ANNEX VI / Harmonised classification and labelling for certain hazardous substances
ANNEX VI
Harmonised classification and labelling for certain hazardous substances
Part 1 of this Annex provides an introduction to the list of harmonised classification and labelling, including information listed for each entry and related classifications and hazard statements in Table 3.
Part 2 of this Annex lays down general principles for preparing dossiers to propose and justify harmonised classification and labelling of substances at Union level.
Part 3 of this Annex lists hazardous substances for which harmonised classification and labelling have been established at Union level. In Table 3 the classification and labelling are based on the criteria in Annex I to this Regulation.
1. PART 1: INTRODUCTION TO THE LIST OF HARMONISED CLASSIFICATIONS AND LABELLING
1.1. Information listed for each entry
1.1.1. Numbering of entries and identification of a substance
1.1.1.1. Index numbers
Entries in Part 3 are listed according to the atomic number of the element most characteristic of the properties of the substance. Organic substances, because of their variety, have been placed in classes. The Index number for each substance is in the form of a digit sequence of the type ABC-RST-VW-Y. ABC corresponds to the atomic number of the most characteristic element or the most characteristic organic group in the molecule. RST is the consecutive number of the substance in the series ABC. VW denotes the form in which the substance is produced or placed on the market. Y is the check-digit calculated in accordance with the 10-digit ISBN method. This number is indicated in the column entitled ‘Index No’.
1.1.1.2. EC numbers
The EC number, i.e. EINECS, ELINCS or NLP, is the official number of the substance within the European Union. The EINECS number can be obtained from the European Inventory of Existing Commercial Chemical Substance (EINECS) ( 21 ). The ELINCS number can be obtained from the European List of Notified Substances (as amended) (EUR 22543 EN, Office for Official Publications of the European Communities, 2006, ISSN 1018-5593). The NLP number can be obtained from the list of ‘No-longer-polymers’ (as amended) (Document, Office for Official Publications of the European Communities, 1997, ISBN 92-827-8995-0). The EC number is a seven-digit system of the type XXX-XXX-X which starts at 200-001-8 (EINECS), at 400-010-9 (ELINCS) and at 500-001-0 (NLP). This number is indicated in the column entitled ‘EC No’.
1.1.1.3. CAS number
The Chemical Abstracts Service (CAS) number is also included to assist identification of the entry. It should be noted that the EINECS number includes both anhydrous and hydrated forms of a substance, and there are frequently different CAS numbers for anhydrous and hydrated forms. The CAS number included is for the anhydrous form only, and therefore the CAS number shown does not always describe the entry as accurately as the EINECS number. This number is indicated in the column entitled ‘CAS No’.
1.1.1.4. ►M18 Chemical name ◄
Wherever possible, hazardous substances are designated by their IUPAC names. Substances listed in EINECS, ELINCS or the list of ‘No-longer-polymers’ are designated using the names in these lists. Other names, such as usual or common names, are included in some cases. Whenever possible, plant protection products and biocides are designated by their ISO names.
Impurities, additives and minor components are normally not mentioned unless they contribute significantly to the classification of the substance.
Some substances are described with a specific percentage of purity. Substances containing a higher content of active material (e.g. organic peroxide) than this percentage are not included in the entry in Part 3 and may have other hazardous properties (e.g. explosive) and should be classified and labelled accordingly.
Where specific concentration limits are shown, these apply to the substance or substances shown in the entry. In particular, in the case of entries which are mixtures of substances or substances described with a specific percentage of purity, the limits apply to the substance as described in Part 3 and not the pure substance.
Without prejudice to Article 17(2), for substances appearing in Part 3, the name of the substance to be used on the label shall be one of the designations given there. For certain substances, additional information has been added in square brackets in order to help identify the substance. This additional information need not be included on the label.
Certain entries contain a reference to impurities; in these cases the name of the substance is followed by the text: ‘(containing ≥ xx % impurity)’. The reference in brackets is then to be considered as a part of the name, and must be included on the label.
1.1.1.5. Entries for groups of substances
A number of group entries are included in Part 3. In these cases, the classification and labelling requirements will apply to all substances covered by the description.
In some cases, there are classification and labelling requirements for specific substances that would be covered by the group entry. In such cases a specific entry is included in Part 3 for the substance and the group entry will be annotated with the phrase ‘except those specified elsewhere in this Annex’.
In some cases, individual substances may be covered by more than one group entry. In these cases, the classification of the substance reflects the classification for each of the two group entries. In cases where different classifications for the same hazard are given, the most severe classification shall be applied.
Entries in Part 3 for salts (under any denomination) cover both anhydrous and hydrous forms, unless specified otherwise.
EC or CAS numbers are not usually included for entries which comprise more than four individual substances.
1.1.2. Information related to the classification and labelling of each entry in Table 3
1.1.2.1. Classification codes
1.1.2.1.1.
The classification for each entry is based on the criteria set out in Annex I, in accordance with Article 13(a) and is presented in the form of a code representing the hazard class and the category or categories/divisions/types within this hazard class.
The Hazard class and category codes used for each of the hazard categories/divisions/types included in a class are shown in Table 1.1.
Table 1.1
|
Hazard Class |
Hazard Class and Category Code |
|
Explosive |
Unst. Expl. Expl. 1.1 Expl. 1.2 Expl. 1.3 Expl. 1.4 Expl. 1.5 Expl. 1.6 |
|
Flammable gases |
Flam. Gas 1A Flam. Gas 1B Flam. Gas 2 Pyr. Gas Chem. Unst. Gas A Chem. Unst. Gas B |
|
Aerosol |
Aerosol 1 Aerosol 2 Aerosol 3 |
|
Oxidising gas |
Ox. Gas 1 |
|
Gases under pressure |
Press. Gas (*1) |
|
Flammable liquid |
Flam. Liq. 1 Flam. Liq. 2 Flam. Liq. 3 |
|
Flammable solid |
Flam. Sol. 1 Flam. Sol. 2 |
|
Self-reactive substance or mixture |
Self-react. A Self-react. B Self-react. CD Self-react. EF Self-react. G |
|
Pyrophoric liquid |
Pyr. Liq. 1 |
|
Pyrophoric solid |
Pyr. Sol. 1 |
|
Self-heating substance or mixture |
Self-heat. 1 Self-heat. 2 |
|
Substance or mixture which in contact with water emits flammable gas |
Water-react. 1 Water-react. 2 Water-react. 3 |
|
Oxidising liquid |
Ox. Liq. 1 Ox. Liq. 2 Ox. Liq. 3 |
|
Oxidising solid |
Ox. Sol. 1 Ox. Sol. 2 Ox. Sol. 3 |
|
Organic peroxide |
Org. Perox. A Org. Perox. B Org. Perox. CD Org. Perox. EF Org. Perox. G |
|
Substance or mixture corrosive to metals |
Met. Corr. 1 |
|
Desensitised explosives |
Desen. Expl. 1 Desen. Expl. 2 Desen. Expl. 3 Desen. Expl. 4 |
|
Acute toxicity |
Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 4 |
|
Skin corrosion/irritation |
Skin Corr. 1 Skin Corr. 1A Skin Corr. 1B Skin Corr. 1C Skin Irrit. 2 |
|
Serious eye damage/eye irritation |
Eye Dam. 1 Eye Irrit. 2 |
|
Respiratory/skin sensitization |
►M2 Resp. Sens. 1, 1A, 1B ◄ ►M2 Skin. Sens. 1, 1A, 1B ◄ |
|
Germ cell mutagenicity |
Muta. 1A Muta. 1B Muta. 2 |
|
Carcinogenicity |
Carc. 1A Carc. 1B Carc. 2 |
|
Reproductive toxicity |
Repr. 1A Repr. 1B Repr. 2 Lact. |
|
Specific target organ toxicity — single exposure |
STOT SE 1 STOT SE 2 STOT SE 3 |
|
Specific target organ toxicity — repeated exposure |
STOT RE 1 STOT RE 2 |
|
Aspiration hazard |
Asp. Tox. 1 |
|
Endocrine disruptor for human health |
ED HH 1 ED HH 2 |
|
Hazardous to the aquatic environment |
Aquatic Acute 1 Aquatic Chronic 1 Aquatic Chronic 2 Aquatic Chronic 3 Aquatic Chronic 4 |
|
Endocrine disruptor for the environment |
ED ENV 1 ED ENV 2 |
|
Persistent, bioaccumulative and toxic Very persistent and very bioaccumulative |
PBT vPvB |
|
Persistent, mobile and toxic Very persistent and very mobile |
PMT vPvM |
|
Hazardous for the ozone layer |
►M2 Ozone 1 ◄ |
|
(*1)
see Note U in 1.1.3. |
|
1.1.2.1.2.
The hazard statements assigned in accordance with Article 13(b) are indicated in accordance with Annex III. In addition, for certain hazard statements, letters are added to the 3-digit hazard statement code for further differentiations. The following additional codes are used:
|
H350i |
May cause cancer by inhalation. |
|
H360F |
May damage fertility. |
|
H360D |
May damage the unborn child. |
|
H361f |
Suspected of damaging fertility. |
|
H361d |
Suspected of damaging the unborn child. |
|
H360FD |
May damage fertility. May damage the unborn child. |
|
H361fd |
Suspected of damaging fertility. Suspected of damaging the unborn child. |
|
H360Fd |
May damage fertility. Suspected of damaging the unborn child. |
|
H360Df |
May damage the unborn child. Suspected of damaging fertility. |
1.1.2.2. Labelling codes
In the labelling column, the following elements are listed:
the hazard pictogram codes as specified in Annex V, in accordance with the precedence rules in Article 26;
the signal word code ‘Dgr’ for ‘Danger’or ‘Wng’ for ‘Warning’, in accordance with the precedence rule in Article 20(3);
the hazard statement codes as specified in Annex III, in accordance with the classification;
the codes for the supplemental statements assigned in accordance with Article 25(1) and the rules specified in Annex II, part 1.
1.1.2.3. Specific concentration limits, M-factors and Acute Toxicity Estimates (ATE)
Specific concentration limits (SCL), where different from the generic concentration limits given in Annex I for a certain category, are given in a separate column together with the classification concerned using the same codes as under 1.1.2.1.1. Also harmonised ATEs are listed in the same column of table 3. The SCLs and harmonised ATEs must be used by the manufacturer, importer or downstream user for the classification of a mixture containing this substance. When applying an ATE, the additivity formula as described in 3.1.3.6 of Annex I shall be used. Where no specific concentration limits are given in this Annex for a certain category, the generic concentration limits given in Annex I must be applied for the classification of substances containing impurities, additives or individual constituents or for mixtures. If harmonised ATE values are missing for acute toxicity the correct value has to be established by using the available data.
Unless otherwise shown, the concentration limits are a percentage by weight of the substance calculated with reference to the total weight of the mixture.
In case an M-factor has been harmonised for substances classified as hazardous to the aquatic environment in the categories Aquatic Acute 1 or Aquatic Chronic 1, that M-factor is given in Table 3 in the same column as the specific concentration limits. In case an M-factor for Aquatic Acute 1 and an M-factor for Aquatic Chronic 1 have been harmonised, each M-factor shall be listed in the same line as its corresponding differentiation. Where a single M-factor is given in Table 3 and the substance is classified as Aquatic Acute 1 and Aquatic Chronic 1, that M-factor shall be used by the manufacturer, importer or downstream user for the classification of a mixture containing this substance for acute and long-term aquatic hazards using the summation method. Where no M-factor is given in Table 3, M-factor(s) based on available data for the substance shall be set by the manufacturer, importer or downstream user. For the setting and use of M-factors, see Section 4.1.3.5.5.5 of Annex I.
1.1.3. Notes assigned to an entry
The note(s) assigned to an entry are listed in the column entitled ‘Notes’. The meaning of the notes is as follows:
1.1.3.1. Notes relating to the identification, classification and labelling of substances
Without prejudice to Article 17(2), the name of the substance must appear on the label in the form of one of the designations given in Part 3.
In Part 3, use is sometimes made of a general description such as ‘... compounds’ or ‘... salts’. In this case, the supplier is required to state on the label the correct name, due account being taken of section 1.1.1.4.
Some substances (acids, bases, etc.) are placed on the market in aqueous solutions at various concentrations and, therefore, these solutions require different classification and labelling since the hazards vary at different concentrations.
In Part 3 entries with Note B have a general designation of the following type: ‘nitric acid … %’.
In this case the supplier must state the percentage concentration of the solution on the label. Unless otherwise stated, it is assumed that the percentage concentration is calculated on a weight/weight basis.
Some organic substances may be marketed either in a specific isomeric form or as a mixture of several isomers.
In this case the supplier must state on the label whether the substance is a specific isomer or a mixture of isomers.
Certain substances which are susceptible to spontaneous polymerisation or decomposition are generally placed on the market in a stabilised form. It is in this form that they are listed in Part 3.
However, such substances are sometimes placed on the market in a non-stabilised form. In this case, the supplier must state on the label the name of the substance followed by the words ‘non-stabilised’.
▼M15 —————
This substance may contain a stabiliser. If the stabiliser changes the hazardous properties of the substance, as indicated by the classification in Part 3, classification and labelling should be provided in accordance with the rules for classification and labelling of hazardous mixtures.
This substance may be marketed in an explosive form in which case it must be evaluated using the appropriate test methods. The classification and labelling provided shall reflect the explosive properties.
▼M2 —————
The harmonised classification as a carcinogen or mutagen applies unless it can be shown that the substance contains less than 0,1 % w/w benzene (Einecs No 200-753-7), in which case a classification in accordance with Title II of this Regulation shall be performed also for those hazard classes.
The harmonised classification as a carcinogen or mutagen applies unless it can be shown that the substance contains less than 0,1 % w/w 1,3- butadiene (Einecs No 203-450-8), in which case a classification in accordance with Title II of this Regulation shall be performed also for those hazard classes. Where the substance is not classified as a carcinogen or mutagen, at least the precautionary statements (P102-)P210-P403 shall apply.
The harmonised classification as a carcinogen applies unless it can be shown that the substance contains less than 3 % of dimethyl sulphoxide extract as measured by IP 346 (‘Determination of polycyclic aromatics in unused lubricating base oils and asphaltene free petroleum fractions – Dimethyl sulphoxide extraction refractive index method’ Institute of Petroleum, London), in which case a classification in accordance with Title II of this Regulation shall be performed also for that hazard class.
The harmonised classification as a carcinogen applies unless it can be shown that the substance contains less than 0,005 % w/w benzo[a]-pyrene (Einecs No 200-028-5), in which case a classification in accordance with Title II of this Regulation shall be performed also for that hazard class.
The harmonised classification as a carcinogen applies unless the full refining history is known and it can be shown that the substance from which it is produced is not a carcinogen, in which case a classification in accordance with Title II of this Regulation shall be performed also for that hazard class.
The harmonised classification as a carcinogen or mutagen applies unless it can be shown that the substance contains less than 0,1 % w/w benzene (Einecs No 200-753-7), in which case a classification in accordance with Title II of this Regulation shall be performed also for those hazard classes.
Where the substance is not classified as a carcinogen or mutagen, at least the precautionary statements (P102-)P260-P262-P301 + P310-P331 shall apply.
The harmonised classification as a carcinogen applies unless one of the following conditions is fulfilled:
The harmonised classification as a carcinogen applies except in the case of fibres with a Length Weighted Geometric Mean Diameter (LWGMD) minus two geometric standard errors greater than 6 μm, as measured in accordance with Test method A.22 in the Annex to Commission Regulation (EC) No 440/2008 ( *4 ).
This substance may not require a label according to Article 17 (see Section 1.3 of Annex I) (Table 3).
This substance may be marketed in a form which does not have the physical hazards as indicated by the classification in the entry in Part 3. If the results of the relevant method or methods in accordance with Part 2 of Annex I of this Regulation show that the specific form of substance marketed does not exhibit this physical property or these physical hazards, the substance shall be classified in accordance with the result or results of this test or these tests. Relevant information, including reference to the relevant test method(s) shall be included in the safety data sheet.
When put on the market gases have to be classified as ‘Gases under pressure’, in one of the groups compressed gas, liquefied gas, refrigerated liquefied gas or dissolved gas. The group depends on the physical state in which the gas is packaged and therefore has to be assigned case by case. The following codes are assigned:
Aerosols shall not be classified as gases under pressure (See Annex I, Part 2, Section 2.3.2.1, Note 2).
Note V:
If the substance is to be placed on the market as fibres (with diameter < 3 μm, length > 5 μm and aspect ratio ≥ 3:1) or particles of the substance fulfilling the WHO fibre criteria or as particles with modified surface chemistry, their hazardous properties must be evaluated in accordance with Title II of this Regulation, to assess whether a higher category (Carc. 1B or 1A) and/or additional routes of exposure (oral or dermal) should be applied.
Note W:
It has been observed that the carcinogenic hazard of this substance arises when respirable dust is inhaled in quantities leading to significant impairment of particle clearance mechanisms in the lung.
This note aims to describe the particular toxicity of the substance; it does not constitute a criterion for classification according to this Regulation.
Note X:
The classification for the hazard class(es) in this entry is based only on the hazardous properties of the part of the substance which is common to all substances in the entry. The hazardous properties of any substances in the entry also depend on the properties of the part of the substance which is not common to all substances in the group. The latter must be evaluated to assess whether more severe classification(s) (i.e. a higher category) or a broader scope of the same classification (additional differentiation, target organs and/or hazard statements) might apply for the hazard class(es) in the entry.
1.1.3.2. Notes relating to the classification and labelling of mixtures
The concentration stated or, in the absence of such concentrations, the generic concentrations set out in this Regulation are the percentages by weight of the metallic element calculated with reference to the total weight of the mixture.
The concentration of isocyanate stated is the percentage by weight of the free monomer calculated with reference to the total weight of the mixture.
The concentration stated is the percentage by weight of chromate ions dissolved in water calculated with reference to the total weight of the mixture.
The concentration limits for gaseous mixtures are expressed as volume per volume percentage.
Alloys containing nickel are classified for skin sensitisation when the release rate of 0,5 μg Ni/cm2/week, as measured by the European Standard reference test method EN 1811, is exceeded.
The classification as a carcinogen shall apply unless it can be shown that the maximum theoretical concentration of releasable formaldehyde, irrespective of the source, in the mixture as placed on the market is less than 0,1 %.
The classification as a mutagen shall apply unless it can be shown that the maximum theoretical concentration of releasable formaldehyde, irrespective of the source, in the mixture as placed on the market is less than 1 %.
Note 10:
The classification as a carcinogen by inhalation applies only to mixtures in powder form containing 1 % or more of titanium dioxide which is in the form of or incorporated in particles with aerodynamic diameter ≤ 10 μm.
Note 11:
The classification of mixtures as reproductive toxicant is necessary if the sum of the concentrations of individual boron compounds that are classified as reproductive toxicant in the mixture as placed on the market is ≥ 0,3 %.
Note 12:
The classification of mixtures as reproductive toxicant is necessary if the sum of the concentrations of individual substances covered by this entry in the mixture as placed on the market is equal to, or above, the applicable generic concentration limit for the assigned category, or a specific concentration limit given in this entry.
1.2. Classifications and hazard statements in Table 3 arising from translation of classifications listed in Annex I to directive 67/548/EEC
1.2.1.
Minimum classification
For certain hazard classes, including acute toxicity and STOT repeated exposure, the classification according to the criteria in Directive 67/548/EEC does not correspond directly to the classification in a hazard class and category under this Regulation. In these cases the classification in this Annex shall be considered as a minimum classification. This classification shall be applied if none of the following conditions are fulfilled:
Minimum classification for a category is indicated by the reference * in the column ‘Classification’ in Table 3.
The reference * can also be found in the column ‘Specific Conc. Limits and M-factors and Acute Toxicity Estimates (ATE)’ where it indicates that the entry concerned had specific concentration limits under Directive 67/548/EEC for acute toxicity. These concentration limits cannot be ‘translated’ into concentration limits under this Regulation, especially when a minimum classification is given. However, when the reference * is shown, the classification for acute toxicity for this entry may be of special concern.
1.2.2. Route of exposure cannot be excluded
For certain hazard classes, e.g. STOT, the route of exposure should be indicated in the hazard statement only if it is conclusively proven that no other route of exposure can cause the hazard in accordance to the criteria in Annex I. Under Directive 67/548/EEC the route of exposure was indicated for classifications with R48 when there was data justifying the classification for this route of exposure. The classification under 67/548/EEC indicating the route of exposure has been translated into the corresponding class and category according to this Regulation, but with a general hazard statement not specifying the route of exposure as the necessary information is not available.
These hazard statements are indicated by the reference ** in Table 3.
1.2.3. Hazard statements for reproductive toxicity
Hazard statements H360 and H361 indicate a general concern for effects on fertility and/or development: ‘May damage/Suspected of damaging fertility or the unborn child’. According to the criteria, the general hazard statement can be replaced by the hazard statement indicating the specific effect of concern in accordance with Section 1.1.2.1.2. When the other differentiation is not mentioned, this is due to evidence proving no such effect, inconclusive data or no data and the obligations in Article 4(3) shall apply for that differentiation.
In order not to lose information from the harmonised classifications for fertility and developmental effects under Directive 67/548/EEC, the classifications have been translated only for those effects classified under that Directive.
These hazard statements are indicated by the reference *** in Table 3.
1.2.4. Correct classification for physical hazards could not be established
For some entries the correct classification for physical hazards could not be established because sufficient data are not available for the application of the classification criteria in this Regulation. The entry might be assigned to a different (also higher) category or even another hazard class than indicated. The correct classification shall be confirmed by testing.
The entries with physical hazards that need to be confirmed by testing are indicated by the reference **** in Table 3.
2. PART 2: DOSSIERS FOR HARMONISED CLASSIFICATION AND LABELLING
This Part lays down general principles for preparing dossiers to propose and justify harmonised classification and labelling.
The relevant parts of sections 1, 2 and 3 of Annex I to Regulation (EC) No 1907/2006 shall be used for the methodology and format of any dossier.
For all dossiers any relevant information from registration dossiers shall be considered and other available information may be used. For hazard information which has not been previously submitted to the Agency, a robust study summary shall be included in the dossier.
A dossier for harmonised classification and labelling shall contain the following:
3. PART 3: HARMONISED CLASSIFICATION AND LABELLING TABLE
Table 3
List of harmonised classification and labelling of hazardous substances
|
Index No |
►M18 Chemical name ◄ |
EC No |
CAS No |
Classification |
Labelling |
Notes |
||||
|
Hazard Class and Category Code(s) |
Hazard statement Code(s) |
Pictogram, Signal Word Code(s) |
Hazard statement Code(s) |
Suppl. Hazard statement Code(s) |
||||||
|
001-001-00-9 |
hydrogen |
215-605-7 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
001-002-00-4 |
aluminium lithium hydride |
240-877-9 |
Water-react. 1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
|
|
|
|
|
001-003-00-X |
sodium hydride |
231-587-3 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
|
|
001-004-00-5 |
calcium hydride |
232-189-2 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
|
|
003-001-00-4 |
lithium |
231-102-5 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
|
003-002-00-X |
n-hexyllithium |
404-950-0 |
Water-react. 1 Pyr. Sol. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
|
|
|
|
003-003-00-5 |
(2-methylpropyl)lithium; isobutyllithium |
440-620-2 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H260 H250 H314 H336 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H260 H250 H314 H336 H410 |
EUH014 |
|
|
|
|
004-001-00-7 |
beryllium |
231-150-7 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
|
|
004-002-00-2 |
beryllium compounds with the exception of aluminium beryllium silicates, and with those specified elsewhere in this Annex |
— |
— |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
|
|
A |
|
004-003-00-8 |
beryllium oxide |
215-133-1 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
|
|
005-001-00-X |
boron trifluoride |
231-569-5 |
Press. Gas Acute Tox. 2 * Skin Corr. 1A |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
EUH014 |
|
U |
|
|
005-002-00-5 |
boron trichloride |
233-658-4 |
Press. Gas Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1B |
H330 H300 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
|
U |
|
|
005-003-00-0 |
boron tribromide |
233-657-9 |
Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A |
H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014 |
|
|
|
|
005-004-00-6 |
trialkylboranes, solid |
— |
— |
Pyr. Sol. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A |
|
005-004-01-3 |
trialkylboranes, liquid |
— |
— |
Pyr. Liq. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A |
|
005-005-00-1 |
trimethyl borate |
204-468-9 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H312 |
GHS02 GHS07 Wng |
H226 H312 |
|
|
|
|
|
005-006-00-7 |
dibutyltin hydrogen borate |
401-040-5 |
Repr. 1B Muta. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H341 H372** H312 H302 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H360FD H341 H372** H312 H302 H318 H317 H410 |
|
|
|
|
|
005-007-00-2 |
boric acid; [1] boric acid [2] |
233-139-2 [1] 234-343-4 [2] |
10043-35-3 [1] 11113-50-1 [2] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
005-008-00-8 |
diboron trioxide |
215-125-8 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
|
005-009-00-3 |
tetrabutylammonium butyltriphenylborate |
418-080-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
005-010-00-9 |
N, N-dimethylanilinium tetrakis(pentafluorophenyl)borate |
422-050-6 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H351 H302 H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H351 H302 H315 H318 |
|
|
|
|
|
005-011-00-4 |
tetraboron disodium heptaoxide, hydrate; [1] disodium tetraborate, anhydrous; [2] orthoboric acid, sodium salt; [3] disodium tetraborate decahydrate; [4] disodium tetraborate pentahydrate [5] |
235-541-3 [1] 215-540-4 [2] 237-560-2 [3] 215-540-4 [4] 215-540-4 [5] |
12267-73-1 [1] 1330-43-4 [2] 13840-56-7 [3] 1303-96-4 [4] 12179-04-3 [5] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
005-012-00-X |
diethyl{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}ammonium butyltriphenylborate |
418-070-1 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
005-013-00-5 |
diethylmethoxyborane |
425-380-9 |
Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H250 H332 H312 H302 H373** H314 H317 H413 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H250 H332 H312 H302 H373** H314 H317 H413 |
|
|
|
|
|
005-014-00-0 |
4-formylphenylboronic acid |
438-670-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
005-015-00-6 |
1-chloromethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) |
414-380-4 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
|
|
005-016-00-1 |
tetrabutylammonium butyl tris-(4-tert-butylphenyl)borate |
431-370-5 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
005-017-00-7 |
sodium perborate; [1] sodium peroxometaborate; [2] sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr.1B; H360Df: C ≥9 % Repr.1B; H360 D: 6,5 % ≤ C <9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-017-01-4 |
sodium perborate; [1] sodium peroxometaborate; [2] sodium peroxoborate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-018-00-2 |
perboric acid (H3BO2(O2)), monosodium salt trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate; [3] sodium peroxoborate hexahydrate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B STOT SE 3 Eye Dam. 1 |
H360Df H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H335 H318 |
|
Repr. 1B; H360Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
|
005-018-01-X |
perboric acid (H3BO2(O2)), monosodium salt, trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate; [3] sodium peroxoborate hexahydrate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H360Df H332 H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H332 H335 H318 |
|
Repr. 1B; H360 Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
|
|
005-019-00-8 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate; [3] sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-019-01-5 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate;[3] sodium peroxoborate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
|
|
005-020-00-3 |
disodium octaborate anhydrous; [1] disodium octaborate tetrahydrate [2] |
234-541-0 [1] 234-541-0 [2] |
12008-41-2 [1] 12280-03-4 [2] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
006-001-00-2 |
carbon monoxide |
211-128-3 |
Flam. Gas 1 Press. Gas Repr. 1A Acute Tox. 3 * STOT RE 1 |
H220 H360D *** H331 H372 ** |
GHS02 GHS04 GHS06 GHS08 Dgr |
H220 H360D *** H331 H372 ** |
|
|
U |
|
|
006-002-00-8 |
phosgene; carbonyl chloride |
200-870-3 |
Press. Gas Acute Tox. 2 * Skin Corr. 1B |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
|
|
U |
|
|
006-003-00-3 |
carbon disulphide |
200-843-6 |
Flam. Liq. 2 Repr. 2 STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 |
H225 H361fd H372 ** H319 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H361fd H372 ** H319 H315 |
|
Repr. 2; H361fd: C ≥ 1 % STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
|
|
006-004-00-9 |
calcium carbide |
200-848-3 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
T |
|
|
006-005-00-4 |
thiram (ISO); tetramethylthiuram disulphide |
205-286-2 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H373 ** H319 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H373 ** H319 H315 H317 H410 |
|
M = 10 |
|
|
|
006-006-00-X |
hydrogen cyanide; hydrocyanic acid |
200-821-6 |
Flam. Liq. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H224 H330 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H224 H330 H410 |
|
|
|
|
|
006-006-01-7 |
hydrogen cyanide … %; hydrocyanic acid … % |
200-821-6 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
|
B |
|
|
006-007-00-5 |
salts of hydrogen cyanide with the exception of complex cyanides such as ferrocyanides, ferricyanides and mercuric oxycyanide and those specified elsewhere in this Annex |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
EUH032 |
|
A |
|
006-008-00-0 |
antu (ISO); 1-(1-naphthyl)-2-thiourea |
201-706-3 |
Acute Tox. 2 * Carc. 2 |
H300 H351 |
GHS06 GHS08 Dgr |
H300 H351 |
|
|
|
|
|
006-009-00-6 |
1-isopropyl-3-methylpyrazol-5-yl dimethylcarbamate; isolan |
204-318-2 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
006-010-00-1 |
5,5-dimethyl-3-oxocyclohex-1-enyl dimethylcarbamate 5,5-dimethyldihydroresorcinol dimethylcarbamate; dimetan |
204-525-8 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
|
006-011-00-7 |
carbaryl (ISO); 1-naphthyl methylcarbamate |
200-555-0 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H351 H332 H302 H400 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H302 H400 |
|
M=100 |
|
|
|
006-012-00-2 |
ziram (ISO); zinc bis dimethyldithiocarbamate |
205-288-3 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H373 ** H335 H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H302 H373 ** H335 H318 H317 H410 |
|
M = 100 |
|
|
|
006-013-00-8 |
metam-sodium (ISO); sodium methyldithiocarbamate |
205-293-0 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
EUH031 |
|
|
|
|
006-014-00-3 |
nabam (ISO); disodium ethylenebis(N, N'-dithiocarbamate) |
205-547-0 |
Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H317 H410 |
GHS07 GHS09 Wng |
H302 H335 H317 H410 |
|
|
|
|
|
006-015-00-9 |
diuron (ISO); 3-(3,4-dichlorophenyl)–1,1-dimethylurea |
206-354-4 |
Carc. 1B STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H373 (blood system) H400 H410 |
GHS08 GHS09 Dgr |
H350 H373 (blood system) H410 |
|
M = 100 M = 100 |
|
|
|
006-016-00-4 |
propoxur (ISO); 2-isopropyloxyphenyl N-methylcarbamate; 2-isopropoxyphenyl methylcarbamate |
204-043-8 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
|
006-017-00-X |
aldicarb (ISO); 2-methyl-2-(methylthio)propanal-O-(N-methylcarbamoyl)oxime |
204-123-2 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
|
|
|
|
006-018-00-5 |
aminocarb (ISO); 4-dimethylamino-3-tolyl methylcarbamate |
217-990-7 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
|
006-019-00-0 |
di-allate (ISO); S-(2,3-dichloroallyl)-N,N-diisopropylthiocarbamate |
218-961-1 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
|
006-020-00-6 |
barban (ISO); 4-chlorbut-2-ynyl N-(3-chlorophenyl)carbamate |
202-930-4 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
|
006-021-00-1 |
linuron (ISO); 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
206-356-5 |
Repr. 1B Carc. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H351 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H351 H302 H373 ** H410 |
|
|
|
|
|
006-022-00-7 |
decarbofuran (ISO); 2,3-dihydro-2-methylbenzofuran-7-yl methylcarbamate |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
006-023-00-2 |
mercaptodimethur (ISO); methiocarb (ISO); 3,5-dimethyl-4-methylthiophenyl N-methylcarbamate |
217-991-2 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
|
006-024-00-8 |
proxan-sodium (ISO); sodium O-isopropyldithiocarbonate |
205-443-5 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
|
|
|
|
|
006-025-00-3 |
allethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; bioallethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [1] S-bioallethrin; [3] (S)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [2] esbiothrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl(1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate [3] |
209-542-4 [1] 249-013-5 [2]-[3] |
584-79-2 [1] 28434-00-6 [2] 84030-86-4 [3] |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
C |
|
006-026-00-9 |
carbofuran (ISO); 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N-methylcarbamate |
216-353-0 |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
|
|
|
|
|
006-028-00-X |
dinobuton (ISO); 2-(1-methylpropyl)-4,6-dinitrophenyl isopropyl carbonate |
213-546-1 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
|
006-029-00-5 |
dioxacarb (ISO); 2-(1,3-dioxolan-2-yl)phenyl N-methylcarbamate |
230-253-4 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
|
|
006-030-00-0 |
EPTC (ISO); S-ethyl dipropylthiocarbamate |
212-073-8 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-031-00-6 |
formetanate (ISO); 3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate |
244-879-0 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
|
|
006-032-00-1 |
monolinuron (ISO); 3-(4-chlorophenyl)-1-methoxy-1-methylurea |
217-129-5 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
|
006-033-00-7 |
metoxuron (ISO); 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
243-433-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
006-034-00-2 |
pebulate (ISO); N-butyl-N-ethyl-S-propylthiocarbamate |
214-215-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-035-00-8 |
pirimicarb (ISO); 2-(dimethylamino)-5,6-dimethylpyrimidin-4-yl dimethylcarbamate |
245-430-1 |
Carc. 2 Acute Tox. 3 Acute Tox. 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H301 H317 H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H351 H331 H301 H317 H410 |
|
M = 10 M = 100 |
|
|
|
006-036-00-3 |
benzthiazuron (ISO); 1-benzothiazol-2-yl-3-methylurea |
217-685-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-037-00-9 |
promecarb (ISO); 3-isopropyl-5-methylphenyl N-methylcarbamate |
220-113-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
|
006-038-00-4 |
sulfallate (ISO); 2-chloroallyl N, N-dimethyldithiocarbamate |
202-388-9 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
|
006-039-00-X |
tri-allate (ISO); S-2,3,3-trichloroallyl diisopropylthiocarbamate |
218-962-7 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
|
006-040-00-5 |
3-methylpyrazol-5-yl-dimethylcarbamate; monometilan |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
006-041-00-0 |
dimethylcarbamoyl chloride |
201-208-6 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H350 H331 H302 H319 H335 H315 |
GHS06 GHS08 Dgr |
H350 H331 H302 H319 H335 H315 |
|
Carc. 1B; H350: C ≥ 0,001 % |
|
|
|
006-042-00-6 |
monuron (ISO); 3-(4-chlorophenyl)-1,1-dimethylurea |
205-766-1 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
|
006-043-00-1 |
3-(4-chlorophenyl)-1,1-dimethyluronium trichloroacetate; monuron-TCA |
— |
Carc. 2 Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H319 H315 H410 |
|
|
|
|
|
006-044-00-7 |
isoproturon (ISO); 3-(4-isopropylphenyl)-1,1-dimethylurea |
251-835-4 |
Carc. 2 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H373 (blood) H400 H410 |
GHS08 GHS09 Wng |
H351 H373 (blood) H410 |
|
M = 10 M = 10 |
|
|
|
006-045-00-2 |
methomyl (ISO); 1-(methylthio)ethylideneamino N-methylcarbamate |
240-815-0 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
|
M=100 |
|
|
|
006-046-00-8 |
bendiocarb (ISO); 2,2-dimethyl-1,3-benzodioxol-4-yl N-methylcarbamate; 2,2-dimethyl-1,3-benzodioxol-4-yl methylcarbamate |
245-216-8 |
Acute Tox. 3 Acute Tox. 3 Acute Tox. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H300 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H300 H410 |
|
M = 10 M = 100 |
|
|
|
006-047-00-3 |
