbenzilat; Ethyl-2,2-di(4-chlorphenyl)-2-hydroxyacetat |
208-110-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-160-00-6 |
Isobutyl-2-(4-(4-chlorphenoxy)phenoxy)propionat; Clofop-isobutyl (ISO) |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-161-00-1 |
Diethanolaminsalz von 4-CPA |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-162-00-7 |
Dalapon; 2,2-Dichlorpropionsäure [1]; Dalaponnatrium; Natrium-2,2-dichlorpropionat[2] |
200-923-0 [1] 204-828-5 [2] |
75-99-0 [1] 127-20-8 [2] |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
607-163-00-2 |
3-Acetyl-6-methyl-2H-pyran-2,4(3H)-dion; Dehydracetsäure |
208-293-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-164-00-8 |
Natrium-1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-yliden)ethonolat; Natriumdehydracetat |
224-580-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-165-00-3 |
Diclofop-methyl (ISO); Methyl-2-(4-(2,4-dichlorphenoxy)phenoxy)propionat; Methyl-(RS)-2-[4-(2,4-dichlorphenoxy)phenoxy]propionat |
257-141-8 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
|
607-166-00-9 |
Medinoterbacetat (ISO); 6-tert-Butyl-3-methyl-2,4-dinitrophenylacetat |
219-634-6 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
|
|
607-167-00-4 |
Natrium-3-chloracrylat |
— |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
607-168-00-X |
Dipropyl-6,7-methylendioxy-1,2,3,4-tetrahydro-3-methylnaphthalin-1,2-dicarboxylat; Propylisom |
— |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H302 H400 H410 |
GHS06 GHS09 Dgr |
H311 H302 H410 |
|
|
|
|
|
607-169-00-5 |
Natriumfluoracetat |
200-548-2 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H330 H310 H300 H400 |
GHS06 GHS09 Dgr |
H330 H310 H300 H400 |
|
|
|
|
|
607-170-00-0 |
Bis(1,2,3-trithiacyclohexyldimethylammonium)oxalat; Thiocyclamoxalat |
250-859-2 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
607-172-00-1 |
Brodifacoum (ISO); 4-Hydroxy-3-(3-(4′-brom-4-biphenylyl)-1,2,3,4-tetrahydro-1-naphthyl)cumarin |
259-980-5 |
Repr. 1 A Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (Blut) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (Blut) H410 |
|
Repr. 1 A; H360D: C ≥ 0,003 % STOT RE 1; H372 (Blut): C ≥ 0,02 % STOT RE 2; H373 (Blut): 0,002 % ≤ C < 0,02 % M = 10 M = 10 |
|
|
|
607-173-00-7 |
Dimethyl-(3-methyl-4-(5-nitro-3-ethoxycarbonyl-2-thienyl)azo)phenylnitrilodipropionat |
400-460-6 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-174-00-2 |
Reaktionsmasse aus Dodecyl-3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionat und Tetradecyl-3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionat |
400-580-9 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-175-00-8 |
Methyl-2-(2-nitrobenzyliden)acetoacetat |
400-650-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-176-00-3 |
Reaktionsmasse aus α-3-(3-(2H-Benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-hydroxypoly(oxyethylen) und α-3-(3-(2H-Benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylen) |
400-830-7 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-177-00-9 |
Tribenuron-methyl (ISO); Methyl-2-[N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-N-methylcarbamoylsulfamoyl]benzoat |
401-190-1 |
STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 H317 H410 |
|
M = 100 M = 100 |
|
|
|
607-178-00-4 |
Methyl-α-((4,6-dimethoxypyrimidin-2-yl)ureidosulfonyl)-o-toluat |
401-340-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-179-00-X |
(Benzothiazol-2-ylthio)bernsteinsäure |
401-450-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-180-00-5 |
Kalium-2-hydroxycarbazol-1-carboxylat |
401-630-2 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H302 H319 H335 H412 |
GHS07 Wng |
H302 H319 H335 H412 |
|
|
|
|
|
607-181-00-0 |
3,5-Dichlor-2,4-difluorbenzoylfluorid |
401-800-6 |
Acute Tox. 3 * Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H331 H314 H302 H317 H412 |
GHS06 GHS05 Dgr |
H331 H314 H302 H317 H412 |
EUH029 |
|
|
|
|
607-182-00-6 |
Methyl-3-sulfamoyl-2-thenoat |
402-050-2 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-183-00-1 |
Zink-2-hydroxy-5-C13-18-alkylbenzoat |
402-280-3 |
— |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
607-184-00-7 |
S-(3-Trimethoxysilyl)propyl-19-isocyanato-11-(6-isocyanatohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanthioat |
402-290-8 |
Flam. Liq. 3 Resp. Sens. 1 Skin Sens. 1 |
H226 H334 H317 |
GHS02 GHS08 Dgr |
H226 H334 H317 |
|
|
|
|
|
607-185-00-2 |
Ethyl-trans-3-dimethylaminoacrylat |
402-650-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-186-00-8 |
Quinclorac (ISO); 3,7-Dichlorchinolin-8-carbonsäure |
402-780-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-187-00-3 |
Bis(2,2,6,6-tetramethyl-4-piperidyl)succinat |
402-940-0 |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
|
607-188-00-9 |
Hydrogennatrium-N-carboxylatoethyl-N-octadec-9-enylmaleamat |
402-970-4 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-189-00-4 |
Trimethylendiamintetraessigsäure |
400-400-9 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
|
607-190-00-X |
Methylacrylamidomethoxyacetat (mit ≥ 0,1 % Acrylamid) |
401-890-7 |
Carc. 1B Muta. 1B Acute Tox. 4 * Eye Irrit. 2 |
H350 H340 H302 H319 |
GHS08 GHS07 Dgr |
H350 H340 H302 H319 |
|
|
|
|
|
607-191-00-5 |
Isobutyl-3,4-epoxybutyrat |
401-920-9 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
|
607-192-00-0 |
Dinatrium-N-carboxymethyl-N-(2-(2-hydroxyethoxy)ethyl)glycinat |
402-360-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-194-00-1 |
Propylencarbonat |
203-572-1 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-195-00-7 |
2-Methoxy-1-methylethylacetat; 1-Methoxypropylacetat-2 |
203-603-9 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
|
607-196-00-2 |
Heptansäure |
203-838-7 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
607-197-00-8 |
Nonansäure |
203-931-2 |
Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H315 H319 H412 |
GHS07 Wng |