bufencarb (ISO); reaction mass of 3-(1-methylbutyl)phenyl N-methylcarbamate and 3-(1-ethylpropyl)phenyl N-methylcarbamate |
— |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
|
006-048-00-9 |
ethiofencarb (ISO); 2-(ethylthiomethyl)phenyl N-methylcarbamate |
249-981-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-049-00-4 |
dixanthogen; O, O-diethyl dithiobis(thioformate) |
207-944-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-050-00-X |
1,1-dimethyl-3-phenyluronium trichloroacetate; fenuron-TCA |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
006-051-00-5 |
ferbam (ISO); iron tris(dimethyldithiocarbamate) |
238-484-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
|
|
|
|
006-052-00-0 |
formetanate hydrochloride; 3-(N, N-dimethylaminomethyleneamino)phenyl N-methylcarbamate |
245-656-0 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
|
|
006-053-00-6 |
isoprocarb (ISO); 2-isopropylphenyl N-methylcarbamate |
220-114-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-054-00-1 |
mexacarbate (ISO); 3,5-dimethyl-4-dimethylaminophenyl N-methylcarbamate |
206-249-3 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
|
006-055-00-7 |
xylylcarb (ISO); 3,4-dimethylphenyl N-methylcarbamate; 3,4-xylyl methylcarbamate; MPMC |
219-364-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-056-00-2 |
metolcarb (ISO); m-tolyl methylcarbamate; MTMC |
214-446-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-057-00-8 |
nitrapyrin (ISO); 2-chloro-6-trichloromethylpyridine |
217-682-2 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-058-00-3 |
noruron (ISO); 1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urea |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-059-00-9 |
oxamyl (ISO); N',N'-dimethylcarbamoyl(methylthio)methylenamine N-methylcarbamate; |
245-445-3 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Chronic 2 |
H330 H300 H312 H411 |
GHS06 GHS09 Dgr |
H330 H300 H312 H411 |
|
|
|
|
|
006-060-00-4 |
oxycarboxin (ISO); 2,3-dihydro-6-methyl-5-(N-phenylcarbamoyl)-1,4-oxothiine 4,4-dioxide |
226-066-2 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
006-061-00-X |
S-ethyl N-(dimethylaminopropyl)thiocarbamatehydrochloride; prothiocarb hydrochloride |
243-193-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-062-00-5 |
methyl 3,4-dichlorophenylcarbanilate; SWEP. |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-063-00-0 |
thiobencarb (ISO); S-4-chlorobenzyl diethylthiocarbamate |
248-924-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-064-00-6 |
thiofanox (ISO); 3,3-dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime |
254-346-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
006-065-00-1 |
3-chloro-6-cyano-bicyclo(2,2,1)heptan-2-one-O-(N-methylcarbamoyl)oxime; triamid |
— |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Chronic 2 |
H300 H311 H411 |
GHS06 GHS09 Dgr |
H300 H311 H411 |
|
|
|
|
|
006-066-00-7 |
vernolate (ISO); S-propyl dipropylthiocarbamate |
217-681-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
006-067-00-2 |
XMC; 3,5-xylyl methylcarbamate |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
006-068-00-8 |
diazomethane |
206-382-7 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
006-069-00-3 |
thiophanate-methyl (ISO); dimethyl (1,2-phenylenedicarbamothioyl)biscarbamate; dimethyl 4,4′-(o-phenylene)bis(3-thioallophanate) |
245-740-7 |
Carc. 2 Muta. 2 Acute Tox. 4 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H341 H332 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H341 H332 H317 H410 |
|
inhalation: ATE = 1,7 mg/l (dusts and mists) M = 10 M = 10 |
|
|
|
006-070-00-9 |
furmecyclox (ISO); N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide |
262-302-0 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
|
006-071-00-4 |
cyclooct-4-en-1-yl methyl carbonate |
401-620-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
006-072-00-X |
prosulfocarb (ISO); S-benzyl N, N-dipropylthiocarbamate |
401-730-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
006-073-00-5 |
3-(dimethylamino)propylurea |
401-950-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
006-074-00-0 |
2-(3-(prop-1-en-2-yl)phenyl)prop-2-yl isocyanate |
402-440-2 |
Acute Tox. 2 * Skin Corr. 1B STOT RE 2 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H314 H373 ** H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H314 H373 ** H334 H317 H410 |
|
|
|
|
|
006-076-00-1 |
mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt |
— |
Carc. 2 Repr. 1B STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360D H373 (thyroid, nervous system) H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D H373 (thyroid, nervous system) H317 H410 |
|
M = 10 M = 10 |
|
|
|
006-077-00-7 |
maneb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) |
235-654-8 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d*** H332 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d*** H332 H319 H317 H410 |
|
M=10 |
|
|
|
006-078-00-2 |
zineb (ISO); zinc ethylenebis(dithiocarbamate) (polymeric) |
235-180-1 |
STOT SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
|
|
|
|
|
006-079-00-8 |
disulfiram; tetraethylthiuramdisulfide |
202-607-8 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
|
006-080-00-3 |
tetramethylthiuram monosulphide |
202-605-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
006-081-00-9 |
zinc bis(dibutyldithiocarbamate) |
205-232-8 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
|
|
006-082-00-4 |
zinc bis(diethyldithiocarbamate) |
238-270-9 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H317 H410 |
|
|
|
|
|
006-083-00-X |
butocarboxim (ISO); 3-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime |
252-139-3 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H331 H311 H301 H319 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H226 H331 H311 H301 H319 H410 |
|
|
|
|
|
006-084-00-5 |
carbosulfan (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamate |
259-565-9 |
Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H317 H410 |
|
|
|
|
|
006-085-00-0 |
fenobucarb (ISO); 2-butylphenyl methylcarbamate |
223-188-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
006-086-00-6 |
fenoxycarb (ISO); ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate |
276-696-7 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 1 M = 10 000 |
|
|
|
006-087-00-1 |
furathiocarb (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4-diazadecanoate |
265-974-3 |
Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H373** H319 H315 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H301 H373** H319 H315 H317 H410 |
|
M = 100 |
|
|
|
006-088-00-7 |
benfuracarb (ISO); ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl-β-alaninate |
— |
Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H361f*** H331 H302 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361f*** H331 H302 H410 |
|
|
|
|
|
▼M1 ————— |
||||||||||
|
006-090-00-8 |
2-(3-iodoprop-2-yn-1-yloxy)ethyl phenylcarbamate |
408-010-0 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H332 H318 H412 |
GHS05 GHS07 Dgr |
H332 H318 H412 |
|
|
|
|
|
006-091-00-3 |
propineb (ISO); polymeric zinc propylenebis(dithiocarbamate) |
— |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 |
H332 H373** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H332 H373** H317 H400 |
|
|
|
|
|
006-092-00-9 |
tert-butyl (1S)-N-[1-((2S)-2-oxiranyl)-2-phenylethyl]carbamate |
425-420-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
006-093-00-4 |
2,2'-dithio di(ethylammonium)-bis(dibenzyldithiocarbamate) |
427-180-7 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
006-094-00-X |
O-isobutyl-N-ethoxy carbonylthiocarbamate |
434-350-4 |
Flam. Liq. 3 Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H226 H350 H340 H302 H373** H317 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H340 H302 H373** H317 H411 |
|
|
|
|
|
006-095-00-5 |
fosetyl-aluminium (ISO); aluminium triethyl triphosphonate |
254-320-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
006-096-00-0 |
chlorpropham (ISO); isopropyl 3-chlorocarbanilate |
202-925-7 |
Carc. 2 STOT RE 2 * Aquatic Chronic 2 |
H351 H373** H411 |
GHS08 GHS09 Wng |
H351 H373** H411 |
|
|
|
|
|
006-097-00-6 |
1-phenyl-3-(p-toluenesulfonyl)urea |
424-620-1 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373** H412 |
GHS08 GHS07 Wng |
H302 H373** H412 |
|
|
|
|
|
006-098-00-1 |
tert-butyl (1R,5S)-3-azabicyclo[3.1.0]hex-6-ylcarbamate |
429-170-8 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373** H318 H317 |
|
|
|
|
|
006-099-00-7 |
N-(p-toluenesulfonyl)-N'-(3-(p-toluenesulfonyloxy)phenyl)urea; 3-][(4-methylphenyl)sulfonyl]carbamoyl}amino)phenyl4-methylbenzenesulfonate |
520-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
006-101-00-6 |
reaction mass of: N, N''-(methylenedi-4,1-phenylene)bis[N'-phenylurea]; N-(4-[[4-[[(phenylamino)carbonyl]amino]phenylmethyl]phenyl]-N'-cyclohexylurea; N, N''-(methylenedi-4,1-phenylene)bis[N'-cyclohexylurea] |
423-070-8 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
006-102-00-1 |
O-hexyl-N-ethoxycarbonylthiocarbamate |
432-750-3 |
— |
Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H340 H302 H373** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H302 H373** H317 H411 |
|
|
|
|
006-103-00-7 |
N, N''-(methylenedi-4,1-phenylene)bis[N'-octyl]urea |
445-760-8 |
— |
Eye Dam. 1 Resp. Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H318 H334 H410 |
|
M=100 |
|
|
007-001-00-5 |
ammonia, anhydrous |
231-635-3 |
Flam. Gas 2 Press. Gas Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H221 H331 H314 H400 |
GHS04 GHS06 GHS05 GHS09 Dgr |
H221 H331 H314 H400 |
|
|
U |
|
|
007-001-01-2 |
ammonia ….% |
215-647-6 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
STOT SE 3; H335: C ≥ 5 % |
B |
|
|
007-002-00-0 |
nitrogen dioxide; [1] dinitrogen tetraoxide [2] |
233-272-6 [1] 234-126-4 [2] |
10102-44-0 [1] 10544-72-6 [2] |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1B |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
* STOT SE 3; H335: C ≥0,5 % |
5 |
|
007-003-00-6 |
chlormequat chloride (ISO); 2-chloroethyltrimethylammonium chloride |
213-666-4 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
007-004-00-1 |
nitric acid …% [C > 70 %] |
231-714-2 |
Ox. Liq. 2 Acute Tox. 1 Skin Corr. 1A |
H272 H330 H314 |
GHS03 GHS06 GHS05 Dgr |
H272 H330 H314 |
EUH071 |
Ox. Liq. 2; H272: C ≥ 99 % Ox. Liq. 3; H272: 70 % ≤ C < 99 % |
B |
|
|
007-006-00-2 |
ethyl nitrite |
203-722-6 |
Flam. Gas 1 Press. Gas Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H220 H332 H312 H302 |
GHS02 GHS04 GHS07 Dgr |
H220 H332 H312 H302 |
|
|
U |
|
|
007-007-00-8 |
ethyl nitrate |
210-903-3 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
|
007-008-00-3 |
hydrazine |
206-114-9 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H350 H331 H311 H301 H314 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H226 H350 H331 H311 H301 H314 H317 H410 |
|
Skin Corr. 1B; H314: C ≥ 10 % Skin Irrit. 2; H315: 3 % ≤ C < 10 % Eye Irrit. 2; H319: 3 % ≤ C < 10 % |
|
|
|
007-009-00-9 |
dicyclohexylammonium nitrite |
221-515-9 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
|
|
|
007-010-00-4 |
sodium nitrite |
231-555-9 |
Ox. Sol. 3 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
|
|
007-011-00-X |
potassium nitrite |
231-832-4 |
Ox. Sol. 2 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
|
|
007-012-00-5 |
N,N-dimethylhydrazine |
200-316-0 |
Flam. Liq. 2 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H225 H350 H331 H301 H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H331 H301 H314 H411 |
|
|
|
|
|
007-013-00-0 |
1,2-dimethylhydrazine |
— |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H411 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
|
007-014-00-6 |
salts of hydrazine |
— |
— |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H311 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H317 H410 |
|
|
A |
|
007-015-00-1 |
O-ethylhydroxylamine |
402-030-3 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
|
|
|
|
|
007-016-00-7 |
butyl nitrite |
208-862-1 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * |
H225 H331 H301 |
GHS02 GHS06 Dgr |
H225 H331 H301 |
|
|
|
|
|
007-017-00-2 |
isobutyl nitrite |
208-819-7 |
Flam. Liq. 2 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H341 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H341 H332 H302 |
|
|
|
|
|
007-018-00-8 |
sec-butyl nitrite |
213-104-8 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
|
007-019-00-3 |
tert-butyl nitrite |
208-757-0 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
|
007-020-00-9 |
pentyl nitrite; [1] ‘amyl nitrite’, mixed isomers [2] |
207-332-7 [1] 203-770-8 [2] |
463-04-7 [1] 110-46-3 [2] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
007-021-00-4 |
hydrazobenzene; 1,2-diphenylhydrazine |
204-563-5 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
|
007-022-00-X |
hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) |
405-030-1 |
— |
Carc. 1B Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H350 H302 H314 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H350 H302 H314 H317 H412 |
|
|
|
|
007-023-00-5 |
sodium 3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzenesulfonate |
405-510-0 |
— |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
007-024-00-0 |
2-(decylthio)ethylammonium chloride |
405-640-8 |
STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H315 H318 H410 |
|
|
|
|
|
007-025-00-6 |
(4-hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride |
406-090-1 |
Muta. 2 Acute Tox. 3 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H301 H372 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H301 H372 ** H317 H410 |
|
|
|
|
|
007-026-00-1 |
oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazide |
413-230-5 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
007-027-00-7 |
1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane |
420-190-2 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H314 H317 H410 |
|
|
|
|
|
007-028-00-2 |
hydroxylammonium nitrate |
236-691-2 |
Expl. 1.1 **** Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H201 H351 H311 H302 H373** H319 H315 H317 H400 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H351 H311 H302 H373** H319 H315 H317 H400 |
|
|
|
|
|
007-029-00-8 |
diethyldimethylammonium hydroxide |
419-400-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
|
007-030-00-3 |
nitric acid …% [C ≤ 70 %] |
231-714-2 |
Ox. Liq. 3 Acute Tox. 3 Skin Corr. 1A |
H272 H331 H314 |
GHS03 GHS06 GHS05 Dgr |
H272 H331 H314 |
EUH071 |
Ox. Liq. 3; H272: C ≥ 65 % inhalation: ATE = 2,65 mg/L (vapours) Skin Corr. 1A; H314: C ≥ 20 % Skin Corr. 1B; H314: 5 % ≤ C < 20 % |
B |
|
|
008-001-00-8 |
oxygen |
231-956-9 |
Ox. Gas 1 Press. Gas |
H270 |
GHS03 GHS04 Dgr |
H270 |
|
|
U |
|
|
008-003-00-9 |
hydrogen peroxide solution… % |
231-765-0 |
Ox. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H271 H332 H302 H314 |
GHS03 GHS05 GHS07 Dgr |
H271 H332 H302 H314 |
|
Ox. Liq. 1; H271: C ≥70 %**** Ox. Liq. 2; H272: 50 % ≤ C < 70 % **** * Skin Corr. 1A; H314: C ≥ 70 % Skin Corr. 1B; H314: 50 % ≤ C < 70 % Skin Irrit. 2; H315: 35 % ≤ C < 50 % Eye Dam. 1; H318: 8 % ≤ C < 50 % Eye Irrit. 2; H319: 5 % ≤ C< 8 % STOT SE 3; H335; C ≥ 35 % |
B |
|
|
009-001-00-0 |
fluorine |
231-954-8 |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1A |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
|
|
|
|
009-002-00-6 |
hydrogen fluoride |
231-634-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
|
|
|
|
009-003-00-1 |
hydrofluoric acid … % |
231-634-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
Skin Corr. 1A; H314: C ≥ 7 % Skin Corr. 1B; H314: 1 % ≤ C< 7 % Eye Irrit. 2; H319: 0,1 % ≤C < 1 % |
B |
|
|
009-004-00-7 |
sodium fluoride |
231-667-8 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H319 H315 |
GHS06 Dgr |
H301 H319 H315 |
EUH032 |
|
|
|
|
009-005-00-2 |
potassium fluoride |
232-151-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
009-006-00-8 |
ammonium fluoride |
235-185-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
009-007-00-3 |
sodium bifluoride; sodium hydrogen difluoride |
215-608-3 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
*Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
|
009-008-00-9 |
potassium bifluoride; potassium hydrogen difluoride |
232-156-2 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
|
009-009-00-4 |
ammonium bifluoride; ammonium hydrogen difluoride |
215-676-4 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit.2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
|
009-010-00-X |
fluoroboric acid … % |
240-898-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
|
009-011-00-5 |
fluorosilicic acid … % |
241-034-8 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
B |
|
|
009-012-00-0 |
alkali fluorosilicates(Na); [1] alkali fluorosilicates(K); [2] alkali fluorosilicates(NH4) [3] |
240-934-8 [1] 240-896-2 [2] 240-968-3 [3] |
16893-85-9 [1] 16871-90-2 [2] 16919-19-0 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
* |
A |
|
009-013-00-6 |
fluorosilicates, with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
* |
A |
|
009-014-00-1 |
lead hexafluorosilicate |
247-278-1 |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
|
009-015-00-7 |
sulphuryl difluoride |
220-281-5 |
Press. Gas Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H373 ** H400 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H331 H373 ** H400 |
|
|
U |
|
|
009-016-00-2 |
trisodium hexafluoroaluminate [1] trisodium hexafluoroaluminate(cryolite) [2] |
237-410-6 [1] 239-148-8 [2] |
13775-53-6 [1] 15096-52-3 [2] |
STOT RE 1 Acute Tox. 4 Aquatic Chronic 2 |
H372 H332 H411 |
GHS07 GHS08 GHS09 Dgr |
H372 H332 H411 |
|
|
|
|
009-017-00-8 |
potassium mu-fluoro-bis(triethylaluminium) |
400-040-2 |
Flam. Sol. 1 Water-react. 1 Skin Corr. 1A Acute Tox. 4 * |
H228 H270 H314 H332 |
GHS02 GHS05 GHS07 Dgr |
H228 H270 H314 H332 |
EUH014 |
|
T |
|
|
009-018-00-3 |
magnesium hexafluorosilicate |
241-022-2 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
* |
|
|
|
011-001-00-0 |
sodium |
231-132-9 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
|
011-002-00-6 |
sodium hydroxide; caustic soda |
215-185-5 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit.2; H319: 0,5 % ≤ C < 2 % |
|
|
|
011-003-00-1 |
sodium peroxide |
215-209-4 |
Ox. Sol. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
|
|
|
|
011-004-00-7 |
sodium azide |
247-852-1 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H400 H410 |
EUH032 |
|
|
|
|
011-005-00-2 |
sodium carbonate |
207-838-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
011-006-00-8 |
sodium cyanate |
213-030-6 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
011-007-00-3 |
propoxycarbazone-sodium |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 10 |
|
|
|
012-001-00-3 |
magnesium powder (pyrophoric) |
231-104-6 |
Water-react. 1 Pyr. Sol. 1 |
H260 H250 |
GHS02 Dgr |
H260 H250 |
|
|
T |
|
|
012-002-00-9 |
magnesium, powder or turnings |
231-104-6 |
— |
Flam. Sol. 1 Water-react. 2 Self-heat. 1 |
H228 H261 H252 |
GHS02 Dgr |
H228 H261 H252 |
|
|
T |
|
012-003-00-4 |
magnesium alkyls |
— |
— |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
|
A |
|
012-004-00-X |
aluminium-magnesium-carbonate-hydroxide-perchlorate-hydrate |
422-150-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
013-001-00-6 |
aluminium powder (pyrophoric) |
231-072-3 |
Water-react. 2 Pyr. Sol. 1 |
H261 H250 |
GHS02 Dgr |
H261 H250 |
|
|
T |
|
|
013-002-00-1 |
aluminium powder (stabilised) |
231-072-3 |
Water-react. 2 Flam. Sol. 1 |
H261 H228 |
GHS02 Dgr |
H261 H228 |
|
|
T |
|
|
013-003-00-7 |
aluminium chloride, anhydrous |
231-208-1 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
013-004-00-2 |
aluminium alkyls |
— |
— |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014 |
|
A |
|
013-005-00-8 |
diethyl(ethyldimethylsilanolato) aluminium |
401-160-8 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014 |
|
|
|
|
013-006-00-3 |
(ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxypropan-2-olato)aluminium(III), dimerised |
402-370-2 |
— |
Flam. Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
|
|
|
|
013-007-00-9 |
poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) |
403-430-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
013-008-00-4 |
di-n-octylaluminium iodide |
408-190-0 |
Pyr. Liq. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H314 H410 |
EUH014 |
|
|
|
|
013-009-00-X |
sodium (n-butyl)x(ethyl)y-1,5-dihydro)aluminate x = 0,5 y =1,5 |
418-720-2 |
— |
Flam. Sol. 1 Water-react. 1 Pyr. Sol. 1 Acute Tox. 4 * Skin Corr. 1A |
H228 H260 H250 H332 H314 |
GHS02 GHS05 GHS07 Dgr |
H228 H260 H250 H332 H314 |
EUH014 |
|
T |
|
013-010-00-5 |
hydroxy aluminium bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d, g][1.3.2]dioxaphosphocin-6-oxide) |
430-650-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
014-001-00-9 |
trichlorosilane |
233-042-5 |
Flam. Liq. 1 Water-react. 1 Acute Tox. 3 Acute Tox. 4 Skin Corr. 1A Eye Dam. 1 |
H224 H260 H331 H302 H314 H318 |
GHS02 GHS06 GHS05 Dgr |
H224 H260 H331 H302 H314 |
EUH014 EUH029 EUH071 |
inhalation: ATE = 7,6 mg/L (vapour) oral: ATE = 1 000 mg/kg bw |
|
|
|
014-002-00-4 |
silicon tetrachloride |
233-054-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
EUH014 |
|
|
|
|
014-003-00-X |
dimethyldichlorosilane |
200-901-0 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
|
|
|
|
|
014-004-00-5 |
trichloro(methyl)silane; methyltrichlorosilane |
200-902-6 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
EUH014 |
Skin Irrit.2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
|
014-005-00-0 |
tetraethyl silicate; ethyl silicate |
201-083-8 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H226 H332 H319 H335 |
GHS02 GHS07 Wng |
H226 H332 H319 H335 |
|
|
|
|
|
014-006-00-6 |
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silane hydrochloride |
401-380-4 |
— |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
014-007-00-1 |
triethoxyisobutylsilane |
402-810-3 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
|
014-008-00-7 |
(chloromethyl)bis(4-fluorophenyl)methylsilane |
401-200-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
014-009-00-2 |
isobutylisopropyldimethoxysilane |
402-580-4 |
Flam. Liq. 3 Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H315 |
GHS02 GHS07 Wng |
H226 H332 H315 |
|
|
|
|
|
014-010-00-8 |
disodium metasilicate |
229-912-9 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
|
|
014-011-00-3 |
cyclohexyldimethoxymethylsilane |
402-140-1 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
014-012-00-9 |
bis(3-(trimethoxysilyl)propyl)amine |
403-480-3 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
014-013-00-4 |
α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxane) |
404-920-7 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H312 H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H411 |
|
|
|
|
014-014-00-X |
etacelasil (ISO); 6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
253-704-7 |
Repr. 1B Acute Tox. 4 * STOT RE 2 * |
H360D *** H302 H373 ** |
GHS08 GHS07 Dgr |
H360D *** H302 H373 ** |
|
|
|
|
|
014-015-00-5 |
α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilanediyl]-co-oxy(dimethylsilane)) |
406-420-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
014-016-00-0 |
reaction mass of: 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxane; 1,3-dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxane |
406-490-6 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-017-00-6 |
flusilazole (ISO); bis(4-fluorophenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silane |
— |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
|
|
014-018-00-1 |
octamethylcyclotetrasiloxane; [D4] |
209-136-7 |
Repr. 2 Aquatic Chronic 1 |
H361f *** H410 |
GHS08 GHS09 Wng |
H361f *** H410 |
|
M = 10 |
|
|
|
014-019-00-7 |
reaction mass of: 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole; 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole |
403-250-2 |
— |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
|
014-020-00-2 |
bis(1,1-dimethyl-2-propynyloxy)dimethylsilane |
414-960-7 |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
|
|
014-021-00-8 |
tris(isopropenyloxy)phenyl silane |
411-340-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H400 H410 |
|
|
|
|
|
014-022-00-3 |
reaction product of: (2-hydroxy-4-(3-propenoxy)benzophenone and triethoxysilane) with (hydrolysis product of silica and methyltrimethoxysilane) |
401-530-9 |
— |
Flam. Sol. 1 STOT SE 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H228 H370 ** H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H228 H370 ** H332 H312 H302 |
|
|
T |
|
014-023-00-9 |
α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxane)hoxysilane with (hydrolysis product of silica and methyltrimethoxysilane)iazole |
408-160-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
014-024-00-4 |
1-((3-(3-chloro-4-fluorophenyl)propyl)dimethylsilanyl)-4-ethoxybenzene |
412-620-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
014-025-00-X |
4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidine |
411-400-3 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H315 H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 H412 |
|
|
|
|
|
014-026-00-5 |
dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane |
407-180-3 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
014-027-00-0 |
chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane |
410-270-5 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
014-028-00-6 |
α-[3-(1-oxoprop-2-enyl)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) |
415-290-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
014-029-00-1 |
O, O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] |
421-870-1 |
Repr. 2 Acute Tox. 4 * STOT RE 2 * |
H361f *** H302 H373 ** |
GHS08 GHS07 Wng |
H361f *** H302 H373 ** |
|
|
|
|
|
014-030-00-7 |
[(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium |
422-060-0 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
|
014-031-00-2 |
bis(1-methylethyl)-dimethoxysilane |
421-540-7 |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H226 H315 H317 H412 |
GHS02 GHS07 Wng |
H226 H315 H317 H412 |
|
|
|
|
|
014-032-00-8 |
dicyclopentyldimethoxysilane |
404-370-8 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
|
014-033-00-3 |
2-methyl-3-(trimethoxysilyl)propyl-2-propenoate hydrolysis product with silica |
419-030-4 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
|
|
|
|
|
014-034-00-9 |
3-hexylheptamethyltrisiloxane |
428-700-5 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
|
014-035-00-4 |
2-(3,4-epoxycyclohexyl)ethyltriethoxy silane |
425-050-4 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
014-036-00-X |
(4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane |
405-020-7 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360F*** H400 H410 |
GHS08 GHS09 Dgr |
H360F*** H410 |
|
M=1000 |
|
|
|
014-037-00-5 |
2-butanone-O, O',O''-(phenylsilylidyne)trioxime |
433-360-6 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373** H317 H412 |
GHS08 GHS07 Wng |
H373** H317 H412 |
|
|
|
|
|
014-038-00-0 |
S-(3-(triethoxysilyl)propyl)octanethioate |
436-690-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
014-039-00-6 |
(2,3-dimethylbut-2-yl)-trimethoxysilane |
439-360-2 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
|
014-041-00-7 |
N, N-bis(trimethylsilyl)aminopropylmethyldiethoxysilane |
445-890-5 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
|
014-042-00-2 |
reaction mass of: O,O',O'',O'''-silanetetrayl tetrakis(4-methyl-2-pentanone oxime) (3 stereoisomers) |
423-010-0 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
014-043-00-8 |
reaction product of amorphous silica (50-85 %), butyl (1-methylpropyl) magnesium (3-15 %), tetraethyl orthosilicate (5-15 %) and titanium tetrachloride (5-20 %) |
432-200-2 |
— |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H335 H315 H318 H412 |
GHS05 GHS07 Dgr |
H335 H315 H318 H412 |
|
|
|
|
014-044-00-3 |
3-[(4'-acetoxy-3'-methoxyphenyl) propyl]trimethoxysilane |
433-050-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-045-00-9 |
magnesium sodium fluoride silicate |
442-650-1 |
— |
STOT RE 2 * |
H373** |
GHS08 Wng |
H373** |
|
|
|
|
014-046-00-4 |
e-glass microfibres of representative composition; [Calcium-aluminium-silicate fibres with random orientation with the following representative composition (% given by weight): SiO2 50,0-56,0 %, Al2O3 13,0-16,0 %, B2O3 5,8-10,0 %, Na2O < 0,6 %, K2O < 0,4 %, CaO 15,0-24,0 %, MgO < 5,5 %, Fe2O3 < 0,5 %, F2 < 1,0 %. Process: typically produced by flame attenuation and rotary process. (Additionalindividual elements may be present at low levels; the process list does not preclude innovation).] |
— |
— |
Carc. 1B |
H350i |
GHS08 Dgr |
H350i |
|
|
A |
|
014-047-00-X |
glass microfibres of representative composition; [Calcium-aluminium-silicate fibres with random orientation with the following composition (% given by weight): SiO2 55,0-60,0 %, Al2O3 4,0-7,0 %, B2O3 8,0-11,0 %, ZrO2 0,0-4,0 %, Na2O 9,5-13,5 %, K2O 0,0-4,0 %, CaO 1,0-5,0 %, MgO 0,0-2,0 %, Fe2O3 < 0,2 %, ZnO 2,0-5,0 %, BaO 3,0-6,0 %, F2 < 1,0 %. Process: typically produced by flame attenuation and rotary process. (Additional individual elements may be present at low levels; the process list does not preclude innovation).] |
— |
— |
Carc. 2 |
H351 (inhalation) |
GHS08 Wng |
H351 (inhalation) |
|
|
A |
|
014-048-00-5 |
silicon carbide fibres (with diameter < 3 μm, length > 5 μm and aspect ratio ≥ 3:1) |
206-991-8 |
Carc. 1B |
H350i |
GHS08 Dgr |
H350i |
|
|
|
|
|
014-049-00-0 |
trimethoxyvinylsilane; trimethoxy(vinyl)silane |
220-449-8 |
Skin Sens. 1B |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
014-050-00-6 |
tris(2-methoxyethoxy)vinylsilane; 6-(2-methoxyethoxy)-6-vinyl-2,5,7,10-tetraoxa-6-silaundecane |
213-934-0 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
014-052-00-7 |
silanamine, 1,1,1-trimethyl-N-(trimethylsilyl)-, hydrolysis products with silica; pyrogenic, synthetic amorphous, nano, surface treated silicon dioxide |
272-697-1 |
STOT RE 2 |
H373 (lungs) (inhalation) |
GHS08 Wng |
H373 (lungs) (inhalation) |
EUH066 |
|
|
|
|
015-001-00-1 |
white phosphorus |
231-768-7 |
Pyr. Sol. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H250 H330 H300 H314 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H250 H330 H300 H314 H400 |
|
|
|
|
|
015-002-00-7 |
red phosphorus |
231-768-7 |
Flam. Sol. 1 Aquatic Chronic 3 |
H228 H412 |
GHS02 Dgr |
H228 H412 |
|
|
|
|
|
015-003-00-2 |
calcium phosphide; tricalcium diphosphide |
215-142-0 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Eye Dam. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H318 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H260 H300 H311 H330 H318 H400 |
EUH029 EUH032 |
M = 100 |
|
|
|
015-004-00-8 |
aluminium phosphide |
244-088-0 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M = 100 |
|
|
|
015-005-00-3 |
magnesium phosphide; trimagnesium diphosphide |
235-023-7 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M = 100 |
|
|
|
015-006-00-9 |
trizinc diphosphide; zinc phosphide |
215-244-5 |
Water-react. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H260 H300 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H410 |
EUH029 EUH032 |
M=100 |
T |
|
|
015-007-00-4 |
phosphorus trichloride |
231-749-3 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Skin Corr. 1A |
H330 H300 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H300 H373 ** H314 |
EUH014 EUH029 |
|
|
|
|
015-008-00-X |
phosphorus pentachloride |
233-060-3 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B |
H330 H302 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H302 H373 ** H314 |
EUH014 EUH029 |
|
|
|
|
015-009-00-5 |
phosphoryl trichloride |
233-046-7 |
Acute Tox. 2 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1A |
H330 H372 ** H302 H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H372 ** H302 H314 |
EUH014 EUH029 |
|
|
|
|
015-010-00-0 |
phosphorus pentoxide |
215-236-1 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
015-011-00-6 |
phosphoric acid . %, orthophosphoric acid . % |
231-633-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
|
015-012-00-1 |
tetraphosphorus trisulphide; phosphorus sesquisulphid |
215-245-0 |
Flam. Sol. 2 Water-react. 1 Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H302 H400 |
|
|
T |
|
|
015-013-00-7 |
triethyl phosphate |
201-114-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
015-014-00-2 |
tributyl phosphate |
204-800-2 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 |
H351 H302 H315 |
GHS08 GHS07 Wng |
H351 H302 H315 |
|
|
|
|
|
015-015-00-8 |
tricresyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); tritolyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); |
201-103-5 |
STOT SE 1 Aquatic Chronic 2 |
H370 ** H411 |
GHS08 GHS09 Dgr |
H370 ** H411 |
|
STOT SE 1; H370: C ≥ 1 % STOT SE 2; H371: 0,2 % ≤ C < 1 % |
C |
|
|
015-016-00-3 |
tricresyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-); tritolyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-); |
201-105-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H312 H302 H411 |
GHS07 GHS09 Wng |
H312 H302 H411 |
|
* |
C |
|
|
015-019-00-X |
dichlorvos (ISO); 2,2-dichlorovinyl dimethyl phosphate |
200-547-7 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 |
H330 H311 H301 H317 H400 |
GHS06 GHS09 Dgr |
H330 H311 H301 H317 H400 |
|
M=1000 |
|
|
|
015-020-00-5 |
mevinphos (ISO); 2-methoxycarbonyl-1-methylvinyl dimethyl phosphate |
232-095-1 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10000 |
|
|
|
015-021-00-0 |
trichlorfon (ISO); dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate |
200-149-3 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H400 H410 |
|
M = 1000 |
|
|
|
015-022-00-6 |
phosphamidon (ISO); 2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate |
236-116-5 |
Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H300 H311 H410 |
|
|
|
|
|
015-023-00-1 |
pyrazoxon; diethyl 3-methylpyrazol-5-yl phosphate |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
|
015-024-00-7 |
triamiphos (ISO); 5-amino-3-phenyl-1,2,4-triazol-1-yl-N, N,N',N'-tetramethylphosphonic diamide |
— |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-025-00-2 |
TEPP (ISO); tetraethyl pyrophosphate |
203-495-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
|
015-026-00-8 |
schradan (ISO); octamethylpyrophosphoramide |
205-801-0 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-027-00-3 |
sulfotep (ISO); O, O,O, O-tetraethyl dithiopyrophosphate |
222-995-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
|
015-028-00-9 |
demeton-O (ISO); O,O-diethyl-O-2-ethylthioethyl phosphorothioate |
206-053-8 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
|
015-029-00-4 |
demeton-S (ISO); diethyl-S-2-ethylthioethyl phosphorothioate |
204-801-8 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-030-00-X |
demeton-O-methyl (ISO); O-2-ethylthioethyl O,O-dimethyl phosphorothioate |
212-758-1 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
|
015-031-00-5 |
demeton-S-methyl (ISO); S-2-ethylthioethyl dimethyl phosphorothioate |
213-052-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H311 H301 H411 |
GHS06 GHS09 Dgr |
H311 H301 H411 |
|
|
|
|
|
015-032-00-0 |
prothoate (ISO); O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate |
218-893-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 3 |
H310 H300 H412 |
GHS06 Dgr |
H310 H300 H412 |
|
|
|
|
|
015-033-00-6 |
phorate (ISO); O,O-diethyl ethylthiomethyl phosphorodithioate |
206-052-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
|
015-034-00-1 |
parathion (ISO); O,O-diethyl O-4-nitrophenyl phosphorothioate |
200-271-7 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H311 H372 ** H410 |
|
M = 100 |
|
|
|
015-035-00-7 |
parathion — methyl (ISO); O,O-dimethyl O-4-nitrophenyl phosphorothioate |
206-050-1 |
Flam. Liq. 3 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H330 H300 H311 H373 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H330 H300 H311 H373 ** H410 |
|
M = 100 |
|
|
|
015-036-00-2 |
O-ethyl O-4-nitrophenyl phenylphosphonothioate; EPN |
218-276-8 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-037-00-8 |
phenkapton (ISO); S-(2,5-dichlorophenylthiomethyl) O, O-diethyl phosphorodithioate |
218-892-7 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
|
015-038-00-3 |
coumaphos (ISO); O-3-chloro-4-methylcoumarin-7-yl O,O-diethyl phosphorothioate |
200-285-3 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
|
015-039-00-9 |
azinphos-methyl (ISO); O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
201-676-1 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H317 H410 |
|
|
|
|
|
015-040-00-4 |
diazinon (ISO); O,O-diethyl O-2-isopropyl-6-methylpyrimidin-4-yl phosphorothioate |
206-373-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
|
015-041-00-X |
malathion (ISO); 1,2-bis(ethoxycarbonyl)ethyl O, O-dimethyl phosphorodithioate; [containing ≤ 0,03 % isomalathion] |
204-497-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M=1000 |
|
|
|
015-042-00-5 |
chlorthion O-(3-chloro-4-nitrophenyl) O, O-dimethyl phosphorothioate |
207-902-5 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 100 |
|
|
|
015-043-00-0 |
phosnichlor (ISO); O-4-chloro-3-nitrophenyl O, O-dimethyl phosphorothioate |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
|
|
015-044-00-6 |
carbophenothion (ISO); 4-chlorophenylthiomethyl O, O-diethyl phosphorodithioate |
212-324-1 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
|
015-045-00-1 |
mecarbam (ISO); N-ethoxycarbonyl-N-methylcarbamoylmethyl O, O-diethyl phosphorodithioate |
219-993-9 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H400 H410 |
|
|
|
|
|
015-046-00-7 |
oxydemeton-methyl; S-2-(ethylsulphinyl)ethyl O,O-dimethyl phosphorothioate |
206-110-7 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H311 H301 H400 |
GHS06 GHS09 Dgr |
H311 H301 H400 |
|
|
|
|
|
015-047-00-2 |
ethion (ISO); O, O,O',O'-tetraethyl S, S'-methylenedi (phosphorodithioate); diethion |
209-242-3 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 10000 |
|
|
|
015-048-00-8 |
fenthion (ISO); O, O-dimethyl-O-(4-methylthion-m-tolyl) phosphorothioate |
200-231-9 |
Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H312 H302 H372** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H312 H302 H372** H410 |
|
M=100 |
|
|
|
015-049-00-3 |
endothion (ISO); S-5-methoxy-4-oxopyran-2-ylmethyl dimethyl phosphorothioate |
220-472-3 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
|
015-050-00-9 |
thiometon (ISO); S-2-ethylthioethyl O,O-dimethyl phosphorodithioate |
211-362-6 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
|
|
015-051-00-4 |
dimethoate (ISO); O, O-dimethyl methylcarbamoylmethyl phosphorodithioate |
200-480-3 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
015-052-00-X |
fenchlorphos (ISO); O, O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate |
206-082-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
015-053-00-5 |
menazon (ISO); S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O, O-dimethyl phosphorodithioate |
201-123-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
015-054-00-0 |
fenitrothion (ISO); O, O-dimethyl O-4-nitro-m-tolyl phosphorothioate |
204-524-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
015-055-00-6 |
naled (ISO); 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
206-098-3 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 |
H312 H302 H319 H315 H400 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H400 |
|
M = 1000 |
|
|
|
015-056-00-1 |
azinphos-ethyl (ISO); O,O-diethyl 4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
220-147-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M=100 |
|
|
|
015-057-00-7 |
formothion (ISO); N-formyl-N-methylcarbamoylmethyl O, O-dimethyl phosphorodithioate |
219-818-6 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
015-058-00-2 |
morphothion (ISO); O, O-dimethyl-S-(morpholinocarbonylmethyl) phosphorodithioate |
205-628-0 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
|
015-059-00-8 |
vamidothion (ISO); O,O-dimethyl S-2-(1-methylcarbamoylethylthio) ethyl phosphorothioate |
218-894-8 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
|
|
015-060-00-3 |
disulfoton (ISO); O,O-diethyl 2-ethylthioethyl phosphorodithioate |
206-054-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-061-00-9 |
dimefox (ISO); tetramethylphosphorodiamidic fluoride |
204-076-8 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-062-00-4 |
mipafox (ISO); N,N'-di-isopropylphosphorodiamidic fluoride |
206-742-3 |
STOT SE 1 |
H370 ** |
GHS08 Dgr |
H370 ** |
|
|
|
|
|
015-063-00-X |
dioxathion (ISO); 1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) |
201-107-7 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
M = 1000 |
|
|
|
015-064-00-5 |
bromophos-ethyl (ISO); O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate |
225-399-0 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
|
015-065-00-0 |
S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H330 H310 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
|
|
|
|
|
015-066-00-6 |
omethoate (ISO); O, O-dimethyl S-methylcarbamoylmethyl phosphorothioate |
214-197-8 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
|
|
015-067-00-1 |
phosalone (ISO); S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl) O, O-diethyl phosphorodithioate |
218-996-2 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H410 |
|
M=1000 |
|
|
|
015-068-00-7 |
dichlofenthion (ISO); O—2,4-dichlorophenyl O,O-diethyl phosphorothioate |
202-564-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
|
015-069-00-2 |
methidathion (ISO); 2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethylphosphorodithioate |
213-449-4 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
|
015-070-00-8 |
cyanthoate (ISO); S-(N-(1-cyano-1-methylethyl)carbamoylmethyl) O,O-diethyl phosphorothioate |
223-099-4 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
|
015-071-00-3 |
chlorfenvinphos (ISO); 2-chloro-1-(2,4 dichlorophenyl)vinyl diethyl phosphate |
207-432-0 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
|
015-072-00-9 |
monocrotophos (ISO); dimethyl-1-methyl-2-(methylcarbamoyl)vinyl phosphate |
230-042-7 |
Muta. 2 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H330 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H330 H300 H311 H410 |
|
|
|
|
|
015-073-00-4 |
dicrotophos (ISO); (Z)-2-dimethylcarbamoyl-1-methylvinyl dimethyl phosphate |
205-494-3 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
|
015-074-00-X |
crufomate (ISO); 4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate |
206-083-1 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
015-075-00-5 |
S-[2-(isopropylsulphinyl)ethyl] O,O-dimethyl phosphorothioate |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
015-076-00-0 |
potasan; O, O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
M = 1000 |
|
|
|
015-077-00-6 |
2,2-dichlorovinyl 2-ethylsulphinylethyl methyl phosphate |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
|
015-078-00-1 |
demeton-S-methylsulphon(ISO); S-2-ethylsulphonylethyl dimethyl phosphorothioate |
241-109-5 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H301 H312 H411 |
GHS06 GHS09 Dgr |
H301 H312 H411 |
|
|
|
|
|
015-079-00-7 |
acephate (ISO); O, S-dimethyl acetylphosphoramidothioate |
250-241-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
015-080-00-2 |
amidithion (ISO); 2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
015-081-00-8 |
O,O,O',O'-tetrapropyl dithiopyrophosphate |
221-817-0 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
015-082-00-3 |
azothoate (ISO); O-4-(4-chlorophenylazo)phenyl O,O-dimethyl phosphorothioate |
227-419-3 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
|
015-083-00-9 |
bensulide (ISO); O, O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate |
212-010-4 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
015-084-00-4 |
chlorpyrifos (ISO); O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
220-864-4 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H400 H410 |
|
M = 10000 |
|
|
|
015-085-00-X |
chlorphonium chloride (ISO); tributyl (2,4-dichlorobenzyl) phosphonium chloride |
204-105-4 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H312 H319 H315 |
GHS06 Dgr |
H301 H312 H319 H315 |
|
|
|
|
|
015-086-00-5 |
coumithoate (ISO); O,O-diethyl O-7,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-yl phosphorothioate |
— |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
|
015-087-00-0 |
cyanophos (ISO); O-4-cyanophenyl O,O-dimethyl phosphorothioate |
220-130-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
015-088-00-6 |
dialifos (ISO); 2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate |
233-689-3 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H400 H410 |
|
|
|
|
|
015-089-00-1 |
ethoate-methyl (ISO); ethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
204-121-1 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
015-090-00-7 |
fensulfothion (ISO); O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate |
204-114-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-091-00-2 |
fonofos (ISO); O-ethyl phenyl ethylphosphonodithioate |
213-408-0 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-092-00-8 |
phosacetim (ISO); O,O-bis(4-chlorophenyl) N-acetimidoylphosphoramidothioate |
223-874-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
|
015-093-00-3 |
leptophos (ISO); O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphorothioate |
244-472-8 |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H370 ** H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H410 |
|
|
|
|
|
015-094-00-9 |
mephosfolan (ISO); diethyl 4-methyl-1,3-dithiolan-2-ylidenephosphoramidate |
213-447-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H310 H300 H411 |
GHS06 GHS09 Dgr |
H310 H300 H411 |
|
|
|
|
|
015-095-00-4 |
methamidophos (ISO); O,S-dimethyl phosphoramidothioate |
233-606-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 |
H330 H300 H311 H400 |
GHS06 GHS09 Dgr |
H330 H300 H311 H400 |
|
|
|
|
|
015-096-00-X |
oxydisulfoton (ISO); O, O-diethyl S-2-ethylsulphinylethyl phosphorodithioate |
219-679-1 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 10 |
|
|
|
015-097-00-5 |
phenthoate (ISO); ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate |
219-997-0 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
M = 100 |
|
|
|
015-098-00-0 |
trichloronate (ISO); O-ethyl O-2,4,5-trichlorophenyl ethylphosphonothioate |
206-326-1 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
|
015-099-00-6 |
pirimiphos-ethyl (ISO); O, O-diethyl O-2-diethylamino-6-methylpyrimidin-4-yl phosphorothioate |
245-704-0 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
|
015-100-00-X |
phoxim (ISO); α-(diethoxyphosphinothioylimino) phenylacetonitrile |
238-887-3 |
Repr. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f*** H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f*** H302 H317 H410 |
|
M=1000 |
|
|
|
015-101-00-5 |
phosmet (ISO); S-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)methyl] O,O-dimethyl phosphorodithioate; O,O-dimethyl-S-phthalimidomethyl phosphorodithioate |
211-987-4 |
Repr. 2 Acute Tox. 4 Acute Tox. 3 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f H332 H301 H370 (nervous system) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H361f H332 H301 H370 (nervous system) H410 |
|
M = 100 M = 100 |
|
|
|
015-102-00-0 |
tris(2-chloroethyl)phosphate |
204-118-5 |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360F*** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F*** H302 H411 |
|
|
|
|
|
015-103-00-6 |
phosphorus tribromide |
232-178-2 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
|
015-104-00-1 |
diphosphorus pentasulphide; phosphorus pentasulphide |
215-242-4 |
Flam. Sol. 1 Water-react. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H332 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H332 H302 H400 |
EUH029 |
|
T |
|
|
015-105-00-7 |
triphenyl phosphite |
202-908-4 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
Skin Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % |
|
|
|
015-106-00-2 |
hexamethylphosphoric triamide; hexamethylphosphoramide |
211-653-8 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
|
015-107-00-8 |
ethoprophos (ISO); ethyl-S,S-dipropyl phosphorodithioate |
236-152-1 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H301 H317 H410 |
|
|
|
|
|
015-108-00-3 |
bromophos (ISO); O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate |
218-277-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 100 |
|
|
|
015-109-00-9 |
crotoxyphos (ISO); 1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate |
231-720-5 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 10 |
|
|
|
015-110-00-4 |
cyanofenphos (ISO); O-4-cyanophenyl O-ethyl phenylphosphonothioate |
— |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H301 H370 ** H312 H319 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H319 H411 |
|
|
|
|
|
015-111-00-X |
phosfolan (ISO); diethyl 1,3-dithiolan-2-ylidenephosphoramidate |
213-423-2 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-112-00-5 |
thionazin (ISO); O,O-diethyl O-pyrazin-2-yl phosphorothioate; |
206-049-6 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-113-00-0 |
tolclofos-methyl (ISO); O-(2,6-dichloro-p-tolyl) O,O-dimethyl thiophosphate |
260-515-3 |
Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 1 M = 1 |
|
|
|
015-114-00-6 |
chlormephos (ISO); S-chloromethyl O,O-diethyl phosphorodithioate |
246-538-1 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10 |
|
|
|
015-115-00-1 |
chlorthiophos (ISO); [isomeric reaction mass in which O-2,5-dichlorophenyl-4-methylthiophenyl O, O-diethyl phosphorothioate predominates] |
244-663-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 1000 |
|
|
|
015-116-00-7 |
demephion-O (ISO); O, O-dimethyl O-2-methylthioethyl phosphorothioate |
211-666-9 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
|
015-117-00-2 |
demephion-S (ISO); O, O-dimethyl S-2-methylthioethyl phosphorothioate |
219-971-9 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
|
015-118-00-8 |
demeton |
— |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
|
015-119-00-3 |
dimethyl 4-(methylthio)phenyl phosphate |
— |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-120-00-9 |
ditalimfos (ISO); O, O-diethyl phthalimidophosphonothioate |
225-875-8 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
|
015-121-00-4 |
edifenphos (ISO); O-ethyl S, S-diphenyl phosphorodithioate |
241-178-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
|
|
|
|
|
015-122-00-X |
etrimfos (ISO); O-6-ethoxy-2-ethylpyrimidin-4-yl O, O-dimethylphosphorothioate |
253-855-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
|
015-123-00-5 |
fenamiphos (ISO); ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate |
244-848-1 |
Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H300 H310 H330 H319 H400 H410 |
GHS06 GHS09 Dgr |
H300 H310 H330 H319 H410 |
|
M = 100 M = 100 |
|
|
|
015-124-00-0 |
fosthietan (ISO); diethyl 1,3-dithietan-2-ylidenephosphoramidate |
244-437-7 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
015-125-00-6 |
glyphosine (ISO); N,N-bis(phosphonomethyl)glycine |
219-468-4 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
015-126-00-1 |
heptenophos (ISO); 7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate |
245-737-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
|
|
015-127-00-7 |
iprobenfos(ISO); S-benzyl diisopropyl phosphorothioate |
247-449-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
015-128-00-2 |
IPSP; S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate |
— |
Acute Tox. 1 Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H301 H400 H410 |
GHS06 GHS09 Dgr |
H310 H301 H410 |
|
M = 100 |
|
|
|
015-129-00-8 |
isofenphos (ISO); O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate |
246-814-1 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 100 |
|
|
|
015-130-00-3 |
isothioate (ISO); S-2-isopropylthioethyl O,O-dimethyl phosphorodithioate; |
— |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
|
015-131-00-9 |
isoxathion (ISO); O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate |
242-624-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
|
015-132-00-4 |
S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate; methylcarbophenothione |
— |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 1000 |
|
|
|
015-133-00-X |
piperophos (ISO); S-2-methylpiperidinocarbonylmethyl-O, O-dipropyl phosphorodithioate |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
|
015-134-00-5 |
pirimiphos-methyl (ISO); O-[2-(diethylamino)-6-methylpyrimidin-4-yl] O,O-dimethyl phosphorothioate |
249-528-5 |
Acute Tox. 4 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H372 (nervous system) H400 H410 |
GHS07 GHS08 GHS09 Dgr |
H302 H372 (nervous system) H410 |
|
oral: ATE = 1414 mg/kg bw M = 1000 M = 1000 |
|
|
|
015-135-00-0 |
profenofos (ISO)O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate; |
255-255-2 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 1000 |
|
|
|
015-136-00-6 |
trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate; isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate; propetamphos (ISO) |
250-517-2 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
|
|
015-137-00-1 |
pyrazophos (ISO); O, O-diethyl O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl) phosphorothioate |
236-656-1 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
|
|
|
015-138-00-7 |
quinalphos (ISO); O, O-diethyl-O-quinoxalin-2-yl phosphorothioate |
237-031-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 1000 |
|
|
|
015-139-00-2 |
terbufos (ISO); S-tert-butylthiomethyl O, O-diethylphosphorodithioate; |
235-963-8 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
|
015-140-00-8 |
triazophos (ISO); O, O-diethyl-O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate |
245-986-5 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H410 |
|
M=100 |
|
|
|
015-141-00-3 |
ethylenediammonium O, O-bis(octyl) phosphorodithioate, mixed isomers |
400-520-1 |
— |
Skin Corr. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H314 H302 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H410 |
|
|
|
|
015-142-00-9 |
butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium (trialkyloxy)titanium phosphate |
401-100-0 |
— |
Flam. Liq. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H225 H319 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H319 H411 |
|
|
T |
|
015-143-00-4 |
reaction mass of 2-chloroethyl chloropropyl 2-chloroethylphosphonate, reaction mass of isomers and 2-chloroethyl chloropropyl 2-chloropropylphosphonate, reaction mass of isomers |
401-740-0 |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-144-00-X |
reaction mass of pentyl methylphosphinate and 2-methylbutyl methylphosphinate |
402-090-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
015-145-00-5 |
reaction mass of copper(I) O, O-diisopropyl phosphorodithioate and copper(I) O-isopropyl O-(4-methylpent-2-yl) phosphorodithioate and copper(I) O, O-bis(4-methylpent-2-yl) phosphorodithioate |
401-520-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-146-00-0 |
S-(tricyclo(5.2.1.0 2,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate |
401-850-9 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-147-00-6 |
reaction mass of C12-14-tert-alkylammonium diphenyl phosphorothioate and dinonyl sulphide (or disulphide) |
400-930-0 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
015-148-00-1 |
2-(diphosphonomethyl)succinic acid |
403-070-4 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
|
015-149-00-7 |
reaction mass of: hexyldioctylphosphineoxide; dihexyloctylphosphineoxide; trioctylphosphineoxide |
403-470-9 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
015-150-00-2 |
(2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphonium bromide |
404-940-6 |
Acute Tox. 4 * Eye Dam. 1 STOT RE 2 * Aquatic Chronic 3 |
H302 H318 H373 ** H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H318 H373 ** H412 |
|
|
|
|
|
015-151-00-8 |
tris(isopropyl/tert-butylphenyl)phosphate |
405-010-2 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
015-152-00-3 |
dioxabenzofos (ISO); 2-methoxy-4H-1,3,2-benzodioxaphosphorin 2-sulphide |
223-292-3 |
Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 Aquatic Chronic 2 |
H311 H301 H370 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H311 H301 H370 ** H411 |
|
|
|
|
|
015-153-00-9 |
isazofos (ISO); O-(5-chloro-1-isopropyl-1,2,4-triazol-3-yl) O, O-diethyl phosphorothioate |
255-863-8 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H311 H301 H373 ** H317 H410 |
|
|
|
|
|
015-154-00-4 |
ethephon; 2-chloroethylphosphonic acid |
240-718-3 |
Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 Skin Corr. 1C Aquatic Chronic 2 |
H311 H332 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H332 H302 H314 H411 |
EUH071 |
|
|
|
|
015-155-00-X |
glufosinate ammonium (ISO); ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate |
278-636-5 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H360Fd H332 H312 H302 H373** |
GHS08 GHS07 Dgr |
H360Fd H332 H312 H302 H373** |
|
|
|
|
|
015-156-00-5 |
methyl 3-[(dimethoxyphosphinothioyl)oxy]methacrylate; [1] methacrifos (ISO); methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [2] |
250-366-9 [1]-[2] |
30864-28-9 [1] 62610-77-9 [2] |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
015-157-00-0 |
phosphonic acid; [1] phosphorous acid [2] |
237-066-7 [1] 233-663-1 [2] |
13598-36-2 [1] 10294-56-1 [2] |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
015-158-00-6 |
(η-cyclopentadienyl)(η-cumenyl)iron(1+)hexafluorophosphate(1-) |
402-340-9 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
015-159-00-1 |
hydroxyphosphonoacetic acid |
405-710-8 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 |
H302 H373 ** H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H314 H317 |
|
|
|
|
|
015-160-00-7 |
vanadyl pyrophosphate |
406-260-5 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
|
015-161-00-2 |
divanadyl pyrophosphate |
407-130-0 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
|
015-162-00-8 |
vanadium(IV) oxide hydrogen phosphate hemihydrate, lithium, zinc, molybdenum, iron and chlorine-doped |
407-350-7 |
— |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H373 ** H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H373 ** H318 H411 |
|
|
|
|
015-163-00-3 |
bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxide |
412-010-6 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
015-164-00-9 |
calcium P, P'-(1-hydroxyethylene)bis(hydrogen phosphonate)dihydrate |
400-480-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
015-165-00-4 |
reaction mass of: thiobis(4,1-phenylene)-S, S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate |
404-986-7 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
015-166-00-X |
3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
410-290-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
015-167-00-5 |
3-(hydroxyphenylphosphinyl)propanoic acid |
411-200-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
015-168-00-0 |
fosthiazate (ISO); (RS)-S-sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioate |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
EUH070 |
|
|
|
|
015-169-00-6 |
tributyltetradecylphosphonium tetrafluoroborate |
413-520-1 |
— |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H317 H410 |
|
|
|
|
015-170-00-1 |
reaction mass of: di-(1-octane-N, N,N-trimethylammonium) octylphosphate; 1-octane-N, N,N-trimethylammonium di-octylphosphate; 1-octane-N, N,N-trimethylammonium octylphosphate |
407-490-9 |
— |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
015-171-00-7 |
O, O,O-tris(2(or 4)-C 9-10-isoalkylphenyl) phosphorothioate |
406-940-1 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
015-172-00-2 |
reaction mass of: bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate; isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate |
406-240-6 |
— |
Flam. Liq. 3 Skin Corr. 1B Aquatic Chronic 2 |
H226 H314 H411 |
GHS02 GHS05 GHS09 Dgr |
H226 H314 H411 |
|
|
|
|
015-173-00-8 |
methyl [2-(1,1-dimethylethyl)-6-methoxypyrimidin-4-yl]ethylphosphonothioate |
414-080-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
015-174-00-3 |
1-chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramine |
411-370-1 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Chronic 2 |
H301 H318 H411 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H411 |
|
|
|
|
|
015-175-00-9 |
tert-butyl (triphenylphosphoranylidene) acetate |
412-880-7 |
Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H301 H373 ** H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H319 H317 H411 |
|
|
|
|
|
015-176-00-4 |
P, P,P',P'-tetrakis-(o-methoxyphenyl)propane-1,3-diphosphine |
413-430-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
015-177-00-X |
((4-phenylbutyl)hydroxyphosphoryl)acetic acid |
412-170-7 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H373 ** H318 H317 |
GHS08 GHS05 Dgr |
H373 ** H318 H317 |
|
|
|
|
|
015-178-00-5 |
(R)-α-phenylethylammonium(-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate |
418-570-8 |
Repr. 2 Aquatic Chronic 2 |
H361f *** H411 |
GHS08 GHS09 Wng |
H361f *** H411 |
|
|
|
|
|
015-179-00-0 |
UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine |
422-720-8 |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H302 H373 ** H314 H317 H410 |
|
|
|
|
|
015-180-00-6 |
[R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt |
415-820-8 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
015-181-00-1 |
phosphine |
232-260-8 |
Flam. Gas 1 Press. Gas Acute Tox. 1 Skin Corr. 1B Aquatic Acute 1 |
H220 H330 H314 H400 |
GHS02 GHS04 GHS06 GHS05 GHS09 Dgr |
H220 H330 H314 H400 |
|
inhalation: ATE = 10 ppmV (gases) |
U |
|
|
015-182-00-7 |
tetrapropan-2-yl (dichloromethanediyl)bis(phosphonate) |
430-630-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
|
015-183-00-2 |
(1-hydroxydodecylidene)diphosphonic acid |
425-230-2 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
|
015-184-00-8 |
salts of glyphosate, with the exception of those specified elsewhere in this Annex |
— |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
A |
|
015-186-00-9 |
chlorpyrifos-methyl (ISO) O, O-dimethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
227-011-5 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10000 |
|
|
|
015-187-00-4 |
reaction mass of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide; trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide |
417-540-1 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
▼M8 ————— |
||||||||||
|
015-189-00-5 |
phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide |
423-340-5 |
Skin Sens. 1A Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
015-190-00-0 |
bis(2,4-dicumylphenyl)neopentyl diphosphite; 3,9-bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
421-920-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
015-191-00-6 |
dodecyldiphenyl phosphate |
431-760-5 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
▼M29 ————— |
||||||||||
|
015-193-00-7 |
triphenyl(phenylmethyl)phosphonium 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) |
442-960-7 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H400 H410 |
GHS05 GHS06 GHS09 Dgr |
H301 H318 H410 |
|
|
|
|
|
015-194-00-2 |
tetrabutyl-phosphonium nonafluoro-butane-1-sulfonate |
444-440-5 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
015-195-00-8 |
reaction mass of: potassium o-toluenephosphonate; potassium m-toluenephosphonate; potassium p-toluenephosphonate |
433-860-4 |
— |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
015-196-00-3 |
reaction mass of: dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate |
435-960-3 |
— |
Carc. 1B Muta. 1B Skin Sens. 1 |
H350 H340 H317 |
GHS08 GHS07 Dgr |
H350 H340 H317 |
|
|
|
|
015-197-00-9 |
bis(2,4,4-trimethylpentyl)dithiophosphonic acid |
420-160-9 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H302 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H302 H314 H411 |
|
|
|
|
|
015-198-00-4 |
(4-phenylbutyl)phosphinic acid |
420-450-5 |
Carc. 2 Eye Dam. 1 |
H351 H318 |
GHS05 GHS08 Dgr |
H351 H318 |
|
|
|
|
|
015-199-00-X |
tris[2-chloro-1-chloromethyl)ethyl] phosphate |
237-159-2 |
Carc. 2 |
H351 |
GSH08 Wng |
H351 |
|
|
|
|
|
015-200-00-3 |
indium phosphide |
244-959-5 |
Carc. 1B Repr. 2 STOT RE 1 |
H350 H361f H372 (lungs) |
GHS08 Dgr |
H350 H361f H372 (lungs) |
|
STOT RE 1; H372: C ≥0,1 % Carc 1B; H350: C ≥0,01 % STOT RE 2; H373: 0,01 % ≤ C < 0,1 % |
|
|
|
015-201-00-9 |
trixylyl phosphate |
246-677-8 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
015-202-00-4 |
tris(nonylphenyl) phosphite |
247-759-6 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
015-203-00-X |
diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide |
278-355-8 |
Repr. 1B Skin Sens. 1B |
H360Fd H317 |
GHS08 GHS07 Dgr |
H360Fd H317 |
|
|
|
|
|
015-204-00-5 |
benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate |
479-100-5 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
015-205-00-0 |
benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) |
278-305-5 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
015-206-00-6 |
reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate (1:1) |
— |
— |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
015-207-00-1 |
reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol (1:1) |
— |
— |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
015-208-00-7 |
dimethyl propylphosphonate |
242-555-3 |
Muta. 1B Repr. 1B |
H340 H360Df |
GHS08 Dgr |
H340 H360Df |
|
|
|
|
|
016-001-00-4 |
hydrogen sulphide, hydrogen sulfide |
231-977-3 |
Flam. Gas 1A Press. Gas Acute Tox. 2 Aquatic Acute 1 |
H220 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H220 H330 H400 |
|
inhalation: ATE = 440 ppmV (gases) |
U |
|
|
016-002-00-X |
barium sulphide |
244-214-4 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
EUH031 |
|
|
|
|
016-003-00-5 |
barium polysulphides |
256-814-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
|
016-004-00-0 |
calcium sulphide |
243-873-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
|
016-005-00-6 |
calcium polysulphides |
215-709-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031 |
|
|
|
|
016-006-00-1 |
dipotassium sulphide; potassium sulphide |
215-197-0 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
|
|
016-007-00-7 |
potassium polysulphides |
253-390-1 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
|
|
016-008-00-2 |
ammonium polysulphides |
232-989-1 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
EUH031: C ≥1 % |
|
|
|
016-009-00-8 |
disodium sulfide; sodium sulfide |
215-211-5 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H311 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H400 |
|
|
|
|
|
016-010-00-3 |
sodium polysulphides |
215-686-9 |
Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
EUH031 |
|
|
|
|
016-011-00-9 |
sulphur dioxide; sulfur dioxide |
231-195-2 |
Press. Gas Acute Tox. 3 STOT SE 1 Skin. Corr. 1B |
H331 H370 (respiratory system) (inhalation) H314 |
GHS04 GHS06 GHS08 GHS05 Dgr |
H331 H370 (respiratory system) (inhalation) H314 |
|
inhalation: ATE = 1 000 ppmV (gases) |
U, 5 |
|
|
016-012-00-4 |
disulphur dichloride; sulfur monochloride |
233-036-2 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H301 H332 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H332 H314 H400 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
|
|
016-013-00-X |
sulphur dichloride |
234-129-0 |
Skin Corr. 1B STOT SE 3 Aquatic Acute 1 |
H314 H335 H400 |
GHS05 GHS07 GHS09 Dgr |
H314 H335 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
|
|
016-014-00-5 |
sulphur tetrachloride |
— |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
|
|
016-015-00-0 |
thionyl dichloride; thionyl chloride |
231-748-8 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H332 H302 H314 |
GHS05 GHS07 Dgr |
H332 H302 H314 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
|
|
016-016-00-6 |
sulphuryl chloride |
232-245-6 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
|
016-017-00-1 |
chlorosulphonic acid |
232-234-6 |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
|
016-018-00-7 |
fluorosulphonic acid |
232-149-4 |
Acute Tox. 4 * Skin Corr. 1A |
H332 H314 |
GHS05 GHS07 Dgr |
H332 H314 |
|
|
|
|
|
016-019-00-2 |
oleum … % SO3 |
— |
— |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
B |
|
016-020-00-8 |
sulphuric acid … % |
231-639-5 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 15 % Skin Irrit. 2; H315: 5 % ≤ C < 15 % Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
B |
|
|
016-021-00-3 |
methanethiol; methyl mercaptan |
200-822-1 |
Flam. Gas. 1 Press. Gas Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H331 H400 H410 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H331 H410 |
|
|
U |
|
|
016-022-00-9 |
ethanethiol; ethyl mercaptan |
200-837-3 |
Flam. Liq. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H410 |
|
|
|
|
|
016-023-00-4 |
dimethyl sulphate |
201-058-1 |
Carc. 1B Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H350 H341 H330 H301 H314 H317 |
GHS06 GHS08 GHS05 Dgr |
H350 H341 H330 H301 H314 H317 |
|
Carc. 1B; H350: C ≥ 0,01 % Muta. 2 H341: C ≥ 0,01 % STOT SE 3; H335: C ≥ 5 % |
|
|
|
016-024-00-X |
dimexano(ISO); bis(methoxythiocarbonyl) disulphide |
215-993-8 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
016-025-00-5 |
disul (ISO); 2-(2,4-dichlorophenoxy)ethyl hydrogensulphate; 2,4-DES |
205-259-5 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H302 H315 H318 |
GHS05 GHS07 Dgr |
H302 H315 H318 |
|
|
|
|
|
016-026-00-0 |
sulphamidic acid; sulphamic acid; sulfamic acid |
226-218-8 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
|
016-027-00-6 |
diethyl sulphate |
200-589-6 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H340 H332 H312 H302 H314 |
GHS05 GHS08 GHS07 Dgr |
H350 H340 H332 H312 H302 H314 |
|
|
|
|
|
016-028-00-1 |
sodium dithionite; sodium hydrosulphite |
231-890-0 |
Self-heat. 1 Acute Tox. 4 * |
H251 H302 |
GHS02 GHS07 Dgr |
H251 H302 |
EUH031 |
|
|
|
|
016-029-00-7 |
p-toluenesulphonic acid, (containing more than 5 % H2SO4) |
— |
— |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
|
016-030-00-2 |
p-toluenesulphonic acid (containing a maximum of 5 % H2SO4) |
203-180-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 20 % |
|
|
|
016-031-00-8 |
tetrahydrothiophene-1,1-dioxide; sulpholane |
204-783-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
016-032-00-3 |
1,3-propanesultone; 1,2-oxathiolane 2,2-dioxide |
214-317-9 |
Carc. 1B Acute Tox. 4 * Acute Tox. 4 * |
H350 H312 H302 |
GHS08 GHS07 Dgr |
H350 H312 H302 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
|
016-033-00-9 |
dimethylsulfamoylchloride |
236-412-4 |
Carc. 1B Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H330 H312 H302 H314 |
GHS06 GHS05 GHS08 Dgr |
H350 H330 H312 H302 H314 |
|
|
|
|
|
016-034-00-4 |
tetrasodium 3,3'-(piperazine-1,4-diylbis((6-chloro-1,3,5-triazine-2,4-diyl)imino(2-acetamido)-4,1-phenyleneazo))bis(naphthalene-1,5-disulphonate) |
400-010-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-035-00-X |
pentasodium 5-anilino-3-(4-(4-(6-chloro-4-(3-sulphonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate |
400-120-7 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
016-036-00-5 |
tetrasodium 5-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalene-1,2,5,7-disulphonate |
400-130-1 |
— |
Resp. Sens. 1 Aquatic Chronic 2 |
H334 H411 |
GHS08 GHS09 Dgr |
H334 H411 |
|
|
|
|
016-037-00-0 |
disodium 1-amino-4-(4-benzenesulphonamido-3-sulphonatoanilino)anthraquinone-2-sulphonate |
400-350-8 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
016-038-00-6 |
disodium 6-((4-chloro-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulphonatophenylazo)naphthalene-3-sulphonate |
400-380-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-039-00-1 |
tetrasodium 2-(6-chloro-4-(4-(2,5-dimethyl-4-(2,5-disulphonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzene-1,4-disulphonate |
400-430-2 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-040-00-7 |
reaction mass of disodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and disodium 6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and trisodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulphonato-2-naphthylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate |
400-570-4 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
016-041-00-2 |
calcium 2,5-dichloro-4-(4-((5-chloro-4-methyl-2-sulphonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzenesulphonate |
400-710-4 |
— |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
|
016-042-00-8 |
tetrasodium 5-benzamido-3-(5-(4-fluoro-6-(1-sulphonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate |
400-790-0 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
|
016-043-00-3 |
dilithium 6-acetamido-4-hydroxy-3-(4-((2-sulphonatooxy)ethylsulphonyl) phenylazo)naphthalene-2-sulphonate |
401-010-1 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-044-00-9 |
disodium S,S-hexane-1,6-diyldi(thiosulphate) dihydrate |
401-320-7 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
016-045-00-4 |
lithium sodium hydrogen 4-amino-6-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-sulphonatophenylazo)-5-hydroxy-3-(4-(2-(sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2,7-disulphonate |
401-560-2 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-046-00-X |
sodium hydrogensulphate |
231-665-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
016-047-00-5 |
hexasodium 7-(4-(4-(4-(2,5-disulphonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulphonatonaphthylazo)naphthalene-1,3,5-trisulphonate |
401-650-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-048-00-0 |
sodium 3,5-dichloro-2-(5-cyano-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzenesulphonate |
401-870-8 |
— |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
016-049-00-6 |
calcium octadecylxylenesulphonate |
402-040-8 |
— |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
|
016-050-00-1 |
potassium sodium 5-(4-chloro-6-(N-(4-(4-chloro-6-(5-hydroxy-2,7-disulphonato-6-(2-sulphonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino) phenyl-N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulphonatophenylazo)naphthalene-2,7-disulphonat |
402-150-6 |
— |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
016-051-00-7 |
trisodium 7-(4-(6-fluoro-4-(2-(2-vinylsulphonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6-trisulphonate |
402-170-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-052-00-2 |
benzyltributylammonium 4-hydroxynaphthalene-1-sulphonate |
402-240-5 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
|
016-053-00-8 |
(C16 or C18-n-alkyl)(C16 or C18-n-alkyl)ammonium 2-((C16 or C18-n-alkyl)(C16 or C18-n-alkyl)carbamoyl)benzenesulphonate |
402-460-1 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
016-054-00-3 |
sodium 4-(2,4,4-trimethylpentylcarbonyloxy)benzenesulfonate |
400-030-8 |
— |
Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Sens. 1 |
H331 H372 ** H302 H319 H335 H317 |
GHS06 GHS08 Dgr |
H331 H372 ** H302 H319 H335 H317 |
|
|
|
|
016-055-00-9 |
tetrasodium 4-amino-3,6-bis(5-(6-chloro-4-(2-hydroxyethylamino)-1,3,5-triazin-2-ylamino)-2-sulfonatophenylazo)-5-hydroxynaphthalene-2,7-sulfonate (containing > 35 % sodium chloride and sodium acetate) |
400-510-7 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
016-056-00-4 |
potassium hydrogensulphate |
231-594-1 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
|
|
016-057-00-X |
styrene-4-sulfonyl chloride |
404-770-2 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
|
016-058-00-5 |
thionyl chloride, reaction products with 1,3,4-thiadiazol-2,5-dithiol, tert-nonanethiol andC 12-14-tert-alkylamine |
404-820-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
|
|
|
|
016-059-00-0 |
N, N,N',N'-tetramethyldithiobis(ethylene)diamine dihydrochloride |
405-300-9 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H317 H410 |
|
|
|
|
|
016-060-00-6 |
diammonium peroxodisulphate; ammonium persulphate |
231-786-5 |
Ox. Sol. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H319 H335 H315 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
|
|
|
|
|
016-061-00-1 |
dipotassium peroxodisulphate; potassium persulphate |
231-781-8 |
Ox. Sol. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 |
H272 H302 H319 H335 H315 H334 H317 |
GHS03 GHS08 GHS07 Dgr |
H272 H302 H319 H335 H315 H334 H317 |
|
|
|
|
|
016-062-00-7 |
bensultap (ISO); 1,3-bis(phenylsulfonylthio)-2-(N,N-dimethylamino)propane |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
016-063-00-2 |
sodium metabisulphite |
231-673-0 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
EUH031 |
|
|
|
|
016-064-00-8 |
sodium hydrogensulphite … %; sodium bisulphite . . . % |
231-548-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
EUH031 |
|
B |
|
|
016-065-00-3 |
sodium 1-amino-4-[2-methyl-5-(4-methylphenylsulfonylamino)phenylamino]anthraquinone-2-sulfonate |
400-100-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
016-066-00-9 |
tetrasodium [5-((4-amino-6-chloro-1,3,5-triazin-2-yl)amino)-2-((2-hydroxy-3,5-disulfonatophenylazo)-2-sulfonatobenzylidenehydrazino)benzoate]copper(II) |
404-070-7 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
016-067-00-4 |
(4-methylphenyl)mesitylene sulfonate |
407-530-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
016-068-00-X |
sodium 3,5-bis(tetradecyloxycarbonyl)benzenesulfinate |
407-720-8 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
016-069-00-5 |
3,5-bis-(tetradecyloxycarbonyl)benzenesulfinic acid |
407-990-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
016-070-00-0 |
4-benzyloxy-4'-(2,3-epoxy-2-methylprop-1-yloxy)diphenylsulfone |
408-220-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
016-071-00-6 |
trisodium 3-amino-6,13-dichloro-10-((3-((4-chloro-6-(2-sulfophenylamino)-1,3,5-triazin-2-yl)amino)propyl) amino)-4,11-triphenoxydioxazinedisulfonate |
410-130-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
016-072-00-1 |
3-amino-4-hydroxy-N-(2-methoxyethyl)-benzenesulfonamide |
411-520-6 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
|
016-073-00-7 |
tetrakis(phenylmethyl)thioperoxydi(carbothioamide) |
404-310-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
016-074-00-2 |
6-fluoro-2-methyl-3-(4-methylthiobenzyl)indene |
405-410-7 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
016-075-00-8 |
2,2'-diallyl-4,4'-sulfonyldiphenol |
411-570-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
016-076-00-3 |
2,3-bis((2-mercaptoethyl)thio)-1-propanethiol |
411-290-7 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
|
016-077-00-9 |
2-chloro-p-toluenesulfochloride |
412-890-1 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H314 H317 H412 |
GHS05 GHS07 Dgr |
H314 H317 H412 |
|
|
|
|
|
016-078-00-4 |
4-methyl-N, N-bis(2-(((4-methylphenyl)sulfonyl)amino)ethyl)benzenesulfonamide |
413-300-5 |
Aquatic Chronic 4 |
H413 |
— |
|
|
|
|
|
|
016-079-00-X |
N, N-bis(2-(p-toluenesulfonyloxy)ethyl)-p-toluenesulfonamide |
412-920-3 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
016-080-00-5 |
sodium 2-anilino-5-(2-nitro-4-(N-phenylsulfamoyl))anilinobenzenesulfonate |
412-320-1 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
016-081-00-0 |
hexahydrocyclopenta[c]pyrrole-1-(1H)-ammonium N-ethoxycarbonyl-N-(p-tolylsulfonyl)azanide |
418-350-1 |
— |
Muta. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H302 H319 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H302 H319 H317 H411 |
|
|
|
|
016-082-00-6 |
ethoxysulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethoxyphenoxysulfonyl)urea |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
016-083-00-1 |
acibenzolar-S-methyl; benzo[1,2,3]thiadiazole-7-carbothioic acid S-methyl ester |
420-050-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
|
|
016-084-00-7 |
prosulfuron (ISO); 1-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluoropropyl)phenylsulfonyl]urea |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M=100 |
|
|
|
016-085-00-2 |
flazasulfuron (ISO); 1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-trifluoromethyl-2-pyridylsulfonyl)urea |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
016-086-00-8 |
tetrasodium 10-amino-6,13-dichloro-3-(3-(4-(2,5-disulfonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)prop-3-ylamino)-5,12-dioxa-7,14-diazapentacene-4,11-disulfonate |
402-590-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
016-087-00-3 |
reaction mass of: thiobis(4,1-phenylene)-S, S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate; propylene carbonate |
403-490-8 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H317 H410 |
|
|
|
|
|
016-088-00-9 |
4-(bis(4-(diethylamino)phenyl)methyl)benzene-1,2-dimethanesulfonic acid |
407-280-7 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
016-089-00-4 |
reaction mass of esters of 5,5',6,6',7,7'-hexahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobiindan and 2-diazo-1,2-dihydro-1-oxo-5-sulfonaphthalene |
413-840-1 |
— |
Self-react. C **** Aquatic Chronic 4 |
H242 H413 |
GHS02 Dgr |
H242 H413 |
|
|
|
|
016-090-00-X |
4-methyl-N-(methylsulfonyl)benzenesulfonamide |
415-040-8 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
|
|
|
|
|
016-091-00-5 |