H315 H319 H412 |
|
|
|
|
|
607-198-00-3 |
Propyl-3,4,5-trihydroxybenzoat; 3,4,5- Trihydroxybenzoesäurepropylester |
204-498-2 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
|
607-199-00-9 |
Octyl-3,4,5-trihydroxybenzoat; 3,4,5- Trihydroxybenzoesäureoctylester |
213-853-0 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
|
607-200-00-2 |
Dodecyl-3,4,5-trihydroxybenzoat; 3,4,5- Trihydroxybenzoesäuredodecylester |
214-620-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-201-00-8 |
Thiocarbonylchlorid, Thiophosgen |
207-341-6 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H331 H302 H319 H335 H315 |
GHS06 Dgr |
H331 H302 H319 H335 H315 |
|
|
|
|
|
607-203-00-9 |
2-Ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetat |
279-452-8 |
Repr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H360D *** H317 H412 |
GHS08 GHS07 Dgr |
H360D *** H317 H412 |
|
|
|
|
|
607-204-00-4 |
(Chlorphenyl)(chlortolyl)methan, Isomerengemisch |
400-140-6 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-205-00-X |
Methylchloracetat, Chloressigsäuremethylester |
202-501-1 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H331 H301 H335 H315 H318 |
GHS02 GHS06 GHS05 Dgr |
H226 H331 H301 H335 H315 H318 |
|
|
|
|
|
607-206-00-5 |
Isopropylchloracetat; Chloressigsäureisopropylester |
203-301-7 |
Flam. Liq. 3 Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H226 H301 H319 H335 H315 |
GHS02 GHS06 Dgr |
H226 H301 H319 H335 H315 |
|
|
|
|
|
607-207-00-0 |
Haloxyfop-etotyl (ISO); 2-Ethoxyethyl-2-(4-(3-chlor-5-trifluormethyl-2-pyridyloxy)phenoxy)propionat; Haloxyfop-(2-ethoxyethyl) |
402-560-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-208-00-6 |
4,8,12-Trimethyltrideca-3,7,11-triensäure, Isomerengemisch |
403-000-2 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
607-209-00-1 |
Reaktionsmasse aus O, O'-Diisopropyl-(pentathio)dithioformiat und O, O'-Diisopropyl-(trithio)dithioformiat und O, O'-Diisopropyl-(tetrathio)dithioformiat |
403-030-6 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
607-210-00-7 |
Methylacrylamidoglycolat (mit ≥ 0,1 % Acrylamid) |
403-230-3 |
Carc. 1B Muta. 1B Skin Corr. 1B Skin Sens. 1 |
H350 H340 H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H350 H340 H314 H317 |
|
|
|
|
|
607-211-00-2 |
Methyl-3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionat |
403-270-1 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-212-00-8 |
Poly(oxypropylencarbonyl-co-oxy(ethylethylen)carbonyl), mit 27 % Hydroxyvalerat |
403-300-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-213-00-3 |
Ethyl-3,3-bis(tert-pentylperoxy)butyrat |
403-320-2 |
Org. Perox. D**** Flam. Liq. 3 Aquatic Chronic 2 |
H242 H226 H411 |
GHS02 GHS09 Dgr |
H242 H226 H411 |
|
|
|
|
|
607-214-00-9 |
N, N-Hydrazinodiessigsäure |
403-510-5 |
Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H301 H373 ** H317 H412 |
GHS06 GHS08 Dgr |
H301 H373 ** H317 H412 |
|
|
|
|
|
607-215-00-4 |
3-(3-tert-Butyl-4-hydroxyphenyl)propionsäure |
403-920-4 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
|
607-216-00-X |
Glutaminsäure, Produkte der Reaktion mit N-(C12-14-Alkyl)propylendiamin |
403-950-8 |
— |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H330 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H302 H314 H400 |
|
|
|
|
607-217-00-5 |
2-Ethoxyethyl-2-(4-(2,6-dihydro-2,6-dioxo-7-phenyl-1,5-dioxaindacen-3-yl)phenoxy)acetat |
403-960-2 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-218-00-0 |
Dichlorprop-P (ISO); (+)-R-2-(2,4-Dichlorphenoxy)propionsäure |
403-980-1 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
|
607-219-00-6 |
Bis(2-ethylhexyl)dithiodiacetat |
404-510-8 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
607-221-00-7 |
6-Docosyloxy-1-hydroxy-4-(1-(4-hydroxy-3-methylphenanthren-1-yl)-3-oxo-2-oxaphenalen-1-yl)naphthalin-2-carbonsäure |
404-550-6 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-222-00-2 |
6-(2,3-Dimethylmaleimido)hexylmethacrylat |
404-870-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-223-00-8 |
Transfluthrin (ISO); 2,3,5,6-Tetrafluorbenzyl (1R,3S)-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
405-060-5 |
Carc. 2 Acute Tox. 4 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H370 (Nervensystem) H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H370 (Nervensystem) H410 |
EUH066 |
Oral: ATE = 580 mg/kg KG M = 1 000 M = 1 000 |
|
|
|
607-224-00-3 |
Methyl-2-(3-nitrobenzyliden)acetoacetat |
405-270-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
607-225-00-9 |
3-Azidosulfonylbenzoesäure |
405-310-3 |
Self-React. C **** STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H241 H373 ** H318 H317 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H241 H373 ** H318 H317 |
|
|
|
|
|
607-226-00-4 |
Reaktionsmasse aus 2-Acryloyloxyethylhydrogencyclohexan-1,2-dicarboxylat und 2-Methacryloyloxyethylhydrogencyclohexan-1,2-dicarboxylat |
405-360-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H315 H318 H317 H412 |
GHS05 GHS07 Dgr |
H315 H318 H317 H412 |
|
|
|
|
607-227-00-X |
Kalium-2-amino-2-methylpropionatoctahydrat |
405-560-3 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
|
607-228-00-5 |
Bis(2-methoxyethyl)phthalat |
204-212-6 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
|
|
|
|
|
607-229-00-0 |
Diethylcarbamoylchlorid |
201-798-5 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H351 H332 H302 H319 H335 H315 |
GHS08 GHS07 Wng |
H351 H332 H302 H319 H335 H315 |
|
|
|
|
|
607-230-00-6 |
2-Ethylhexansäure und ihre Salze, soweit in diesem Anhang nicht gesondert aufgeführt |
— |
— |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
|
A, X, 12 |
|
607-231-00-1 |
Clopyralid (ISO); 3,6-Dichlorpyridine-2-carbonsäure |
216-935-4 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-232-00-7 |
Pyridat (ISO); O-(6-Chlor-3-phenylpyridazin-4-yl)-S-octylthiocarbonat |
259-686-7 |
Acute Tox. 4 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H317 H410 |