C12-14-tert-alkyl ammonium 1-amino-9,10-dihydro-9,10-dioxo-4-(2,4,6-trimethylanilino)-anthracen-2-sulfonate |
414-110-5 |
— |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
016-092-00-0 |
reaction mass of: 4,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 4,8-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol; 5,7-bis(mercaptomethyl)-3,6,9-trithia-1,11-undecanedithiol |
427-050-1 |
— |
Repr. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f H315 H317 H410 |
|
|
|
|
016-093-00-6 |
reaction mass of: 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinol-4-yl-tris(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate); 4-(7-hydroxy-2,4,4-trimethyl-2-chromanyl)resorcinolbis(6-diazo-5,6-dihydro-5-oxonaphthalen-1-sulfonate) (2:1) |
414-770-4 |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
|
|
016-094-00-1 |
sulfur |
231-722-6 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
|
016-095-00-7 |
reaction mass of: reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:2); reaction product of 4,4'-methylenebis[2-(4-hydroxybenzyl)-3,6-dimethylphenol] and 6-diazo-5,6-dihydro-5-oxo-naphthalenesulfonate (1:3) |
417-980-4 |
— |
Self-react. C **** Carc. 2 |
H242 H351 |
GHS02 GHS08 Dgr |
H242 H351 |
|
|
|
|
016-096-00-2 |
thifensulfuron-methyl (ISO); methyl 3-(4-methoxy-6-methyl-1,3,5-triazin-2-ylcarbamoylsulfamoyl)thiophene-2-carboxylate |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 M = 100 |
|
|
|
016-097-00-8 |
1-amino-2-methyl-2-propanethiol hydrochloride |
434-480-1 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H302 H314 H317 H412 |
GHS05 GHS07 Dgr |
H302 H314 H317 H412 |
|
|
|
|
|
016-098-00-3 |
dimethyl disulphide |
210-871-0 |
Flam. Liq. 2 Acute Tox. 3 Acute Tox. 3 STOT SE 3 STOT SE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H331 H301 H336 H370 (upper respiratory tract, inhalation) H319 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H301 H336 H370 (upper respiratory tract, inhalation) H319 H317 H410 |
|
inhalation: ATE = 5 mg/L (vapours) oral: ATE = 190 mg/kg bw M = 1 M = 10 |
|
|
|
017-001-00-7 |
chlorine |
231-959-5 |
Ox. Gas 1 Press. Gas Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H270 H331 H319 H335 H315 H400 |
GHS03 GHS04 GHS06 GHS09 Dgr |
H270 H331 H319 H335 H315 H400 |
|
M = 100 |
U |
|
|
017-002-00-2 |
hydrogen chloride |
231-595-7 |
Press. Gas Acute Tox. 3 * Skin Corr. 1A |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
|
|
U5 |
|
|
017-002-01-X |
hydrochloric acid … % |
231-595-7 |
— |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % EyeIrrit. 2; H319: 10 % ≤ C < 25 % STOT SE 3; H335: C ≥ 10 % |
B |
|
017-003-00-8 |
barium chlorate |
236-760-7 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H271 H332 H302 H411 |
GHS03 GHS07 GHS09 Dgr |
H271 H332 H302 H411 |
|
|
|
|
|
017-004-00-3 |
potassium chlorate |
223-289-7 |
Ox. Sol. 1 Acute Tox. 3 |
H271 H301 |
GHS03 GHS06 Dgr |
H271 H301 |
|
oral: ATE = 100 mg/kg bw |
|
|
|
017-005-00-9 |
sodium chlorate |
231-887-4 |
Ox. Sol. 1 Acute Tox. 3 |
H271 H301 |
GHS03 GHS06 Dgr |
H271 H301 |
|
oral: ATE = 100 mg/kg bw |
|
|
|
017-006-00-4 |
perchloric acid … % |
231-512-4 |
Ox. Liq. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
Skin Corr. 1A; H314: C ≥ 50 % Skin Corr. 1B; H314: 10 % ≤ C < 50 % Skin Irrit. 2; H315: 1 % ≤ C < 10 % Eye Irrit. 2; H319: 1 % ≤ C < 10 % Ox. Liq. 1; H271: C > 50 %: Ox. Liq. 2; H272: C ≤ 50 %: |
B |
|
|
017-007-00-X |
barium perchlorate |
236-710-4 |
Ox. Sol. 1 Acute Tox. 4 * Acute Tox. 4 * |
H271 H332 H302 |
GHS03 GHS07 Dgr |
H271 H332 H302 |
|
|
|
|
|
017-008-00-5 |
potassium perchlorate |
231-912-9 |
Ox. Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
|
|
|
|
|
017-009-00-0 |
ammonium perchlorate |
232-235-1 |
Expl. 1.1 Ox. Sol. 1 |
H201 H271 |
GHS01 Dgr |
H201 H271 |
|
|
T |
|
|
017-010-00-6 |
sodium perchlorate |
231-511-9 |
Ox. Sol. 1 Acute Tox. 4 * |
H271 H302 |
GHS03 GHS07 Dgr |
H271 H302 |
|
|
|
|
|
017-011-00-1 |
sodium hypochlorite, solution … % Cl active |
231-668-3 |
Skin Corr. 1B Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H318 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
EUH031 |
M = 10 M = 1 EUH031: C ≥ 5 % |
B |
|
|
017-012-00-7 |
calcium hypochlorite |
231-908-7 |
Ox. Sol. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H272 H302 H314 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H400 |
EUH031 |
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 3 % M = 10 |
T |
|
|
017-013-00-2 |
calcium chloride |
233-140-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
017-014-00-8 |
ammonium chloride |
235-186-4 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
|
017-015-00-3 |
(2-(aminomethyl)phenyl)acetylchloride hydrochloride |
417-410-4 |
Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
|
017-016-00-9 |
methyltriphenylphosphonium chloride |
418-400-2 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H312 H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H411 |
|
|
|
|
|
017-017-00-4 |
(Z)-13-docosenyl-N,N-bis(2-hydroxyethyl)-N-methyl-ammonium-chloride |
426-210-6 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
|
017-018-00-X |
N, N,N-trimethyl-2,3-bis(stearoyloxy)propylammonium chloride |
405-660-7 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
017-019-00-5 |
(R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-veratrylisoquinoline hydrochloride |
415-110-8 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
017-020-00-0 |
ethyl propoxy aluminium chloride |
421-790-7 |
Water-react. 1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
|
017-021-00-6 |
behenamidopropyl-dimethyl-(dihydroxypropyl) ammonium chloride |
423-420-1 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
|
017-023-00-7 |
[phosphinyldynetris(oxy)] tris[3-aminopropyl-2-hydroxy-N, N-dimethyl-N-(C6-18)-alkyl] trichlorides |
425-520-9 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
|
017-026-00-3 |
chlorine dioxide |
233-162-8 |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 |
H270 H330 H314 H400 |
GHS04 GHS03 GHS06 GHS05 GHS09 Dgr |
H270 H330 H314 H400 |
|
M = 10 |
5 |
|
|
017-026-01-0 |
chlorine dioxide … % |
233-162-8 |
Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
|
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 1 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,3 % ≤ C < 3 % STOT SE 3; H335: C ≥ 3 % M = 10 |
B |
|
|
019-001-00-2 |
potassium |
231-119-8 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
|
019-002-00-8 |
potassium hydroxide; caustic potash |
215-181-3 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
Skin Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314: 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
|
|
|
019-003-00-3 |
potassium (E,E)-hexa-2,4-dienoate |
246-376-1 |
Eye Irrit. 2 |
H319 |
GSH07 Wng |
H319 |
|
|
|
|
|
020-001-00-X |
calcium |
231-179-5 |
Water-react. 2 |
H261 |
GHS02 Dgr |
H261 |
|
|
|
|
|
020-002-00-5 |
calcium cyanide |
209-740-0 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
EUH032 |
|
|
|
|
020-003-00-0 |
reaction mass of: dicalcium (bis(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)dihydroxide; tri-calcium (tris(2-hydroxy-5-tetra-propenylphenylmethyl)methylamine)tri-hydroxide; poly[calcium ((2-hydroxy-5-tetra-propenyl-phenylmethyl)methylamine)hydroxide] |
420-470-4 |
— |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
022-001-00-5 |
titanium tetrachloride |
231-441-9 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
EUH014 |
|
|
|
|
022-002-00-0 |
titanium(4+) oxalate |
403-260-7 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
022-003-00-6 |
bis(η5-cyclopentadienyl)-bis(2,6-difluoro-3-[pyrrol-1-yl]-phenyl)titanium |
412-000-1 |
Flam. Sol. 1 Repr. 2 STOT RE 2 * Aquatic Chronic 2 |
H228 H361f *** H373 ** H411 |
GHS02 GHS08 GHS09 Dgr |
H228 H361f *** H373 ** H411 |
|
|
T |
|
|
022-004-00-1 |
Potassium titanium oxide(K 2 Ti 6 O 13 ) |
432-240-0 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
022-005-00-7 |
[N-(1,1-dimethylethyl)-1,1-dimethyl-1-[(1,2,3,4,5-η)-2,3,4,5-tetramethyl-2,4-cyclopentadien-1-yl]silanaminato(2-)-κN][(1,2,3,4-η)-1,3-pentadiene]-titanium |
419-840-8 |
Flam. Sol. 1**** Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H228 H314 H317 H413 |
GHS02 GHS05 GHS07 Dgr |
H228 H314 H317 H413 |
|
|
|
|
|
►C6 022-006-00-2 ◄ |
titanium dioxide; [in powder form containing 1 % or more of particles with aerodynamic diameter ≤ 10 μm] |
236-675-5 |
Carc. 2 |
H351 (inhalation) |
GHS08 Wng |
H351 (inhalation) |
|
|
V, W, 10 |
|
|
023-001-00-8 |
divanadium pentaoxide; vanadium pentoxide |
215-239-8 |
Muta. 2 Carc. 1B Repr. 2 Lact. Acute Tox. 3 Acute Tox. 2 STOT SE 3 STOT RE 1 Aquatic Chronic 2 |
H341 H350 H361fd H362 H301 H330 H335 H372 (respiratory tract, inhalation) H411 |
GHS06 GHS08 GHS09 Dgr |
H341 H350 H361fd H362 H301 H330 H335 H372 (respiratory tract, inhalation) H411 |
|
inhalation: ATE = 0,05 mg/L (dusts or mists) oral: ATE = 220 mg/kg bw |
|
|
|
024-001-00-0 |
chromium (VI) trioxide |
215-607-8 |
Ox. Sol. 1 Carc. 1A Muta. 1B Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350 H340 H361f *** H330 H311 H301 H372 ** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H271 H350 H340 H361f *** H330 H311 H301 H372 ** H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
|
024-002-00-6 |
potassium dichromate |
231-906-6 |
Ox. Sol. 2 Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
3 |
|
|
024-003-00-1 |
ammonium dichromate |
232-143-1 |
Ox. Sol. 2 **** Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS08 GHS05 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
STOT SE 3; H335: C ≥ 5 % Resp. Sens.; H334: C ≥0,2 % Skin Sens.; H317:C ≥0,2 % |
G3 |
|
|
024-004-00-7 |
sodium dichromate |
234-190-3 |
Ox. Sol. 2 Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350 H340 H360FD H330 H301 H312 H372** H314 H334 H317 H400 H410 |
GHS03 GHS06 GHS05 GHS08 GHS09 Dgr |
H272 H350 H340 H360FD H330 H301 H312 H372** H314 H334 H317 H410 |
|
Resp. Sens. 1; H334: C ≥ 0,2 % Skin Sens. 1; H317:C ≥0,2 % STOT SE 3; H335: C ≥ 5 % |
3 |
|
|
▼M1 ————— |
||||||||||
|
024-005-00-2 |
chromyl dichloride; chromic oxychloride |
239-056-8 |
Ox. Liq. 1 Carc. 1B Muta. 1B Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350i H340 H314 H317 H400 H410 |
GHS03 GHS08 GHS05 GHS07 GHS09 Dgr |
H271 H350i H340 H314 H317 H410 |
|
Skin Corr. 1A; H314: C ≥ 10 % Skin Corr. 1B; H314: 5 % ≤ C < 10 % Skin Irrit. 2; H315: 0,5 % ≤ C < 5 % Eye Irrit. 2; H319: 0,5 % ≤ C < 5 % STOT SE 3; H335: 0,5 % ≤ C < 5 % Skin Sens. 1; H317: C ≥ 0,5 % |
T3 |
|
|
024-006-00-8 |
potassium chromate |
232-140-5 |
Carc. 1B Muta. 1B Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H340 H319 H335 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H340 H319 H335 H315 H317 H410 |
|
Skin Sens. 1; H317:C ≥ 0,5 % |
3 |
|
|
024-007-00-3 |
zinc chromates including zinc potassium chromate |
— |
— |
Carc. 1A Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H410 |
|
|
A |
|
024-008-00-9 |
calcium chromate |
237-366-8 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
|
024-009-00-4 |
strontium chromate |
232-142-6 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H400 H410 |
|
|
|
|
|
024-010-00-X |
dichromium tris(chromate); chromium III chromate; chromic chromate |
246-356-2 |
Ox. Sol. 1 Carc. 1B Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H271 H350 H314 H317 H400 H410 |
GHS03 GHS08 GHS05 GHS07 GHS09 Dgr |
H271 H350 H314 H317 H410 |
|
|
T |
|
|
024-011-00-5 |
ammonium bis(1-(3,5-dinitro-2-oxidophenylazo)-3-(N-phenylcarbamoyl)-2-naphtholato)chromate(1-) |
400-110-2 |
Self-react. C **** Aquatic Acute 1 Aquatic Chronic 1 |
H242 H400 H410 |
GHS02 GHS09 Dgr |
H242 H410 |
|
|
|
|
|
024-012-00-0 |
trisodium bis(7-acetamido-2-(4-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)chromate(1-) |
400-810-8 |
— |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
024-013-00-6 |
trisodium (6-anilino-2-(5-nitro-2-oxidophenylazo)-3-sulphonato-1-naphtholato)(4-sulphonato-1,1'-azodi-2,2'naphtholato)chromate(1-) |
402-500-8 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
024-014-00-1 |
trisodium bis(2-(5-chloro-4-nitro-2-oxidophenylazo)-5-sulphonato-1-naphtholato)chromate(1-) |
402-870-0 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
024-015-00-7 |
disodium (3-methyl-4-(5-nitro-2-oxidophenylazo)-1-phenylpyrazololato)(1-(3-nitro-2-oxido-5-sulfonatophenylazo)-2-naphtholato)chromate(1-) |
404-930-1 |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H318 H411 |
|
|
|
|
024-016-00-2 |
tetradecylammonium bis(1-(5-chloro-2-oxidophenylazo)-2-naphtholato)chromate(1-) |
405-110-6 |
STOT RE 2 * Aquatic Chronic 4 |
H373 ** H413 |
GHS08 Wng |
H373 ** H413 |
|
|
|
|
|
024-017-00-8 |
chromium (VI) compounds, with the exception of barium chromate and of compounds specified elsewhere in this Annex |
— |
— |
Carc. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H317 H410 |
|
|
A |
|
024-018-00-3 |
sodium chromate |
231-889-5 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H312 H314 H334 H317 H410 |
|
Resp. Sens.; H334: C ≥ 0,2 % Skin Sens.; H317:C ≥ 0,2 % |
3 |
|
|
024-019-00-9 |
Main component: acetoacetic acid anilide/3-amino-1-hydroxybenzene (ATAN-MAP): trisodium {6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}-{6''-[1-(phenylcarbamoyl)ethylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2''-azobenzene-1'',2'''-diolato}chromate (III); by-product 1: acetoacetic acid anilide/acetoacetic acid anilide (ATAN-ATAN): trisodium bis{6-[1-(phenylcarbamoyl)ethylazo]-5'''-(phenylsulfonyl)-3''-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}chromate (III); by-product 2: 3-amino-1-hydroxybenzene/3-amino-1-hydroxybenzene (MAP-MAP): trisodium bis{6-[(2 or 3 or 4)-amino-(4 or 5 or 6)-hydroxyphenylazo]-5'-(phenylsulfamoyl)-3-sulfonatonaphthalene-2-azobenzene-1,2'-diolato}chromate (III) |
419-230-1 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
024-020-00-4 |
trisodium bis[(3'-nitro-5'-sulfonato(6-amino-2-[4-(2-hydroxy-1-naphtylazo)phenylsulfonylamino]pyrimidin-5-azo)benzene-2',4-diolato)]chromate(III) |
418-220-4 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
024-021-00-X |
potassium tetrasodium bis[(N,N'-n)-1'-(phenylcarbamoyl)-3,5-disulfonatobenzeneazo-1'-prop-1'-ene-2,2'-diolato]chromate(III) |
425-830-4 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
025-001-00-3 |
manganese dioxide |
215-202-6 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
|
025-002-00-9 |
potassium permanganate |
231-760-3 |
Ox. Sol. 2 Repr. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H272 H361d H302 H400 H410 |
GHS03 GHS08 GHS07 GHS09 Dgr |
H272 H361d H302 H410 |
|
|
|
|
|
025-003-00-4 |
manganese sulphate |
232-089-9 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
|
025-004-00-X |
bis(N, N',N''-trimethyl-1,4,7-triazacyclononane)-trioxo-dimanganese (IV) di(hexafluorophosphate) monohydrate |
411-760-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
025-005-00-5 |
reaction mass of: tri-sodium [29H, 31H-phthalocyanine-C, C,C-trisulfonato (6-)-N29, N30, N31, N32] manganate (3-); tetrasodium [29H, 31H-phthalocyanine-C, C,C, C-tetrasulfonato(6-)-N29, N30, N31, N32], manganate (3-); pentasodium [29H, 31H-phthalocyanine-C, C,C, C,C-pentasulfonato (6-)-N29, N30, N31, N32] manganate (3-) |
417-660-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
026-001-00-6 |
(η-cumene)-(η-cyclopentadienyl)iron(II) hexafluoroantimonate |
407-840-0 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
026-002-00-1 |
(η-cumene)-(η-cyclopentadienyl)iron(II) trifluoromethane-sulfonate |
407-880-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
026-003-00-7 |
iron (II) sulfate |
231-753-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
|
026-003-01-4 |
iron (II) sulfate (1:1) heptahydrate; sulfuric acid, iron(II) salt (1:1), heptahydrate; ferrous sulfate heptahydrate |
231-753-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
Skin Irrit.2; H315: C ≥ 25 % |
|
|
|
026-004-00-2 |
potassium ferrite |
430-010-4 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
|
027-001-00-9 |
cobalt |
231-158-0 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 4 |
H350 H341 H360F H334 H317 H413 |
GHS08 Dgr |
H350 H341 H360F H334 H317 H413 |
|
|
|
|
|
027-002-00-4 |
cobalt oxide |
215-154-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M=10 |
|
|
|
027-003-00-X |
cobalt sulfide |
215-273-3 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M=10 |
|
|
|
027-004-00-5 |
cobalt dichloride |
231-589-4 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360F*** H302 H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M=10 |
1 |
|
|
027-005-00-0 |
cobalt sulfate |
233-334-2 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360F*** H302 H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M=10 |
1 |
|
|
027-006-00-6 |
cobalt di(acetate) |
200-755-8 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360F*** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
|
027-007-00-1 |
zinc hexacyanocobaltate(III), tertiary butyl alcohol/polypropylene glycol complex |
425-240-7 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
027-008-00-7 |
complex of cobalt(III)-bis(N-phenyl-4-(5-ethylsulfonyl-2-hydroxyphenylazo)-3-hydroxynaphthylamide), hydrated(n H2O,2<n<3) |
427-390-9 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
027-009-00-2 |
cobalt dinitrate |
233-402-1 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360F*** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M = 10 |
1 |
|
|
027-010-00-8 |
cobalt carbonate |
208-169-4 |
Carc. 1B Muta. 2 Repr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360F*** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360F*** H334 H317 H410 |
|
Carc. 1B; H350i: C ≥ 0,01 % M=10 |
1 |
|
|
028-001-00-1 |
tetracarbonylnickel; nickel tetracarbonyl |
236-669-2 |
Flam. Liq. 2 Carc. 2 Repr. 1B Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H351 H360D *** H330 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H351 H360D *** H330 H410 |
|
|
|
|
|
028-002-00-7 |
nickel |
231-111-4 |
Carc. 2 STOT RE 1 Skin Sens. 1 |
H351 H372** H317 |
GHS08 GHS07 Dgr |
H351 H372** H317 |
|
|
S7 |
|
|
028-002-01-4 |
nickel powder; [particle diameter < 1mm] |
231-111-4 |
Carc. 2 STOT RE 1 Skin Sens. 1 Aquatic Chronic 3 |
H351 H372** H317 H412 |
GHS08 GHS07 Dgr |
H351 H372** H317 H412 |
|
|
|
|
|
028-003-00-2 |
nickel monoxide; [1] nickel oxide; [2] bunsenite [3] |
215-215-7[1] 234-323-5[2]-[3] |
1313-99-1 [1] 11099-02-8 [2] 34492-97-2 [3] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372** H317 H413 |
|
|
|
|
028-004-00-8 |
nickel dioxide |
234-823-3 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372** H317 H413 |
|
|
|
|
|
028-005-00-3 |
dinickel trioxide |
215-217-8 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Chronic 4 |
H350i H372** H317 H413 |
GHS08 GHS07 Dgr |
H350i H372** H317 H413 |
|
|
|
|
|
028-006-00-9 |
nickel (II) sulfide; [1] nickel sulfide; [2] millerite [3] |
240-841-2[1] 234-349-7[2]-[3] |
16812-54-7 [1] 11113-75-0 [2] 1314-04-1 [3] |
Carc. 1A Muta. 2 STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H372** H317 H410 |
|
|
|
|
028-007-00-4 |
trinickel disulfide; nickel subsulfide; [1] heazlewoodite [2] |
234-829-6 [1] - [2] |
12035-72-2 [1] 12035-71-1 [2] |
Carc. 1A Muta. 2 Acute Tox. 3 STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H331 H372** H317 H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H350i H341 H331 H372** H317 H410 |
|
inhalation: ATE = 0,92 mg/l (dusts or mists) |
|
|
028-008-00-X |
nickel dihydroxide; [1] nickel hydroxide [2] |
235-008-5 [1] 234-348-1 [2] |
12054-48-7 [1] 11113-74-9 [2] |
Carc. 1A Repr. 1B Muta. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H360D*** H341 H372** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H360D*** H341 H372** H332 H302 H315 H334 H317 H410 |
|
|
|
|
028-009-00-5 |
nickel sulfate |
232-104-9 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
|
028-010-00-0 |
nickel carbonate; basic nickel carbonate; carbonic acid, nickel (2+) salt; [1] carbonic acid, nickel salt; [2] [μ-[carbonato(2-)-O:O']]dihydroxy trinickel; [3] [carbonato(2-)] tetrahydroxytrinickel [4] |
222-068-2 [1] 240-408-8 [2] 265-748-4 [3] 235-715-9 [4] |
3333-67-3 [1] 16337-84-1 [2] 65405-96-1 [3] 12607-70-4 [4] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H410 |
|
|
|
|
028-011-00-6 |
nickel dichloride |
231-743-0 |
Carc. 1A Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H331 H301 H372** H315 H334 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350i H341 H360D*** H331 H301 H372** H315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % < C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
|
028-012-00-1 |
nickel dinitrate; [1] nitric acid, nickel salt [2] |
236-068-5 [1] 238-076-4 [2] |
13138-45-9 [1] 14216-75-2 [2] |
Ox. Sol. 2 Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H272 H350i H341 H360D*** H372** H332 H302 H315 H318 H334 H317 H400 H410 |
GHS03 GHS05 GHS08 GHS07 GHS09 Dgr |
H272 H350i H341 H360D*** H372** H332 H302 H315 H318 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % < C < 1 % Skin Irrit. 2; H315: C ≥ 20 % Skin Sens. 1; H317 C ≥0,01 % M = 1 |
|
|
028-013-00-7 |
nickel matte |
273-749-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-014-00-2 |
slimes and sludges, copper electrolytic refining, decopperised, nickel sulfate |
295-859-3 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H315 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < % Skin Sens. 1; H317:C ≥ 0,01 % M=1 |
|
|
|
028-015-00-8 |
slimes and sludges, copper electrolyte refining, decopperised |
305-433-1 |
Carc. 1A Muta. 2 Repr. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
|
|
|
|
028-016-00-3 |
nickel diperchlorate; perchloric acid, nickel(II) salt |
237-124-1 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H314 H334 H317 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H314 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
|
|
|
028-017-00-9 |
nickel dipotassium bis(sulfate); [1] diammonium nickel bis(sulfate) [2] |
237-563-9 [1] 239-793-2 [2] |
13842-46-1 [1] 15699-18-0 [2] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M=1 |
|
|
028-018-00-4 |
nickel bis(sulfamidate); nickel sulfamate |
237-396-1 |
Carc. 1A Muta. 2 Repr. 1B Acute Tox. 4 STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H302 H372** H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H302 H372** H334 H317 H410 |
|
oral: ATE = 853 mg/kg bw (anhydrate) oral: ATE = 1098 mg/kg bw (tetrahydrate) STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M = 1 |
|
|
|
028-019-00-X |
nickel bis(tetrafluoroborate) |
238-753-4 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥0,01 % M=1 |
|
|
|
028-021-00-0 |
nickel diformate; [1] formic acid, nickel salt; [2] formic acid, copper nickel salt [3] |
222-101-0 [1] 239-946-6 [2] 268-755-0 [3] |
3349-06-2 [1] 15843-02-4 [2] 68134-59-8 [3] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥0,01 % M=1 |
|
|
028-022-00-6 |
nickel di(acetate); [1] nickel acetate [2] |
206-761-7 [1] 239-086-1 [2] |
373-02-4 [1] 14998-37-9 [2] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H332 H302 H334 H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H341 H360D*** H372** H332 H302 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥ 0,01 % M = 1 |
|
|
028-024-00-7 |
nickel dibenzoate |
209-046-8 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥ 0,01 % M=1 |
|
|
|
028-025-00-2 |
nickel bis(4-cyclohexylbutyrate) |
223-463-2 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥0,01 % M=1 |
|
|
|
028-026-00-8 |
nickel(II) stearate; nickel(II) octadecanoate |
218-744-1 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317:C;≥0,01 % M=1 |
|
|
|
028-027-00-3 |
nickel dilactate |
— |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372:C ≥ 1 % STOT RE 2; H373:0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
|
|
|
028-028-00-9 |
nickel(II) octanoate |
225-656-7 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H314 H334 H317 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H314 H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
|
|
|
028-029-00-4 |
nickel difluoride; [1] nickel dibromide; [2] nickel diiodide; [3] nickel potassium fluoride [4] |
233-071-3 [1] 236-665-0 [2] 236-666-6 [3] -[4] |
10028-18-9 [1] 13462-88-9 [2] 13462-90-3 [3] 11132-10-8 [4] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥0,01 % M=1 |
|
|
028-030-00-X |
nickel hexafluorosilicate |
247-430-7 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C ≥ 0,01 % M=1 |
|
|
|
028-031-00-5 |
nickel selenate |
239-125-2 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥0,01 % M=1 |
|
|
|
028-032-00-0 |
nickel hydrogen phosphate; [1] nickel bis(dihydrogen phosphate); [2] trinickel bis(orthophosphate); [3] dinickel diphosphate; [4] nickel bis(phosphinate); [5] nickel phosphinate; [6] phosphoric acid, calcium nickel salt; [7] diphosphoric acid, nickel(II) salt[8] |
238-278-2 [1] 242-522-3 [2] 233-844-5 [3] 238-426-6 [4] 238-511-8 [5] 252-840-4 [6] -[7] -[8] |
14332-34-4 [1] 18718-11-1 [2] 10381-36-9 [3] 14448-18-1 [4] 14507-36-9 [5] 36026-88-7 [6] 17169-61-8 [7] 19372-20-4 [8] |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
028-033-00-6 |
diammonium nickel hexacyanoferrate |
— |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
|
028-034-00-1 |
nickel dicyanide |
209-160-8 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
EUH032 |
|
|
|
|
028-035-00-7 |
nickel chromate |
238-766-5 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
|
028-036-00-2 |
nickel(II) silicate; [1] dinickel orthosilicate; [2] nickel silicate (3:4); [3] silicic acid, nickel salt; [4] trihydrogen hydroxybis[orthosilicato(4-)]trinickelate(3-) [5] |
244-578-4 [1] 237-411-1 [2] 250-788-7 [3] 253-461-7 [4] 235-688-3 [5] |
21784-78-1 [1] 13775-54-7 [2] 31748-25-1 [3] 37321-15-6 [4] 12519-85-6 [5] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
028-037-00-8 |
dinickel hexacyanoferrate |
238-946-3 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-038-00-3 |
trinickel bis(arsenate); nickel(II) arsenate |
236-771-7 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H372** H317 H410 |
|
|
|
|
|
028-039-00-9 |
nickel oxalate; [1] oxalic acid, nickel salt [2] |
208-933-7 [1] 243-867-2 [2] |
547-67-1 [1] 20543-06-0 [2] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
028-040-00-4 |
nickel telluride |
235-260-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-041-00-X |
trinickel tetrasulfide |
— |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-042-00-5 |
trinickel bis(arsenite) |
— |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-043-00-0 |
cobalt nickel gray periclase; C.I. Pigment Black 25; C.I. 77332; [1] cobalt nickel dioxide; [2] cobalt nickel oxide [3] |
269-051-6 [1] 261-346-8 [2] -[3] |
68186-89-0 [1] 58591-45-0 [2] 12737-30-3 [3] |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
028-044-00-6 |
nickel tin trioxide; nickel stannate |
234-824-9 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
|
028-045-00-1 |
nickel triuranium decaoxide |
239-876-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
|
028-046-00-7 |
nickel dithiocyanate |
237-205-1 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
EUH032 |
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥0,01 % M=1 |
|
|
|
028-047-00-2 |
nickel dichromate |
239-646-5 |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372:C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317:C≥0,01 % M=1 |
|
|
|
028-048-00-8 |
nickel(II) selenite |
233-263-7 |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
|
028-049-00-3 |
nickel selenide |
215-216-2 |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
|
028-050-00-9 |
silicic acid, lead nickel salt |
— |
Carc. 1A Repr. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H360Df H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H360Df H372** H317 H410 |
|
|
|
|
|
028-051-00-4 |
nickel diarsenide; [1] nickel arsenide [2] |
235-103-1 [1] 248-169-1 [2] |
12068-61-0 [1] 27016-75-7 [2] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
028-052-00-X |
nickel barium titanium primrose priderite; C.I. Pigment Yellow 157; C.I. 77900 |
271-853-6 |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
|
028-053-00-5 |
nickel dichlorate; [1] nickel dibromate; [2] ethyl hydrogen sulfate, nickel(II) salt [3] |
267-897-0 [1] 238-596-1 [2] 275-897-7 [3] |
67952-43-6 [1] 14550-87-9 [2] 71720-48-4 [3] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < % Skin Sens. 1; H317:C≥0,01 %1 M=1 |
|
|
028-054-00-0 |
nickel(II) trifluoroacetate; [1] nickel(II) propionate; [2] nickel bis(benzenesulfonate); [3] nickel(II) hydrogen citrate; [4] citric acid, ammonium nickel salt; [5] citric acid, nickel salt; [6] nickel bis(2-ethylhexanoate); [7] 2-ethylhexanoic acid, nickel salt; [8] dimethylhexanoic acid nickelsalt; [9] nickel(II) isooctanoate; [10] nickel isooctanoate; [11] nickel bis(isononanoate); [12] nickel(II) neononanoate; [13] nickel(II) isodecanoate; [14] nickel(II) neodecanoate; [15] neodecanoic acid, nickel salt;[16] nickel(II) neoundecanoate; [17] bis(d-gluconato-O 1,O 2)nickel; [18] nickel 3,5-bis(tert-butyl)-4-hydroxybenzoate (1:2); [19] nickel(II) palmitate; [20] (2-ethylhexanoato-O)(isononanoato-O)nickel; [21] (isononanoato-O)(isooctanoato-O)nickel; [22] (isooctanoato-O)(neodecanoato-O)nickel; [23] (2-ethylhexanoato-O)(isodecanoato-O)nickel; [24] 2-ethylhexanoato-O)(neodecanoato-O)nickel; [25] (isodecanoato-O)(isooctanoato-O)nickel; [26] (isodecanoato-O)(isononanoato-O)nickel; [27] (isononanoato-O)(neodecanoato-O)nickel; [28] fatty acids, C6-19-branched, nickel salts; [29] fatty acids, C 8-18 and C18-unsaturated, nickel salts; [30] 2,7-naphthalenedisulfonic acid, nickel(II) salt; [31] |
240-235-8 [1] 222-102-6 [2] 254-642-3 [3] 242-533-3 [4] 242-161-1 [5] 245-119-0 [6] 224-699-9 [7] 231-480-1 [8] 301-323-2 [9] 249-555-2 [10] 248-585-3 [11] 284-349-6 [12] 300-094-6 [13] 287-468-1 [14] 287-469-7 [15] 257-447-1 [16] 300-093-0 [17] 276-205-6 [18] 258-051-1 [19] 294-302-1 [29] 283-972-0 [30] -[31] 237-138-8 [20] 287-470-2 [21] 287-471-8 [22] 284-347-5 [23] 284-351-7 [24] 285-698-7 [25] 285-909-2 [26] 284-348-0 [27] 287-592-6 [28] |
16083-14-0 [1] 3349-08-4 [2] 39819-65-3 [3] 18721-51-2 [4] 18283-82-4 [5] 22605-92-1 [6] 4454-16-4 [7] 7580-31-6 [8] 93983-68-7 [9] 29317-63-3 [10] 27637-46-3 [11] 84852-37-9 [12] 93920-10-6 [13] 85508-43-6 [14] 85508-44-7 [15] 51818-56-5 [16] 93920-09-3 [17] 71957-07-8 [18] 52625-25-9 [19] 13654-40-5 [20] 85508-45-8 [21] 85508-46-9 [22] 84852-35-7 [23] 84852-39-1 [24] [25] 85166-19-4 [26] 84852-36-8 [27] 85551-28-6 [28] 91697-41-5 [29] 84776-45-4 [30] 72319-19-8 [31] |
Carc. 1A Muta. 2 Repr. 1B STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H341 H360D*** H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H341 H360D*** H372** H334 H317 H410 |
|
STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,1 % ≤ C < 1 % Skin Sens. 1; H317: C ≥ 0,01 % M=1 |
|
|
028-055-00-6 |
nickel(II) sulfite; [1] nickel tellurium trioxide; [2] nickel tellurium tetraoxide; [3] molybdenum nickel hydroxide oxide phosphate [4] |
231-827-7 [1] 239-967-0 [2] 239-974-9 [3] 268-585-7 [4] |
7757-95-1 [1] 15851-52-2 [2] 15852-21-8 [3] 68130-36-9 [4] |
Carc. 1A STOT RE 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H334 H317 H400 H410 |
GHS08 GHS09 Dgr |
H350i H372** H334 H317 H410 |
|
|
|
|
028-056-00-1 |
nickel boride (NiB); [1] dinickel boride; [2] trinickel boride; [3] nickel boride; [4] dinickel silicide; [5] nickel disilicide; [6] dinickel phosphide; [7] nickel boron phosphide [8] |
234-493-0 [1] 234-494-6 [2] 234-495-1 [3] 235-723-2 [4] 235-033-1 [5] 235-379-3 [6] 234-828-0 [7] -[8] |
12007-00-0 [1] 12007-01-1 [2] 12007-02-2 [3] 12619-90-8 [4] 12059-14-2 [5] 12201-89-7 [6] 12035-64-2 [7] 65229-23-4 [8] |
Carc. 1A STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H372** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350i H372** H317 H410 |
|
|
|
|
028-057-00-7 |
dialuminium nickel tetraoxide; [1] nickel titanium trioxide; [2] nickel titanium oxide; [3] nickel divanadium hexaoxide; [4] cobalt dimolybdenum nickel octaoxide; [5] nickel zirkonium trioxide; [6] molybdenum nickel tetraoxide; [7] nickel tungsten tetraoxide; [8] olivine, nickel green; [9] lithium nickel dioxide; [10] molybdenum nickel oxide; [11] |
234-454-8 [1] 234-825-4 [2] 235-752-0 [3] 257-970-5 [4] 268-169-5 [5] 274-755-1 [6] 238-034-5 [7] 238-032-4 [8] 271-112-7 [9] -[10] -[11] |
12004-35-2 [1] 12035-39-1 [2] 12653-76-8 [3] 52502-12-2 [4] 68016-03-5 [5] 70692-93-2 [6] 14177-55-0 [7] 14177-51-6 [8] 68515-84-4 [9] 12031-65-1 [10] 12673-58-4 [11] |
Carc. 1A STOT RE 1 Skin Sens. 1 |
H350i H372** H317 |
GHS08 GHS07 Dgr |
H350i H372** H317 |
|
|
|
|
028-058-00-2 |
cobalt lithium nickel oxide |
442-750-5 |
— |
Carc. 1A Acute Tox. 2 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350i H330 H372** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H372** H317 H410 |
|
|
|
|
029-001-00-4 |
copper chloride; copper (I) chloride; cuprous chloride |
231-842-9 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
|
029-002-00-X |
dicopper oxide; copper (I) oxide |
215-270-7 |
Acute Tox. 4 Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H332 H302 H318 H410 |
|
inhalation: ATE = 3,34 mg/l (dusts or mists) oral: ATE = 500 mg/kg bw M = 100 M = 10 |
|
|
|
029-003-00-5 |
naphthenic acids, copper salts; copper naphthenate |
215-657-0 |
Flam. Liq. 3 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H400 H410 |
GHS02 GHS07 GHS09 Wng |
H226 H302 H410 |
|
|
|
|
|
029-004-00-0 |
copper sulphate |
231-847-6 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
|
029-005-00-6 |
(tris(chloromethyl)phthalocyaninato)copper(II), reaction products with N-methylpiperazine and methoxyacetic acid |
401-260-1 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
029-006-00-1 |
tris(octadec-9-enylammonium) (trisulfonatophthalocyaninato)copper(II) |
403-210-4 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
029-007-00-7 |
(trisodium (2-((3-(6-(2-chloro-5-sulfonato)anilino)-4-(3-carboxypyridinio)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)phenylmethylazo)-4-sulfonatobenzoato)copper(3-)) hydroxide |
404-670-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
G |
|
|
029-008-00-2 |
copper(II) methanesulfonate |
405-400-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
|
029-009-00-8 |
phthalocyanine-N-[3-(diethylamino)propyl]sulfonamide copper complex |
413-650-9 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
029-010-00-3 |
reaction mass of compounds from (dodecakis(p-tolylthio)phthalocyaninato)copper(II)to (hexadecakis(p-tolylthio)phthalocyaninato)copper(II) |
407-700-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
029-011-00-9 |
sodium [29H,31H-phthalocyaninato-(2-)-N29,N30,N31,N32]-((3-(N-methyl-N-(2-hydroxyethyl)amino)propyl)amino)sulfonyl-sulfonato, copper complex |
412-730-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
029-012-00-4 |
sodium ((N-(3-trimethylammoniopropyl)sulfamoyl)methylsulfonatophthalocyaninato)copper(II) |
407-340-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
029-013-00-X |
trisodium(2-(α-(3-(4-chloro-6-(2-(2-(vinylsulfonyl)ethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-oxido-5-sulfonatophenylazo)benzylidenehydrazino)-4-sulfonatobenzoato)copper(II) |
407-580-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
029-014-00-5 |
reaction mass of: 2,2'-[[cis-1,2-cyclohexanediylbis(nitrilomethylidene)]bis[phenolate]](2-)N, N',O, O'-copper complex;2,2'-[[trans-1,2-cyclohexanediylbis(nitrilomethylidyne)]bis[phenolate]](2-)N, N',O, O'-copper complex |
419-610-7 |
STOT RE 2 * Aquatic Chronic 2 |
H373** H411 |
GHS08 GHS09 Wng |
H373** H411 |
|
|
|
|
|
029-015-00-0 |
copper thiocyanate |
214-183-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
EUH032 |
M = 10 M = 10 |
|
|
|
029-016-00-6 |
copper(II) oxide |
215-269-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 M = 10 |
|
|
|
029-017-00-1 |
dicopper chloride trihydroxide |
215-572-9 |
Acute Tox. 4 Acute Tox. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H301 H400 H410 |
GHS06 GHS09 Dgr |
H332 H301 H410 |
|
inhalation: ATE = 2,83 mg/l (dusts or mists) oral: ATE = 299 mg/kg bw M = 10 M = 10 |
|
|
|
029-018-00-7 |
tetracopper hexahydroxide sulphate; [1] tetracopper hexahydroxide sulphate hydrate [2] |
215-582-3 [1] 215-582-3 [2] |
1333-22-8 [1] 12527-76-3 [2] |
Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
oral: ATE = 500 mg/kg bw M = 10 M = 10 |
|
|
029-019-01-X |
copper flakes (coated with aliphatic acid) |
— |
— |
Acute Tox. 3 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H302 H319 H400 H410 |
GHS06 GHS09 Dgr |
H331 H302 H319 H410 |
|
inhalation: ATE = 0,733 mg/l (dusts or mists) oral: ATE = 500 mg/kg bw M = 10 M = 10 |
|
|
029-020-00-8 |
copper(II) carbonate—copper(II) hydroxide (1:1) |
235-113-6 |
Acute Tox. 4 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H319 H410 |
|
inhalation: ATE = 1,2 mg/l (dusts or mists) oral: ATE = 500 mg/kg bw M = 10 M = 10 |
|
|
|
029-021-00-3 |
copper dihydroxide; copper(II) hydroxide |
243-815-9 |
Acute Tox. 2 Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H302 H318 H410 |
|
inhalation: ATE = 0,47 mg/l (dusts or mists) oral: ATE = 500 mg/kg bw M = 10 M = 10 |
|
|
|
029-022-00-9 |
bordeaux mixture; reaction products of copper sulphate with calcium dihydroxide |
— |
Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H332 H318 H410 |
|
inhalation: ATE = 1,97 mg/l (dusts or mists) M = 10 M = 1 |
|
|
|
029-023-00-4 |
copper sulphate pentahydrate |
231-847-6 |
Acute Tox. 4 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS07 GHS05 GHS09 Dgr |
H302 H318 H410 |
|
oral: ATE = 481 mg/kg bw M = 10 M = 1 |
|
|
|
029-024-00-X |
granulated copper; [particle length: from 0,9 mm to 6,0 mm; particle width: from 0,494 to 0,949 mm] |
231-159-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
029-025-00-5 |
bis(N-hydroxy-N-nitrosocyclohexylaminato-O,O’)copper; bis(N-cyclohexyl-diazenium-dioxy)-copper; [Cu-HDO] |
239-703-4 |
Flam. Sol. 1 Acute Tox. 4 STOT RE 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H373 (liver) H318 H400 H410 |
GHS02 GHS07 GHS08 GHS05 GHS09 Dgr |
H228 H302 H373(liver) H318 H410 |
|
oral: ATE = 360 mg/kg bw M = 1 M = 1 |
|
|
|
030-001-00-1 |
zinc powder — zinc dust (pyrophoric) |
231-175-3 |
Water-react. 1 Pyr. Sol. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H260 H250 H400 H410 |
GHS02 GHS09 Dgr |
H260 H250 H410 |
|
|
T |
|
|
030-001-01-9 |
zinc powder — zinc dust (stabilised) |
231-175-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
030-003-00-2 |
zinc chloride |
231-592-0 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
030-004-00-8 |
dimethylzinc; [1] diethylzinc [2] |
208-884-1 [1] 209-161-3 [2] |
544-97-8 [1] 557-20-0 [2] |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H260 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H260 H314 H410 |
EUH014 |
|
|
|
030-005-00-3 |
diamminediisocyanatozinc |
401-610-3 |
— |
Acute Tox. 4 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 |
H302 H318 H334 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H318 H334 H317 H400 |
|
|
|
|
030-006-00-9 |
zinc sulphate (hydrous) (mono-, hexa-and hepta hydrate); [1] zinc sulphate (anhydrous) [2] |
231-793-3 [1] 231-793-3 [2] |
7446-19-7 [1] 7733-02-0 [2] |
Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H410 |
|
|
|
|
030-007-00-4 |
bis(3,5-di-tert-butylsalicylato-O 1,O 2)zinc |
403-360-0 |
Flam. Sol. 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H228 H302 H410 |
|
|
T |
|
|
030-008-00-X |
hydroxo(2-(benzenesulfonamido)benzoato)zinc(II) |
403-750-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
|
030-009-00-5 |
zinc-bis(4-(n-octyloxycarbonylamino)salicylate) dihydrate |
417-130-2 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
030-010-00-0 |
2-dodec-1-enylbutanedioic acid,4-methyl ester zinc salt |
430-740-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
030-011-00-6 |
trizinc bis(orthophosphate) |
231-944-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
030-012-00-1 |
aluminium-magnesium-zinc-carbonate-hydroxide |
423-570-6 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
|
030-013-00-7 |
zinc oxide |
215-222-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
030-015-00-8 |
tetrazinc(2+)bis(hexacyanocobalt(3+))diacetate |
440-060-9 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
031-001-00-4 |
gallium arsenide |
215-114-8 |
Repr. 1B Carc. 1B STOT RE 1 |
H360F H350 H372 (respiratory and haematopoietic systems) |
GHS08 Dgr |
H360F H350 H372 (respiratory and haematopoietic systems) |
|
|
|
|
|
033-001-00-X |
arsenic |
231-148-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
|
|
|
|
033-002-00-5 |
arsenic compounds, with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
* |
A1 |
|
033-003-00-0 |
diarsenic trioxide; arsenic trioxide |
215-481-4 |
Carc. 1A Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H300 H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H300 H314 H410 |
|
|
|
|
|
033-004-00-6 |
diarsenic pentaoxide; arsenic pentoxide; arsenic oxide |
215-116-9 |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
|
|
|
033-005-00-1 |
arsenic acid and it salts with the exception of those specified elsewhere in this Annex |
— |
— |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
A |
|
033-006-00-7 |
arsine |
232-066-3 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H330 H373 ** H400 H410 |
GHS02 GHS04 GHS06 GHS08 GHS09 Dgr |
H220 H330 H373 ** H410 |
|
|
U |
|
|
033-007-00-2 |
tert-butylarsine |
423-320-6 |
Pyr. Liq. 1 Acute Tox. 2 * |
H250 H330 |
GHS02 GHS06 Dgr |
H250 H330 |
|
|
|
|
|
034-001-00-2 |
selenium |
231-957-4 |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 4 |
H331 H301 H373 ** H413 |
GHS06 GHS08 Dgr |
H331 H301 H373 ** H413 |
|
|
|
|
|
034-002-00-8 |
selenium compounds with the exception of cadmium sulphoselenide and those specified elsewhere in this Annex |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H373** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H373** H410 |
|
|
A |
|
034-003-00-3 |
sodium selenite |
233-267-9 |
Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Chronic 2 |
H300 H331 H317 H411 |
GHS06 GHS09 Dgr |
H300 H331 H317 H411 |
EUH031 |
|
|
|
|
035-001-00-5 |
bromine |
231-778-1 |
Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H330 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H314 H400 |
|
|
|
|
|
035-002-00-0 |
hydrogen bromide |
233-113-0 |
Press. Gas Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS04 GHS05 GHS07 Dgr |
H314 H335 |
|
|
U |
|
|
035-002-01-8 |
hydrobromic acid … % |
— |
— |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
Skin Corr. 1B; H314: C ≥ 40 % Skin Irrit. 2; H315: 10 % ≤ C < 40 % Eye Irrit. 2; H319: 10 % ≤ C < 40 % STOT SE 3; H335: C ≥ 10 % |
B |
|
035-003-00-6 |
potassium bromate |
231-829-8 |
Ox. Sol. 1 Carc. 1B Acute Tox. 3 * |
H271 H350 H301 |
GHS03 GHS06 GHS08 Dgr |
H271 H350 H301 |
|
|
|
|
|
035-004-00-1 |
2-hydroxyethylammonium perbromide |
407-440-6 |
— |
Ox. Sol. 2 **** Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 |
H272 H302 H314 H317 H400 |
GHS03 GHS05 GHS07 GHS09 Dgr |
H272 H302 H314 H317 H400 |
|
|
|
|
035-005-00-7 |
ammonium bromide |
235-183-8 |
Repr. 1B Lact. STOT SE 3 STOT RE 1 Eye Irrit. 2 |
H360FD H362 H336 H372 (nervous system) H319 |
GHS08 GHS07 Dgr |
H360FD H362 H336 H372 (nervous system) H319 |
|
|
|
|
|
040-001-00-3 |
zirconium powder (pyrophoric) |
231-176-9 |
Water-react. 1 Pyr. Sol. 1 |
H260 H250 |
GHS02 Dgr |
H260 H250 |
|
|
T |
|
|
040-002-00-9 |
zirconium powder, dry (non pyrophoric) |
— |
— |
Self-heat. 1 |
H251 |
GHS02 Dgr |
H251 |
|
|
T |
|
040-003-00-4 |
reaction product of 3,5-di-tert-butylsalicylic acid and zirconium oxychloride, dehydrated, basic Zr: DTBS= 1.0:1.0 to 1.0: 1.5 |
430-610-6 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
042-001-00-9 |
molybdenum trioxide |
215-204-7 |
Carc. 2 Eye Irrit. 2 STOT SE 3 |
H351 H319 H335 |
GHS08 GHS07 Wng |
H351 H319 H335 |
|
|
|
|
|
042-002-00-4 |
tetrakis(dimethylditetradecylammonium) hexa-μ-oxotetra-μ3-oxodi-μ5-oxotetradecaoxooctamolybdate(4-) |
404-760-8 |
Acute Tox. 3 * Eye Dam. 1 |
H331 H318 |
GHS06 GHS05 Dgr |
H331 H318 |
|
|
|
|
|
042-003-00-X |
tetrakis(trimethylhexadecylammonium) hexa-mu-oxotetra-mu3-oxodi-mu5-oxotetradecaoxooctamolybdate(4-) |
404-860-1 |
Flam. Sol. 1 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H228 H318 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H228 H318 H410 |
|
|
T |
|
|
042-004-00-5 |
reaction product of ammonium molybdate and C12-C24-diethoxylated alkylamine (1:5-1:3) |
412-780-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
042-005-00-0 |
reaction mass of: mono-and di-glycerols of canola oil; canola oil acid amide of branched 1,3-propanediamine, N-[3-(tridecyloxy)-propyl]; N, N-diorgano dithiocarbamate molybdenum complex |
434-240-6 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
046-001-00-X |
tetraammine palladium (II)hydrogen carbonate |
425-270-0 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373** H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373** H318 H317 H410 |
|
|
|
|
|
047-001-00-2 |
silver nitrate |
231-853-9 |
Ox. Sol. 2 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H272 H314 H400 H410 |
GHS03 GHS05 GHS09 Dgr |
H272 H314 H410 |
|
|
|
|
|
047-002-00-8 |
polyphosphoric acid, copper, sodium, magnesium, calcium, silver and zinc salt |
416-850-4 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
047-003-00-3 |
silver zinc zeolite (Zeolite, LTA framework type, surface-modified with silver and zinc ions) [This entry covers LTA (Linde Type A) framework type zeolite which has been surface-modified with both silver and zinc ions at contents Ag+ 0,5 %-6 %, Zn2 + 5 %-16 %, and potentially with phosphorus, NH4+, Mg2+ and/or Ca2+ each at level < 3 %] |
— |
Repr. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H361d H315 H318 H410 |
|
M = 100 M = 100 |
|
|
|
048-001-00-5 |
cadmium compounds, with the exception of cadmium sulphoselenide (xCdS.yCdSe), reaction mass of cadmium sulphide with zinc sulphide (xCdS.yZnS), reaction mass of cadmium sulphide with mercury sulphide (xCdS.yHgS), and those specified elsewhere in this Annex |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
A1 |
|
048-002-00-0 |
cadmium (non-pyrophoric); [1] cadmium oxide (non-pyrophoric) [2] |
231-152-8 [1] 215-146-2 [2] |
7440-43-9 [1] 1306-19-0 [2] |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H361fd H330 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H341 H361fd H330 H372 ** H410 |
|
|
|
|
048-003-00-6 |
cadmium diformate; cadmiumformate |
224-729-0 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥0,25 % |
|
|
|
048-004-00-1 |
cadmium cyanide |
208-829-1 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H351 H373 ** H410 |
EUH032 |
STOT RE 2; H373: C ≥0,1 % EUH032:C≥1 % |
|
|
|
048-005-00-7 |
cadmiumhexafluorosilicate(2-); cadmium fluorosilica |
241-084-0 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥0,1 % |
|
|
|
048-006-00-2 |
cadmium fluoride |
232-222-0 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2: 0,1 % ≤ C <7 % |
|
|
|
048-007-00-8 |
cadmium iodide |
232-223-6 |
Acute Tox. 3 * Acute Tox. 3 * Carc. 2 STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H351 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H331 H301 H351 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,1 % |
|
|
|
048-008-00-3 |
cadmium chloride |
233-296-7 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373: 0,1 % ≤ C < 7 % |
|
|
|
048-009-00-9 |
cadmium sulphate |
233-331-6 |
Carc. 1B Muta. 1B Repr. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H330 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H340 H360FD H330 H301 H372 ** H410 |
|
Carc. 1B; H350: C ≥ 0,01 % * oral STOT RE 1; H372: C ≥ 7 % STOT RE 2; H373 0,1 % ≤ C < 7 % |
|
|
|
048-010-00-4 |
cadmium sulphide |
215-147-8 |
Carc. 1B Muta. 2 Repr. 2 STOT RE 1 Acute Tox. 4 * Aquatic Chronic 4 |
H350 H341 H361fd H372 ** H302 H413 |
GHS08 GHS07 Dgr |
H350 H341 H361fd H372 ** H302 H413 |
|
* STOT RE 1; H372: C ≥ 10 % STOT RE 2; H373: 0,1 % ≤ C < 10 % |
1 |
|
|
048-011-00-X |
cadmium (pyrophoric) |
231-152-8 |
Pyr. Sol. 1 Carc. 1B Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H250 H350 H341 H361fd H330 H372 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H250 H350 H341 H361fd H330 H372 ** H410 |
|
|
|
|
|
048-012-00-5 |
cadmium carbonate |
208-168-9 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (kidney, bone) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H332 H312 H302 H372 (kidney, bone) H410 |
|
|
A1 |
|
|
048-013-00-0 |
cadmium hydroxide; cadmium dihydroxide |
244-168-5 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (kidney, bone) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H332 H312 H302 H372 (kidney, bone) H410 |
|
|
A1 |
|
|
048-014-00-6 |
cadmium nitrate; cadmium dinitrate |
233-710-6 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H332 H312 H302 H372 (kidney, bone) H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H332 H312 H302 H372 (kidney, bone) H410 |
|
Carc. 1B; H350: C ≥ 0,01 % |
A1 |
|
|
050-001-00-5 |
tin tetrachloride; stannic chloride |
231-588-9 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
STOT SE 3; H335:C≥5 % |
|
|
|
050-002-00-0 |
cyhexatin (ISO); hydroxytricyclohexylstannane; tri(cyclohexyl)tin hydroxide |
236-049-1 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M=1000 |
|
|
|
050-003-00-6 |
fentin acetate (ISO); triphenyltin acetate |
212-984-0 |
Carc. 2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d*** H330 H311 H301 H372** H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H361d*** H330 H311 H301 H372** H335 H315 H318 H410 |
|
M=10 |
|
|
|
050-004-00-1 |
fentin hydroxide (ISO); triphenyltin hydroxide |
200-990-6 |
Carc. 2 Repr. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d*** H330 H311 H301 H372** H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H351 H361d*** H330 H311 H301 H372** H335 H315 H318 H410 |
|
M=10 |
|
|
|
050-005-00-7 |
trimethyltin compounds, with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
* |
A1 |
|
050-006-00-2 |
triethyltin compounds, with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
* |
A1 |
|
050-007-00-8 |
tripropyltin compounds, with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
* |
A1 |
|
050-008-00-3 |
tributyltin compounds, with the exception of those specified elsewhere in this annex |
— |
— |
Repr. 1B Acute Tox. 3 Acute Tox. 4* STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H301 H312 H372** H315 H319 H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360FD H301 H312 H372** H315 H319 H410 |
|
* STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,25 % ≤ C < 1 % Skin Irrit. 2; H315:C ≥ 1 % Eye Irrit. 2; H319:C ≥ 1 % M = 10 |
A 1 |
|
050-009-00-9 |
fluorotripentylstannane;[1] hexapentyldistannoxane [2] |
243-546-7 [1] 247-143-7 [2] |
20153-49-5 [1] 25637-27-8 [2] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
1 |
|
050-010-00-4 |
fluorotrihexylstannane |
243-547-2 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
1 |
|
|
050-011-00-X |
triphenyltin compounds, with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
* M=100 |
A1 |
|
050-012-00-5 |
tetracyclohexylstannane; [1] chlorotricyclohexylstannane; [2] butyltricyclohexylstannane [3] |
215-910-5 [1] 221-437-5 [2] 230-358-5 [3] |
1449-55-4 [1] 3091-32-5 [2] 7067-44-9 [3] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
* |
A1 |
|
050-013-00-0 |
trioctyltin compounds, with the exception of those specified elsewhere in this Annex |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 4 |
H319 H335 H315 H413 |
GHS07 Wng |
H319 H335 H315 H413 |
|
Skin Irrit. 2; H315: C ≥ 1 % Eye Irrit.2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
A1 |
|
050-017-00-2 |
fenbutatin oxide (ISO); bis(tris(2-methyl-2-phenylpropyl)tin)oxide |
236-407-7 |
Acute Tox. 2 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H319 H315 H400 H410 |
GHS06 GHS09 Dgr |
H330 H319 H315 H410 |
|
|
|
|
|
050-018-00-8 |
tin(II) methanesulphonate |
401-640-7 |
Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H314 H302 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H317 H411 |
|
|
|
|
|
050-019-00-3 |
azocyclotin (ISO); 1-(tricyclohexylstannyl)-1H-1,2,4-triazole |
255-209-1 |
Acute Tox. 2 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H335 H315 H318 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H301 H335 H315 H318 H410 |
|
|
|
|
|
050-020-00-9 |
trioctylstannane |
413-320-4 |
STOT RE 1 Skin Irrit. 2 Aquatic Chronic 4 |
H372 ** H315 H413 |
GHS08 GHS07 Dgr |
H372 ** H315 H413 |
|
|
|
|
|
050-021-00-4 |
dichlorodioctylstannane |
222-583-2 |
Repr. 1B Acute Tox. 2 STOT RE 1 Aquatic Chronic 3 |
H360D H330 H372 ** H412 |
GHS08 GHS06 Dgr |
H360D H330 H372 ** H412 |
|
Repr. 1B; H360 D: C ≥ 0,03 % inhalation: ATE = 0,098 mg/L (dusts or mists) |
|
|
|
050-022-00-X |
dibutyltin dichloride; (DBTC) |
211-670-0 |
Muta. 2 Repr. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H341 H360FD H330 H301 H312 H372** H314 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H341 H360FD H330 H301 H312 H372** H314 H410 |
|
Skin Corr. 1B; H314: C ≥ 5 % Skin Irrit. 2; H315: 0,01 % ≤ C < 5 % Eye Dam.1; H318: 3 % ≤ C < 5 % Eye Irrit. 2; H319: 0,01 % ≤ C < 3 % M=10 |
|
|
|
050-023-00-5 |
reaction mass of: bis[(2-ethyl-1-oxohexyl)oxy]dioctyl stannane; bis[((2-ethyl-1-oxohexyl)oxy)dioctylstannyl]oxide; bis(1-phenyl-1,3-decanedionyl)dioctyl stannane; ((2-ethyl-1-oxohexyl)oxy)-(1-phenyl-1,3-decanedionyl)dioctyl stannane |
422-920-5 |
— |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373** H400 H410 |
GHS08 GHS09 Wng |
H373** H410 |
|
M=10 |
|
|
050-024-00-0 |
reaction mass of: tri-p-tolyltin hydroxide; hexa-p-tolyl-distannoxane |
432-230-6 |
— |
STOT RE 1 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H372** H302 H315 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H372** H302 H315 H318 H317 H410 |
|
|
|
|
050-025-00-6 |
trichloromethylstannane |
213-608-8 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
|
050-026-00-1 |
2-ethylhexyl 10-ethyl-4-[[2-[(2-ethylhexyl)oxy]-2-oxoethyl]thio]-4-methyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate |
260-828-5 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
|
050-027-00-7 |
2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate; [DOTE] |
239-622-4 |
Repr. 1B STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H372 (immune system) H400 H410 |
GHS08 GHS09 Dgr |
H360D H372 (immune system) H410 |
|
|
|
|
|
050-028-00-2 |
2-ethylhexyl 10-ethyl-4,4-dimethyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate |
260-829-0 |
Repr. 2 Acute Tox. 4 STOT RE 1 Skin Sens. 1A |
H361d H302 H372 (nervous system, immune system) H317 |
GHS08 GHS07 Dgr |
H361d H302 H372 (nervous system, immune system) H317 |
|
|
|
|
|
050-029-00-8 |
dimethyltin dichloride |
212-039-2 |
Repr. 2 Acute Tox. 2 Acute Tox. 3 Acute Tox. 3 STOT RE 1 Skin Corr. 1B |
H361d H330 H301 H311 H372 (nervous system, immune system) H314 |
GHS08 GHS06 GHS05 Dgr |
H361d H330 H301 H311 H372 (nervous system, immune system) H314 |
EUH071 |
|
|
|
|
050-030-00-3 |
dibutyltin dilaurate; dibutyl[bis(dodecanoyloxy)]stannane |
201-039-8 |
Muta. 2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (immune system) |
GHS08 Dgr |
H341 H360FD H372 (immune system) |
|
|
|
|
|
050-031-00-9 |
dioctyltin dilaurate; [1] stannane, dioctyl-, bis(coco acyloxy) derivs. [2] |
222-883-3 [1] 293-901-5 [2] |
3648-18-8 [1] 91648-39-4 [2] |
Repr. 1B STOT RE 1 |
H360D H372 (immune system) |
GHS08 Dgr |
H360D H372 (immune system) |
|
|
|
|
050-032-00-4 |
dibutyltin bis(2-ethylhexanoate) |
220-481-2 |
Muta. 2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (immune system) |
GHS08 Dgr |
H341 H360FD H372 (immune system) |
|
|
|
|
|
050-033-00-X |
dibutyltin di(acetate) |
213-928-8 |
Muta 2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (immune system) |
GHS08 Dgr |
H341 H360FD H372 (immune system) |
|
|
|
|
|
050-034-00-5 |
dibutyltin maleate |
201-077-5 |
Muta. 2 Repr. 1B Acute Tox. 2 Acute Tox. 4 STOT RE 1 Skin Corr. 1 Eye Dam. 1 |
H341 H360FD H330 H302 H372 (immune system) H314 H318 |
GHS08 GHS06 GHS05 Dgr |
H341 H360FD H330 H302 H372 (immune system) H314 |
|
inhalation: ATE = 0,317 mg/L (dusts or mists) oral: ATE = 510 mg/kg bw |
|
|
|
050-035-00-0 |
dibutyltin oxide |
212-449-1 |
Muta. 2 Repr. 1B Acute Tox. 3 STOT RE 1 Skin Irrit. 2 Eye Dam. 1 |
H341 H360FD H301 H372 (immune system) H315 H318 |
GHS08 GHS06 GHS05 Dgr |
H341 H360FD H301 H372 (immune system) H315 H318 |
|
oral: ATE = 170 mg/kg bw |
|
|
|
051-001-00-8 |
antimony trichloride |
233-047-2 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
STOT SE3; H335: C ≥ 5 % |
|
|
|
051-002-00-3 |
antimony pentachloride |
231-601-8 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
051-003-00-9 |
antimony compounds, with the exception of the tetroxide (Sb2O4), pentoxide (Sb2O5), trisulphide (Sb2S3), pentasulphide (Sb2S5) and those specified elsewhere in this Annex |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H302 H411 |
GHS07 GHS09 Wng |
H332 H302 H411 |
|
* |
A1 |
|
051-004-00-4 |
antimony trifluoride |
232-009-2 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H331 H311 H301 H411 |
GHS06 GHS09 Dgr |
H331 H311 H301 H411 |
|
|
|
|
|
051-005-00-X |
antimony trioxide |
215-175-0 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
051-006-00-5 |
diphenyl(4-phenylthiophenyl)sulfonium hexafluoroantimonate |
403-500-0 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
051-007-00-0 |
bis(4-dodecylphenyl)iodonium hexafluoroantimonate |
404-420-9 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
052-001-00-0 |
tellurium |
236-813-4 |
Repr. 1B Lact. |
H360Df H362 |
GHS08 Dgr |
H360Df H362 |
|
|
|
|
|
052-002-00-6 |
tellurium dioxide |
231-193-1 |
Repr. 1B Lact. |
H360Df H362 |
GHS08 Dgr |
H360Df H362 |
|
|
|
|
|
053-001-00-3 |
iodine |
231-442-4 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H312 H400 |
GHS07 GHS09 Wng |
H332 H312 H400 |
|
|
|
|
|
053-002-00-9 |
hydrogen iodide |
233-109-9 |
Press. Gas Skin Corr. 1A |
H314 |
GHS04 GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 10 % Skin Corr. 1B; H314: 0,2 % ≤ C < 10 % Skin Irrit. 2; H315: 0,02 % ≤ C < 0,2 % Eye Irrit. 2; H319: 0,02 % ≤ C < 0,2 % STOT SE 3; H335: C ≥0,02 % |
U5 |
|
|
053-002-01-6 |
hydriodic acid … % |
— |
— |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
|
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
053-003-00-4 |
iodoxybenzene |
— |
Expl. **** |
**** |
**** |
**** |
|
|
|
|
|
053-004-00-X |
calcium iodoxybenzoate |
— |
— |
Expl. **** |
**** |
**** |
**** |
|
|
C |
|
053-005-00-5 |
(4-(1-methylethyl)phenyl)-(4-methylphenyl)iodonium tetrakis(pentafluorophenyl)borate(1-) |
422-960-3 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H312 H302 H373 ** H410 |
|
|
|
|
|
056-001-00-1 |
barium peroxide |
215-128-4 |
Ox. Sol. 2 Acute Tox. 4 * Acute Tox. 4 * |
H272 H332 H302 |
GHS03 GHS07 Dgr |
H272 H332 H302 |
|
|
|
|
|
056-002-00-7 |
barium salts, with the exception of barium sulphate, salts of 1-azo-2-hydroxynaphthalenyl aryl sulphonic acid, and of salts specified elsewhere in this Annex |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
A1 |
|
056-003-00-2 |
barium carbonate |
208-167-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
056-004-00-8 |
barium chloride |
233-788-1 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H332 |
GHS06 Dgr |
H301 H332 |
|
|
|
|
|
056-005-00-3 |
barium diboron tetraoxide |
237-222-4 |
Repr. 1B Acute Tox. 4 Acute Tox. 3 |
H360FD H332 H301 |
GHS08 GHS06 Dgr |
H360FD H332 H301 |
|
inhalation: ATE = 1,5 mg/L (dusts or mists) oral: ATE = 100 mg/kg bw |
|
|
|
064-001-00-8 |
gadolinium(III)sulfite trihydrate |
456-900-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
072-001-00-4 |
hafnium tetra-n-butoxide |
411-740-2 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
074-001-00-X |
hexasodium tungstate hydrate |
412-770-9 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
074-002-00-5 |
reaction products of tungsten hexachloride with 2-methylpropan-2-ol, nonylphenol and pentane-2,4-dione |
408-250-6 |
— |
Flam. Liq. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H314 H317 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H314 H317 H410 |
|
|
|
|
076-001-00-5 |
osmium tetraoxide; osmic acid |
244-058-7 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1B |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
|
|
|
|
078-001-00-0 |
tetrachloroplatinates with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
A |
|
078-002-00-6 |
diammonium tetrachloroplatinate |
237-499-1 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
|
078-003-00-1 |
disodium tetrachloroplatinate |
233-051-4 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
|
078-004-00-7 |
dipotassium tetrachloroplatinate |
233-050-9 |
Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H315 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H315 H318 H334 H317 |
|
|
|
|
|
078-005-00-2 |
hexachloroplatinates with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
A |
|
078-006-00-8 |
disodium hexachloroplatinate |
240-983-5 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
|
078-007-00-3 |
dipotassium hexachloroplatinate |
240-979-3 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
|
078-008-00-9 |
diammonium hexachloroplatinate |
240-973-0 |
Acute Tox. 3 * Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H301 H318 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H318 H334 H317 |
|
|
|
|
|
078-009-00-4 |
hexachloroplatinic acid |
241-010-7 |
Acute Tox. 3 * Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1 |
H301 H314 H334 H317 |
GHS06 GHS05 GHS08 Dgr |
H301 H314 H334 H317 |
|
|
|
|
|
078-010-00-X |
tetraammine platinum (II) hydrogen carbonate |
426-730-3 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
078-011-00-5 |
hydroxydisulfito platinum(II)acid |
423-310-1 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1A Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H373 H314 H334 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H302 H373 H314 H334 H317 H412 |
|
|
|
|
|
078-012-00-0 |
platinum(IV) nitrate/nitric acid solution |
432-400-1 |
— |
Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
080-001-00-0 |
mercury |
231-106-7 |
Repr. 1B Acute Tox. 2 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D*** H330 H372** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360D*** H330 H372** H410 |
|
|
|
|
|
080-002-00-6 |
Inorganic compounds of mercury with the exception of mercuric sulphide and those specified elsewhere in this Annex |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥ 0,1 % |
A1 |
|
080-003-00-1 |
dimercury dichloride; mercurous chloride; calomel |
233-307-5 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
|
|
|
080-004-00-7 |
organic compounds of mercury with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥0,1 % |
A1 |
|
080-005-00-2 |
mercury difulminate; mercuric fulminate; fulminate of mercury |
211-057-8 |
Unst. Expl. Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H200 H331 H311 H301 H373 ** H400 H410 |
|
|
|
|
|
080-005-01-X |
mercury difulminate; mercuric fulminate; fulminate of mercury [≥ 20 % phlegmatiser] |
211-057-8 |
Expl. 1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H331 H311 H301 H373 ** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373 ** H400 H410 |
|
|
|
|
|
080-006-00-8 |
dimercury dicyanide oxide; mercuric oxycyanide |
215-629-8 |
Expl. 1.1 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H331 H311 H301 H373** H400 H410 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H331 H311 H301 H373** H410 |
|
|
|
|
|
080-007-00-3 |
dimethylmercury; [1] diethylmercury [2] |
209-805-3 [1] 211-000-7 [2] |
593-74-8 [1] 627-44-1 [2] |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H310 H300 H373 ** H410 |
|
* STOT RE 2; H373: C ≥0,05 % |
1 |
|
080-008-00-9 |
phenylmercury nitrate; [1] phenylmercury hydroxide; [2] basic phenylmercury nitrate [3] |
200-242-9 [1] 202-866-7 [2] -[3] |
55-68-5 [1] 100-57-2 [2] 8003-05-2 [3] |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
080-009-00-4 |
2-methoxyethylmercury chloride |
204-659-7 |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
|
080-010-00-X |
mercury dichloride; mercuric chloride |
231-299-8 |
Muta. 2 Repr. 2 Acute Tox. 2 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H341 H361f*** H300 H372** H314 H400 H410 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H341 H361f*** H300 H372** H314 H410 |
|
|
|
|
|
080-011-00-5 |
phenylmercury acetate |
200-532-5 |
Acute Tox. 3 * STOT RE 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H301 H372 ** H314 H410 |
|
|
|
|
|
080-012-00-0 |
methylmercuric chloride |
204-064-2 |
Carc. 2 Repr. 1A Lact. Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360Df H362 H330 H310 H300 H372 (nervous system, kidneys) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H351 H360Df H362 H330 H310 H300 H372 (nervous system, kidneys) H410 |
|
inhalation: ATE = 0,05 mg/l (dusts or mists) dermal: ATE = 50 mg/kg bw oral: ATE = 5 mg/kg bw |
1 |
|
|
081-001-00-3 |
thallium |
231-138-1 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 4 |
H330 H300 H373 ** H413 |
GHS06 GHS08 Dgr |
H330 H300 H373 ** H413 |
|
|
|
|
|
081-002-00-9 |
thallium compounds, with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H330 H300 H373 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H373 ** H411 |
|
|
A |
|
081-003-00-4 |
dithallium sulphate; thallic sulphate |
231-201-3 |
Acute Tox. 2 * STOT RE 1 Skin Irrit. 2 Aquatic Chronic 2 |
H300 H372 ** H315 H411 |
GHS06 GHS08 GHS09 Dgr |
H300 H372 ** H315 H411 |
|
|
|
|
|
082-001-00-6 |
lead compounds with the exception of those specified elsewhere in this Annex |
— |
— |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
|
Repr.2 H361f: C ≥ 2,5 % * STOT RE 2; H373: C ≥0,5 % |
A1 |
|
082-002-00-1 |
lead alkyls |
— |
— |
Repr. 1A Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H330 H310 H300 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H360Df H330 H310 H300 H373 ** H410 |
|
Repr.1A; H360D: C≥ 0,1 % * STOT RE 2; H373: C ≥0,05 % |
A1 |
|
082-003-00-7 |
lead diazide; lead azide |
236-542-1 |
Unst. Expl. Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H200 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H200 H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
|
082-003-01-4 |
lead diazide; lead azide [≥ 20 % phlegmatiser] |
236-542-1 |
Expl. 1.1 Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H201 H360Df H332 H302 H373 ** H400 H410 |
GHS01 GHS08 GHS07 GHS09 Dgr |
H201 H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
|
082-004-00-2 |
lead chromate |
231-846-0 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373** H410 |
|
|
1 |
|
|
082-005-00-8 |
lead di(acetate) |
206-104-4 |
Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
|
|
1 |
|
|
082-006-00-3 |
trilead bis(orthophosphate) |
231-205-5 |
Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H360Df H373 ** H410 |
|
|
1 |
|
|
082-007-00-9 |
lead acetate, basic |
215-630-3 |
Carc. 2 Repr. 1A STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360Df H373 ** H400 H410 |
GHS08 GHS09 Dgr |
H351 H360Df H373 ** H410 |
|
|
1 |
|
|
082-008-00-4 |
lead(II) methanesulphonate |
401-750-5 |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H360Df H332 H302 H373 ** H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H360Df H332 H302 H373 ** H315 H318 |
|
|
1 |
|
|
082-009-00-X |
lead sulfochromate yellow; C.I. Pigment Yellow 34; [This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77603.] |
215-693-7 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373** H410 |
|
|
1 |
|
|
082-010-00-5 |
lead chromate molybdate sulfate red; C.I. Pigment Red 104; [This substance is identified in the Colour Index by Colour Index Constitution Number, C.I. 77605.] |
235-759-9 |
Carc. 1B Repr. 1A STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H373** H400 H410 |
GHS08 GHS09 Dgr |
H350 H360Df H373** H410 |
|
|
1 |
|
|
082-011-00-0 |
lead hydrogen arsenate |
232-064-2 |
Carc. 1A Repr. 1A Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H360Df H331 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H360Df H331 H301 H373 ** H410 |
|
|
1 |
|
|
082-012-00-6 |
barium calcium cesium lead samarium strontium bromide chloride fluoride iodide europium doped |
431-780-4 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373** H411 |
|
|
|
|
|
082-013-00-1 |
lead powder; [particle diameter < 1 mm] |
231-100-4 |
Repr. 1A Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H362 H400 H410 |
GHS08 GHS09 Dgr |
H360FD H362 H410 |
|
Repr. 1A; H360D: C ≥ 0,03 % M = 10 M = 100 |
|
|
|
082-014-00-7 |
lead massive: [particle diameter ≥ 1 mm] |
231-100-4 |
Repr. 1A Lact. Aquatic Chronic 1 |
H360FD H362 H410 |
GHS08 GHS09 Dgr |
H360FD H362 H410 |
|
M = 10 |
|
|
|
092-001-00-8 |
uranium |
231-170-6 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 4 |
H330 H300 H373 ** H413 |
GHS06 GHS08 Dgr |
H330 H300 H373 ** H413 |
|
|
|
|
|
092-002-00-3 |
uranium compounds with the exception of those specified elsewhere in this Annex |
— |
— |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 Aquatic Chronic 2 |
H330 H300 H373** H411 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H373** H411 |
|
|
A |
|
601-001-00-4 |
methane |
200-812-7 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-002-00-X |
ethane |
200-814-8 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-003-00-5 |
propane |
200-827-9 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-004-00-0 |
butane; [1] and isobutane [2] |
203-448-7 [1] 200-857-2 [2] |
106-97-8 [1] 75-28-5 [2] |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
C U |
|
601-004-01-8 |
butane (containing ≥ 0,1 % butadiene (203-450-8)); [1] isobutane (containing ≥ 0,1 % butadiene (203-450-8)) [2] |
203-448-7 [1] 200-857-2 [2] |
106-97-8 [1] 75-28-5 [2] |
Flam. Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
|
|
C S U |
|
601-005-00-6 |
2,2-dimethylpropane; neopentane |
207-343-7 |
Flam. Gas 1 Press. Gas Aquatic Chronic 2 |
H220 H411 |
GHS02 GHS04 GHS09 Dgr |
H220 H411 |
|
|
U |
|
|
601-006-00-1 |
pentane |
203-692-4 |
Flam. Liq. 2 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H336 H411 |
EUH066 |
|
C |
|
|
601-007-00-7 |
hexane (containing < 5 % n-hexane (203-777-6)); 2-methylpentane;[1] 3-methylpentane; [2] 2,2-dimethylbutane; [3] 2,3-dimethylbutane [4] |
203-523-4 [1] 202-481-4 [2] 200-906-8 [3] 201-193-6 [4] |
107-83-5 [1] 96-14-0 [2] 75-83-2 [3] 79-29-8 [4] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
C |
|
601-008-00-2 |
heptane; n-heptane; [1] 2,4-dimethylpentane; [2] 2,2,3-trimethylbutane; [3] 3,3-dimethylpentane; [4] 2,3-dimethylpentane; [5] 3-methylhexane; [6] 2,2-dimethylpentane; [7] 2-methylhexane; [8] 3-ethylpentane; [9] isoheptane; [10] |
205-563-8 [1] 203-548-0 [2] 207-346-3 [3] 209-230-8 [4] 209-280-0 [5] 209-643-3 [6] 209-680-5 [7] 209-730-6 [8] 210-529-0 [9] 250-610-8 [10] |
142-82-5 [1] 108-08-7 [2] 464-06-2 [3] 562-49-2 [4] 565-59-3 [5] 589-34-4 [6] 590-35-2 [7] 591-76-4 [8] 617-78-7 [9] 31394-54-4 [10] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
C |
|
601-009-00-8 |
octane; n-octane; [1] 2,2,4-trimethylpentane; [2] 2,3,3-trimethylpentane; [3] 3,3-dimethylhexane; [4] 2,2,3-trimethylpentane; [5] 2,3,4-trimethylpentane; [6] 3,4-dimethylhexane; [7] 2,3-dimethylhexane; [8] 2,4-dimethylhexane; [9] 4-methylheptane; [10] 3-methylheptane; [11] 2,2-dimethylhexane; [12] 2,5-dimethylhexane; [13] 2-methylheptane; [14] 2,2,3,3-tetramethylbutane; [15] 3-ethyl-2-methylpentane; [16] 3-ethylhexane; [17] 3-ethyl-3-methylpentane; [18] isooctane; [19] |
203-892-1 [1] 208-759-1 [2] 209-207-2 [3] 209-243-9 [4] 209-266-4 [5] 209-292-6 [6] 209-504-7 [7] 209-547-1 [8] 209-649-6 [9] 209-650-1 [10] 209-660-6 [11] 209-689-4 [12] 209-745-8 [13] 209-747-9 [14] 209-855-6 [15] 210-187-2 [16] 210-621-0 [17] 213-923-0 [18] 247-861-0 [19] |
111-65-9 [1] 540-84-1 [2] 560-21-4 [3] 563-16-6 [4] 564-02-3 [5] 565-75-3 [6] 583-48-2 [7] 584-94-1 [8] 589-43-5 [9] 589-53-7 [10] 589-81-1 [11] 590-73-8 [12] 592-13-2 [13] 592-27-8 [14] 594-82-1 [15] 609-26-7 [16] 619-99-8 [17] 1067-08-9 [18] 26635-64-3 [19] |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
C |
|
601-010-00-3 |
ethylene |
200-815-3 |
Flam. Gas 1 Press. Gas STOT SE 3 |
H220 H336 |
GHS02 GHS04 GHS07 Dgr |
H220 H336 |
|
|
U |
|
|
601-011-00-9 |
propene; propylene |
204-062-1 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-012-00-4 |
but-1-ene; [1] butene, mixed-1-and-2-isomers; [2] 2-methylpropene; [3] (Z)-but-2-ene; [4] (E)-but-2-ene [5] |
203-449-2 [1] 203-452-9 [2] 204-066-3 [3] 209-673-7 [4] 210-855-3 [5] |
106-98-9 [1] 107-01-7 [2] 115-11-7 [3] 590-18-1 [4] 624-64-6 [5] |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
C U |
|
601-013-00-X |
1,3-butadiene; buta-1,3-diene |
203-450-8 |
Flam. Gas 1 Press. Gas Carc. 1A Muta. 1B |
H220 H350 H340 |
GHS02 GHS04 GHS08 Dgr |
H220 H350 H340 |
|
|
D U |
|
|
601-014-00-5 |
isoprene (stabilised) 2-methyl-1,3-butadiene |
201-143-3 |
Flam. Liq. 1 Carc. 1B Muta. 2 Aquatic Chronic 3 |
H224 H350 H341 H412 |
GHS02 GHS08 Dgr |
H224 H350 H341 H412 |
|
|
D |
|
|
601-015-00-0 |
acetylene; ethyne |
200-816-9 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
►M4 — ◄ |
|
U |
|
|
601-016-00-6 |
cyclopropane |
200-847-8 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
601-017-00-1 |
cyclohexane |
203-806-2 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H225 H304 H315 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H410 |
|
|
|
|
|
601-018-00-7 |
methylcyclohexane |
203-624-3 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
|
|
|
601-019-00-2 |
1,4-dimethylcyclohexane |
209-663-2 |
Flam. Liq. 2 Asp. Tox. 1 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H304 H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H304 H315 H336 H411 |
|
|
|
|
|
601-020-00-8 |
benzene |
200-753-7 |
Flam. Liq. 2 Carc. 1a Muta. 1B STOT RE 1 Asp. Tox. 1 Eye Irrit. 2 Skin Irrit. 2 |
H225 H350 H340 H372 ** H304 H319 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H340 H372 ** H304 H319 H315 |
|
|
E |
|
|
601-021-00-3 |
toluene |
203-625-9 |
Flam. Liq. 2 Repr. 2 Asp. Tox. 1 STOT RE 2 * Skin Irrit. 2 STOT SE 3 |
H225 H361d *** H304 H373 ** H315 H336 |
GHS02 GHS08 GHS07 Dgr |
H225 H361d *** H304 H373 ** H315 H336 |
|
|
|
|
|
601-022-00-9 |
o-xylene; [1] p-xylene; [2] m-xylene; [3] xylene [4] |
202-422-2 [1] 203-396-5 [2] 203-576-3 [3] 215-535-7 [4] |
95-47-6 [1] 106-42-3 [2] 108-38-3 [3] 1330-20-7 [4] |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H312 H315 |
GHS02 GHS07 Wng |
H226 H332 H312 H315 |
|
* |
C |
|
601-023-00-4 |
ethylbenzene |
202-849-4 |
Flam. Liq. 2 Acute Tox. 4* STOT RE 2 Asp. Tox. 1 |
H225 H332 H373 (hearing organs) H304 |
GHS02 GHS07 GHS08 Dgr |
H225 H332 H373 (hearing organs) H304 |
|
|
|
|
|
601-024-00-X |
Cumene |
202-704-5 |
Flam. Liq. 3 Carc. 1B Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H226 H350 H304 H335 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H304 H335 H411 |
|
|
|
|
|
601-025-00-5 |
mesitylene; 1,3,5-trimethylbenzene |
203-604-4 |
Flam. Liq. 3 STOT SE 3 Aquatic Chronic 2 |
H226 H335 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H335 H411 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
|
601-026-00-0 |
styrene |
202-851-5 |
Flam. Liq. 3 Repr. 2 Acute Tox. 4* STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 |
H226 H361d H332 H372 (hearing organs) H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H226 H361d H332 H372 (hearing organs) H315 H319 |
|
* |
D |
|
|
601-027-00-6 |
2-phenylpropene; α-methylstyrene |
202-705-0 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H226 H319 H335 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H319 H335 H411 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
|
601-028-00-1 |
2-methylstyrene; 2-vinyltoluene |
210-256-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
|
601-029-00-7 |
dipentene; limonene [1] (S)-p-mentha-1,8-diene; l-limonene [2] trans-1-methyl-4-(1-methylvinyl)cyclohexene; [3] (±)-1-methyl-4-(1-methylvinyl)cyclohexene [4] |
205-341-0 [1] 227-815-6 [2] 229-977-3 [3] 231-732-0 [4] |
138-86-3 [1] 5989-54-8 [2] 6876-12-6 [3] 7705-14-8 [4] |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H315 H317 H400 H410 |
GHS02 GHS07 GHS09 Wng |
H226 H315 H317 H410 |
|
|
C |
|
601-030-00-2 |
cyclopentane |
206-016-6 |
Flam. Liq. 2 Aquatic Chronic 3 |
H225 H412 |
GHS02 Dgr |
H225 H412 |
|
|
|
|
|
601-031-00-8 |
2,4,4-trimethylpent-1-ene |
203-486-4 |
Flam. Liq. 2 Aquatic Chronic 2 |
H225 H411 |
GHS02 GHS09 Dgr |
H225 H411 |
|
|
|
|
|
601-032-00-3 |
benzo[a]pyrene; benzo[def]chrysene |
200-028-5 |
Carc. 1B Muta. 1B Repr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H340 H360FD H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H360FD H317 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
|
601-033-00-9 |
benz[a]anthracene |
200-280-6 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
M=100 |
|
|
|
601-034-00-4 |
benz[e]acephenanthrylene |
205-911-9 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
601-035-00-X |
benzo[j]fluoranthene |
205-910-3 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
601-036-00-5 |
benzo[k]fluoranthene |
205-916-6 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
601-037-00-0 |
n-hexane |
203-777-6 |
Flam. Liq. 2 Repr. 2 Asp. Tox. 1 STOT RE 2 * Skin Irrit. 2 STOT SE 3 Aquatic Chronic 2 |
H225 H361f *** H304 H373 ** H315 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H361f *** H304 H373 ** H315 H336 H411 |
|
STOT RE 2; H373: C ≥ 5 % |
|
|
|
601-041-00-2 |
dibenz[a,h]anthracene |
200-181-8 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % M=100 |
|
|
|
601-042-00-8 |
biphenyl; diphenyl |
202-163-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
|
|
|
|
601-043-00-3 |
1,2,4-trimethylbenzene |
202-436-9 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H332 H319 H335 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H319 H335 H315 H411 |
|
|
|
|
|
601-044-00-9 |
3a,4,7,7a-tetrahydro-4,7-methanoindene |
201-052-9 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H225 H332 H302 H319 H335 H315 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H302 H319 H335 H315 H411 |
|
|
|
|
|
601-045-00-4 |
1,2,3,4-tetrahydronaphthalene |
204-340-2 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
EUH019 |
|
|
|
|
601-046-00-X |
7-methylocta-1,6-diene |
404-210-7 |
Flam. Liq. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H400 H410 |
GHS02 GHS09 Wng |
H226 H410 |
|
|
|
|
|
601-047-00-5 |
m-mentha-1,3(8)-diene |
404-150-1 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
601-048-00-0 |
chrysene |
205-923-4 |
Carc. 1B Muta. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H341 H400 H410 |
GHS08 GHS09 Dgr |
H350 H341 H410 |
|
|
|
|
|
601-049-00-6 |
benzo[e]pyrene |
205-892-7 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
601-051-00-7 |
4-phenylbut-1-ene |
405-980-7 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
601-052-00-2 |
naphthalene |
202-049-5 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS07 GHS08 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
|
601-053-00-8 |
nonylphenol; [1] 4-nonylphenol, branched [2] |
246-672-0 [1] 284-325-5 [2] |
25154-52-3 [1] 84852-15-3 [2] |
Repr. 2 Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H361fd H302 H314 H410 |
|
|
|
|
601-054-00-3 |
reaction mass of isomers of: dibenzylbenzene; dibenzyl(methyl)benzene; dibenzyl(dimethyl)benzene; dibenzyl(trimethyl)benzene |
405-570-8 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
601-055-00-9 |
reaction mass of isomers of: mono-(2-tetradecyl)naphthalenes; di-(2-tetradecyl)naphthalenes; tri-(2-tetradecyl)naphthalenes |
410-190-0 |
Eye Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
|
|
|
|
|
601-056-00-4 |
reaction mass of isomers of: methyldiphenylmethane; dimethyldiphenylmethane |
405-470-4 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
601-057-00-X |
N-dodecyl-[3-(4-(dimethylamino)benzamido)-propyl]dimethylammonium tosylate |
421-130-8 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
|
601-058-00-5 |
di-L-para-menthene |
417-870-6 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
|
601-059-00-0 |
methyl 2-benzylidene-3-oxobutyrate |
420-940-9 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
|
601-060-00-6 |
1,2-bis[4-fluoro-6-{4-sulfo-5-(2-(4-sulfonaphtalene-3-ylazo)-1-hydroxy-3,6-disulfo-8-aminonaphthalene-7-ylazo)phenylamino}-1,3,5-triazin-2ylamino]ethane; x-sodium, y-potassium salts x = 7,755 y =0,245 |
417-610-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
601-061-00-1 |
(ethyl-1,2-ethanediyl)[-2-[[[(2-hydroxyethyl)methylamino]acetyl]-propyl]ω-(nonylphenoxy)poly]oxy-(methyl-1,2-ethanediyl) |
418-960-8 |
— |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
601-062-00-7 |
reaction mass of: branched triacontane; branched dotriacontane; branched tetratriacontane; branched hexatriacontane |
417-030-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
601-063-00-2 |
reaction mass of isomers of branched tetracosane |
417-060-2 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
|
▼M23 ————— |
||||||||||
|
601-065-00-3 |
reaction mass of: (1'α, 3'α, 6'α)-2,2,3' ,7', 7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane); (1'α, 3'β, 6'α)-2,2,3', 7', 7'-pentamethylspiro(1,3-dioxane-5,2'-norcarane) |
416-930-9 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
601-066-00-9 |
1-(4-(trans-4-heptylcyclohexyl)phenyl) ethanone |
426-820-2 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
601-067-00-4 |
triethyl arsenate |
427-700-2 |
Carc. 1A Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H301 H410 |
|
|
|
|
|
601-068-00-X |
1,2-diacetoxybut-3-ene |
421-720-5 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
601-069-00-5 |
2-ethyl-1-(2-(1,3-dioxanyl)ethyl)-pyridinium bromide |
422-680-1 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