|
Oral: ATE = 500 mg/kg KG M = 1 M = 10 |
|
|
|
607-233-00-2 |
Hexylacrylat |
219-698-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H335 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H411 |
|
|
|
|
|
607-234-00-8 |
Flurenol (ISO); 9-Hydroxy-9H-fluoren-9-carbonsäure |
207-397-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-235-00-3 |
Mecrilat,; Methyl-2-cyanacrylatcyanoacrylat |
205-275-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-236-00-9 |
Ethyl-2-cyanacrylat |
230-391-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-237-00-4 |
Benzyl-2-chlor-4-(trifluormethyl)thiazol-5-carboxylat; Flurazol |
276-942-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-238-00-X |
Tau-Fluvalinat (ISO); N-(2-Chlor-4-(trifluormethyl)phenyl)-D-valincyano(3-phenoxyphenyl)methylester |
— |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
607-239-00-5 |
Fenpropathrin (ISO); α-Cyan-3-phenoxybenzyl-2,2,3,3-tetramethylcyclopropancarboxylat |
254-485-0 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H312 H410 |
|
|
|
|
|
607-240-00-0 |
cis-1,2,3,6-Tetrahydro-4-methylphthalsäureanhydrid [1]; 1,2,3,6-Tetrahydro-4-methylphthalsäureanhydrid [2]; 1,2,3,6-Tetrahydro-3-methylphthalsäureanhydrid [3]; Tetrahydromethylphthalsäureanhydrid [4]; 1,2,3,6-Tetrahydromethylphthalsäureanhydrid [5]; Tetrahydro-4-methylphthalsäureanhydrid [6]; 2,3,5,6-Tetrahydro-2-methylphthalsäureanhydrid [7] |
216-906-6 [1] 222-323-8 [2] 226-247-6 [3] 234-290-7 [4] 247-830-1 [5] 251-823-9 [6] 255-853-3 [7] |
1694-82-2 [1] 3425-89-6 [2] 5333-84-6 [3] 11070-44-3 [4] 26590-20-5 [5] 34090-76-1 [6] 42498-58-8 [7] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-241-00-6 |
Hexahydro-4-methylphthalsäureanhydrid [1]; Hexahydromethylphthalsäureanhydrid [2]; Hexahydro-1-methylphthal-säureanhydrid [3]; Hexahydro-3-methylphthalsäureanhydrid [4] |
243-072-0 [1] 247-094-1 [2] 256-356-4 [3] 260-566-1 [4] |
19438-60-9 [1] 25550-51-0 [2] 48122-14-1 [3] 57110-29-9 [4] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-242-00-1 |
Tetrachlorphthalsäureanhydrid |
204-171-4 |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H317 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H318 H334 H317 H410 |
|
|
|
|
|
607-243-00-7 |
Natrium-3,6-dichlor-o-anisat [1]; 3,6-Dichlor-o-anissäure, Verbindung mit 2,2'-Iminodiethanol (1:1) [2]; 3,6-Dichlor-o-anissäure, Verbindung mit 2-Aminoethanol (1:1) [3] |
217-846-3 [1] 246-590-5 [2] 258-527-9 [3] |
1982-69-0 [1] 25059-78-3 [2] 53404-28-7 [3] |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-244-00-2 |
Isooctylacrylat |
249-707-8 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-245-00-8 |
tert-Butylacrylat |
216-768-7 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H225 H332 H312 H302 H335 H315 H317 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H312 H302 H335 H315 H317 H411 |
|
|
D |
|
|
607-246-00-3 |
Allylmethacrylat; 2-Methyl-2-propensäure 2-propenylester |
202-473-0 |
Flam. Liq. 3 Acute Tox. 2 Acute Tox. 3 Acute Tox. 4 Aquatic Acute 1 |
H226 H330 H311 H302 H400 |
GHS02 GHS06 GHS09 Dgr |
H226 H330 H311 H302 H400 |
|
Inhalation: ATE = 1,5 mg/L (Dämpfe) dermal: ATE = 300 mg/kg KG Oral: ATE = 400 mg/kg KG |
|
|
|
607-247-00-9 |
Dodecylmethacrylat |
205-570-6 |
STOT SE 3 |
H335 |
GHS07 Wng |
H335 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-248-00-4 |
Naptalam-Natrium (ISO); Natrium-N-naphth-1-ylphthalamat |
205-073-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-249-00-X |
(1-Methyl-1,2-ethandiyl)bis[oxy(methyl-2,1-ethandiyl)]diacrylat; Tripropylenglykoldiacrylat |
256-032-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H335 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-250-00-5 |
4H-3,1-Benzoxazin-2,4(1H)-dion |
204-255-0 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
|
607-251-00-0 |
2-Methoxypropylacetat |
274-724-2 |
Flam. Liq. 3 Repr. 1B STOT SE 3 |
H226 H360D *** H335 |
GHS02 GHS08 GHS07 Dgr |
H226 H360D *** H335 |
|
|
|
|
|
607-252-00-6 |
Lambda-Cyhalothrin (ISO); Reaktionsmasse aus (S)-α-Cyan-3-phenoxybenzyl(Z)-(1R)-cis-3-(2-chlor-3,3,3-trifluorpropenyl)-2,2-dimethylcyclopropancarboxylat und (R)-α-Cyan-3-phenoxybenzyl(Z)-(1S)-cis-3-(2-chlor-3,3,3-trifluorpropenyl)-2,2-dimethylcyclopropancarboxylat (1:1) |
415-130-7 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H312 H410 |
|
M=10000 |
|
|
|
607-253-00-1 |
Cyfluthrin (ISO); α-Cyan-4-fluor-3-phenoxybenzyl-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
269-855-7 |
Lact. Acute Tox. 2 Acute Tox. 2 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H362 H330 H300 H370 (Nervensystem) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H362 H330 H300 H370 (Nervensystem) H410 |
|
Einatmung: ATE = 0,14 mg/L (Stäube oder Nebel) Oral: ATE = 14 mg/kg KG M = 1 000 000 M = 1 000 000 |
|
|
|
607-254-00-7 |
beta-Cyfluthrin (ISO); Reaktionsmasse aus rel-(R)-Cyan(4-fluor-3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichlorethenyl)-2,2-dimethylcyclopropan-1-carboxylat und rel-(R)-Cyan(4-fluor-3-phenoxyphenyl)methyl (1S,3R)-3-(2,2-dichlorethenyl)-2,2-dimethylcyclopropan-1-carboxylat |
— |
Lact. Acute Tox. 2 Acute Tox. 2 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H362 H330 H300 H370 (Nervensystem) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H362 H330 H300 H370 (Nervensystem) H410 |
|
Einatmung: ATE = 0,081 mg/L (Stäube oder Nebel) Oral: ATE = 11 mg/kg KG M = 1 000 000 M = 1 000 000 |
|
|
|
607-255-00-2 |
Fluroxypyr (ISO); 4-Amino-3,5-dichlor-6-fluor-2-pyridyloxyessigsäure |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-256-00-8 |
Azoxystrobin (ISO); Methyl (E)-2-{2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl}-3-methoxyacrylat |
— |
Acute Tox. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H400 H410 |
GHS06 GHS09 Dgr |
H331 H410 |
|
Einatmen: ATE = 0,7 mg/L (Stäube oder Nebel) M = 10 M = 10 |
|
|
|
607-257-00-3 |
Isopropylpropionat |
211-300-8 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
607-258-00-9 |
Dodecyl-3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(4-methoxybenzoyl)acetamido)-4-chlorbenzoat |
403-990-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-259-00-4 |
Methyl-2R,3S-(-)-3-(4-methoxyphenyl)oxirancarboxylat |
404-130-2 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
607-260-00-X |
Ethyl-2-(3-nitrobenzyliden)acetoacetat |
404-490-0 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
607-261-00-5 |
Iso(C10-C14)alkyl-(3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetat |
404-800-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-262-00-0 |
7-Chlor-1-cyclopropyl-6-fluor-1,4-dihydro-4-oxochinolin-3-carbonsäure |
405-050-0 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
607-263-00-6 |
Kalium/Eisen(III)-1,3-propandiamine-N, N,N',N'-tetraacetathemihydrat |
405-680-6 |
— |
Self-heat. 2 **** Aquatic Chronic 2 |
H252 H411 |
GHS02 GHS09 Wng |
H252 H411 |
|
|
|
|
607-264-00-1 |
2-Chlor-4-(methylsulfonyl)benzoesäure |
406-520-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-265-00-7 |
Ethyl-2-chlor-2,2-diphenylacetat |
406-580-5 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
607-266-00-2 |
Reaktionsmasse aus Hydroxyaluminium-bis[2-hydroxy-3,5-di-tert-butylbenzoat]; 3,5-Di-tert-butylsalicylsäure |
406-890-0 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-267-00-8 |
tert-Butyl-(5S,6R,7R)-3-brommethyl-5,8-dioxo-7-(2-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0]-oct-2-en-2-carboxylat |
407-620-4 |
Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H334 H317 H412 |
GHS08 Dgr |
H334 H317 H412 |
|
|
|
|
|
607-268-00-3 |
2-Methylpropyl-(R)-2-hydroxypropanoat |
407-770-0 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-269-00-9 |
(R)-2-(4-Hydroxyphenoxy)propansäure |
407-960-3 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-270-00-4 |
3,9-Bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10-tetraoxaspiro[5.5]undecan |
410-730-5 |
Acute Tox. 4 * |
H312 |
GHS07 Wng |
H312 |
|
|
|
|
|
607-271-00-X |
2-Isopropyl-5-methylcyclohexyloxycarbonyloxy-2-hydroxypropan |
417-420-9 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
|
607-272-00-5 |
Fluroxypyr-meptyl (ISO); Methylheptyl,-O-(4-amino-3,5-dichlor-6-fluor-2-pyridyloxy)acetat [1]; Fluroxypyr-butometyl (ISO); 2-Butoxy-1-methylethyl-O-(4-amino-3,5-dichlor-6-fluor-2-pyridyloxy)acetat [2] |
279-752-9 [1] - [2] |
81406-37-3 [1] 154486-27-8 [2] |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-273-00-0 |
Ammonium-7-(2,6-dimethyl-8-(2,2-dimethylbutyryloxy)-1,2,6,7,8,8a-hexahydro-1-naphthyl)-3,5-dihydroxyheptanoat |
404-520-2 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-274-00-6 |
2-(N-Benzyl-N-methylamino)ethyl 3-amino-2-butenoat |
405-350-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-275-00-1 |
Natrium-benzoyloxybenzol-4-sulfonat |
405-450-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-276-00-7 |
Bis[(1-methylimidazol)-(2-ethylhexanoat)], Zinkkomplex |
405-635-0 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
607-277-00-2 |
Reaktionsmasse aus 2-(Hexylthio)ethylaminhydrochlorid; Natriumpropionat |
405-720-2 |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
607-278-00-8 |
Reaktionsmasse aus Isomeren von Natriumphenethylnaphthalinsulfonat; Natriumnaphthylethylbenzolsulfonat |
405-760-0 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-279-00-3 |
Reaktionsmasse aus n-Octadecylaminodiethylbis(hydrogen maleat); n-Octadecylaminodiethylhydrogenmaleathydrogenphthalat |
405-960-8 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-280-00-9 |
Natrium-4-chlor-1-hydroxybutan-1-sulfonat |
406-190-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
|
607-281-00-4 |
Reaktionsmasse aus verzweigten und linearen C7-C9-Alkyl-3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]propionaten |
407-000-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-282-00-X |
2-Acetoxymethyl-4-benzyloxybut-1-ylacetat |
407-140-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-283-00-5 |
E-Ethyl-4-oxo-4-phenylcrotonat |
408-040-4 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H317 H410 |
|
|
|
|
|
607-284-00-0 |
Reaktionsmasse aus Natrium-3,3'-(1,4-phenylenbis(carbonylimino-3,1-propandiylimino))bis(10-amino-6,13-dichlor-4,11-triphenodioxazindisulfonat); Lithium-3,3'-(1,4-phenylenbis(carbonylimino-3,1-propandiylimino))bis(10-amino-6,13-dichlor)-4,11-triphenodioxazindisulfonat (9:1) |
410-040-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-285-00-6 |
Reaktionsmasse aus 7-(((3-Aminophenyl)sulfonyl)amino)-naphthalin-1,3-disulfonsäure; Natrium-7-(((3-aminophenyl)sulfonyl)amino)-naphthalin-1,3-disulfonat; Kalium-7-(((3-aminophenyl)sulfonyl)amino)-naphthalin-1,3-disulfonat |
410-065-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
|
|
|
|
|
607-286-00-1 |
Reaktionsmasse aus Natrium/Kalium-7-[[[3-[[4-((2-hydroxynaphthyl)azo)phenyl]azo]phenyl]sulfonyl]amino]-naphthalin-1,3-disulfonat |
410-070-8 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
607-287-00-7 |
O'-Methyl-O-(1-methyl-2-methacryloyloxyethyl)-1,2,3,6-tetrahydrophthalat |
410-140-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-288-00-2 |
Tetranatrium-(c-(3-(1-(3-(e-6-dichlor-5-cyanopyrimidin-f-yl(methyl)amino)propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)-4-sulfonatophenylsulfamoyl)phthalocyanin-a, b,d-trisulfonato(6-))nickelat(II) (a: 1, 2, 3 oder 4, b: 8, 9, 10 oder 11, c: 15, 16, 17 oder 18, d: 22, 23, 24 oder 25, e, f zusammen: 2 und 4 bzw. 4 und 2) |
410-160-7 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
|
607-289-00-8 |
3-(3-(4-(2,4-Bis(1,1-dimethylpropyl)phenoxy)butylaminocarbonyl-4-hydroxy-1-naphthalinyl)thio)propansäure |
410-370-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-290-00-3 |
Reaktionsmasse aus Ammonium-1-C14-C18-Alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethan-1-sulfonat; Ammonium-2-C14-C18-Alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethan-1-sulfonat (Verhältnis nicht bekannt) |