601-070-00-0 |
reaction mass of: branched icosane; branched docosane; branched tetracosane |
417-050-8 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
|
601-071-00-6 |
1-dimethoxymethyl-2-nitro-benzene |
423-830-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
601-072-00-1 |
reaction mass of: 1-(4-isopropylphenyl)-1-phenylethane; 1-(3-isopropylphenyl)-1-phenylethane; 1-(2-isopropylphenyl)-1-phenylethane |
430-690-2 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
601-073-00-7 |
1-bromo-3,5-difluorobenzene |
416-710-2 |
Flam. Liq. 3 Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H373 ** H315 H317 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Wng |
H226 H302 H373 ** H315 H317 H410 |
|
|
|
|
|
601-074-00-2 |
reaction mass of: 4-(2,2,3-trimethylcyclopent-3-en-1-yl)-1-methyl-2-oxabicyclo[2.2.2]octane; 1-(2,2,3-trimethylcyclopent-3-en-1-yl)-5-methyl-6-oxabicyclo[3.2.1]octane; spiro[cyclohex-3-en-1-yl-[(4,5,6,6a-tetrahydro-3,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]furan]; spiro[cyclohex-3-en-1-yl-[4,5,6,6a-tetrahydro-4,6',6',6'a-tetramethyl)-1,3'(3'aH)-[2H]cyclopenta[b]]furan] |
422-040-1 |
— |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
601-075-00-8 |
4,4'-bis(N-carbamoyl-4-methylbenzenesulfonamide)diphenylmethane |
418-770-5 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
601-076-00-3 |
ethynyl cyclopropane |
425-430-1 |
Flam. Liq. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H225 H315 H318 H412 |
GHS02 GHS05 Dgr |
H225 H315 H318 H412 |
|
|
|
|
|
601-077-00-9 |
reaction mass of: 1-heptyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octane; 1-nonyl-4-ethyl-2,6,7-trioxabicyclo[2.2.2]octane |
426-510-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
601-078-00-4 |
reaction mass of: 1,7-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptane; 2,3-dimethyl-2-[(3-methylbicyclo[2.2.1]hept-2-yl)methyl]bicyclo[2.2.1]heptane |
427-040-5 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
601-079-00-X |
reaction mass of: trans-trans-cyclohexadeca-1,9-diene; cis-trans-cyclohexadeca-1,9-diene |
429-620-3 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
601-080-00-5 |
reaction mass of: sec-butylphenyl(phenyl)methane, mixed isomers; 1-(sec-butylphenyl(phenyl)-2-phenylethane, mixed isomers; 1-(sec-butylphenyl-1-phenylethane, mixed isomers |
431-100-6 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
601-081-00-0 |
cyclohexadeca-1,9-diene |
431-730-1 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
|
|
601-082-00-6 |
reaction mass of: endo-2-methyl-exo-3-methyl-exo-2-[(exo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptane; exo-2-methyl-exo-3-methyl-endo-2-[(endo-3-methylbicyclo[2.2.1]hept-exo-2-yl)methyl]bicyclo[2.2.1]heptane |
434-420-4 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
601-083-00-1 |
5-endo-hexyl-bicyclo[2.2.1]hept-2-ene |
435-000-3 |
Asp. Tox. 1 Skin Irrit. 2 Aquatic Chronic 4 |
H304 H315 H413 |
GHS08 GHS07 Dgr |
H304 H315 H413 |
|
|
|
|
|
601-084-00-7 |
reaction mass of:5-endo-butyl-bicyclo[2.2.1]hept-2-ene; 5-exo-butyl-bicyclo[2.2.1]hept-2-ene (80:20) |
435-180-3 |
— |
Asp. Tox. 1 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H304 H315 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H304 H315 H410 |
|
|
|
|
601-085-00-2 |
isopentane; 2-methylbutane |
201-142-8 |
Flam. Liq. 1 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H224 H304 H336 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H224 H304 H336 H411 |
EUH066 |
|
|
|
|
601-087-00-3 |
2,4,4-trimethylpentene |
246-690-9 |
Flam. Liq. 2 Asp. Tox. 1 STOT SE 3 |
H225 H304 H336 |
GHS02 GHS07 GHS08 Dgr |
H225 H304 H336 |
|
|
D |
|
|
601-088-00-9 |
4-vinylcyclohexene |
202-848-9 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
601-089-00-4 |
muscalure; cis-tricos-9-ene |
248-505-7 |
Skin Sens. 1B |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
601-090-00-X |
benzo[rst]pentaphene |
205-877-5 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
|
|
|
|
601-091-00-5 |
dibenzo[b,def]chrysene; dibenzo[a,h]pyrene |
205-878-0 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
|
|
|
|
601-092-00-0 |
dibenzo[def,p]chrysene; dibenzo[a,l]pyrene |
205-886-4 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
Carc. 1B; H350: C ≥ 0,001 % |
|
|
|
601-093-00-6 |
1,4-dimethylnaphthalene |
209-335-9 |
Acute Tox. 4 Asp. Tox. 1 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 3 |
H302 H304 H319 H400 H412 |
GHS07 GHS08 GHS09 Dgr |
H302 H304 H319 H410 |
|
oral: ATE = 1 300 mg/kg bw M = 1 |
|
|
|
601-094-00-1 |
1-isopropyl-4-methylbenzene; p-cymene |
202-796-7 |
Flam. Liq. 3 Acute Tox. 3 Asp. Tox. 1 Aquatic Chronic 2 |
H226 H331 H304 H411 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H331 H304 H411 |
|
inhalation: ATE = 3 mg/l (vapours) |
|
|
|
601-095-00-7 |
p-mentha-1,3-diene; 1-isopropyl-4-methylcyclohexa-1,3-diene; alpha-terpinene |
202-795-1 |
Flam. Liq. 3 Acute Tox. 4 Skin Sens. 1 Asp. Tox. 1 Aquatic Chronic 2 |
H226 H302 H317 H304 H411 |
GHS02 GHS07 GHS08 GHS09 Dgr |
H226 H302 H317 H304 H411 |
|
oral: ATE = 1 680 mg/kg bw |
|
|
|
601-096-00-2 |
(R)-p-mentha-1,8-diene; d-limonene |
227-813-5 |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1B Asp. Tox. 1 Aquatic Acute 1 Aquatic Chronic 3 |
H226 H315 H317 H304 H400 H412 |
GHS02 GHS07 GHS08 GHS09 Dgr |
H226 H315 H317 H304 H410 |
|
M = 1 |
|
|
|
601-097-00-8 |
Propylbenzene |
203-132-9 |
Flam. Liq. 3 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H226 H304 H335 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H304 H335 H411 |
|
|
|
|
|
602-001-00-7 |
chloromethane; methyl chloride |
200-817-4 |
Flam. Gas 1 Press. Gas Carc. 2 STOT RE 2 * |
H220 H351 H373 ** |
GHS02 GHS04 GHS08 Dgr |
H220 H351 H373 ** |
|
|
U |
|
|
602-002-00-2 |
bromomethane; methylbromide |
200-813-2 |
Press. Gas Muta. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Ozone 1 |
H341 H331 H301 H373** H319 H335 H315 H400 H420 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H341 H331 H301 H373 ** H319 H335 H315 H400 H420 |
|
|
U |
|
|
602-003-00-8 |
dibromomethane |
200-824-2 |
Acute Tox. 4 * Aquatic Chronic 3 |
H332 H412 |
GHS07 Wng |
H332 H412 |
|
* |
|
|
|
602-004-00-3 |
dichloromethane; methylene chloride |
200-838-9 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
602-005-00-9 |
methyl iodide; iodomethane |
200-819-5 |
Carc. 2 Acute Tox. 4 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 |
H351 H312 H331 H301 H335 H315 |
GHS06 GHS08 Dgr |
H351 H312 H331 H301 H335 H315 |
|
|
|
|
|
602-006-00-4 |
chloroform; trichloromethane |
200-663-8 |
Carc. 2 Repr. 2 Acute Tox. 3 Acute Tox. 4 STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 |
H351 H361d H331 H302 H372 H319 H315 |
GHS06 GHS08 Dgr |
H351 H361d H331 H302 H372 H319 H315 |
|
|
|
|
|
602-007-00-X |
bromoform; tribromomethane |
200-854-6 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H331 H302 H319 H315 H411 |
GHS06 GHS09 Dgr |
H331 H302 H319 H315 H411 |
|
|
|
|
|
602-008-00-5 |
carbon tetrachloride; tetrachloromethane |
200-262-8 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Chronic 3 Ozone 1 |
H351 H331 H311 H301 H372** H412 H420 |
GHS06 GHS08 Dgr |
H351 H331 H311 H301 H372 ** H412 H420 |
|
* STOT RE 1; H372:C≥1 % STOT RE 2; H373:0,2 % ≤C < 1 % |
|
|
|
602-009-00-0 |
chloroethane |
200-830-5 |
Flam. Gas 1 Press. Gas Carc. 2 Aquatic Chronic 3 |
H220 H351 H412 |
GHS02 GHS04 GHS08 Dgr |
H220 H351 H412 |
|
|
U |
|
|
602-010-00-6 |
1,2-dibromoethane |
203-444-5 |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H350 H331 H311 H301 H319 H335 H315 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H319 H335 H315 H411 |
|
* |
|
|
|
602-011-00-1 |
1,1-dichloroethane |
200-863-5 |
Flam. Liq. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H225 H302 H319 H335 H412 |
GHS02 GHS07 Dgr |
H225 H302 H319 H335 H412 |
|
* |
|
|
|
602-012-00-7 |
1,2-dichloroethane; ethylene dichloride |
203-458-1 |
Flam. Liq. 2 Carc. 1B Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H350 H302 H319 H335 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H302 H319 H335 H315 |
|
|
|
|
|
602-013-00-2 |
1,1,1-trichloroethane; methyl chloroform |
200-756-3 |
Acute Tox. 4 * Ozone 1 |
H332 H420 |
GHS07 Wng |
H332 H420 |
|
|
F |
|
|
602-014-00-8 |
1,1,2-trichloroethane |
201-166-9 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H351 H332 H312 H302 |
GHS08 GHS07 Wng |
H351 H332 H312 H302 |
EUH066 |
* |
|
|
|
602-015-00-3 |
1,1,2,2-tetrachloroethane |
201-197-8 |
Acute Tox. 2 * Acute Tox. 1 Aquatic Chronic 2 |
H330 H310 H411 |
GHS06 GHS09 Dgr |
H330 H310 H411 |
|
|
|
|
|
602-016-00-9 |
1,1,2,2-tetrabromoethane |
201-191-5 |
Acute Tox. 2 * Eye Irrit. 2 Aquatic Chronic 3 |
H330 H319 H412 |
GHS06 Dgr |
H330 H319 H412 |
|
|
|
|
|
602-017-00-4 |
pentachloroethane |
200-925-1 |
Carc. 2 STOT RE 1 Aquatic Chronic 2 |
H351 H372 ** H411 |
GHS08 GHS09 Dgr |
H351 H372 ** H411 |
|
STOT RE 1; H372: C≥ 1 % STOT RE 2; H373: 0,2 % ≤ C < 1 % |
|
|
|
602-018-00-X |
1-chloropropane; [1] 2-chloropropane [2] |
208-749-7 [1] 200-858-8 [2] |
540-54-5 [1] 75-29-6 [2] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
C |
|
602-019-00-5 |
1-bromopropane; n-propyl bromide |
203-445-0 |
Flam. Liq. 2 Repr. 1B STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 STOT SE 3 |
H225 H360FD H373 ** H319 H335 H315 H336 |
GHS02 GHS08 GHS07 Dgr |
H225 H360FD H373 ** H319 H335 H315 H336 |
|
|
|
|
|
602-020-00-0 |
1,2-dichloropropane; propylene dichloride |
201-152-2 |
Flam. Liq. 2 Carc. 1B Acute Tox. 4* Acute Tox. 4* |
H225 H350 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H302 |
|
|
|
|
|
602-021-00-6 |
1,2-dibromo-3-chloropropane |
202-479-3 |
Carc. 1B Muta. 1B Repr. 1A Acute Tox. 3 * STOT RE 2 * Aquatic Chronic 3 |
H350 H340 H360F *** H301 H373 ** H412 |
GHS06 GHS08 Dgr |
H350 H340 H360F *** H301 H373 ** H412 |
|
|
|
|
|
602-022-00-1 |
1-chloropentane; [1] 2-chloropentane; [2] 3-chloropentane [3] |
208-846-4 [1] 210-885-7 [2] 210-467-4 [3] |
543-59-9 [1] 625-29-6 [2] 616-20-6 [3] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
C |
|
602-023-00-7 |
vinyl chloride; chloroethylene |
200-831-0 |
Press. Gas Flam. Gas 1 Carc. 1A |
H220 H350 |
GHS02 GHS08 Dgr |
H220 H350 |
|
|
D U |
|
|
602-024-00-2 |
bromoethylene |
209-800-6 |
Press. Gas Flam. Gas 1 Carc. 1B |
H220 H350 |
GHS02 GHS08 Dgr |
H220 H350 |
|
|
U |
|
|
602-025-00-8 |
1,1-dichloroethylene; vinylidene chloride |
200-864-0 |
Flam. Liq. 1 Carc. 2 Acute Tox. 4 * |
H224 H351 H332 |
GHS02 GHS08 GHS07 Dgr |
H224 H351 H332 |
|
* |
D |
|
|
602-026-00-3 |
1,2-dichloroethylene; [1] cis-dichloroethylene; [2] trans-dichloroethylene [3] |
208-750-2 [1] 205-859-7 [2] 205-860-2 [3] |
540-59-0 [1] 156-59-2 [2] 156-60-5 [3] |
Flam. Liq. 2 Acute Tox. 4 * Aquatic Chronic 3 |
H225 H332 H412 |
GHS02 GHS07 Dgr |
H225 H332 H412 |
|
* |
C |
|
602-027-00-9 |
trichloroethylene; trichloroethene |
201-167-4 |
Carc. 1B Muta. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H350 H341 H319 H315 H336 H412 |
GHS08 GHS07 Dgr |
H350 H341 H319 H315 H336 H412 |
|
|
|
|
|
602-028-00-4 |
tetrachloroethylene |
204-825-9 |
Carc. 2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
|
|
|
|
|
602-029-00-X |
3-chloropropene; allyl chloride |
203-457-6 |
Flam. Liq. 2 Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H225 H351 H341 H332 H312 H302 H373 ** H319 H335 H315 H400 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H225 H351 H341 H332 H312 H302 H373 ** H319 H335 H315 H400 |
|
|
D |
|
|
602-030-00-5 |
1,3-dichloropropene; [1] (Z)-1,3-dichloropropene [2] |
208-826-5 [1] 233-195-8 [2] |
542-75-6 [1] 10061-01-5 [2] |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Asp. Tox. 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H311 H301 H332 H304 H319 H335 H315 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H311 H301 H332 H304 H319 H335 H315 H317 H410 |
|
|
C D |
|
602-031-00-0 |
1,1-dichloropropene |
209-253-3 |
Flam. Liq. 2 Acute Tox. 3 * Aquatic Chronic 3 |
H225 H301 H412 |
GHS02 GHS06 Dgr |
H225 H301 H412 |
|
|
|
|
|
602-032-00-6 |
3-chloro-2-methylpropene |
209-251-2 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H225 H332 H302 H314 H317 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H225 H332 H302 H314 H317 H411 |
|
|
|
|
|
602-033-00-1 |
chlorobenzene |
203-628-5 |
Flam. Liq. 3 Acute Tox. 4 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H332 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H315 H411 |
|
|
|
|
|
602-034-00-7 |
1,2-dichlorobenzene; o-dichlorobenzene |
202-425-9 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
* |
|
|
|
602-035-00-2 |
1,4-dichlorobenzene; p-dichlorobenzene |
203-400-5 |
Carc. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H400 H410 |
GHS08 GHS09 Wng |
H351 H319 H410 |
|
|
|
|
|
602-036-00-8 |
chloroprene (stabilised); 2-chlorobuta-1,3-diene (stabilised) |
204-818-0 |
Flam. Liq. 2 Carc. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H350 H332 H302 H373 ** H319 H335 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H302 H373 ** H319 H335 H315 |
|
|
D |
|
|
602-037-00-3 |
α-chlorotoluene; benzyl chloride |
202-853-6 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H350 H331 H302 H373 ** H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H350 H331 H302 H373 ** H335 H315 H318 |
|
|
|
|
|
602-038-00-9 |
α, α, α-trichlorotoluene; benzotrichloride |
202-634-5 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H350 H331 H302 H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H350 H331 H302 H335 H315 H318 |
|
|
|
|
|
602-039-00-4 |
polychlorobiphenyls; PCB |
215-648-1 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H400 H410 |
GHS08 GHS09 Wng |
H373 ** H410 |
|
STOT RE 2; H373: C ≥ 0,005 % |
C |
|
|
602-040-00-X |
2-chlorotoluene; [1] 3-chlorotoluene; [2] 4-chlorotoluene; [3] chlorotoluene [4] |
202-424-3 [1] 203-580-5 [2] 203-397-0 [3] 246-698-2 [4] |
95-49-8 [1] 108-41-8 [2] 106-43-4 [3] 25168-05-2 [4] |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
C |
|
602-041-00-5 |
penthachloronaphthalene |
215-320-8 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H410 |
|
|
C |
|
|
602-042-00-0 |
1,2,3,4,5,6-hexachlorcyclohexanes with the exception of those specified elsewhere in this Annex |
— |
— |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H312 H410 |
|
|
A C |
|
602-043-00-6 |
lindane (ISO); γ-HCH or γ-BHC; γ-1,2,3,4,5,6-hexachlorocyclohexane |
200-401-2 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H373 ** H362 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H332 H312 H373 ** H362 H410 |
|
M=10 |
|
|
|
602-044-00-1 |
camphechlor (ISO); toxaphene; |
232-283-3 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H312 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H312 H335 H315 H410 |
|
|
|
|
|
602-045-00-7 |
DDT (ISO); clofenotane (INN); dicophane;1,1,1-trichloro-2,2-bis(4-chlorophenyl)ethane; dichlorodiphenyltrichloroethane |
200-024-3 |
Carc. 2 Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H372 ** H410 |
|
|
|
|
|
602-046-00-2 |
heptachlor (ISO); 1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindene |
200-962-3 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H373 ** H410 |
|
|
|
|
|
602-047-00-8 |
chlordane (ISO); 1,2,4,5,6,7,8,8-octachloro-3a,4,7,7a-tetrahydro-4,7-methanoindan |
200-349-0 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H312 H302 H410 |
|
|
|
|
|
602-048-00-3 |
aldrin (ISO) |
206-215-8 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H372 ** H410 |
|
|
|
|
|
602-049-00-9 |
dieldrin (ISO) |
200-484-5 |
Carc. 2 Acute Tox. 1 Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H310 H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H310 H301 H372 ** H410 |
|
|
|
|
|
602-050-00-4 |
isodrin; (1α,4α,4aβ, 5β,8β,8aβ)-1,2,3,4,10,10-hexachloro-1,4,4a,5,8,8a-hexahydro-1,4:5,8-dimethanonaphthalene |
207-366-2 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
M=100 |
|
|
|
602-051-00-X |
endrin (ISO); 1,2,3,4,10,10-hexachloro-6,7-epoxy-1,4,4a,5,6,7,8,8a-octahydro-1,4:5,8-dimethanonaphthalene |
200-775-7 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
|
602-052-00-5 |
endosulfan (ISO); 1,2,3,4,7,7-hexachloro-8,9,10-trinorborn-2-en-5,6-ylenedimethylene sulfite; 1,4,5,6,7,7-hexachloro-8,9,10-trinorborn-5-en-2,3-ylenedimethylene sulfite |
204-079-4 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H312 H410 |
|
|
|
|
|
602-053-00-0 |
isobenzan (ISO); 1,3,4,5,6,7,8,8-octachloro-1,3,3a,4,7,7a-hexahydro-4,7-methanoisobenzofuran |
206-045-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
|
602-054-00-6 |
3-iodpropene; allyl iodide |
209-130-4 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
|
602-055-00-1 |
bromoethane; ethyl bromide |
200-825-8 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H351 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H332 H302 |
|
|
|
|
|
602-056-00-7 |
α, α, α-trifluorotoluene; benzotrifluoride |
202-635-0 |
Flam. Liq. 2 Aquatic Chronic 2 |
H225 H411 |
GHS02 GHS09 Dgr |
H225 H411 |
|
|
|
|
|
602-057-00-2 |
α-bromotoluene; benzyl bromide |
202-847-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
|
|
|
|
602-058-00-8 |
α, α-dichlorotoluene; benzylidene chloride; benzal chloride |
202-709-2 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H351 H331 H302 H335 H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H351 H331 H302 H335 H315 H318 |
|
|
|
|
|
602-059-00-3 |
1-chlorobutane; butyl chloride |
203-696-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
602-060-00-9 |
bromobenzene |
203-623-8 |
Flam. Liq. 3 Skin Irrit. 2 Aquatic Chronic 2 |
H226 H315 H411 |
GHS02 GHS07 GHS09 Wng |
H226 H315 H411 |
|
|
|
|
|
602-061-00-4 |
hexafluoropropene; hexafluoropropylene |
204-127-4 |
Press. Gas Acute Tox. 4 * STOT SE 3 |
H332 H335 |
GHS07 Wng |
H332 H335 |
|
|
U |
|
|
602-062-00-X |
1,2,3-trichloropropane |
202-486-1 |
Carc. 1B Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H350 H360F *** H332 H312 H302 |
GHS08 GHS07 Dgr |
H350 H360F *** H332 H312 H302 |
|
|
D |
|
|
602-063-00-5 |
heptachlor epoxide; 2,3-epoxy-1,4,5,6,7,8,8-heptachloro-3a,4,7,7a-tetrahydro-4,7-methanoindane |
213-831-0 |
Carc. 2 Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H301 H373 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H301 H373 ** H410 |
|
|
|
|
|
602-064-00-0 |
1,3-dichloro-2-propanol |
202-491-9 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * |
H350 H301 H312 |
GHS06 GHS08 Dgr |
H350 H301 H312 |
|
|
|
|
|
602-065-00-6 |
hexachlorobenzene |
204-273-9 |
Carc. 1B STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H372 ** H400 H410 |
GHS08 GHS09 Dgr |
H350 H372 ** H410 |
|
|
|
|
|
602-066-00-1 |
tetrachloro-p-benzoquinone |
204-274-4 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
|
602-067-00-7 |
1,3-dichlorbenzene |
208-792-1 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
602-068-00-2 |
ethylene bis(trichloroacetate) |
219-732-9 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
|
602-069-00-8 |
dichloroacetylene |
— |
Unst. Expl. Carc. 2 STOT RE 2 * |
H200 H351 H373 ** |
GHS01 GHS08 Wng |
H200 H351 H373 ** |
|
|
|
|
|
602-070-00-3 |
3-chloro-4,5,α, α, α-pentafluorotoluene |
401-930-3 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H226 H332 H302 H400 |
GHS02 GHS07 GHS09 Wng |
H226 H332 H302 H400 |
|
|
|
|
|
602-071-00-9 |
bromobenzylbromotoluene, reaction mass of isomers |
402-210-1 |
STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 ** H317 H410 |
|
|
|
|
|
602-072-00-4 |
dichloro [(dichlorophenyl)methyl]methylbenzene, reaction mass of isomers; (dichlorophenyl)(dichlorotolyl)methane, reaction mass of isomers (IUPAC) |
278-404-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
602-073-00-X |
1,4-dichlorobut-2-ene |
212-121-8 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H330 H311 H301 H314 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H350 H330 H311 H301 H314 H410 |
|
Carc. 1B; H350: C ≥ 0,01 % STOT SE 3; H335:C≥5 % |
|
|
|
602-074-00-5 |
pentachlorobenzene |
210-172-0 |
Flam. Sol. 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H228 H302 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H228 H302 H410 |
|
|
T |
|
|
602-075-00-0 |
4,4,5,5-tetrachloro-1,3-dioxolan-2-one |
404-060-2 |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H330 H302 H314 |
GHS06 GHS05 Dgr |
H330 H302 H314 |
|
|
|
|
|
602-076-00-6 |
2,3,4-trichlorobut-1-ene |
219-397-9 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H302 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H331 H302 H319 H335 H315 H410 |
|
Carc. 2; H351: C ≥ 0,1 % |
|
|
|
602-077-00-1 |
dodecachloropentacyclo[5.2.1.02,6.03,9.05,8]decane; mirex |
219-196-6 |
Carc. 2 Repr. 2 Lact. Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361fd H362 H312 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361fd H362 H312 H302 H410 |
|
|
|
|
|
602-078-00-7 |
hexachlorocyclopentadiene |
201-029-3 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H302 H314 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H330 H311 H302 H314 H410 |
|
|
|
|
|
602-079-00-2 |
2,3-dichloropropene; 2,3-dichloropropylene |
201-153-8 |
Flam. Liq. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H225 H341 H332 H312 H302 H335 H315 H318 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H225 H341 H332 H312 H302 H335 H315 H318 H412 |
|
|
|
|
|
602-080-00-8 |
alkanes, C10-13, chloro; chlorinated paraffins, C10-13 |
287-476-5 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
EUH066 |
|
|
|
|
602-081-00-3 |
2-chloro-4,5-difluorobenzoic acid |
405-380-5 |
— |
Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H312 H302 H318 H317 |
GHS05 GHS07 Dgr |
H312 H302 H318 H317 |
|
|
|
|
602-082-00-9 |
2,2,6,6-tetrakis(bromomethyl)-4-oxaheptane-1,7-diol |
408-020-5 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
602-083-00-4 |
diphenyl ether, pentabromo derivative pentabromodiphenyl ether |
251-084-2 |
STOT RE 2 * Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H362 H400 H410 |
GHS08 GHS09 Wng |
H373 ** H362 H410 |
|
|
|
|
|
602-084-00-X |
1,1-dichloro-1-fluoroethane |
404-080-1 |
Aquatic Chronic 3 Ozone 1 |
H412 H420 |
GHS07 Wng |
H412 H420 |
|
|
|
|
|
602-085-00-5 |
2-bromopropane |
200-855-1 |
Flam. Liq. 2 Repr. 1a STOT RE 2 * |
H225 H360F *** H373 ** |
GHS02 GHS08 Dgr |
H225 H360F *** H373 ** |
EUH066 |
|
|
|
|
602-086-00-0 |
trifluoroiodomethane; trifluoromethyl iodide |
219-014-5 |
Muta. 2 |
H341 |
GHS08 Wng |
H341 |
|
|
|
|
|
602-087-00-6 |
1,2,4-trichlorobenzene |
204-428-0 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
602-088-00-1 |
2,3-dibromopropan-1-ol; 2,3-dibromo-1-propanol |
202-480-9 |
Carc. 1B Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H350 H361f *** H311 H332 H302 H412 |
GHS08 GHS07 Dgr |
H350 H361f *** H311 H332 H302 H412 |
|
|
|
|
|
602-089-00-7 |
4-bromo-2-chlorofluorobenzene |
405-580-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
602-090-00-2 |
1-allyl-3-chloro-4-fluorobenzene |
406-630-6 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
602-091-00-8 |
1,3-dichloro-4-fluorobenzene |
406-160-1 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 |
H302 H373 ** H315 H411 |
GHS08 GHS07 Wng |
H302 H373 ** H315 H411 |
|
|
|
|
|
602-092-00-3 |
1-bromo-3,4,5-trifluorobenzene |
418-480-9 |
Flam. Liq. 3 Carc. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H226 H351 H315 H318 H411 |
GHS02 GHS08 GHS05 GHS09 Dgr |
H226 H351 H315 H318 H411 |
|
|
|
|
|
602-093-00-9 |
α, α, α,4-tetrachlorotoluene; p-chlorobenzotrichloride |
226-009-1 |
Carc. 1B Repr. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H350 H361f *** H372 ** H312 H302 H335 H315 |
GHS08 GHS07 Dgr |
H350 H361f *** H372 ** H312 H302 H335 H315 |
|
|
|
|
|
602-094-00-4 |
diphenylether; octabromo derivate |
251-087-9 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
|
|
|
|
|
602-095-00-X |
alkanes, C14-17, chloro; chlorinated paraffins, C14-17 |
287-477-0 |
Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
EUH066 |
|
|
|
|
602-096-00-5 |
malachite green hydrochloride; [1] malachite green oxalate [2] |
209-322-8 [1] 219-441-7 [2] |
569-64-2 [1] 2437-29-8 [2] |
Repr. 2 Acute Tox. 4 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H302 H318 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H361d *** H302 H318 H410 |
|
|
|
|
602-097-00-0 |
1-bromo-9-(4,4,5,5,5-pentafluoropentylthio)nonane |
422-850-5 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
602-098-00-6 |
2-(3-bromophenoxy)tetrahydro-2H-pyran |
429-030-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
602-099-00-1 |
3-(4-fluorophenyl)-2-methylpropionylchloride |
426-370-7 |
— |
Skin Corr. 1A Acute Tox. 4 * Aquatic Chronic 3 |
H314 H302 H412 |
GHS05 GHS07 Dgr |
H314 H302 H412 |
EUH014 EUH029 |
|
|
|
602-100-00-5 |
reaction mass of: (R, R)-1,1,1,2,2,3,4,5,5,5-decafluoropentane; (S, S)-1,1,1,2,2,3,4,5,5,5-decafluoropentane |
420-640-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
602-101-00-0 |
2-chloro-4-fluoro-5-nitrophenyl(isobutyl)carbonate |
427-020-6 |
STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373** H317 H410 |
|
|
|
|
|
602-102-00-6 |
1,1,1,3,3-pentafluorobutane |
430-250-1 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
602-103-00-1 |
1-(chlorophenylmethyl)-2-methylbenzene |
431-450-1 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
602-104-00-7 |
1,1,2,2,3,3,4-heptafluorocyclopentane |
430-710-1 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
602-105-00-2 |
sodium 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfinate |
422-100-7 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
602-106-00-8 |
2-bromo-4,6-difluoroaniline |
429-430-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
602-107-00-3 |
3,3,4,4-tetrafluoro-4-iodo-1-butene |
439-500-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
|
|
|
|
|
602-108-00-9 |
(2,3,5,6-tetrafluorophenyl)methanol |
443-840-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
|
602-109-00-4 |
hexabromocyclododecane [1] 1,2,5,6,9,10-hexabromocyclododecane [2] |
247-148-4 [1] 221-695-9[2] |
25637-99-4[1] 3194-55-6[2] |
Repr. 2 Lact. |
H361 H362 |
GHS08 Wng |
H361 H362 |
|
|
|
|
602-110-00-X |
tetrafluoroethylene |
204-126-9 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
603-001-00-X |
methanol |
200-659-6 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 |
H225 H331 H311 H301 H370 ** |
GHS02 GHS06 GHS08 Dgr |
H225 H331 H311 H301 H370 ** |
|
* STOT SE 1; H370: C≥10 % STOT SE 2; H371: 3 % ≤ C<10 % |
|
|
|
603-002-00-5 |
ethanol; ethyl alcohol |
200-578-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
603-003-00-0 |
propan-1-ol; n-propanol |
200-746-9 |
Flam. Liq. 2 Eye Dam. 1 STOT SE 3 |
H225 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H225 H318 H336 |
|
|
|
|
|
603-004-00-6 |
butan-1-ol; n-butanol |
200-751-6 |
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 STOT SE 3 |
H226 H302 H335 H315 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H335 H315 H318 H336 |
|
|
|
|
|
603-005-00-1 |
2-methylpropan-2-ol; tert-butyl alcohol |
200-889-7 |
Flam. Liq. 2 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H225 H332 H319 H335 |
GHS02 GHS07 Dgr |
H225 H332 H319 H335 |
|
|
|
|
|
603-006-00-7 |
pentanol isomers, with the exception of those specified elsewhere in this Annex |
250-378-8 |
|
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 |
H226 H332 H335 |
GHS02 GHS07 Wng |
H226 H332 H335 |
EUH066 |
|
C |
|
603-007-00-2 |
2-methylbutan-2-ol; tert-pentanol |
200-908-9 |
Flam. Liq. 2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H225 H332 H335 H315 |
GHS02 GHS07 Dgr |
H225 H332 H335 H315 |
|
|
|
|
|
603-008-00-8 |
4-methylpentan-2-ol; methyl isobutyl carbinol |
203-551-7 |
Flam. Liq. 3 STOT SE 3 |
H226 H335 |
GHS02 GHS07 Wng |
H226 H335 |
|
STOT SE 3; H335: C ≥ 25 % |
|
|
|
603-009-00-3 |
cyclohexanol |
203-630-6 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H332 H302 H335 H315 |
GHS07 Wng |
H332 H302 H335 H315 |
|
|
|
|
|
603-010-00-9 |
2-methylcyclohexanol, mixed isomers; [1] cis-2-methylcyclohexanol; [2] trans-2-methylcyclohexanol [3] |
209-512-0 [1] 231-187-9 [2] 231-186-3 [3] |
583-59-5 [1] 7443-70-1 [2] 7443-52-9 [3] |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
C |
|
603-011-00-4 |
2-methoxyethanol; ethylene glycol monomethyl ether |
203-713-7 |
Flam. Liq. 3 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H360FD H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H360FD H332 H312 H302 |
|
|
|
|
|
603-012-00-X |
2-ethoxyethanol; ethylene glycol monoethyl ether |
203-804-1 |
Flam. Liq. 3 Repr. 1B Acute Tox. 3 Acute Tox. 4 |
H226 H360FD H331 H302 |
GHS02 GHS08 GHS06 Dgr |
H226 H360FD H331 H302 |
|
|
|
|
|
603-013-00-5 |
2-isopropoxyethanol; ethylene glycol monoisopropyl ether |
203-685-6 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 |
H332 H312 H319 |
GHS07 Wng |
H332 H312 H319 |
|
|
|
|
|
603-014-00-0 |
2-butoxyethanol; ethylene glycol monobutyl ether |
203-905-0 |
Acute Tox. 3 Acute Tox. 4 Skin Irrit. 2 Eye Irrit. 2 |
H331 H302 H315 H319 |
GHS06 Dgr |
H331 H302 H315 H319 |
|
inhalation: ATE = 3 mg/L (Vapours) oral: ATE = 1 200 mg/kg bw |
|
|
|
603-015-00-6 |
allyl alcohol |
203-470-7 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H225 H331 H311 H301 H319 H335 H315 H400 |
GHS02 GHS06 GHS09 Dgr |
H225 H331 H311 H301 H319 H335 H315 H400 |
|
|
|
|
|
603-016-00-1 |
4-hydroxy-4-methylpentan-2-one; diacetone alcohol |
204-626-7 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
Eye Irrit. 2; H319: C≥ 10 % |
|
|
|
603-018-00-2 |
furfuryl alcohol |
202-626-1 |
Carc. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 STOT SE 3 |
H351 H331 H312 H302 H373** H319 H335 |
GHS06 GHS08 Dgr |
H351 H331 H312 H302 H373** H319 H335 |
|
|
|
|
|
603-019-00-8 |
dimethyl ether |
204-065-8 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
603-020-00-3 |
ethyl methyl ether |
— |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U |
|
|
603-021-00-9 |
methyl vinyl ether |
203-475-4 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
D U |
|
|
603-022-00-4 |
diethyl ether; ether |
200-467-2 |
Flam. Liq. 1 Acute Tox. 4 * STOT SE 3 |
H224 H302 H336 |
GHS02 GHS07 Dgr |
H224 H302 H336 |
EUH019 EUH066 |
|
|
|
|
603-023-00-X |
ethylene oxide; oxirane |
200-849-9 |
Flam. Gas 1 Press. Gas Carc. 1B Muta. 1B Repr. 1B Acute Tox. 3 Acute Tox. 3 STOT SE 3 STOT SE 3 STOT RE 1 Skin Corr. 1 Eye Dam. 1 |
H220 H350 H340 H360Fd H331 H301 H335 H336 H372 (nervous system) H314 H318 |
GHS02 GHS08 GHS06 GHS05 Dgr |
H220 H350 H340 H360Fd H331 H301 H335 H336 H372 (nervous system) H314 |
|
inhalation: ATE = 700ppm (gases) oral: ATE = 100 mg/kg bw |
U |
|
|
603-024-00-5 |
1,4-dioxane |
204-661-8 |
Flam. Liq. 2 Carc. 1B STOT SE 3 Eye Irrit. 2 |
H225 H350 H335 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H335 H319 |
EUH019 EUH066 |
|
D |
|
|
603-025-00-0 |
tetrahydrofuran |
203-726-8 |
Flam. Liq. 2 Carc. 2 Eye Irrit. 2 STOT SE 3 |
H225 H351 H319 H335 |
GHS02 GHS07 GHS08 Dgr |
H225 H351 H319 H335 |
EUH019 |
STOT SE 3; H335: C≥25 % Eye Irrit.2; H319: C ≥ 25 % |
|
|
|
603-026-00-6 |
1-chloro-2,3-epoxypropane; epichlorhydrin |
203-439-8 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H226 H350 H331 H311 H301 H314 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H350 H331 H311 H301 H314 H317 |
|
* |
|
|
|
603-027-00-1 |
ethanediol; ethylene glycol |
203-473-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
603-028-00-7 |
2-chloroethanol; ethylene chlorohydrin |
203-459-7 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
|
603-029-00-2 |
bis(2-chloroethyl) ether |
203-870-1 |
Carc. 2 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H351 H330 H310 H300 |
GHS06 GHS08 Dgr |
H351 H330 H310 H300 |
|
|
|
|
|
603-030-00-8 |
2-aminoethanol; ethanolamine |
205-483-3 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H332 H312 H302 H314 |
GHS05 GHS07 Dgr |
H332 H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
603-031-00-3 |
1,2-dimethoxyethane; ethylene glycol dimethyl ether; EGDME |
203-794-9 |
Flam. Liq. 2 Repr. 1B Acute Tox. 4 * |
H225 H360FD H332 |
GHS02 GHS08 GHS07 Dgr |
H225 H360FD H332 |
EUH019 |
|
|
|
|
603-032-00-9 |
ethylene dinitrate; ethylene glycol dinitrate |
211-063-0 |
Unst. Expl. Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 |
H200 H330 H310 H300 H373** |
GHS01 GHS06 GHS08 Dgr |
H200 H330 H310 H300 H373** |
|
|
|
|
|
603-033-00-4 |
oxydiethylene dinitrate; diethylene glycol dinitrate; digol dinitrate |
211-745-8 |
Unst. Expl Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H200 H330 H310 H300 H373 ** H412 |
GHS01 GHS06 GHS08 Dgr |
H200 H330 H310 H300 H373 ** H412 |
|
|
|
|
|
603-033-01-1 |
oxydiethylene dinitrate; diethylene glycol dinitrate; digol dinitrate; [>25 % phlegmatiser] |
211-745-8 |
Expl. 1.1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 3 |
H201 H330 H310 H300 H373 ** H412 |
GHS01 GHS06 GHS08 Dgr |
H201 H330 H310 H300 H373 ** H412 |
|
|
|
|
|
603-034-00-X |
glycerol trinitrate; nitroglycerine |
200-240-8 |
Unst. Expl. Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H200 H330 H310 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H200 H330 H310 H300 H373 ** H411 |
|
|
|
|
|
603-034-01-7 |
glycerol trinitrate; nitroglycerine; [>40 % phlegmatiser] |
200-240-8 |
Expl. 1.1 Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * STOT RE 2 * Aquatic Chronic 2 |
H201 H330 H310 H300 H373 ** H411 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H330 H310 H300 H373 ** H411 |
|
|
|
|
|
603-035-00-5 |
pentaerythritol tetranitrate; pentaerythrite tetranitrate; P.E.T.N. |
201-084-3 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
|
603-035-01-2 |
pentaerythritol tetranitrate; pentaerythrite tetranitrate; P.E.T.N.;[>20 % phlegmatiser] |
201-084-3 |
Expl. 1.1 |
H201 |
GHS01 Dgr |
H201 |
|
|
T |
|
|
603-036-00-0 |
mannitol hexanitrate; nitromannite |
239-924-6 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
|
|
|
603-036-01-8 |
mannitol hexanitrate; nitromannite;[>40 % phlegmatiser] |
239-924-6 |
Expl. 1.1 |
H201 |
GHS01 Dgr |
H201 |
|
|
|
|
|
603-037-00-6 |
cellulose nitrate; nitrocellulose |
— |
— |
Expl. 1.1 |
H201 |
GHS01 Dgr |
H201 |
|
|
T |
|
603-038-00-1 |
allyl glycidyl ether; allyl 2,3-epoxypropyl ether; prop-2-en-1-yl 2,3-epoxypropyl ether |
203-442-4 |
Flam. Liq. 3 Carc. 2 Muta. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H226 H351 H341 H361f *** H332 H302 H335 H315 H318 H317 H412 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H351 H341 H361f *** H332 H302 H335 H315 H318 H317 H412 |
|
|
|
|
|
603-039-00-7 |
butyl glycidyl ether; butyl 2,3-epoxypropyl ether |
219-376-4 |
Flam. Liq. 3 Carc. 2 Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Chronic 3 |
H226 H351 H341 H332 H302 H335 H317 H412 |
GHS02 GHS08 GHS07 Wng |
H226 H351 H341 H332 H302 H335 H317 H412 |
|
|
|
|
|
603-040-00-2 |
sodium methanolate; sodium methoxide; [1] potassium methanolate; potassium methoxide; [2] lithium methanolate; lithium methoxide [3] |
204-699-5 [1] 212-736-1 [2] 212-737-7 [3] |
124-41-4 [1] 865-33-8 [2] 865-34-9 [3] |
Self-heat 1 Skin Corr. 1B |
H251 H314 |
GHS02 GHS05 Dgr |
H251 H314 |
EUH014 |
|
T |
|
603-041-00-8 |
potassium ethanolate; potassium ethoxide; [1] sodium ethanolate; sodium ethoxide [2] |
213-029-0 [1] 205-487-5 [2] |
917-58-8 [1] 141-52-6 [2] |
Self-heat 1 Skin Corr. 1B |
H251 H314 |
GHS02 GHS05 Dgr |
H251 H314 |
EUH014 |
|
T |
|
603-042-00-3 |
aluminium-tri-isopropoxide |
209-090-8 |
Flam. Sol. 1 |
H228 |
GHS02 Dgr |
H228 |
|
|
T |
|
|
603-043-00-9 |
triarimol (ISO); 2,4-dichloro-α-(pyrimidin-5-yl)benzhydryl alcohol |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
603-044-00-4 |
dicofol (ISO); 2,2,2-trichloro-1,1-bis(4-chlorophenyl)ethanol |
204-082-0 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H315 H317 H410 |
|
|
|
|
|
603-045-00-X |
diisopropyl ether; [1] dipropyl ether [2] |
203-560-6 [1] 203-869-6 [2] |
108-20-3 [1] 111-43-3 [2] |
Flam. Liq. 2 STOT SE 3 |
H225 H336 |
GHS02 GHS07 Dgr |
H225 H336 |
EUH019 EUH066 |
|
C |
|
603-046-00-5 |
bis(chloromethyl) ether; oxybis(chloromethane) |
208-832-8 |
Flam. Liq. 2 Carc. 1A Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * |
H225 H350 H330 H311 H302 |
GHS02 GHS06 GHS08 Dgr |
H225 H350 H330 H311 H302 |
|
Carc. 1A; H350: C ≥ 0,001 % |
|
|
|
603-047-00-0 |
2-dimethylaminoethanol; N,N-dimethylethanolamine |
203-542-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H312 H302 H314 |
|
STOT SE 3; H335: C≥5 % |
|
|
|
603-048-00-6 |
2-diethylaminoethanol; N,N-diethylethanolamine |
202-845-2 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H312 H302 H314 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H314 |
|
STOT SE 3; H335: C≥5 % |
|
|
|
603-049-00-1 |
chlorfenethol (ISO); 1,1-bis (4-chlorophenyl) ethanol |
201-246-3 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
603-050-00-7 |
1-(2-butoxypropoxy)propan-2-ol |
246-011-6 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
603-051-00-2 |
2-ethylbutan-1-ol |
202-621-4 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
603-052-00-8 |
3-butoxypropan-2-ol; propylene glycol monobutyl ether |
225-878-4 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
|
603-053-00-3 |
2-methylpentane-2,4-diol |
203-489-0 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
|
603-054-00-9 |
di-n-butyl ether; dibutyl ether |
205-575-3 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 3 |
H226 H319 H335 H315 H412 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H412 |
|
STOT SE 3; H335: C≥10 % |
|
|
|
603-055-00-4 |
propylene oxide; 1,2-epoxypropane; methyloxirane |
200-879-2 |
Flam. Liq. 1 Carc. 1B Muta. 1B Acute Tox. 3 Acute Tox. 3 Acute Tox. 4 STOT SE 3 Eye Irrit. 2 |
H224 H350 H340 H331 H311 H302 H335 H319 |
GHS02 GHS08 GHS06 Dgr |
H224 H350 H340 H331 H311 H302 H335 H319 |
|
|
|
|
|
603-056-00-X |
[(p-tolyloxy)methyl]oxirane; [1] [(m-tolyloxy)methyl]oxirane; [2]2,3-epoxypropyl o-tolyl ether; [3] [(tolyloxy)methyl]oxirane; cresyl glycidyl ether [4] |
218-574-8 [1] 218-575-3 [2] 218-645-3 [3] 247-711-4 [4] |
2186-24-5 [1] 2186-25-6 [2] 2210-79-9 [3] 26447-14-3 [4] |
Muta. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H341 H315 H317 H411 |
GHS08 GHS07 GHS09 Wng |
H341 H315 H317 H411 |
|
|
C |
|
603-057-00-5 |
benzyl alcohol |
202-859-9 |
Acute Tox. 4 Eye Irrit. 2 Skin Sens. 1B |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
oral: ATE = 1 200 mg/kg bw |
|
|
|
603-058-00-0 |
1,3-propylene oxide |
207-964-3 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H312 H302 |
GHS02 GHS07 Dgr |
H225 H332 H312 H302 |
|
|
|
|
|
603-059-00-6 |
hexan-1-ol |
203-852-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
603-060-00-1 |
2,2'-bioxirane; 1,2:3,4-diepoxybutane |
215-979-1 |
Carc. 1B Muta. 1B Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H350 H340 H330 H311 H301 H314 |
GHS06 GHS08 GHS05 Dgr |
H350 H340 H330 H311 H301 H314 |
|
|
|
|
|
603-061-00-7 |
tetrahydro-2-furyl-methanol; tetrahydrofurfuryl alcohol |
202-625-6 |
Repr. 1B Eye Irrit. 2 |
H360Df H319 |
GHS08 GHS07 Dgr |
H360Df H319 |
|
|
|
|
|
603-062-00-2 |
tetrahydrofuran-2,5-diyldimethanol |
203-239-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥10 % |
|
|
|
603-063-00-8 |
2,3-epoxypropan-1-ol; glycidol; oxiranemethanol |
209-128-3 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H350 H341 H360F *** H331 H312 H302 H319 H335 H315 |
GHS06 GHS08 Dgr |
H350 H341 H360F *** H331 H312 H302 H319 H335 H315 |
|
|
|
|
|
603-064-00-3 |
1-methoxy-2-propanol; monopropylene glycol methyl ether |
203-539-1 |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
|
|
|
|
|
603-065-00-9 |
m-bis(2,3-epoxypropoxy)benzene; resorcinol diglycidyl ether |
202-987-5 |
Carc. 1B Muta. 2 Acute Tox. 3 Acute Tox. 4 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H311 H302 H315 H319 H317 H412 |
GHS08 GHS06 Dgr |
H350 H341 H311 H302 H315 H319 H317 H412 |
|
dermal: ATE = 300 mg/kg bw oral: ATE = 500 mg/kg bw |
|
|
|
603-066-00-4 |
7-oxa-3-oxiranylbicyclo[4.1.0]heptane; 1,2-epoxy-4-epoxyethylcyclohexane; 4-vinylcyclohexene diepoxide |
203-437-7 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 Acute Tox. 4 |
H350 H341 H360F H331 H302 |
GHS08 GHS06 Dgr |
H350 H341 H360F H331 H302 |
|
inhalation: ATE = 0,5 mg/l (dusts or mists) oral: ATE = 1 847 mg/kg bw |
|
|
|
603-067-00-X |
phenyl glycidyl ether; 2,3-epoxypropyl phenyl ether;1,2-epoxy-3-phenoxypropane |
204-557-2 |
Carc. 1B Muta. 2 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H332 H335 H315 H317 H412 |
GHS08 GHS07 Dgr |
H350 H341 H332 H335 H315 H317 H412 |
|
|
|
|
|
603-068-00-5 |
2,3-epoxypropyl-2-ethylcyclohexyl ether; ethylcyclohexylglycidyl ether |
— |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
|
603-069-00-0 |
2,4,6-tris(dimethylaminomethyl)phenol |
202-013-9 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
|
603-070-00-6 |
2-amino-2-methylpropanol |
204-709-8 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
|
603-071-00-1 |
2,2'-iminodiethanol; diethanolamine |
203-868-0 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H302 H373 ** H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 |
|
|
|
|
|
603-072-00-7 |