410-540-2 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
607-291-00-9 |
Dodecyl-ω-(C5/C6-cycloalkyl)alkylcarboxylat |
410-630-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-292-00-4 |
Reaktionsmasse aus [1-(Methoxymethyl)-2-(C12-alkoxy)-ethoxy]essigsäure; [1-(Methoxymethyl)-2-(C14-alkoxy)-ethoxy]essigsäure |
410-640-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
607-293-00-X |
Reaktionsmasse aus N-Aminoethylpiperazonium-mono-2,4,6-trimethylnonyldiphenyletherdi-sulfonat; N-Aminoethylpiperazonium-di-2,4,6-trimethylnonyldiphenyletherdisulfonat |
410-650-0 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
607-294-00-5 |
Natrium-2-benzoyloxy-1-hydroxyethan-sulfonat |
410-680-4 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-295-00-0 |
Reaktionsmasse aus Tetranatrium-phosphonethan-1,2-dicarboxylat; Hexanatrium-phosphonbutan-1,2,3,4-tetracarboxylat |
410-800-5 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-296-00-6 |
Reaktionsmasse aus Tetraestern von Pentaerythriol mit Heptansäure und 2-Ethylhexansäure |
410-830-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-297-00-1 |
(E-E)-3,3'-(1,4-Phenylendimethyliden)bis(2-oxobornan-10-sulfonsäure) |
410-960-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-298-00-7 |
2-(Trimethylammonium)ethoxycarboxybenzol-4-sulfonat |
411-010-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-299-00-2 |
Methyl-3-(acetylthio)-2-methylpropanoat |
411-040-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
|
607-300-00-6 |
Trinatrium-[2-(5-chlor-2,6-difluorpyrimidin-4-ylamino)-5-(b-sulfamoyl-c, d-sulfonatophthalocyanin-a-yl-K4,N29,N30,N31,N32-sulfonylamino)benzoato(5-)]cuprat(II) (a: 1, 2, 3 oder 4, b: 8, 9, 10 oder 11, c: 15, 16, 17 oder 18, d: 22, 23, 24 oder 25 |
411-430-7 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-301-00-1 |
Reaktionsmasse aus Dodecansäure und Poly(1-7)lactatestern der Dodecansäure |
411-860-5 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-302-00-7 |
Reaktionsmasse aus Tetradecansäure und Poly(1-7)lactatestern der Tetradecansäure |
411-910-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
607-303-00-2 |
1-Cyclopropyl-6,7-difluor-1,4-dihydro-4-oxochinolin-3-carbonsäure |
413-760-7 |
Repr. 2 Aquatic Chronic 3 |
H361f *** H412 |
GHS08 Wng |
H361f *** H412 |
|
|
|
|
|
607-304-00-8 |
Fluazifop-butyl (ISO); Butyl-(RS)-2-(4-[5-(trifluormethyl)-2-pyridyloxy)phenoxy]propionat |
274-125-6 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H400 H410 |
GHS08 GHS09 Dgr |
H360D *** H410 |
|
|
|
|
|
607-305-00-3 |
Fluazifop-P-butyl (ISO); Butyl-(R)-2-[4-(5-trifluormethyl-2-pyridyloxy)phenoxy]propionat |
— |
Repr. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H400 H410 |
GHS08 GHS09 Wng |
H361d *** H410 |
|
|
|
|
|
607-306-00-9 |
Chlozolinat (ISO); Ethyl-(RS)-3-(3,5-dichlorphenyl)-5-methyl-2,4-dioxo-oxazolidin-5-carboxylat |
282-714-4 |
Carc. 2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
|
|
|
|
|
607-307-00-4 |
Vinclozolin (ISO); N-3,5-Dichlorphenyl-5-methyl-5-vinyl-1,3-oxazolidin-2,4-dion |
256-599-6 |
Carc. 2 Repr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H351 H360FD H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360FD H317 H411 |
|
|
|
|
|
607-308-00-X |
Ester von 2,4-D |
— |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
A |
|
607-309-00-5 |
Carfentrazon-ethyl (ISO); Ethyl-(RS)-2-chlor-3-[2-chlor-4-fluor-5-[4-difluormethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionat |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-310-00-0 |
Kresoxim-methyl (ISO); Methyl-(E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetat |
— |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
|
607-311-00-6 |
Benazolin-ethyl; Ethyl-4-chlor-2-oxo-2H-benzothiazol-3-acetat |
246-591-0 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-312-00-1 |
Methoxyessigsäure; Essigsäure-methylether |
210-894-6 |
Repr. 1B Acute Tox. 4 * Skin Corr. 1B |
H360FD H302 H314 |
GHS08 GHS05 GHS07 Dgr |
H360FD H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
607-313-00-7 |
Neodecanoylchlorid |
254-875-0 |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H330 H302 H314 |
GHS06 GHS06 Dgr |
H330 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
607-314-00-2 |
Ethofumesat (ISO); (RS)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl-methansulfonat |
247-525-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 1 M = 1 |
|
|
|
607-315-00-8 |
Glyphosat (ISO); N-(Phosphonomethyl)glycin |
213-997-4 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
|
607-316-00-3 |
Glyphosat-trimesium; Glyphosattrimethylsulfonium |
— |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-317-00-9 |
Bis(2-ethylhexyl)phthalat; Di-(2-ethylhexyl)phthalat; DEHP |
204-211-0 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
607-318-00-4 |
Dibutylphthalat; DBP |
201-557-4 |
Repr. 1B Aquatic Acute 1 |
H360Df H400 |
GHS08 GHS09 Dgr |
H360Df H400 |
|
|
|
|
|
607-319-00-X |
Deltamethrin (ISO); (S)-α-Cyan-3-phenoxybenzyl(1R,3R)-3-(2,2-dibromvinyl)-2,2-dimethylcyclopropancarboxylat |
258-256-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
M=1000000 |
|
|
|
607-320-00-5 |
Bis[4-(ethenyloxy)butyl]-1,3-benzoldicarboxylat |
413-930-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
607-321-00-0 |
(S)-Methyl-2-chlorpropionat |
412-470-8 |
Flam. Liq. 3 STOT RE 2 * Eye Irrit. 2 |
H226 H373 ** H319 |
GHS02 GHS08 Wng |
H226 H373 ** H319 |
|
|
|
|
|
607-322-00-6 |
4-(4,4-Dimethyl-3-oxo-pyrazolidin-1-yl)-benzoesäure |
413-120-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-323-00-1 |
2-(1-(2-Hydroxy-3,5-di-tert-pentyl-phenyl)ethyl)-4,6-di-tert-pentylphenylacrylat |
413-850-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-324-00-7 |
Reaktionsmasse aus N, N-di(hydrierter Alkyl C14-C18)phtalamsäure und dihydrierten Alkyl(C14-C18)aminen |
413-800-3 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-325-00-2 |
(S)-2-Chlorpropionsäure |
411-150-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
|
607-326-00-8 |
Reaktionsmasse aus Isobutylhydrogen-2-(α-2,4,6-trimethylnon-2-enyl)succinat und Isobutylhydrogen-2-(ß-2,4,6-trimetyhylnon-2-enyl)succinat |
410-720-0 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
|
607-327-00-3 |
2-(2-Iodethyl)prop-1,3-diyl-diacetat |
411-780-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-328-00-9 |
Methyl-4-brommethyl-3-methoxybenzoat |
410-310-1 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
607-329-00-4 |
Reaktionsmasse aus Natrium-2-(C12-18-n-alkyl)amino-1,4-butandioat; Natrium-2-octadecenyl-amino-1,4-butandioat |
411-250-9 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-330-00-X |
(S)-2,3-Dihydro-1H-indol-2-carbonsäure |
410-860-2 |
Repr. 2 STOT RE 2 * Skin Sens. 1 |
H361f *** H373 ** H317 |
GHS08 GHS07 Wng |
H361f *** H373 ** H317 |
|
|
|
|
|
607-331-00-5 |
Reaktionsmasse aus Bis(2,2,6,6-tetramethyl-1-oktyloxypiperidin-4-yl)-1,10-decandioat; 1,8-Bis[(2,2,6,6-tetramethyl-4-((2,2,6,6-tetramethyl-1-oktyloxypiperidin-4-yl)-decan-1,10-dioyl)piperidin-1-yl)oxy]oktan |
406-750-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-332-00-0 |
Cyclopentylchlorformiat |
411-460-0 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H226 H331 H302 H373 ** H318 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H331 H302 H373 ** H318 H317 |
|
|
|
|
|
607-333-00-6 |
Reaktionsmasse aus Dodecyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninat; Tetradecyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninat |
405-670-1 |
— |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H410 |
|
|
|
|
607-334-00-1 |
Ethyl-1-ethyl-6,7,8-trifluor-1,4-dihydro-4-oxochinolin-3-carboxylat |
405-880-3 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
607-335-00-7 |
Methyl-(R)-2-(4-(3-chlor-5-trifluormethyl-2-pyridyloxy)phenoxy)propionat |
406-250-0 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-336-00-2 |
4-Methyl-8-methylentricyclo[3.3.1.13,7]dec-2-ylacetat |
406-560-6 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
|
607-337-00-8 |
Di-tert-(C12-14)-alkylammonium)-2-(benzothiazolylthio)succinat |
406-052-4 |
Flam. Liq. 3 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H226 H302 H315 H318 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H302 H315 H318 H411 |
|
|
|
|
|
607-338-00-3 |
2-Methylpropyl-2-hydroxy-2-methylbut-3-enoat |
406-235-9 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
|
607-339-00-9 |
2,3,4,5-Tetrachlorbenzoylchlorid |
406-760-3 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
|
607-340-00-4 |
1,3-Bis(4-benzoyl-3-hydroxyphenoxy)prop-2-ylacetat |
406-990-4 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-341-00-X |
(9S)-9-amino-9-deoxyerythromycin |
406-790-7 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
|
607-342-00-5 |
4-Chlorbutylveratrat |
410-950-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-343-00-0 |
4,7-Methanooctahydro-1H-inden-diyldimethylbis(2-carboxybenzoat) |
407-410-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-344-00-6 |
Reaktionsmasse aus 3-(N-(3-Dimethylaminopropyl)-(C4-8)perfluoralkylsulfonamido)propionsäure; N-[Dimethyl-3-(C4-8-perfluoralkylsulfonamido)propylammoniumpropionat; 3-(N-(3-dimethylpropylammonium)-(C4-8)perfluoralkylsulfonamido)propionsäurepropionat |
407-810-7 |
— |
STOT RE 2 * |
H373 ** |
GHS08 Wng |
H373 ** |
|
|
|
|
607-345-00-1 |
Kalium-2-(2,4-dichlorphenoxy)-(R)-propionat |
413-580-9 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
|
607-346-00-7 |
3-Icosyl-4-henicosyliden-oxetan-2-on |
401-210-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-347-00-2 |
Natrium-(R)-2-(2,4-Dichlorphenoxy)propionat |
413-340-3 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
|
607-348-00-8 |
Magnesium-bis((R)-2-(2,4-dichlorphenoxy)propionat) |
413-360-2 |
— |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
607-349-00-3 |
Tetrapropylammonium-2-(2-carboxyphenyldisulfanyl)benzoat |
411-270-8 |
— |
Aquatic Chronic 3 |
H412 |
|
H412 |
|
|
|
|
607-350-00-9 |
Bis(4-(1,2-bis(ethoxycarbonyl)ethylamino)-3-methylcyclohexyl)methan |
412-060-9 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
607-351-00-4 |
Methyl-O-(4-amino-3,5-dichlor-6-fluorpyridin-2-yloxy)acetat |
407-550-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-352-00-X |
4,4'-Oxydiphthalsäureanhydrid |
412-830-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-353-00-5 |
Reaktionsmasse aus Ethyl-exo-tricyclo[5.2.1.02,6]decan-endo-2-carboxylat; Ethyl-endo-tricyclo[5.2.1.02,6]decan-exo-2-carboxylat |
407-520-0 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
607-354-00-0 |
Ethyl-2-cyclohexylpropionat |
412-280-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-355-00-6 |
p-Tolyl-4-chlorbenzoat |
411-530-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
607-356-00-1 |
Ethyl-trans-2,2,6-trimethylcyclohexancarboxylat |
412-540-8 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-357-00-7 |
Reaktionsmasse aus trans-4-Acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran und cis-4-Acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran |
412-450-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-358-00-2 |
(1S,3S,5R,6R)-(4-Nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylat |
412-670-5 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
|
607-359-00-8 |
(1S,4R,6R,7R)-(4-Nitrophenylmethyl)3-methylen-1-oxo-7-phenylacetamido-cepham-4-carboxylat |
412-800-0 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
|
607-360-00-3 |
Natrium-3-acetoacetylamino-4-methoxytolyl-6-sulfonat |
411-680-7 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-361-00-9 |
Methyl-(R)-2-(4-hydroxyphenoxy)propionat |
411-950-4 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
607-362-00-4 |