1,4-bis(2,3 epoxypropoxy)butane; butanedioldiglycidyl ether |
219-371-7 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H332 H312 H319 H315 H317 |
GHS07 Wng |
H332 H312 H319 H315 H317 |
|
|
|
|
|
603-073-00-2 |
bis-[4-(2,3-epoxipropoxi)phenyl]propane |
216-823-5 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
Eye Irrit. 2; H319: C≥ 5 % Skin Irrit. 2; H315: C≥5 % |
|
|
|
603-074-00-8 |
reaction product: bisphenol-A-(epichlorhydrin); epoxy resin (number average molecular weight ≤ 700) |
500-033-5 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H315 H317 H411 |
|
Eye Irrit. 2; H319: C ≥ 5 % Skin Irrit 2; H315: C≥ 5 % |
|
|
|
603-075-00-3 |
chlormethyl methyl ether; chlorodimethyl ether |
203-480-1 |
Flam. Liq. 2 Carc. 1A Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H332 H312 H302 |
|
|
|
|
|
603-076-00-9 |
but-2-yne-1,4-diol; 2-butyne-1,4-diol |
203-788-6 |
Skin Corr. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 |
H314 H331 H301 H312 H373 ** H317 |
GHS06 GHS05 GHS08 Dgr |
H314 H331 H301 H312 H373 ** H317 |
|
Skin Corr. 1B; H314: C≥50 % Skin Irrit. 2; H315: 25 %≤ C < 50 % Eye Irrit. 2; H319: 25 %≤ C<50 % |
D |
|
|
603-077-00-4 |
1-dimethylaminopropan-2-ol; dimepranol (INN) |
203-556-4 |
Flam. Liq. 3 Acute Tox. 4 * Skin Corr. 1B |
H226 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H302 H314 |
|
|
|
|
|
603-078-00-X |
prop-2-yn-1-ol; propargyl alcohol |
203-471-2 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H311 H301 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H311 H301 H314 H411 |
|
|
|
|
|
603-079-00-5 |
2,2'-(methylimino)diethanol; N-methyldiethanolamine |
203-312-7 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-080-00-0 |
2-methylaminoethanol; N-methylethanolamine; N-methyl-2-ethanolamine; N-methyl-2-amino ethanol; 2-(methylamino)ethanol |
203-710-0 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
STOT SE 3; H335: C≥5 % |
|
|
|
603-081-00-6 |
2,2'-thiodiethanol; thiodiglycol |
203-874-3 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-082-00-1 |
1-aminopropan-2-ol; isopropanolamine |
201-162-7 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
603-083-00-7 |
1,1'-iminodipropan-2-ol; di-isopropanolamine |
203-820-9 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-084-00-2 |
styrene oxide;(epoxyethyl)benzene; phenyloxirane |
202-476-7 |
Carc. 1B Acute Tox. 4 * Eye Irrit. 2 |
H350 H312 H319 |
GHS08 GHS07 Dgr |
H350 H312 H319 |
|
|
|
|
|
603-085-00-8 |
bronopol (INN); 2-bromo-2-nitropropane-1,3-diol |
200-143-0 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H312 H302 H335 H315 H318 H400 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H335 H315 H318 H400 |
|
M=10 |
|
|
|
603-086-00-3 |
ethirimol (ISO); 5-butyl-2-ethylamino-6-methylpyrimidin-4-ol |
245-949-3 |
Acute Tox. 4 * |
H312 |
GHS07 Wng |
H312 |
|
|
|
|
|
603-087-00-9 |
2-ethylhexane-1,3-diol; octylene glycol; ethoexadiol |
202-377-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
603-088-00-4 |
2-(octylthio)ethanol; 2-hydroxyethyl octyl sulphide |
222-598-4 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
603-089-00-X |
7,7-dimethyl-3-oxa-6-azaoctan-1-ol |
400-390-6 |
— |
Skin Corr. 1A Acute Tox. 4 * |
H314 H302 |
GHS05 GHS07 Dgr |
H314 H302 |
|
|
|
|
603-090-00-5 |
2-(2-bromoethoxy)anisole |
402-010-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
603-091-00-0 |
exo-1-methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptan-2-ol |
402-470-6 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
|
603-092-00-6 |
2-methyl-4-phenylpentanol |
402-770-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
603-093-00-1 |
cinmethylin (ISO); exo-(±)-1-methyl-2-(2-methylbenzyloxy)-4-isopropyl-7-oxabicyclo(2.2.1)heptane |
402-410-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Dgr |
H332 H411 |
|
|
|
|
|
603-094-00-7 |
1,3-bis(2,3-epoxypropoxy)-2,2-dimethylpropane |
241-536-7 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
|
603-095-00-2 |
2-(propyloxy)ethanol; EGPE |
220-548-6 |
Acute Tox. 4 * Eye Irrit. 2 |
H312 H319 |
GHS07 Wng |
H312 H319 |
|
|
|
|
|
603-096-00-8 |
2-(2-butoxyethoxy)ethanol; diethylene glycol monobutyl ether |
203-961-6 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-097-00-3 |
1,1’,1’-nitrilotripropan-2-ol; triisopropanolamine |
204-528-4 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-098-00-9 |
2-phenoxyethanol |
204-589-7 |
Acute Tox. 4 STOT SE 3 Eye Dam. 1 |
H302 H335 H318 |
GHS05 GHS07 Dgr |
H302 H335 H318 |
|
oral: ATE = 1 394 mg/kg bw |
|
|
|
603-099-00-4 |
3-(N-methyl-N-(4-methylamino-3-nitrophenyl)amino)propane-1,2-diol hydrochloride |
403-440-5 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
603-100-00-8 |
1,2-dimethoxypropane |
404-630-0 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH019 |
|
|
|
|
603-101-00-3 |
tetrahydro-2-isobutyl-4-methylpyran-4-ol, mixed isomers (cis and trans) |
405-040-6 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
603-102-00-9 |
1,2-epoxybutane |
203-438-2 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4* Acute Tox. 4* Acute Tox. 4* STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H225 H351 H302 H312 H332 H335 H315 H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H302 H312 H332 H335 H315 H319 |
|
|
|
|
|
603-103-00-4 |
oxirane, mono[(C12-14-alkyloxy)methyl] derivs. |
271-846-8 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
|
603-104-00-X |
fenarimol (ISO); 2,4'-dichloro-α-(pyrimidin-5-yl)benzhydryl alcohol |
262-095-7 |
Repr. 2 Lact. Aquatic Chronic 2 |
H361fd H362 H411 |
GHS08 GHS09 Wng |
H361fd H362 H411 |
|
|
|
|
|
603-105-00-5 |
furan |
203-727-3 |
Flam. Liq. 1 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Aquatic Chronic 3 |
H224 H350 H341 H332 H302 H373 ** H315 H412 |
GHS02 GHS08 GHS07 Dgr |
H224 H350 H341 H332 H302 H373 ** H315 H412 |
EUH019 |
|
|
|
|
603-106-00-0 |
2-methoxypropanol |
216-455-5 |
Flam. Liq. 3 Repr. 1B STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H360D *** H335 H315 H318 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H226 H360D *** H335 H315 H318 |
|
|
|
|
|
603-107-00-6 |
2-(2-methoxyethoxy)ethanol; diethylene glycol monomethyl ether |
203-906-6 |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
Repr. 1B; H360D: C ≥ 3 % |
|
|
|
603-108-00-1 |
2-methylpropan-1-ol; iso-butanol |
201-148-0 |
Flam. Liq. 3 STOT SE 3 Skin Irrit. 2 Eye Dam. 1 STOT SE 3 |
H226 H335 H315 H318 H336 |
GHS02 GHS05 GHS07 Dgr |
H226 H335 H315 H318 H336 |
|
|
|
|
|
603-109-00-7 |
reaction mass of: 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane; 1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane |
425-340-0 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-110-00-2 |
reaction mass of: cis-2-isobutyl-5-methyl 1,3-dioxane; trans-2-isobutyl-5-methyl 1,3-dioxane |
426-130-1 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
603-111-00-8 |
reaction mass of: 1-(1,1-dimethylpropyl)-4-ethoxy-cis-cyclohexane; 1-(1,1-dimethylpropyl)-4-ethoxy-trans-cyclohexane |
426-530-6 |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
603-112-00-3 |
cyclopentyl 2-phenylethyl ether |
428-340-9 |
— |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
603-113-00-9 |
6-glycidyloxynapht-1-yl oxymethyloxirane |
429-960-2 |
Muta. 2 Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H341 H312 H315 H317 H412 |
GHS08 GHS07 Wng |
H341 H312 H315 H317 H412 |
|
|
|
|
|
603-114-00-4 |
9-(2-propenyloxy)tricyclo[5.2.1.0(2,6)]dec-3(or-4-)-ene |
430-830-2 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
603-115-00-X |
reaction mass of: O, O',O''-(methylsilanetriyl)tris(4-methyl-2-pentanone oxime) (3 stereoisomers) |
423-580-0 |
— |
STOT RE 2 * Aquatic Chronic 4 |
H373** H413 |
GHS08 Wng |
H373** H413 |
|
|
|
|
603-116-00-5 |
(Z)-(2,4-difluorophenyl)piperidin-4-ylmethanone oxime monohydrochloride |
424-740-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
603-117-00-0 |
propan-2-ol; isopropyl alcohol; isopropanol |
200-661-7 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
|
|
|
|
|
603-118-00-6 |
6-dimethylaminohexan-1-ol |
404-680-3 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H302 H314 H412 |
|
|
|
|
|
603-119-00-1 |
1,1'-(1,3-phenylenedioxy)bis(3-(2-(prop-2-enyl)phenoxy)propan-2-ol) |
405-840-5 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
603-120-00-7 |
2-methyl-5-phenylpentanol |
405-890-8 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
|
603-121-00-2 |
4-[4-(1,3-dihydroxyprop-2-yl)phenylamino]-1,8-dihydroxy-5-nitroanthraquinone |
406-057-1 |
Carc. 2 Skin Sens. 1 Aquatic Chronic 4 |
H351 H317 H413 |
GHS08 GHS07 Wng |
H351 H317 H413 |
|
|
|
|
|
603-122-00-8 |
sodium 2-ethylhexanolate |
406-150-7 |
Flam. Sol. 1 Skin Corr. 1B Aquatic Chronic 3 |
H228 H314 H412 |
GHS02 GHS05 Dgr |
H228 H314 H412 |
|
|
T |
|
|
603-123-00-3 |
4-methyl-8-methylenetricyclo[3.3.1.1 3,7]decan-2-ol |
406-330-5 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
|
603-124-00-9 |
1,4-bis[2-(vinyloxy)ethoxy]benzene |
406-900-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-125-00-4 |
2-(2,4-dichlorophenyl)-1-(1H—1,2,4-triazol-1-yl)pent-4-en-2-ol |
407-850-5 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
603-126-00-X |
2-((4-methyl-2-nitrophenyl)amino)ethanol |
408-090-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
|
603-127-00-5 |
butan-2-ol; [1](S)-butan-2-ol; [2] (R)-butan-2-ol; [3](±)-butan-2-ol [4] |
201-158-5 [1] 224-168-1 [2] 238-967-8 [3] 240-029-8 [4] |
78-92-2 [1] 4221-99-2 [2] 14898-79-4 [3] 15892-23-6 [4] |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 STOT SE 3 |
H226 H319 H335 H336 |
GHS02 GHS07 Wng |
H226 H319 H335 H336 |
|
|
C |
|
603-128-00-0 |
2-(phenylmethoxy)naphthalene |
405-490-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-129-00-6 |
1-tert-butoxypropan-2-ol |
406-180-0 |
Flam. Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
|
|
|
|
|
603-130-00-1 |
reaction mass of isomers of: α-((dimethyl)biphenyl)-ω-hydroxypoly(oxyethylene) |
406-325-8 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-131-00-7 |
reaction mass of: 1-deoxy-1-[methyl-(1-oxododecyl)amino]-D-glucitol; 1-deoxy-1-[methyl-(1-oxotetradecyl)amino]-D-glucitol (3:1) |
407-290-1 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-132-00-2 |
2-hydroxymethyl-9-methyl-6-(1-methylethyl)-1,4-dioxaspiro[4.5]decane |
408-200-3 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
|
603-133-00-8 |
reaction mass of: 3-[(4-amino-2-chloro-5-nitrophenyl)amino]-propane-1,2-diol; 3,3'-(2-chloro-5-nitro-1,4-phenylenediimino)bis(propan-1,2-diol) |
408-240-1 |
— |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
603-134-00-3 |
reaction mass of substituted dodecyl and/or tetradecyl, diphenyl ethers. The substance is produce by the Friedel Crafts reaction. The catalyst is removed from the reaction product. Diphenyl ether is substituted by C1-C10 alkyl groups. The alkyl groups are bonded randomly between C1 and C6 Linear C12 and C14, 50/50 used. |
410-450-3 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-135-00-9 |
bis[[2,2',2''-nitrilotris-[ethanolato]]-1-N,O]-bis[2-(2-methoxyethoxy)ethoxy]-titanium |
410-500-4 |
— |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
603-136-00-4 |
3-((4-(bis(2-hydroxyethyl)amino)-2-nitrophenyl)amino)-1-propanol |
410-910-3 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
603-137-00-X |
reaction mass of:1-deoxy-1-[methyl-(1-oxohexadecyl)amino]-D-glucitol; 1-deoxy-1-[methyl-(1-oxooctadecyl)amino]-D-glucitol |
411-130-6 |
— |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
603-138-00-5 |
3-(2,2-dimethyl-3-hydroxypropyl)toluene;(alt.): 2,2-dimethyl-3-(3-methylphenyl)propanol |
403-140-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
603-139-00-0 |
bis(2-methoxyethyl) ether |
203-924-4 |
Flam. Liq. 3 Repr. 1B |
H226 H360FD |
GHS02 GHS08 Dgr |
H226 H360FD |
EUH019 |
|
|
|
|
603-140-00-6 |
2,2' -oxybisethanol; diethylene glycol |
203-872-2 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
603-141-00-1 |
reaction mass of: dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]pentadecane; dodecyloxy-1-methyl-1-[oxy-poly-(2-hydroxymethylethanoxy)]heptadecane |
413-780-6 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-142-00-7 |
2-(2-(2-hydroxyethoxy)ethyl)-2-aza-bicyclo[2.2.1]heptane |
407-360-1 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H373 ** H315 H318 |
GHS06 GHS08 GHS05 Dgr |
H312 H302 H373 ** H315 H318 |
|
|
|
|
|
603-143-00-2 |
R—2,3-epoxy-1-propanol |
404-660-4 |
Self-react. C **** Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H242 H350 H341 H360F *** H331 H312 H302 H314 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H242 H350 H341 H360F *** H331 H312 H302 H314 |
|
|
|
|
|
603-144-00-8 |
Reaction mass of: 2,6,9-trimethyl-2,5,9-cyclododecatrien-1-ol; 6,9-dimethyl-2-methylen-5,9-cyclododecadien-1-ol |
413-530-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
603-145-00-3 |
2-isopropyl-2-(1-methylbutyl)-1,3-dimethoxypropane |
406-970-5 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
603-146-00-9 |
2-[(2-[2-(dimethylamino)ethoxy]ethyl)methylamino]ethanol |
406-080-7 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 3 |
H302 H314 H412 |
GHS05 GHS07 Dgr |
H302 H314 H412 |
|
|
|
|
|
603-147-00-4 |
(-)-trans-4-(4'-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine |
406-030-4 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
603-148-00-X |
1,4-bis[(vinyloxy)methyl]cyclohexane |
413-370-7 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
603-149-00-5 |
reaction mass of: diastereoisomers of 1-(1-hydroxyethyl)-4-(1-methylethyl)cyclohexane |
407-640-3 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
|
603-150-00-0 |
(±) trans—3,3-dimethyl-5-(2,2,3-trimethyl-cyclopent-3-en-1-yl)-pent-4-en-2-ol |
411-580-3 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
603-151-00-6 |
(±)-2-(2,4-dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propan-1-ol |
413-570-4 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-152-00-1 |
2-(4-tert-butylphenyl)ethanol |
410-020-5 |
Repr. 2 STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H361f *** H373 ** H318 H411 |
GHS08 GHS05 GHS09 Dgr |
H361f *** H373 ** H318 H411 |
|
|
|
|
|
603-153-00-7 |
3-((2-nitro-4-(trifluoromethyl)phenyl)amino)propane-1,2-diol |
410-010-0 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
603-154-00-2 |
1-[(2-tert-butyl)cyclohexyloxy]-2-butanol |
412-300-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
▼M1 ————— |
||||||||||
|
603-156-00-3 |
2-(2,4-dichlorophenyl)-2-(2-propenyl)oxirane |
411-210-0 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
|
603-157-00-9 |
6,9-bis(hexadecyloxymethyl)-4,7-dioxanonane-1,2,9-triol |
411-450-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-158-00-4 |
reaction mass of: 4 diastereoisomers of 2,7-dimethyl-10-(1-methylethyl)-1-oxaspiro[4.5]deca-3,6-diene |
412-460-3 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
603-159-00-X |
2-cyclododecylpropan-1-ol |
411-410-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-160-00-5 |
1,2-diethoxypropane |
412-180-1 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH019 |
|
|
|
|
603-161-00-0 |
1,3-diethoxypropane |
413-140-6 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
|
603-162-00-6 |
α[2-[[[(2-hydroxyethyl)methylamino]acetyl]amino]propyl]-ω nonylphenoxy)poly[oxo(methyl-1,2-ethanediyl)] |
413-420-8 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
|
603-163-00-1 |
2-phenyl-1,3-propanediol |
411-810-2 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
603-164-00-7 |
2-butyl-4-chloro-4,5-dihydro-5-hydroxymethyl-1-[2'-(2-triphenylmethyl-1,2,3,4-2H-tetrazol-5-yl)-1,1'-biphenyl-4-methyl]-1H-imidazole |
412-420-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-165-00-2 |
reaction mass of: 4-allyl-2,6-bis(2,3-epoxypropyl)phenol; 4-allyl-6-[3-[6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol; 4-allyl-6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol; 4-allyl-6-[3-[6-[3-(4-allyl-2,6-bis(2,3-epoxypropyl)phenoxy)-2-hydroxypropyl]-4-allyl-2-(2,3-epoxypropyl)phenoxy]-2-hydroxypropyl]-2-(2,3-epoxypropyl)phenol |
417-470-1 |
— |
Muta. 2 Skin Sens. 1 |
H341 H317 |
GHS08 GHS07 Wng |
H341 H317 |
|
|
|
|
603-166-00-8 |
R-1-chloro-2,3-epoxypropane |
424-280-2 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H226 H350 H331 H311 H301 H314 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H350 H331 H311 H301 H314 H317 |
|
|
|
|
|
603-167-00-3 |
3,3',5,5'-tetra-tert-butylbiphenyl-2,2'-diol |
407-920-5 |
Aquatic Chronic 4 |
H413 |
GHS05 Dgr |
H413 |
|
|
|
|
|
603-168-00-9 |
3-(2-ethylhexyloxy)propane-1,2-diol |
408-080-2 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
603-169-00-4 |
(±)-trans-4-(4-fluorophenyl)-3-hydroxymethyl-N-methylpiperidine |
415-550-0 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
603-170-00-X |
reaction mass of: 2-methyl-1-(6-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol; 2-methyl-1-(1-methylbicyclo[2.2.1]hept-5-en-2-yl)-pent-1-en-3-ol; 2-methyl-1-(5-methylbicyclo[2.2.1]hept-5-en-2-yl)pent-1-en-3-ol |
415-990-3 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
|
603-171-00-5 |
5-thiazolylmethanol |
414-780-9 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
603-172-00-0 |
mono-2-[2-(4-dibenzo[b, f][1,4]thiazepin-11-yl)piperazinium-1-yl]ethoxy)ethanol trans-butenedioate |
415-180-1 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
603-173-00-6 |
4,4-dimethyl-3,5,8-trioxabicyclo[5.1.0]octane |
421-750-9 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
|
603-174-00-1 |
4-cyclohexyl-2-methyl-2-butanol |
420-630-3 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
|
603-175-00-7 |
2-(2-hexyloxyethoxy)ethanol; DEGHE; diethylene glycol monohexyl ether; 3,6-dioxa-1-dodecanol; hexyl carbitol; 3,6-dioxadodecan-1-ol |
203-988-3 |
Acute Tox. 4 * Eye Dam. 1 |
H312 H318 |
GHS05 GHS07 Dgr |
H312 H318 |
|
|
|
|
|
603-176-00-2 |
1,2-bis(2-methoxyethoxy)ethane; TEGDME; triethylene glycol dimethyl ether; triglyme |
203-977-3 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
EUH019 |
|
|
|
|
603-177-00-8 |
1-ethoxypropan-2-ol; 2PG1EE; 1-ethoxy-2-propanol; propylene glycol monoethyl ether; [1] 2-ethoxy-1-methylethyl acetate; 2PG1EEA [2] |
216-374-5 [1] 259-370-9 [2] |
1569-02-4 [1] 54839-24-6 [2] |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
|
|
|
|
603-178-00-3 |
2-hexyloxyethanol; ethylene glycol monohexyl ether; n-hexylglycol |
203-951-1 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
|
603-179-00-9 |
ergocalciferol (ISO); Vitamin D2 |
200-014-9 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 |
H330 H311 H301 H372 ** |
GHS06 GHS08 Dgr |
H330 H311 H301 H372 ** |
|
|
|
|
|
603-180-00-4 |
colecalciferol; cholecalciferol; vitamin D3 |
200-673-2 |
Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 STOT RE 1 |
H330 H310 H300 H372 |
GHS06 GHS08 Dgr |
H330 H310 H300 H372 |
|
inhalation: ATE = 0,05 mg/L (dusts or mists) dermal: ATE = 50 mg/kg bw oral: ATE = 35 mg/kg bw STOT RE 1; H372: C ≥ 3 % STOT RE 2; H373: 0,3 % ≤ C < 3 % |
|
|
|
603-181-00-X |
tert-butyl methyl ether; MTBE; 2-methoxy-2-methylpropane |
216-653-1 |
Flam. Liq. 2 Skin Irrit. 2 |
H225 H315 |
GHS02 GHS07 Dgr |
H225 H315 |
|
|
|
|
|
603-182-00-5 |
reaction product of: saturated, monounsaturated and multiple unsaturated long-chained partly estrified alcohols of vegetable origin (Brassica napus L., Brassica rapa L., Helianthus annuus L., Glycine hispida, Gossypium hirsutum L., Cocos nucifera L., Elaeis guineensis) with O, O-diisobutyldithiophosphate and 2-ethylhexylamine and hydrogen peroxide |
428-630-5 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
603-183-00-0 |
2-[2-(2-butoxyethoxy)ethoxy]ethanol; TEGBE; triethylene glycol monobutylether; butoxytriethylene glycol |
205-592-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
Eye Dam.1; H318: C≥30 % Eye Irrit. 2; H319: 20 % ≤C< 30 % |
|
|
|
603-184-00-6 |
2-(hydroxymethyl)-2-[[2-hydroxy-3-(isooctadecyloxy)propoxy]methyl]-1,3-propanediol |
416-380-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-185-00-1 |
2,4-dichloro-3-ethyl-6-nitrophenol |
420-740-1 |
Acute Tox. 3 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H317 H400 H410 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H317 H410 |
|
|
|
|
|
603-186-00-7 |
trans-(5RS,6SR)-6-amino-2,2-dimethyl-1,3-dioxepan-5-ol |
419-050-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
603-187-00-2 |
2-((4,6-bis(4-(2-(1-methylpyridinium-4-yl)vinyl)phenylamino)-1,3,5-triazin-2-yl)(2-hydroxyethyl)amino)ethanol dichloride |
419-360-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-188-00-8 |
reaction mass of: 6,7-epoxy-1,2,3,4,5,6,7,8-octahydro-1,1,2,4,4,7-hexamethylnaphthalene; 7,8-epoxy-1,2,3,4,6,7,8,8a-octahydro-1,1,2,4,4,7-hexamethylnaphthalene |
426-970-9 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
603-189-00-3 |
reaction mass of complexes of: titanium, 2,2'-oxydiethanol, ammonium lactate, nitrilotris(2-propanol) and ethylene glycol |
405-250-8 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-190-00-9 |
8,8-dimethyl-7-isopropyl-6,10-dioxaspiro[4.5]decane |
424-030-2 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
603-191-00-4 |
2-(4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl)-5-(3-((2-ethylhexyl)oxy)-2-hydroxypropoxy)phenol |
419-740-4 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-192-00-X |
(E,E)-3,7,11-trimethyldodeca-1,4,6,10-tetraen-3-ol |
423-240-1 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
603-193-00-5 |
disodium 9,10-anthracenedioxide |
426-030-8 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
603-194-00-0 |
2-(2-aminoethylamino)ethanol; (AEEA) |
203-867-5 |
Repr. 1B Skin Corr. 1B Skin Sens. 1 |
H360Df H314 H317 |
GHS05 GHS08 GHS07 Dgr |
H360Df H314 H317 |
|
STOT SE 3; H335: C≥5 % |
|
|
|
603-195-00-6 |
2-[4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]-phenol |
430-810-3 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
603-196-00-1 |
2-(7-ethyl-1H-indol-3-yl)ethanol |
431-020-1 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
|
603-197-00-7 |
tebuconazole (ISO); 1-(4-chlorophenyl)-4,4-dimethyl-3-(1,2,4-triazol-1-ylmethyl)pentan-3-ol |
403-640-2 |
Repr. 2 Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H361d*** H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d*** H302 H410 |
|
M = 1 M = 10 |
|
|
|
603-199-00-8 |
etoxazol (ISO); (RS)-5-tert-butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 100 |
|
|
|
603-200-00-1 |
1-pentanol; [1] 3-pentanol [2] |
200-752-1 [1] 209-526-7 [2] |
71-41-0 [1] 584-02-1 [2] |
Flam. Liq. 3 Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 |
H226 H332 H335 H315 |
GHS02 GHS07 Wng |
H226 H332 H335 H315 |
|
|
|
|
603-201-00-7 |
(E)-(7R,11R)-3,7,11,15-tetramethylhexadec-2-ene-1-ol |
416-120-5 |
— |
Skin Irrit. 2 Aquatic Chronic 4 |
H315 H413 |
GHS07 Wng |
H315 H413 |
|
|
|
|
603-202-00-2 |
4,4,5,5,5-pentafluoropentan-1-ol |
421-360-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
603-203-00-8 |
(1R,3S,7R,8R,10R,13R)-5,5,7,9,9,13-hexamethyl-4,6-dioxatetracyclo[6.5.1.01,10.03,7]tetradecane |
427-580-1 |
— |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
603-204-00-3 |
reaction mass of: 2,2'-(heptane-1,7-diyl)bis-1,3-dioxolane; 2,2'-(heptane-1,6-diyl)bis-1,3-dioxolane |
428-110-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-205-00-9 |
(1S-cis)-4-(2-amino-6-chloro-9H-purin-9-yl)-2-cyclopentene-1-methanol hydrochloride |
426-200-1 |
STOT RE 1 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H372** H302 H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H372** H302 H318 H317 H412 |
|
|
|
|
|
603-206-00-4 |
2,2-dichloro-1,3-benzodioxol |
426-850-6 |
Flam. Liq. 3 Skin Corr. 1A Acute Tox. 4 * Skin Sens. 1 |
H226 H314 H302 H317 |
GHS02 GHS05 GHS07 Dgr |
H226 H314 H302 H317 |
EUH014 |
|
|
|
|
603-207-00-X |
2-isobutyl-2-isopropyl-1,3-dimethoxypropane |
430-800-9 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
603-208-00-5 |
1,2-diethoxyethane |
211-076-1 |
Flam. Liq. 2 Repr. 1A Eye Irrit. 2 |
H225 H360Df H319 |
GHS02 GHS08 GHS07 Dgr |
H225 H360Df H319 |
EUH019 |
|
|
|
|
603-209-00-0 |
spinosad (ISO) (reaction mass of spinosyn A and spinosyn D in ratios between 95:5 to 50:50); reaction mass of 50-95 % of (2R, 3aS, 5aR, 5bS, 9S, 13S,14R, 16aS, 16bR)-2-(6-deoxy-2,3,4-tri-O-methyl-α-l-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-d-erythropyranosyloxy)-9-ethyl-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-14-methyl-1H-8-oxacyclododeca[b]as-indacene-7,15-dione and 50-5 % (2S, 3aR, 5aS,5bS, 9S, 13S, 14R, 16aS, 16bS)-2-(6-deoxy-2,3,4-tri-O-methyl-α-l-mannopyranosyloxy)-13-(4-dimethylamino-2,3,4,6-tetradeoxy-β-d-erythropyranosyloxy)-9-ethyl-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-4,14-dimethyl-1H-8-oxacyclododeca[b]as-indacene-7,15-dione; [1] spinosyn A; [2] spinosyn D [3] |
-[1] -[2] -[3] |
-[1] 131929-60-7 [2] 131929-63-0 [3] |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M=10 |
|
|
603-210-00-6 |
2,4-diethyl-1,5-pentanediol |
429-310-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
603-211-00-1 |
2,3-epoxypropyltrimethylammonium chloride … %; glycidyl trimethylammonium chloride … % |
221-221-0 |
Carc. 1B Muta. 2 Repr. 2 Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H350 H341 H361f*** H312 H302 H373** H318 H317 H412 |
GHS05 GHS08 GHS07 Dgr |
H350 H341 H361f*** H312 H302 H373** H318 H317 H412 |
|
|
B |
|
|
603-212-00-7 |
1,3,4,6,7,8-hexahydro-4,6,6,7,8,8-hexamethylindeno[5,6-c]pyran; galaxolide;(HHCB) |
214-946-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
603-213-00-2 |
2-methoxy-2-methylbutane; tert-amyl methyl ether |
213-611-4 |
Flam. Liq. 2 Acute Tox. 4 * STOT SE 3 |
H225 H302 H336 |
GHS02 GHS07 Dgr |
H225 H302 H336 |
|
|
|
|
|
603-214-00-8 |
1,1-diisopropoxycyclohexane |
413-740-8 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
603-215-00-3 |
1-hydroxy-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) |
418-330-2 |
Expl. 1.1**** Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H201 H302 H373** H318 H317 H400 H410 |
GHS01 GHS05 GHS08 GHS07 GHS09 Dgr |
H201 H302 H373** H318 H317 H410 |
|
|
|
|
|
603-216-00-9 |
cis-1-amino-2,3-dihydro-1H-inden-2-ol |
422-660-2 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
603-217-00-4 |
2,4,6-tri-tert-butylphenyl 2-butyl-2-ethyl-1,3-propanediolphosphite |
423-560-1 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
603-220-00-0 |
1-{]benzyl[}2-(2-methoxyphenoxy)ethyl]amino}-3-(9H-carbazol-4-yloxy)propan-2-ol |
432-890-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-221-00-6 |
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride; [containing < 0,1 % 4-chloroaniline (EC No 203-401-0)] |
433-580-2 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
|
|
|
|
|
603-221-01-3 |
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoro-1,1-ethanediol, hydrochloride; [containing ≥ 0,1 % 4-chloroaniline (EC No 203-401-0)] |
433-580-2 |
Carc. 1B Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H350 H302 H314 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H350 H302 H314 H411 |
|
|
|
|
|
603-222-00-1 |
(2R, 3S, 4R, 5R, 7R, 9R, 10R,11S, 12S, 13R)-10-[(4-dimethylamino-3-hydroxy-6-methyltetrahydropyran-2-yl)oxy]-2-ethyl-3,4,12-trihydroxy-9-methoxy-3,5,7,9,11,13-hexamethyl-6,14-dioxo-1-oxacyclotetradecane |
433-820-6 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
603-223-00-7 |
2-cyclopentylidene cyclopentanol 1,1'-bi(cyclopentyliden)-2-ol |
434-270-1 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
|
603-224-00-2 |
3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)-hexane |
435-790-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
603-225-00-8 |
erythromycin A9-oxime (E);(3R, 4S, 5S, 6R, 7R, 9R, 11R,12R, 13S, 14R)-4-((2,6-didesoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopiranosyl)oxy)-14-ethyl-7,12,13-trihydroxy-3,5,7,9,11,13-hexamethyl-6-((3,4,6-tridesoxy-3-dimethylamino-β-d-xylohexapiranosyl)oxy)oxacyclotetradecan-2-ona-10-oxime (E) |
437-070-0 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
603-226-00-3 |
4,4'(4-(4-methoxyphenyl)-1,3,5-triazin-2,4-diyl)bisbenzene-1,3-diol |
444-500-0 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
603-227-00-9 |
α-hydro-ω-[[[(1,1-dimethylethyl)dioxy]carbonyl]oxy]-poly[oxy(methyl-1,2-ethanediyl)] ether with 2,2-bis(hydroxymethyl)-1,3-propanediol (4:1); reaction product of: α-hydro-ω-((chlorocarbonyl)oxy)-poly(oxy(methyl-1,2-ethanediyl)) ether with 2,2-bis(hydroxymethyl)-1,3-propanediol with potassium 1,1-dimethylethylperoxalate |
445-060-2 |
**** Aquatic Acute 1 Aquatic Chronic 1 |
**** H400 H410 |
**** GHS09 Wng |
**** H410 |
|
|
|
|
|
603-228-00-4 |
(+/–)-(R*,R*)-6-fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran; 6-fluoro-2-(2-oxiranyl)chromane |
419-620-1 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
603-229-00-X |
sodium (Z)-3-chloro-3-(4-chlorophenyl)-1-hydroxy-2-propene-1-sulfonate |
420-800-7 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
603-230-00-5 |
2,6,6,7,8,8-hexamethyldecahydro-2H-indeno[4,5-b]furan |
440-030-5 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 4 |
H315 H318 H413 |
GHS05 Dgr |
H315 H318 H413 |
|
|
|
|
603-231-00-0 |
(S)-1,1-diphenyl-1,2-propanediol |
443-220-6 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
603-232-00-6 |
3,3,8,8,10,10-hexamethyl-9-[1-(4-oxiranylmethoxy-phenyl)-ethoxy]-1,5-dioxa-9-aza-spiro[5.5]undecane |
444-420-6 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
603-233-00-1 |
reaction mass of: 4-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)-3-methylbutan-2-ol; 4-(3,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)-3-methylbutan-2-ol; 1-(1,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)pentan-3-ol; 1-(3,3a,4,6,7,7a-hexahydro-4,7-methanoinden-5-ylidene)pentan-3-ol; (E)-4-(3a,4,5,6,7,7a-hexahydro-1H-4,7-methanoinden-5-yl)-3-methylbut-3-en-2-ol; (E)-4-(3a,4,5,6,7,7a-hexahydro-3H-4,7-methanoinden-5-yl)-3-methylbut-3-en-2-ol |
444-430-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
603-234-00-7 |
(1R, 4R)-4-methoxy-2,2,7,7-tetramethyltricyclo(6.2.1.0(1,6))undec-5-ene |
444-480-3 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
603-235-00-2 |
linalool; 3,7-dimethyl-1,6-octadien-3-ol; dl-linalool; [1] coriandrol; (S)-3,7-dimethyl-1,6-octadien-3-ol; d-linalool; [2] licareol; (R)-3,7-dimethyl-1,6-octadien-3-ol; l-linalool [3] |
201-134-4 [1] 204-810-7 [2] 204-811-2 [3] |
78-70-6 [1] 126-90-9 [2] 126-91-0 [3] |
Skin Sens. 1B |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
603-236-00-8 |
ethanol, 2,2’-iminobis-, N-(C13-15-branched and linear alkyl) derivs. |
308-208-6 |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
|
|
|
|
603-237-00-3 |
ipconazole (ISO); (1RS,2SR,5RS;1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
— |
Repr. 1B Acute Tox. 4 STOT RE 2 Aquatic Chronic 1 |
H360D H302 H373 (eyes, skin, liver) H410 |
GHS08 GHS07 GHS09 Dgr |
H360D H302 H373 (eyes, skin, liver) H410 |
|
oral: ATE = 500 mg/kg bw M = 100 |
|
|
|
603-238-00-9 |
bis(2-(2-methoxyethoxy)ethyl)ether; tetraglyme |
205-594-7 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
603-239-00-4 |
paclobutrazol (ISO); (2RS,3RS)-1-(4-chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pentan-3-ol |
— |
Repr. 2 Acute Tox. 4 Acute Tox. 4 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H332 H302 H319 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H332 H302 H319 H410 |
|
inhalation: ATE = 3,13 mg/L (dusts or mists) oral: ATE = 490 mg/kg bw M = 10 M = 10 |
|
|
|
603-240-00-X |
2,2-bis(bromomethyl)propane-1,3-diol |
221-967-7 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
|
|
|
|
603-241-00-5 |
geraniol; (2E)-3,7-dimethylocta-2,6-dien-1-ol |
203-377-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
603-243-00-6 |
2,2-dimethylpropan-1-ol, tribromo derivative; 3-bromo-2,2-bis(bromomethyl)propan-1-ol |
253-057-0 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
|
|
|
|
603-244-00-1 |
reaction mass of 1-(2,3-epoxypropoxy)–2,2-bis ((2,3-epoxypropoxy)methyl) butane and 1-(2,3-epoxypropoxy)-2-((2,3-epoxypropoxy)methyl)-2-hydroxymethyl butane |
— |
— |
Muta. 2 Repr. 1B |
H341 H360F |
GHS08 Dgr |
H341 H360F |
|
|
|
|
603-245-00-7 |
2,2'-[[3-methyl-4-[(4-nitrophenyl)azo]phenyl]imino]bisethanol |
221-665-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
603-246-00-2 |
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctan-1-ol |
211-477-1 |
STOT RE 2 Aquatic Chronic 1 |
H373 (teeth, bones) H410 |
GHS08 GHS09 Wng |
H373 (teeth, bones) H410 |
|
M = 1 |
|
|
|
604-001-00-2 |
phenol; carbolic acid; monohydroxybenzene; phenylalcohol |
203-632-7 |
Muta. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Corr. 1B |
H341 H331 H311 H301 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H341 H331 H311 H301 H373 ** H314 |
|
* Skin Corr. 1B; H314: C ≥ 3 % Skin Irrit. 2; H315 1 % ≤ C<3 % Eye Irrit. 2; H319:1 % ≤C<3 % |
|
|
|
604-002-00-8 |
pentachlorophenol |
201-778-6 |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H311 H301 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H330 H311 H301 H319 H335 H315 H410 |
|
|
|
|
|
604-003-00-3 |
sodiumpentachlorophenolate; [1] potassium pentachlorophenolate[2] |
205-025-2 [1] 231-911-3 [2] |
131-52-2 [1] 7778-73-6 [2] |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H330 H311 H301 H319 H335 H315 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H330 H311 H301 H319 H335 H315 H410 |
|
|
|
|
604-004-00-9 |
m-cresol; [1] o-cresol; [2] p-cresol; [3] mix-cresol [4] |
203-577-9 [1] 202-423-8 [2] 203-398-6 [3] 215-293-2 [4] |
108-39-4 [1] 95-48-7 [2] 106-44-5 [3] 1319-77-3 [4] |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H311 H301 H314 |
GHS06 GHS05 Dgr |
H311 H301 H314 |
|
* |
C |
|
604-005-00-4 |
1,4-dihydroxybenzene; hydroquinone; quinol |
204-617-8 |
Carc. 2 Muta. 2 Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 |
H351 H341 H302 H318 H317 H400 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H351 H341 H302 H318 H317 H400 |
|
M=10 |
|
|
|
604-006-00-X |
3,4-xylenol; [1] 2,5-xylenol; [2] 2,4-xylenol; [3] 2,3-xylenol; [4] 2,6-xylenol; [5] xylenol; [6] 2,4(or 2,5)-xylenol [7] |
202-439-5 [1] 202-461-5 [2] 203-321-6 [3] 208-395-3 [4] 209-400-1 [5] 215-089-3 [6] 276-245-4 [7] |
95-65-8 [1] 95-87-4 [2] 105-67-9 [3] 526-75-0 [4] 576-26-1 [5] 1300-71-6 [6] 71975-58-1 [7] |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H311 H301 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H301 H314 H411 |
|
|
C |
|
604-007-00-5 |
2-naphthol |
205-182-7 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
|
|
|
|
|
604-008-00-0 |
2-chlorophenol; [1] 4-chlorophenol; [2] 3-chlorophenol; [3] chlorophenol [4] |
202-433-2 [1] 203-402-6 [2] 203-582-6 [3] 246-691-4 [4] |
95-57-8 [1] 106-48-9 [2] 108-43-0 [3] 25167-80-0 [4] |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H332 H312 H302 H411 |
GHS07 GHS09 Wng |
H332 H312 H302 H411 |
|
|
C |
|
604-009-00-6 |
pyrogallol; 1,2,3-trihydroxybenzene |
201-762-9 |
Muta. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 3 |
H341 H332 H312 H302 H412 |
GHS08 GHS07 Wng |
H341 H332 H312 H302 H412 |
|
* |
|
|
|
604-010-00-1 |
resorcinol; 1,3-benzenediol |
203-585-2 |
Acute Tox. 4 STOT SE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1B Aquatic Acute 1 |
H302 H370 (nervous system) H315 H319 H317 H400 |
GHS07 GHS08 GHS09 Dgr |
H302 H370 (nervous system) H315 H319 H317 H400 |
|
oral: ATE = 500 mg/kg bw M = 1 |
|
|
|
604-011-00-7 |
2,4-dichlorophenol |
204-429-6 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H311 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H411 |
|
|
|
|
|
604-012-00-2 |
4-chloro-o-cresol; 4-chloro-2-methylphenol |
216-381-3 |
Acute Tox. 3 * Skin Corr. 1A Aquatic Acute 1 |
H331 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H314 H400 |
|
STOT SE 3; H335: C≥1 % |
|
|
|
604-013-00-8 |
2,3,4,6-tetrachlorophenol |
200-402-8 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H319 H315 H400 H410 |
GHS06 GHS09 Dgr |
H301 H319 H315 H410 |
|
* Eye Irrit. 2; H319:C≥5 % Skin Irrit. 2; H315: C≥5 % |
|
|
|
604-014-00-3 |
chlorocresol; 4-chloro-m-cresol; 4-chloro-3-methylphenol |
200-431-6 |
Acute Tox. 4 Skin Corr. 1C Eye Dam. 1 STOT SE 3 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 3 |
H302 H314 H318 H335 H317 H400 H412 |
GHS07 GHS05 GHS09 Dgr |
H302 H314 H335 H317 H410 |
|
M = 1 |
|
|
|
604-015-00-9 |
2,2'-methylenebis-(3,4,6-trichlorophenol); hexachlorophene |
200-733-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
* |
|
|
|
604-016-00-4 |
1,2-dihydroxybenzene; pyrocatechol |
204-427-5 |
Carc. 1Β Muta. 2 Acute Tox. 3 Acute Tox. 3 Skin Irrit. 2 Eye Irrit. 2 |
H350 H341 H311 H301 H315 H319 |
GHS08 GHS06 Dgr |
H350 H341 H311 H301 H315 H319 |
|
oral: ATE = 300 mg/kg bw dermal: ATE = 600 mg/kg bw |
|
|
|
604-017-00-X |
2,4,5-trichlorophenol |
202-467-8 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
* Eye Irrit. 2; H319: C≥5 % Skin Irrit.2; H315: C ≥5 % |
|
|
|
604-018-00-5 |
2,4,6-trichlorophenol |
201-795-9 |
Carc. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H319 H315 H410 |
|
|
|
|
|
604-019-00-0 |
dichlorophen (ISO) |
202-567-1 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
|
604-020-00-6 |
2-phenylphenol (ISO)biphenyl-2-ol; 2-hydroxybiphenyl; |
201-993-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
|
|
|
|
|
604-021-00-1 |
sodium 2-biphenylate; 2-phenylphenol, sodium salt |
205-055-6 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H302 H335 H315 H318 H400 |
GHS05 GHS07 GHS09 Wng |
H302 H335 H315 H318 H400 |
|
|
|
|
|
604-022-00-7 |
2,2-dimethyl-1,3-benzodioxol-4-ol |
400-900-7 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
604-023-00-2 |
2,4-dichloro-3-ethylphenol |
401-060-4 |
— |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
604-024-00-8 |
4,4-isobutylethylidenediphenol |
401-720-1 |
Repr. 1B Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H360F *** H319 H400 H410 |
GHS08 GHS09 Dgr |
H360F *** H319 H410 |
|
|
|
|
|
604-025-00-3 |
2,5-bis(1,1-dimethylbutyl)hydroquinone |
400-220-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-026-00-9 |
2,2-spirobi(6-hydroxy-4,4,7-trimethylchromane) |
400-270-3 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
604-027-00-4 |
2-methyl-5-(1,1,3,3-tetramethylbutyl)hydroquinone |
400-530-6 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
604-028-00-X |
4-amino-3-fluorophenol |
402-230-0 |
Carc. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H302 H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H317 H411 |
|
|
|
|
|
604-029-00-5 |
1-naphtol |
201-969-4 |
Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H335 H315 H318 |
GHS05 GHS07 Dgr |
H312 H302 H335 H315 H318 |
|
|
|
|
|
604-030-00-0 |
4,4'-isopropylidenediphenol; bisphenol A |
201-245-8 |
Repr. 1B STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360F H335 H318 H317 H400 H410 |
GHS08 GHS07 GHS05 GHS09 Dgr |
H360F H335 H318 H317 H410 |
|
M = 1 M = 10 |
|
|
|
604-031-00-6 |
guaiacol |
201-964-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
|
604-032-00-1 |
thymol |
201-944-8 |
Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H411 |
|
|
|
|
|
604-033-00-7 |
isobutyl but-3-enoate |
401-170-2 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
|
604-034-00-2 |
4,4'-thiodi-o-cresol |
403-330-7 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
|
604-035-00-8 |
4-nonylphenol, reaction products with formaldehyde and dodecane-1-thiol |
404-160-6 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
604-036-00-3 |
4,4'-oxybis(ethylenethio)diphenol |
404-590-4 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
604-037-00-9 |
3,5-xylenol; 3,5-dimethylphenol |
203-606-5 |
Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H311 H301 H314 |
GHS06 GHS05 Dgr |
H311 H301 H314 |
|
|
|
|
|
604-038-00-4 |
4-chloro-3,5-dimethylphenol; [1] chloroxylenol [2] |
201-793-8 [1] 215-316-6 [2] |
88-04-0 [1] 1321-23-9 [2] |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H302 H319 H315 H317 |
GHS07 Wng |
H302 H319 H315 H317 |
|
|
|
|
604-039-00-X |
ethyl 2-[4-[(6-chlorobenzoxazol-2-yl)oxy]phenoxy]propionate; fenoxaprop-ethyl |
266-362-9 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
604-040-00-5 |
fomesafen (ISO); 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulphonyl)-2-nitrobenzamide |
276-439-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
604-041-00-0 |
acifluorfen (ISO); 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid [1] sodium 5-[2-chloro-4-(trifluoromethyl) phenoxy]-2-nitrobenzoate; acifluorfen-sodium [2] |
256-634-5 [1] 263-560-7 [2] |
50594-66-6 [1] 62476-59-9 [2] |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
|
|
604-042-00-6 |
4-nitrosophenol |
203-251-6 |
Muta. 2 Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H341 H302 H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H341 H302 H318 H411 |
|
|
|
|
|
604-043-00-1 |
monobenzone; 4-hydroxyphenyl benzyl ether; hydroquinone monobenzyl ether |
203-083-3 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
|
604-044-00-7 |
mequinol; 4-methoxyphenol; hydroquinone monomethyl ether |