Reaktionsmasse aus (3-Methoxy)propylammonium/[Tris-(2-hydroxyethyl)]ammonium-2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoat; (3-Methoxy)propylammonium/[Tris-(2-hydroxyethyl)]ammonium-2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)tetradec-4-enoat; (3-Methoxy)propylammonium/[Tris-(2-hydroxyethyl)]ammonium-2-(3-methoxypropylcarbamoylmethyl)hexadec-4-enoat; (3-Methoxy)propylammonium/[Tris-(2-hydroxyethyl)]ammonium-2-(3-methoxypropylcarbamoylmethyl)tetradec-4-enoat |
413-500-2 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H315 H318 H411 |
GHS05 GHS09 Dgr |
H315 H318 H411 |
|
|
|
|
607-363-00-X |
Methyl-3-methoxyacrylat |
412-900-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-364-00-5 |
3-Phenyl-7-[4-(tetrahydrofuran-2-yl-metoxy)phenyl]-benzo[1,2-b;4,5-b']difuran-2,6-dion |
413-330-9 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
|
607-365-00-0 |
2-(2-Amino-1,3-thiazol-4-yl)-(Z)-2-methoxyiminoacetylchloridhydrochlorid |
410-620-7 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
|
607-366-00-6 |
3,5-Dimethylbenzoylchlorid |
413-010-9 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
|
607-367-00-1 |
Kalium-bis(N-carboxymethyl)-N-methyl-glycinato-(2-)N, O,O, N)-ferrat-(1-)monohydrat |
411-640-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-368-00-7 |
1-(N,N-Dimethylcarbamoyl)-3-tert-butyl-5-carbethoxymethylthio-1H-1,2,4-triazol |
411-650-3 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
|
|
|
|
607-369-00-2 |
Reaktionsmasse aus trans-(2R)-5-Acetoxy-1,3-oxathiolan-2-carbonsäure; cis-(2R)-5-Acetoxy-1,3-oxathiolan-2-carbonsäure |
411-660-8 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
|
607-370-00-8 |
2-[[2-(Acetyloxy)-3-(1,1-dimethyl-ethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol |
412-210-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-371-00-3 |
3-Ethyl-5-methyl-4-(2-chlorphenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2H)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridindicarboxylat |
413-410-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-372-00-9 |
Ethoxyliertes Bisphenol-A-di-(norbornencarboxylat) |
412-410-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-373-00-4 |
Quizalofop-P-tefuryl (ISO); (+/–)-Tetrahydrofurfuryl-(R)-2-[4-(6-chlorchinoxalin-2-yloxy)phenyloxy]propionat |
414-200-4 |
Carc. 2 Repr. 2 Acute Tox. 4 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361fd H302 H373 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361fd H302 H373 H410 |
|
M = 1 M = 1 |
|
|
|
607-374-00-X |
5-Amino-2,4,6-triiod-1,3-benzoldicarbonyldichlorid |
417-220-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-375-00-5 |
Flocoumafen (ISO); Reaktionsmasse aus: cis-4-Hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluormethylbenzyloxy)phenyl)-1-naphthyl)cumarin und trans-4-Hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluormethylbenzyloxy)phenyl)-1-naphthyl)cumarin |
421-960-0 |
Repr. 1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (Blut) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (Blut) H410 |
|
Repr. 1B; H360D: C ≥ 0,003 % STOT RE 1; H372 (Blut): C ≥ 0,05 % STOT RE 2; H373 (Blut): 0,005 % ≤ C < 0,05 % M = 10 M = 10 |
|
|
|
607-376-00-0 |
Benzyl-2,4-dibrombutanoat |
420-710-8 |
Repr. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f *** H315 H317 H410 |
|
|
|
|
|
607-377-00-6 |
trans-4-Cyclohexyl- L-prolinmonohydrochlorid |
419-160-1 |
Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H361f *** H302 H315 H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H361f *** H302 H315 H318 H317 |
|
|
|
|
|
607-378-00-1 |
Ammonium-(Z)-α-methoxyimino-2-furylacetat |
405-990-1 |
Flam. Sol. 2 |
H228 |
GHS02 Dgr |
H228 |
|
|
T |
|
|
607-379-00-7 |
Reaktionsmasse aus 2-[N-(2-Hydroxyethyl)stearamido]ethyl-stearat; Natrium-[bis[2-(stearoyloxy)ethyl]amino]methylsulfonat; Natrium-[bis(2-hydroxyethyl)amino]methylsulfonat; N, N-Bis(2-Hydroxyethyl)stearamid |
401-230-8 |
|
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-380-00-2 |
Reaktionsmasse aus Ammonium-1,2-bis(hexyloxycarbonyl)ethansulfonat; Ammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethansulfonat; Ammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethansulfonat |
407-320-3 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
607-381-00-8 |
Reaktionsmasse aus Triestern von 2,2-Bis(hydroxymethyl)butanol mit C7-Alkansäuren und 2-Ethylhexansäure |
413-710-4 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-382-00-3 |
2-((4-Amino-2-nitrophenyl)amino)benzoesäure |
411-260-3 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
607-383-00-9 |
Reaktionsmasse aus 2,2,6,6-Tetramethylpiperidin-4-yl-hexadecanoat und 2,2,6,6-Tetramethylpiperidin-4-yl-octadecanoat |
415-430-8 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
|
607-384-00-4 |
Reaktionsmasse aus Estern von verzweigten C14-C15-Alkoholen mit 3,5-Di-tert-butyl-4-hydroxyphenylpropionsäure; verzweigtem und linearem C15-Alkyl-3,5-bis(1,1-dimethylethyl)-4-hydroxybenzolpropionat; verzweigtem und linearem C13-Alkyl-3,5-bis(1,1-dimethylethyl)-4-hydroxybenzolpropionat |
413-750-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-385-00-X |
Copolymer von Vinylalkohol und Vinylacetat, teilweise acetyliert mit 4-(2-(4-Formylphenyl)ethenyl)-1-methylpyridiniummethylsulfat |
414-590-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-386-00-5 |
Reaktionsmasse aus Tetradecansäure (42,5 - 47,5 %) und Poly(1-7)lactatestern der Tetradecansäure (52,5 - 57,5 %) |
412-580-6 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
607-387-00-0 |
Reaktionsmasse aus Dodecansäure (35 - 40 %) und Poly(1-7)lactatestern der Dodecansäure (60 - 65 %) |
412-590-0 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
607-388-00-6 |
4-Ethylamino-3-nitrobenzoesäure |
412-090-2 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
|
607-389-00-1 |
Trinatrium-N, N-bis(carboxymethyl)-3-amino-2-hydroxypropionat |
414-130-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-390-00-7 |
1,2,3,4-Tetrahydro-6-nitrochinoxalin |
414-270-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-391-00-2 |
Dimethylcyclopropan-1,1-dicarboxylat |
414-240-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-392-00-8 |
2-Phenoxyethyl-4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoat |
414-260-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-393-00-3 |
3-(cis-1-Propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-2-carbonsäure |
415-750-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-394-00-9 |
5-Methylpyrazin-2-carbonsäure |
413-260-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-395-00-4 |
Reaktionsmasse aus Natrium-1-tridecyl-4-allyl-(2 oder 3)-sulfobutandioat und Natrium-1-dodecyl-4-allyl-(2 oder 3)-sulfobutandioat |
410-230-7 |
— |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
607-396-00-X |
Bis(1,2,2,6,6-pentamethyl-4-piperidinyl)-2-(4-methoxybenzyliden)malonat |
414-840-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-397-00-5 |
Reaktionsmasse aus Calciumsalicylaten (verzweigt C10-14 und C18-30 alkyliert); Calciumphenolaten (verzweigt C10-14 und C18-30 alkyliert); geschwefelten Calciumphenolaten (verzweigt C10-14 und C18-30 alkyliert |
415-930-6 |
— |
Repr. 2 Skin Sens. 1 |
H361f*** H317 |
GHS08 GHS07 Wng |
H361f*** H317 |
|
|
|
|
607-398-00-0 |
Ethyl-N-(5-chlor-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamat |
414-820-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-399-00-6 |
2,2-Dimethyl-3-methyl-3-butenylpropanoat |
415-610-6 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
607-400-00-X |
Methyl-3-[[(dibutylamino)thioxomethyl]thio]propanoat |
414-400-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-401-00-5 |
Ethyl-3-hydroxy-5-oxo-3-cyclohexen-1-carboxylat |
414-450-4 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
|
607-402-00-0 |
Methyl-N-(phenoxycarbonyl)- L -valinat |
414-500-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-403-00-6 |
Reaktionsmasse aus Bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammoniumsuccinat und Isopropylalkohol |
414-810-0 |
— |
STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H318 H410 |
|
|
|
|
607-404-00-1 |
Reaktionsmasse aus ((Z)-3,7-Dimethyl-2,6-octadienyl)oxycarbonylpropansäure; Di-((E)-3,7-dimethyl-2,6-octadienyl)butandioat; Di-((Z)-3,7-dimethyl-2,6-octadienyl)butandioat; (Z)-3,7-Dimethyl-2,6-octadienylbutandioat und ((E)-3,7-Dimethyl-2,6-octadienyl)oxycarbonylpropansäure |
415-190-4 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-405-00-7 |
2-Hexyldecyl-p-hydroxybenzoat |
415-380-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-406-00-2 |
Kalium-2,5-dichlorbenzoat |
415-700-5 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
|
607-407-00-8 |
Ethyl-2-carboxy-3-(2-thienyl)propionat |
415-680-8 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
|
607-408-00-3 |
Kalium-N-(4-fluorphenyl)glycinat |
415-710-1 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H373 ** H318 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H373 ** H318 H317 H412 |
|
|
|
|
|
607-409-00-9 |
Reaktionsmasse aus (3R)-[1S-(1α,2α,6β-((2S)-2-Methyl-1-oxo-butoxy)-8aγ)hexahydro-2,6-dimethyl-1-naphthalin]-3,5-dihydroxyheptansäure und inerter Biomasse von Aspergillus terreus |
415-840-7 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-410-00-4 |
Mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butandioat und/oder Mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butandioat |
415-880-5 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
607-411-00-X |
Oxiranmethanol, 4-Methylbenzolsulfonat, (S)- Toluolsulfonsäureglycidylester |
417-210-7 |
Carc. 1B Muta. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H350 H341 H318 H317 H411 |
|
|
|
|
|
607-412-00-5 |
Ethyl-2-(1-cyanocyclohexyl)acetat |
415-970-4 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
|
|
|
|
|
607-413-00-0 |
trans-4-Phenyl- L-prolin |
416-020-1 |
Repr. 2 Skin Sens. 1 |
H361f *** H317 |
GHS08 GHS07 Wng |
H361f *** H317 |
|
|
|
|
|
▼M18 ————— |
||||||||||
|
607-415-00-1 |
Poly-(methylmethacrylat)-co-(butylmethacrylat)-co-(4-acryloxybutyl-isopropenyl-α, α-dimethylbenzylcarbamate)-co-(maleinsäureanhydrid) |
419-590-1 |
— |
Flam. Sol. 1 Skin Sens. 1 |
H228 H317 |
GHS02 GHS07 Dgr |
H228 H317 |
|
|
T |
|
607-416-00-7 |
4-(2-Carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamid |
420-730-7 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-417-00-2 |
3-Chlorpropylchlorformiat |
425-770-9 |
Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H331 H302 H373** H315 H318 H317 |
GHS06 GHS05 GHS08 Dgr |
H331 H302 H373** H315 H318 H317 |
|
|
|
|
|
607-418-00-8 |
2-Ethylhexyl-4-aminobenzoat |
420-170-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-419-00-3 |
(3'-Carboxymethyl-5-(2-(3-ethyl-3H-benzothiazol-2-yliden)-1-methyl-ethyliden)-4,4'-dioxo-2'-thioxo-(2,5')bithiazolidinyliden-3-yl)-essigsäure |
422-240-9 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
607-420-00-9 |
2,2-Bis(hydroxymethyl)butansäure |
424-090-1 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
607-421-00-4 |
Cypermethrin (ISO); α-Cyan-3-phenoxybenzyl 3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat; Cypermethrin cis/trans +/-40/60 |
257-842-9 |
Acute Tox. 4 Acute Tox. 4 STOT SE 3 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H335 H373 (Nervensystem) H400 H410 |
GHS07 GHS08 GHS09 Wng |
H332 H302 H335 H373 (Nervensystem) H410 |
|
oral: ATE = 500 mg/kg KG Einatmen: ATE = 3,3 mg/L (Stäube oder Nebel) M = 100000 M = 100000 |
|
|
|
607-422-00-X |
α-Cypermethrin (ISO); Racemat mit (R)-α-Cyano-3-phenoxybenzyl-(1S,3S)-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat; (S)-α-Cyano-3-phenoxybenzyl(1R,3R)-3-(2,2-dichlorvinyl)-2,2-dimethylcyclopropancarboxylat |
257-842-9 |
Acute Tox. 3 * STOT RE 2 * STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H373** H335 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H373** H335 H410 |
|
M=1000 |
|
|
|
607-423-00-5 |
Ester von Mecoprop und Mecoprop-P (ISO) |
— | ||||||||