205-769-8 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
|
604-045-00-2 |
2,3,5-trimethylhydroquinone |
211-838-3 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H335 H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H332 H335 H315 H318 H317 H410 |
|
|
|
|
|
604-046-00-8 |
4-(4-isopropoxyphenylsulfonyl)phenol |
405-520-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
604-047-00-3 |
4-(4-tolyloxy)biphenyl |
405-730-7 |
STOT RE 2 * Aquatic Chronic 4 |
H373 ** H413 |
GHS08 Wng |
H373 ** H413 |
|
|
|
|
|
604-048-00-9 |
4,4',4''-(ethan-1,1,1-triyl)triphenol |
405-800-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
604-049-00-4 |
4-4'-methylenebis(oxyethylenethio)diphenol |
407-480-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
604-051-00-5 |
3,5-bis((3,5-di-tert-butyl-4-hydroxy)benzyl)-2,4,6-trimethylphenol |
401-110-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
604-052-00-0 |
2,2'-methylenebis(6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol) |
403-800-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
604-053-00-6 |
2-methyl-4-(1,1-dimethylethyl)-6-(1-methyl-pentadecyl)-phenol |
410-760-9 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
|
604-054-00-1 |
reaction mass of: 2-methoxy-4-(tetrahydro-4-methylene-2H-pyran-2-yl)-phenol; 4-(3,6-dihydro-4-methyl-2H-pyran-2-yl)-2-methoxyphenol |
412-020-0 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
604-055-00-7 |
2,2'-((3,3', 5,5'-tetramethyl-(1,1'-biphenyl)-4,4'-diyl)-bis(oxymethylene))-bis-oxirane |
413-900-7 |
Carc. 2 Skin Sens. 1 |
H351 H317 |
GHS08 GHS07 Wng |
H351 H317 |
|
|
|
|
|
604-056-00-2 |
2-(2-hydroxy-3,5-dinitroanilino)ethanol |
412-520-9 |
Flam. Sol. 2 Repr. 2 Acute Tox. 4 * |
H228 H361f *** H302 |
GHS02 GHS07 GHS08 Dgr |
H228 H361f *** H302 |
|
|
|
|
|
604-057-00-8 |
reaction mass of: isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-dodecylphenol; isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-(n)-tetracosylphenol; isomers of 2-(2H-benzotriazol-2-yl)-4-methyl-5,6-didodecyl-phenol. n = 5 or 6 |
401-680-5 |
— |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
604-058-00-3 |
1,2-bis(3-methylphenoxy)ethane |
402-730-9 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
604-059-00-9 |
2-n-hexadecylhydroquinone |
406-400-5 |
— |
STOT RE 2 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H373 ** H315 H317 H413 |
GHS08 GHS07 Wng |
H373 ** H315 H317 H413 |
|
|
|
|
604-060-00-4 |
9,9-bis(4-hydroxyphenyl)fluorene |
406-950-6 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
|
|
|
|
604-061-00-X |
reaction mass of: 2-chloro-5-sec-tetradecylhydroquinones where sec-tetradecyl = 1-methyltridecyl; 1-ethyldodecyl; 1-propylundecyl; 1-butyldecyl; 1-pentylnonyl; 1-hexyloctyl |
407-740-7 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H315 H317 H412 |
GHS07 Wng |
H315 H317 H412 |
|
|
|
|
604-062-00-5 |
2,4-dimethyl-6-(1-methyl-pentadecyl)phenol |
411-220-5 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
604-063-00-0 |
5,6-dihydroxyindole |
412-130-9 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
|
|
|
604-064-00-6 |
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-((hexyl)oxy)-phenol |
411-380-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
604-065-00-1 |
4,4',4''-(1-methylpropan-1-yl-3-ylidene)tris(2-cyclohexyl-5-methylphenol) |
407-460-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
604-066-00-7 |
reaction mass of: phenol, 6-(1,1-dimethylethyl)-4-tetrapropyl-2-[(2-hydroxy-5-tetra-propylphenyl)methyl (C41-compound) and methane, 2,2'-bis[6-(1,1-dimethyl-ethyl)-1-hydroxy-4-tetrapropyl-phenyl)]-(C45-compound); 2,6-bis(1,1-dimethylethyl)-4-tetra-propyl-phenol and 2-(1,1-dimethylethyl)-4-tetrapropyl-phenol; 2,6-bis[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol and 2-[(6-(1,1-dimethylethyl)-1-hydroxy-4-tetrapropylphenylmethyl]-6-[1-hydroxy-4-tetrapropylphenyl)methyl]-4-(tetrapropyl)phenol |
414-550-8 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
604-067-00-2 |
reaction mass of: 2,2'-[[(2-hydroxyethyl)imino]bis(methylene)bis[4-dodecylphenol]; formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 2); formaldehyde, oligomer with 4-dodecyl phenol and 2-aminoethanol(n = 3, 4 and higher) |
414-520-4 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
604-068-00-8 |
(±)-4-[2-[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]-1-hydroxyethyl]phenol hydrochloride |
415-170-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 |
H332 H302 H317 |
GHS07 Wng |
H332 H302 H317 |
|
|
|
|
|
604-069-00-3 |
2-(1-methylpropyl)-4-tert-butylphenol |
421-740-4 |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
|
|
604-070-00-9 |
triclosan;2,4,4'-trichloro-2'-hydroxy-diphenyl-ether; 5-chloro-2-(2,4-dichlorophenoxy)phenol |
222-182-2 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
M = 100 |
|
|
|
604-071-00-4 |
4,4'-(1-{4-[1-(4-hydroxyphenyl)-1-methylethyl]phenyl}ethylidene)diphenol |
425-600-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
604-072-00-X |
1,2-bis(phenoxymethyl)benzene |
428-620-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
604-073-00-5 |
(E)-3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
428-010-4 |
Carc. 2 Repr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360F*** H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F*** H317 H410 |
|
|
|
|
|
604-074-00-0 |
2,2',6,6'-tetrabromo–4,4'-isopropylidenediphenol; tetrabromobisphenol-A |
201-236-9 |
Carc. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H350 H400 H410 |
GHS08 GHS09 Dgr |
H350 H410 |
|
|
|
|
|
604-075-00-6 |
4-(1,1,3,3-tetramethylbutyl)phenol; 4-tert-octylphenol |
205-426-2 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
M=10 |
|
|
|
604-076-00-1 |
phenolphthalein |
201-004-7 |
Carc. 1B Muta. 2 Repr. 2 |
H350 H341 H361f*** |
GHS08 Dgr |
H350 H341 H361f*** |
|
Carc. 1B; H350: C ≥1 % |
|
|
|
604-077-00-7 |
2-benzotriazol-2-yl-4-methyl-6-(2-methylallyl)phenol |
419-750-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
604-079-00-8 |
4,4'-(1,3-phenylene-bis(1-methylethylidene))bis-phenol |
428-970-4 |
Repr. 2 Skin Sens. 1 Aquatic Chronic 2 |
H361f*** H317 H411 |
GHS08 GHS07 GHS09 Wng |
H361f*** H317 H411 |
|
|
|
|
|
604-080-00-3 |
4-fluoro-3-trifluoromethylphenol |
432-560-0 |
Acute Tox. 4 * Skin Corr. 1A Skin Sens. 1 Aquatic Chronic 2 |
H332 H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H332 H314 H317 H411 |
|
|
|
|
|
604-081-00-9 |
1,1-bis(4-hydroxyphenyl)-1-phenylethane |
433-130-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
604-082-00-4 |
2-chloro-6-fluoro-phenol |
433-890-8 |
Muta. 1B Repr. 2 Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H340 H361f*** H302 H314 H317 H411 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H340 H361f*** H302 H314 H317 H411 |
|
|
|
|
|
▼M22 ————— |
||||||||||
|
604-084-00-5 |
1-ethoxy-2,3-difluorobenzene |
441-000-4 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
604-087-00-1 |
reaction mass of: 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)monoester with 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bisphenol; 1,2-naphthoquinonediazide-5-sulfonylchloride(or sulfonicacid)diester with 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bisphenol; 1,2-naphthoquinonediazide-5-sulfonylchloride (or sulfonic acid)triester with 4,4'-(1-(4-(1-(4-hydroxyphenyl)-1-methylethyl)phenyl)ethylidene)bisphenol |
433-640-8 |
— |
Pyr. Sol. 1 Aquatic Chronic 4 |
H250 H413 |
GHS02 Dgr |
H250 H413 |
EUH044 |
|
|
|
604-089-00-2 |
2-methyl-5-tert-butylthiophenol |
444-970-7 |
— |
Flam. Liq. 3 Repr. 2 STOT RE 2 * Asp. Tox. 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H361d*** H373** H304 H319 H315 H317 H336 H400 H410 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H361d*** H373** H304 H319 H315 H317 H336 H410 |
|
|
|
|
604-090-00-8 |
4-tert-butylphenol |
202-679-0 |
Repr. 2 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 1 |
H361f H315 H318 H410 |
GHS08 GHS05 GHS09 Dgr |
H361f H315 H318 H410 |
|
M = 1 |
|
|
|
604-091-00-3 |
etofenprox (ISO); 2-(4-ethoxyphenyl)-2-methylpropyl 3-phenoxybenzyl ether |
407-980-2 |
Lact. Aquatic Acute 1 Aquatic Chronic 1 |
H362 H400 H410 |
GHS09 Wng |
H362 H410 |
|
M = 100 M = 1 000 |
|
|
|
604-092-00-9 |
phenol, dodecyl-, branched; [1] phenol, 2-dodecyl-, branched; [2] phenol, 3-dodecyl-, branched; [3] phenol, 4-dodecyl-, branched; [4] phenol, (tetrapropenyl) derivatives [5] |
310-154-3 [1] [2] [3] [4] [5] |
121158-58-5 [1] [2] [3] 210555-94-5 [4] 74499-35-7 [5] |
Repr. 1B Skin Corr. 1C Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360F H314 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H360F H314 H410 |
|
M = 10 M = 10 |
|
|
604-093-00-4 |
clorofene; chlorophene; 2-benzyl-4-chlorophenol |
204-385-8 |
Carc. 2 Repr. 2 Acute Tox. 4 Skin Irrit. 2 Skin Sens. 1 Eye Dam. 1 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361f H332 H315 H317 H318 H373 (kidney) H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H361f H332 H315 H317 H318 H373 (kidney) H410 |
|
M = 1 M = 100 |
|
|
|
604-094-00-X |
isoeugenol; [1] (E)-2-methoxy-4-(prop-1-enyl)phenol; [2] (Z)-2-methoxy-4-(prop-1-enyl)phenol [3] |
202-590-7 [1] 227-678-2 [2] 227-633-7 [3] |
97-54-1 [1] 5932-68-3 [2] 5912-86-7 [3] |
Skin Sens. 1A |
H317 |
GHS07 Wng |
H317 |
|
Skin Sens. 1A; H317: C ≥ 0,01 % |
|
|
604-095-00-5 |
6,6'-di-tert-butyl-2,2'-methylenedi-p-cresol; [DBMC] |
204-327-1 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
604-096-00-0 |
piperonyl butoxide (ISO); 2-(2-butoxyethoxy)ethyl 6-propylpiperonyl ether |
200-076-7 |
STOT SE 3 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H319 H400 H410 |
GHS07 GHS09 Wng |
H335 H319 H410 |
EUH066 |
M = 1 M = 1 |
|
|
|
604-097-00-6 |
2,4,6-tri-tert-butylphenol |
211-989-5 |
Repr. 1B Acute Tox. 4 STOT RE 2 Skin Sens. 1B |
H360D H302 H373 (liver) H317 |
GHS08 GHS07 Dgr |
H360D H302 H373 (liver) H317 |
|
oral: ATE = 500 mg/kg bw |
|
|
|
604-098-00-1 |
4,4'-sulphonyldiphenol; bisphenol S |
201-250-5 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
604-099-00-7 |
4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol; bisphenol AF |
216-036-7 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F |
|
|
|
|
|
604-100-00-0 |
nonylphenol, branched and linear, ethoxylated (with average molecular weight ≤ 1 540 g/mol) [includes ortho-, meta-, para- isomers or any combination thereof] |
500-315-8 500-024-6 500-045-0 500-209-1 248-762-5 243-816-4 248-291-5 — 230-770-5 248-743-1 247-555-7 248-293-6 — and others |
1119449-38-5 7311-27-5 27942-27-4 26264-02-8 27177-05-5 14409-72-4 and others |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 1 M = 10 |
|
|
605-001-00-5 |
formaldehyde …% |
200-001-8 |
Carc. 1B Muta. 2 Acute Tox. 3* Acute Tox. 3* Acute Tox. 3* Skin Corr. 1B Skin Sens. 1 |
H350 H341 H301 H311 H331 H314 H317 |
GHS08 GHS06 GHS05 Dgr |
H350 H341 H301 H311 H331 H314 H317 |
|
* Skin Corr. 1B; H314: C ≥25 % Skin Irrit. 2; H315: 5 % ≤C < 25 % Eye Irrit. 2; H319: 5 % ≤ C <25 % STOT SE 3; H335: C ≥ 5 % SkinSens.; H317: C ≥ 0,2 % |
B, D |
|
|
605-002-00-0 |
1,3,5-trioxan; trioxymethylene |
203-812-5 |
Flam. Sol. 1 Repr. 2 STOT SE 3 |
H228 H361d *** H335 |
GHS02 GHS08 GHS07 Dgr |
H228 H361d *** H335 |
|
|
T |
|
|
605-003-00-6 |
acetaldehyde; ethanal |
200-836-8 |
Flam. Liq. 1 Carc. 1B Muta. 2 STOT SE 3 Eye Irrit. 2 |
H224 H350 H341 H335 H319 |
GHS02 GHS08 GHS07 Dgr |
H224 H350 H341 H335 H319 |
|
|
|
|
|
605-004-00-1 |
2,4,6-trimethyl-1,3,5-trioxane; paraldehyde |
204-639-8 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
|
605-005-00-7 |
metaldehyde (ISO); 2,4,6,8-tetramethyl-1,3,5,7-tetraoxacyclooctane |
203-600-2 |
Flam. Sol. 2 Repr. 2 Acute Tox. 3 Aquatic Chronic 3 |
H228 H361f H301 H412 |
GHS02 GHS08 GHS06 Dgr |
H228 H361f H301 H412 |
|
oral: ATE = 283 mg/kg bw |
|
|
|
605-006-00-2 |
butyraldehyde |
204-646-6 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
605-007-00-8 |
1,1-dimethoxyethane; dimethyl acetal |
208-589-8 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
605-008-00-3 |
acrolein; prop-2-enal; acrylaldehyde |
203-453-4 |
Flam. Liq. 2 Acute Tox. 1 Acute Tox. 2 Acute Tox. 3 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H225 H330 H300 H311 H314 H400 H410 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H225 H330 H300 H311 H314 H410 |
EUH071 |
Skin Corr. 1B; H314:C≥ 0,1 % M = 100 M = 1 |
D |
|
|
605-009-00-9 |
crotonaldehyde; 2-butenal; [1] (E)-2-butenal; (E)-crotonaldehyde [2] |
224-030-0 [1] 204-647-1 [2] |
4170-30-3 [1] 123-73-9 [2] |
Flam. Liq. 2 Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 |
H225 H341 H330 H311 H301 H373 ** H335 H315 H318 H400 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H341 H330 H311 H301 H373 ** H335 H315 H318 H400 |
|
|
|
|
605-010-00-4 |
2-furaldehyde |
202-627-7 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H351 H331 H301 H312 H319 H335 H315 |
GHS06 GHS08 Dgr |
H351 H331 H301 H312 H319 H335 H315 |
|
|
|
|
|
605-011-00-X |
2-chlorobenzaldehyde; o-chlorobenzaldehyde |
201-956-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
605-012-00-5 |
benzaldehyde |
202-860-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
605-013-00-0 |
chloralose (INN); (R)-1,2-O-(2,2,2-trichloroethylidene)-α-D-glucofuranose; glucochloralose; anhydroglucochloral |
240-016-7 |
Acute Tox. 4* Acute Tox. 3 STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H301 H336 H400 H410 |
GHS06 GHS09 Dgr |
H332 H301 H336 H410 |
|
M = 10 M = 10 |
C |
|
|
605-014-00-6 |
chloral hydrate; 2,2,2-trichloroethane-1,1-diol |
206-117-5 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H319 H315 |
GHS06 Dgr |
H301 H319 H315 |
|
|
|
|
|
605-015-00-1 |
1,1-diethoxyethane; acetal |
203-310-6 |
Flam. Liq. 2 Eye Irrit. 2 Skin Irrit. 2 |
H225 H319 H315 |
GHS02 GHS07 Dgr |
H225 H319 H315 |
|
|
|
|
|
605-016-00-7 |
glyoxal…%; ethandial…% |
203-474-9 |
Muta. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H341 H332 H319 H315 H317 |
GHS07 GHS08 Wng |
H341 H332 H319 H315 H317 |
|
* |
B |
|
|
605-017-00-2 |
1,3-dioxolane |
211-463-5 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
605-018-00-8 |
propanal; propionaldehyde |
204-623-0 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
|
|
|
|
|
605-019-00-3 |
citral |
226-394-6 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
|
605-020-00-9 |
safrole; 5-allyl-1,3-benzodioxole |
202-345-4 |
Carc. 1B Muta. 2 Acute Tox. 4 * |
H350 H341 H302 |
GHS08 GHS07 Dgr |
H350 H341 H302 |
|
|
|
|
|
605-021-00-4 |
formaldehyde, reaction products with butylphenol |
294-145-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
605-022-00-X |
glutaral; glutaraldehyde; 1,5-pentanedial |
203-856-5 |
Acute Tox. 2 Acute Tox. 3 STOT SE 3 Skin Corr. 1B Resp. Sens. 1 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 2 |
H330 H301 H335 H314 H334 H317 H400 H411 |
GHS06 GHS05 GHS08 GHS09 Dgr |
H330 H301 H335 H314 H334 H317 H410 |
EUH071 |
STOT SE 3; H335: 0,5 % ≤ C < 5 % M = 1 |
|
|
|
605-023-00-5 |
5-chloro-2-(4-chlorophenoxy)phenol; [DCPP] |
429-290-0 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
M = 10 M = 10 |
|
|
|
605-024-00-0 |
2-bromo-5-hydroxy-4-methoxybenzaldehyde |
426-540-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
605-025-00-6 |
chloroacetaldehyde |
203-472-8 |
Carc. 2 Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H351 H330 H311 H301 H314 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H330 H311 H301 H314 H400 |
|
STOT SE 3; H335: C≥ 5 % |
|
|
|
605-026-00-1 |
2,5,7,7-tetramethyloctanal |
405-690-0 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
|
605-027-00-7 |
reaction mass of: 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-6-carboxaldehyde; 3a,4,5,6,7,7a-hexahydro-4,7-methano-1H-indene-5-carboxaldehyde |
410-480-7 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
605-028-00-2 |
β-methyl-3-(1-methylethyl)-benzenepropanal |
412-050-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
605-029-00-8 |
2-cyclohexylpropanal |
412-270-0 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
605-030-00-3 |
1-(p-methoxyphenyl)acetaldehyde oxime |
411-510-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
605-031-00-9 |
reaction mass of: 2,2-dimethoxyethanal [this component is considered to be anhydrous in terms of identity, structure and composition. However, 2,2-dimethoxyethanal will exist in a hydrated form. 60 % anhydrous is equivalent to 70,4 % hydrate; water (Including free water and water in hydrated 2,2-dimethoxyethanal)] |
421-890-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
605-032-00-4 |
3-[3-(4-fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl]-(E)-2-propenal |
425-370-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
605-033-00-X |
Reaction mass of: 3,7,11-trimethyl-cis-6,10-dodecadienal; 3,7,11-trimethyl-trans-6,10-dodecadienal |
425-910-9 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
605-034-00-5 |
reaction mass of: (1RS, 2RS,3SR, 6RS, 9SR)-9-methoxytricyclo[5.2.1.0(2,6)]decane-3-carbaldehyde; (1RS, 2RS, 3RS, 6RS, 8SR)-8-methoxytricyclo[5.2.1.0(2,6)]decane-3-carbaldehyde; (1RS, 2RS, 4SR, 6RS, 8SR)-8-methoxytricyclo[5.2.1.0(2,6)]decane-4-carbaldehyde |
429-860-9 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
605-035-00-0 |
(E)-3-(4-(4-fluorophenyl)-5-methoxymethyl-2,6-bis(1-methoxymethyl)pyridin-3-yl)prop-2-enal |
426-330-9 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H319 H317 H413 |
GHS07 Wng |
H319 H317 H413 |
|
|
|
|
|
605-036-00-6 |
2-bromomalonaldehyde |
430-470-6 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
|
605-037-00-1 |
trans-3-[2-(7-chloro-2-quinolinyl)vinyl]benzaldehyde; 3-[(E)-2-(7-chloro-2-quinolinyl)vinyl]benzaldehyde |
421-800-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
605-038-00-7 |
3-methyl-5-phenylpentan-1-al |
433-900-0 |
Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H302 H315 H317 H411 |
GHS07 GHS09 Wng |
H302 H315 H317 H411 |
|
|
|
|
|
605-039-00-2 |
3,4-dihydroxy-5-nitrobenzaldehyde |
441-810-8 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
|
605-040-00-8 |
hydroxyisohexyl 3-cyclohexene carboxaldehyde (INCI); reaction mass of 4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde and 3-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde; [1] 4-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde; [2] 3-(4-hydroxy-4-methylpentyl)cyclohex-3-ene-1-carbaldehyde [3] |
- [1] 250-863-4 [2] 257-187-9 [3] |
130066-44-3 [1] 31906-04-4 [2] 51414-25-6 [3] |
Skin Sens. 1A |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
605-041-00-3 |
2-(4-tert-butylbenzyl)propionaldehyde |
201-289-8 |
Repr. 1B |
H360Fd |
GHS08 Dgr |
H360Fd |
|
|
|
|
|
606-001-00-8 |
acetone; propan-2-one; propanone |
200-662-2 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
|
606-002-00-3 |
butanone; ethyl methyl ketone |
201-159-0 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
|
606-003-00-9 |
heptan-3-one; butyl ethyl ketone |
203-388-1 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 |
H226 H332 H319 |
GHS02 GHS07 Wng |
H226 H332 H319 |
|
|
|
|
|
606-004-00-4 |
4-methylpentan-2-one; isobutyl methyl ketone |
203-550-1 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4 STOT SE 3 Eye Irrit. 2 |
H225 H351 H332 H336 H319 |
GHS02 GHS07 GHS08 Dgr |
H225 H351 H332 H336 H319 |
EUH066 |
inhalation: ATE = 11 mg/l (vapours) |
|
|
|
606-005-00-X |
2,6-dimethylheptan-4-one; di-isobutyl ketone |
203-620-1 |
Flam. Liq. 3 STOT SE 3 |
H226 H335 |
GHS02 GHS07 Wng |
H226 H335 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
606-006-00-5 |
pentan-3-one; diethyl ketone |
202-490-3 |
Flam. Liq. 2 STOT SE 3 STOT SE 3 |
H225 H335 H336 |
GHS02 GHS07 Dgr |
H225 H335 H336 |
EUH066 |
|
|
|
|
606-007-00-0 |
3-methylbutan-2-one; methyl isopropyl ketone |
209-264-3 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
606-009-00-1 |
4-methylpent-3-en-2-one; mesityl oxide |
205-502-5 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H312 H302 |
GHS02 GHS07 Wng |
H226 H332 H312 H302 |
|
* |
|
|
|
606-010-00-7 |
cyclohexanone |
203-631-1 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-011-00-2 |
2-methylcyclohexanone |
209-513-6 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-012-00-8 |
3,5,5-trimethylcyclohex-2-enone; isophorone |
201-126-0 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H351 H312 H302 H319 H335 |
GHS08 GHS07 Wng |
H351 H312 H302 H319 H335 |
|
STOT SE 3; H335: C ≥10 % |
|
|
|
606-013-00-3 |
p-benzoquinone; quinone |
203-405-2 |
Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H331 H301 H319 H335 H315 H400 |
GHS06 GHS09 Dgr |
H331 H301 H319 H335 H315 H400 |
|
M=10 |
|
|
|
606-014-00-9 |
chlorophacinone (ISO); 2-[(4-chlorophenyl)(phenyl)acetyl]-1H-indene-1,3(2H)-dione |
223-003-0 |
Repr. 1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (blood) H410 |
|
Repr. 1B; H360D: C ≥ 0,003 % STOT RE 1; H372 (blood): C ≥ 0,1 % STOT RE 2; H373 (blood): 0,01 % ≤ C < 0,1 % M = 1 M = 1 |
|
|
|
606-016-00-X |
pindone (ISO); 2-pivaloylindan-1,3-dione |
201-462-8 |
Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H372 ** H410 |
|
|
|
|
|
606-017-00-5 |
diketene; diketen |
211-617-1 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
D |
|
|
606-018-00-0 |
dichlone (ISO); 2,3-dichloro-1,4-naphthoquinone |
204-210-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
|
606-019-00-6 |
chlordecone (ISO); perchloropentacyclo[5,3,0,02,6,03,9,0 4,8]decan-5-one; decachloropentacyclo[5,2,1,02,6,03,9,05,8]decan-4-one |
205-601-3 |
Carc. 2 Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H311 H301 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H351 H311 H301 H410 |
|
|
|
|
|
606-020-00-1 |
5-methylheptan-3-one |
208-793-7 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 |
H226 H319 H335 |
GHS02 GHS07 Wng |
H226 H319 H335 |
|
STOT SE 3; H335: C≥10 % |
|
|
|
606-021-00-7 |
N-methyl-2-pyrrolidone; 1-methyl-2-pyrrolidone |
212-828-1 |
Repr. 1B STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 |
H360D*** H335 H315 H319 |
GHS08 GHS07 Dgr |
H360D*** H335 H315 H319 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
606-022-00-2 |
1-phenyl-3-pyrazolidone |
202-155-1 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
606-023-00-8 |
4-methoxy-4-methylpentan-2-one |
203-512-4 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-024-00-3 |
heptan-2-one; methyl amyl ketone |
203-767-1 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * |
H226 H332 H302 |
GHS02 GHS07 Wng |
H226 H332 H302 |
|
|
|
|
|
606-025-00-9 |
cyclopentanone |
204-435-9 |
Flam. Liq. 3 Eye Irrit. 2 Skin Irrit. 2 |
H226 H319 H315 |
GHS02 GHS07 Wng |
H226 H319 H315 |
|
|
|
|
|
606-026-00-4 |
5-methylhexan-2-one; isoamyl methyl ketone |
203-737-8 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-027-00-X |
heptan-4-one; di-n-propyl ketone |
204-608-9 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
606-028-00-5 |
2,4-dimethylpentan-3-one; di-isopropyl ketone |
209-294-7 |
Flam. Liq. 2 Acute Tox. 4 * |
H225 H332 |
GHS02 GHS07 Dgr |
H225 H332 |
|
|
|
|
|
606-029-00-0 |
pentane-2,4-dione; acetylacetone |
204-634-0 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H302 |
GHS02 GHS07 Wng |
H226 H302 |
|
|
|
|
|
606-030-00-6 |
hexan-2-one; methyl butyl ketone; butyl methyl ketone; methyl-n-butyl ketone |
209-731-1 |
Flam. Liq. 3 Repr. 2 STOT RE 1 STOT SE 3 |
H226 H361f *** H372 ** H336 |
GHS02 GHS08 GHS07 Dgr |
H226 H361f *** H372 ** H336 |
|
|
|
|
|
606-031-00-1 |
3-propanolide;1,3-propiolactone |
200-340-1 |
Carc. 1B Acute Tox. 2 * Eye Irrit. 2 Skin Irrit. 2 |
H350 H330 H319 H315 |
GHS06 GHS08 Dgr |
H350 H330 H319 H315 |
|
|
|
|
|
606-032-00-7 |
hexachloroacetone |
204-129-5 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
606-033-00-2 |
2-(3,4-dichlorophenyl)-4-methyl-1,2,4-oxadiazolidinedione; methazole |
243-761-6 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H312 H302 H319 H315 H411 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H411 |
|
|
|
|
|
606-034-00-8 |
metribuzin (ISO); 4-amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one; 4-amino-4,5-dihydro-6-(1,1-dimethylethyl)-3-methylthio-1,2,4-triazin-5-one |
244-209-7 |
Acute Tox. 4 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 (blood system) H400 H410 |
GHS07 GHS08 GHS09 Wng |
H302 H373 (blood system) H410 |
|
oral: ATE = 320 mg/kg bw M = 10 M = 10 |
|
|
|
606-035-00-3 |
chloridazon (ISO); 5-amino-4-chloro-2-phenylpyridazine-3-(2H)-one; pyrazon |
216-920-2 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
606-036-00-9 |
quinomethionate; chinomethionat (ISO); 6-methyl-1,3-dithiolo(4,5-b)quinoxalin-2-one |
219-455-3 |
Repr. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H332 H312 H302 H373 ** H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f *** H332 H312 H302 H373 ** H319 H317 H410 |
|
|
|
|
|
606-037-00-4 |
triadimefon (ISO); 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butanone |
256-103-8 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
606-038-00-X |
diphacinone (ISO); 2-diphenylacetylindan-1,3-dione |
201-434-5 |
Acute Tox. 2 * STOT RE 1 |
H300 H372 ** |
GHS06 GHS08 Dgr |
H300 H372 ** |
|
|
|
|
|
606-039-00-5 |
5(or 6)-tert-butyl-2'-chloro-6'-ethylamino-3',7'-dimethylspiro(isobenzofuran-1(1H),9'-xanthene)-3-one |
400-680-2 |
— |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H400 H410 |
GHS07 GHS09 Wng |
H332 H410 |
|
|
|
|
606-040-00-0 |
(N-benzyl-N-ethyl)amino-3-hydroxyacetophenone hydrochloride |
401-840-4 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
|
606-041-00-6 |
2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one |
400-600-6 |
Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H360FD H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H360FD H302 H411 |
|
|
|
|
|
606-042-00-1 |
acetophenone |
202-708-7 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
|
606-043-00-7 |
2,4-di-tert-butylcyclohexanone |
405-340-7 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
606-044-00-2 |
2,4,6-trimethylbenzophenone |
403-150-9 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H410 |
|
|
|
|
|
606-045-00-8 |
oxadiazon (ISO); 3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one |
243-215-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-046-00-3 |
reaction mass of cis-and trans-cyclohexadec-8-en-1-one |
401-700-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-047-00-9 |
2-benzyl-2-dimethylamino-4'-morpholinobutyrophenone |
404-360-3 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D H400 H410 |
GHS08 GHS09 Dgr |
H360D H410 |
|
|
|
|
|
606-048-00-4 |
2'-anilino-3'-methyl-6'-dipentylaminospiro(isobenzofuran-1(1H),9'-xanthen)-3-one |
406-480-1 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-049-00-X |
4-(trans-4-propylcyclohexyl)acetophenone |
406-700-6 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-050-00-5 |
6-anilino-1-benzoyl-4-(4-tert-pentylphenoxy)naphto[1,2,3-de]quinoline-2,7-(3H)-dione |
412-480-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-051-00-0 |
4-pentylcyclohexanone |
406-670-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-052-00-6 |
4-(N,N-dibutylamino)-2-hydroxy-2'-carboxybenzophenone |
410-410-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
606-053-00-1 |
flurtamone (ISO); (RS)-5-methylamino-2-phenyl-4-(α, α,α-trifluoro-m-tolyl)furan-3(2H)-one |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-054-00-7 |
isoxaflutole (ISO); 5-cyclopropyl-1,2-oxazol-4-yl α,α,α-trifluoro-2-mesyl-p-tolyl ketone |
— |
Repr. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d*** H400 H410 |
GHS08 GHS09 Wng |
H361d*** H410 |
|
M = 10 M = 100 |
|
|
|
606-055-00-2 |
1-(2,3-dihydro-1,3,3,6-tetramethyl-1-(1-methylethyl)-1H-inden-5-yl)ethanone |
411-180-9 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 2 |
H302 H373 ** H411 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H411 |
|
|
|
|
|
606-056-00-8 |
4-chloro-3',4'-dimethoxybenzophenone |
404-610-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-057-00-3 |
4-propylcyclohexanone |
406-810-4 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
606-058-00-9 |
4'-fluoro-2,2-dimethoxyacetophenone |
407-500-1 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
606-059-00-4 |
2,4-difluoro-α-(1H-1,2,4-triazol-1-yl)acetophenone hydrochloride |
412-390-3 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
|
606-060-00-X |
Reaction mass of: trans-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane; cis-2,4-dimethyl-2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-naphthalene-2-yl)-1,3-dioxolane |
412-950-7 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-061-00-5 |
(3-chlorophenyl)-(4-methoxy-3-nitrophenyl)methanone |
423-290-4 |
Muta. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H400 H410 |
GHS08 GHS09 Wng |
H341 H410 |
|
|
|
|
|
606-062-00-0 |
tetrahydrothiopyran-3-carboxaldehyde |
407-330-8 |
Repr. 1B Eye Dam. 1 Aquatic Chronic 3 |
H360D *** H318 H412 |
GHS08 GHS05 Dgr |
H360D *** H318 H412 |
|
|
|
|
|
606-063-00-6 |
(E)-3-(2-chlorophenyl)-2-(4-fluorophenyl)propenal |
410-980-5 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
|
606-064-00-1 |
pregn-5-ene-3,20-dione bis(ethylene ketal) |
407-450-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-065-00-7 |
1-(4-morpholinophenyl)butan-1-one |
413-790-0 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
606-066-00-2 |
(E)-5[(4-chlorophenyl)methylene]-2,2-dimethylcyclopentanone |
410-440-9 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-067-00-8 |
reaction mass of: 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-4-yl)ethanone; 1-(2,3,5,6,7,8-hexahydro-1,1-dimethyl-1H-benz(f)inden-4-yl)ethanone; 1-(2,3,6,7,8,9-hexahydro-1,1-dimethyl-1H-benz(g)inden-5-yl)ethanone; 1-(2,3,6,7,8,9-hexahydro-3,3-dimethyl-1H-benz(g)inden-5-yl)ethanone |
414-870-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-068-00-3 |
2,7,11-trimethyl-13-(2,6,6-trimethylcyclohex-1-en-1-yl)tridecahexaen-2,4,6,8,10,12-al |
415-770-7 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373 ** H317 H412 |
GHS08 GHS07 Wng |
H373 ** H317 H412 |
|
|
|
|
|
606-069-00-9 |
spiro[1,3-dioxolane-2,5'-(4',4',8',8'-tetramethyl-hexahydro-3',9'-methanonaphthalene)] |
415-460-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-070-00-4 |
butroxydim (ISO); 5-(3-butyryl-2,4,6-trimethylphenyl)-2-[1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-one |
414-790-3 |
Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361fd H302 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361fd H302 H315 H410 |
|
|
|
|
|
606-071-00-X |
17-spiro(5,5-dimethyl-1,3-dioxan-2-yl)androsta-1,4-diene-3-one |
421-050-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-072-00-5 |
3-acetyl-1-phenyl-pyrrolidine-2,4-dione |
421-600-2 |
STOT RE 2 * Aquatic Chronic 2 |
H373 ** H411 |
GHS08 GHS09 Wng |
H373 ** H411 |
|
|
|
|
|
606-073-00-0 |
4,4'-bis(dimethylamino)benzophenone; Michler's ketone |
202-027-5 |
Carc. 1B Muta. 2 Eye Dam. 1 |
H350 H341 H318 |
GHS08 GHS05 Dgr |
H350 H341 H318 |
|
|
|
|
|
606-074-00-6 |
reaction mass of: (1R*, 2S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-1,2,8,8-tetramethylnaphthalene; (2R*,3S*)-2-acetyl-1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethylnaphthalene |
425-570-1 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-075-00-1 |
1-benzyl-5-ethoxyimidazolidine-2,4-dione |
417-340-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
606-076-00-7 |
1-((2-quinolinyl-carbonyl)oxy)-2,5-pyrrolidinedione |
418-630-3 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
|
606-077-00-2 |
(3S,4S)-3-hexyl-4-[(R)-2-hydroxytridecyl]-2-oxetanone |
418-650-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-078-00-8 |
1-octylazepin-2-one |
420-040-6 |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
|
606-079-00-3 |
2-n-butyl-benzo[d]isothiazol-3-one |
420-590-7 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
|
▼M1 ————— |
||||||||||
|
606-081-00-4 |
(3β, 5α, 6β)-3-(acetyloxy)-5-bromo-6-hydroxy-androstan-17-one |
419-790-7 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
606-082-00-X |
reaction mass of: butan-2-one oxime; syn-O,O'-di(butan-2-one oxime)diethoxysilane |
406-930-7 |
|
STOT RE 1 Skin Sens. 1 Aquatic Chronic 3 |
H372 ** H317 H412 |
GHS08 GHS07 Dgr |
H372 ** H317 H412 |
|
|
|
|
606-083-00-5 |
2-chloro-5-sec-hexadecylhydroquinone |
407-750-1 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H315 H317 H412 |
GHS07 Wng |
H319 H315 H317 H412 |
|
|
|
|
|
606-084-00-0 |
1-(4-methoxy-5-benzofuranyl)-3-phenyl-1,3-propanedione |
414-540-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-085-00-6 |
(1R,4S)-2-azabicyclo[2.2.1]hept-5-en-3-one |
418-530-1 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 |
H302 H318 H317 |
GHS05 GHS07 Dgr |
H302 H318 H317 |
|
|
|
|
|
606-086-00-1 |
1-(3,3-dimethylcyclohexyl)pent-4-en-1-one |
422-330-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-087-00-7 |
6-ethyl-5-fluoro-4(3H)-pyrimidone |
422-460-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
606-088-00-2 |
2,4,4,7-tetramethyl-6-octen-3-one |
422-520-0 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
606-089-00-8 |
reaction mass of: 1,4-diamino-2-chloro-3-phenoxyanthraquinone; 1,4-diamino-2,3-bis-phenoxyanthraquinone |
423-220-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-090-00-3 |
1-[3-[(dimethylamino)methyl]-4-hydroxyphenyl]ethanone |
430-920-1 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
606-091-00-9 |
6-chloro-5-(2-chloroethyl)-1,3-dihydroindol-2-one |
421-320-0 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-092-00-4 |
reaction mass of: (E)-oxacyclohexadec-12-en-2-one; (E)-oxacyclohexadec-13-en-2-one; a) (Z)-oxacyclohexadec-(12)-en-2-one and b) (Z)-oxacyclohexadec-(13)-en-2-one |
422-320-3 |
|
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
606-093-00-X |
5-ethyl-2,4-dihydro-4-(2-phenoxyethyl)-3H-1,2,4-triazol-3-one |
414-470-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
606-094-00-5 |
N-[ethyl(3-methylbutyl)amino]-3-methyl-1-phenyl-spiro[[1]benzo-pyrano[2,3-c]pyrazole-4(1H), 1'(3'H)-isobenzofuran]-3'-one |
417-460-7 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
606-095-00-0 |
(R, S)-2-azabicyclo[2.2.1]hept-5-en-3-one |
421-830-3 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
|
606-096-00-6 |
3-(6-O-(6-desoxy-α-l-mannopyranosyl-O-(α-d-glucopyranosyl)-(β-d-glucopyranosyl)oxy)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one |
424-170-4 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
606-097-00-1 |
2,2''-dihydroxy-4,4''-(2-hydroxy-propane-1,3-diyldioxy)dibenzophenone |
424-210-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-098-00-7 |
1-benzyl-5-(hexadecyloxy)-2,4-imidazolidinedione |
431-220-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-099-00-2 |
5-methoxy-4'-(trifluoromethyl)valerophenone |
425-000-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-100-00-6 |
2-butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one |
425-150-8 |
Repr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H360F*** H302 H317 H412 |
GHS08 GHS07 Dgr |
H360F*** H302 H317 H412 |
|
|
|
|
|
606-101-00-1 |
reaction mass of: 1,5-bis[(2-ethylhexyl)amino]-9,10-anthracenedione; 1-[(2-ethylhexyl)amino]-5-[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracenedione; 1,5-bis[3-[(2-ethylhexyl)oxy]propyl]amino-9,10-anthracenedione; 1-[(2-ethylhexyl)amino]-5-[(3-methoxypropyl)amino]-9,10-anthracenedione; 1-[3-[(2-ethylhexyl)oxy]propyl]amino-5-[(3-methoxypropyl)amino]-9,10-anthracenedione; 1,5-bis[(3-methyloxypropyl)amino]-9,10-anthracenedione |
426-050-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
606-102-00-7 |
4-(3-triethoxysilylpropoxy)-2-hydroxybenzophenone |
431-490-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-103-00-2 |
1-(4-(trans-4-ethylcyclohexyl)phenyl)ethanone |
426-460-6 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
606-104-00-8 |
1-(4-(trans-4-pentylcyclohexyl)phenyl)ethanone |
426-830-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-105-00-3 |
3,4,3', 4'-tetraphenyl-1,1'-ethandiylbispyrol-2,5-dione |
431-500-0 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-106-00-9 |
1-(4-(trans-4-butylcyclohexyl)phenyl)ethanone |
427-320-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-107-00-4 |
8-azaspiro[4.5]decane-7,9-dione |
427-770-4 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
|
|
606-108-00-X |
1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)-3-pentanone |
436-710-6 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
606-109-00-5 |
2-(4-methyl-3-pentenyl)anthraquinone |
428-320-1 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 4 |
H302 H317 H413 |
GHS07 Wng |
H302 H317 H413 |
|
|
|
|
|
606-110-00-0 |
5-ethoxy-5H-furan-2-one |
428-330-4 |
Skin Corr. 1B Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 |
H314 H312 H302 H373** H317 |
GHS05 GHS08 GHS07 Dgr |
H314 H312 H302 H373** H317 |
|
|
|
|
|
606-111-00-6 |
5-amino-6-methyl-1,3-dihydrobenzoimidazol-2-one |
428-410-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
606-112-00-1 |
(4aR*,8aR*)-4a,5,9,10,11,12-hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-one |
428-690-2 |
Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 3 |
H302 H319 H412 |
GHS07 Wng |
H302 H319 H412 |
|
|
|
|
|
606-113-00-7 |
1-[4-(4-benzoylphenylsulfanyl)phenyl]-2-methyl-2-(4-methylphenylsulfonyl)propan-1-one |
429-040-0 |
Eye Dam. 1 Aquatic Chronic 4 |
H318 H413 |
GHS05 Dgr |
H318 H413 |
|
|
|
|
|
606-114-00-2 |
4,4', 5,5', 6,6', 7,7'-octachloro-(2,2')biisoindolyl-1,1', 3,3'-tetraone |
429-150-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-115-00-8 |
profoxydim (ISO); 2-{(EZ)-1-[(2RS)-2-(4-chlorophenoxy)propoxyimino]butyl}-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one |
— |
Carc. 2 Repr. 2 Skin Sens. 1 |
H351 H361d H317 |
GHS08 GHS07 Wng |
H351 H361d H317 |
|
|
|
|
|
606-116-00-3 |
tepraloxydim (ISO); (RS)-(EZ)-2-{1-[(2E)-3-chloroallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-one |
— |
Carc. 2 Repr. 2 |
H351 H361fd |
GHS08 Wng |
H351 H361fd |
|
|
|
|
|
606-117-00-9 |
2,6-bis(1,1-dimethylethyl)-4-(phenylenemethylene)cyclohexa-2,5-dien-1-one |
429-460-4 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
|
606-118-00-4 |
N-(1,3-dimethylbutyl)-N'-(phenyl)-1,4-benzoquinonediimine |
429-640-2 |
Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H400 H410 |
GHS07 GHS09 Wng |
H319 H410 |
|
|
|
|
|
606-119-00-X |
(E)-3-methyl-5-cyclopentadecen-1-one |
429-900-5 |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
606-120-00-5 |
2,5-dihydroxy-5-methyl-3-(morpholin-4-yl)-2-cyclopenten-1-one |
430-170-5 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
606-121-00-0 |
(+)-(1S, 2S, 3S, 5R)-2,6,6-trimethylbicyclo[3.1.1]heptane-3-spiro-1'-(cyclohex-2'-en-4'-one) |
430-460-1 |
Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H410 |
|
|
|
|
|
606-122-00-6 |
3-(2-bromopropionoyl)-4,4-dimethyl-1,3-oxazolan-2-one |
430-820-8 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373** H315 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H302 H373** H315 H318 H317 H410 |
|
|
|
|
|
606-123-00-1 |
4-hexadecyl-1-phenylpyrazolidin-3-one |
430-840-7 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
606-124-00-7 |
1-cyclopropyl-3-(2-methylthio-4-trifluoromethylphenyl)-1,3-propanedione |
421-080-7 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373** H400 H410 |
GHS08 GHS09 Wng |
H373** H410 |
|
|
|
|
|
606-125-00-2 |
1-benzylimidazolidine-2,4-dione |
421-340-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
606-126-00-8 |
1,4-bis(2,3-dihydroxypropylamino)anthraquinone |
421-470-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
606-128-00-9 |
2,2'-(1,3-phenylene)bis[5-chloro-1H-isoindole]-1,3(2H)-dione |
422-650-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-129-00-4 |
5-amino-[2S-di(methylphenyl)amino]-1,6-diphenyl-4Z-hexen-3-one; (2S, 4Z)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one |
423-090-7 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-130-00-X |
4-(1,4-dioxa-spiro[4.5]dec-8-yl)-cyclohexanone |
423-860-2 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
606-131-00-5 |
cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione |
427-230-8 |
Repr. 1B STOT RE 2 * Aquatic Chronic 2 |
H360F*** H373** H411 |
GHS08 GHS09 Dgr |
H360F*** H373** H411 |
|
|
|
|
|
606-132-00-0 |
(6β)-6,19-epoxyandrost-4-ene-3,17-dione |
433-490-3 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
606-134-00-1 |
androsta-1,4,9(11)-triene-3,17-dione |
433-560-3 |
Repr. 2 |
H361f*** |
GHS08 Wng |
H361f*** |
|
|
|
|
|
606-135-00-7 |
cyclohexadecanone |
438-930-8 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-136-00-2 |
(3S, 6R, 9S, 12R, 15S, 18R, 21S,24R)-6,18-dibenzyl-3,9,15,21-tetraisobutyl-4,10,12,16,22,24-hexamethyl-1,7,13,19-tetraoxa-4,10,16,22-tetraazacyclo-tetracosane-2,5,8,11,14,17,20,23-octaone |
444-350-6 |
Eye Irrit. 2 Aquatic Chronic 4 |
H319 H413 |
GHS07 Wng |
H319 H413 |
|
|
|
|
|
606-137-00-8 |
trans-7,7'-dimethyl-(4H,4H')-(2,2')bi[benzo[1,4]thiazinylidene]-3,3'-dione |
444-750-0 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-138-00-3 |
(2-butyl-5-nitrobenzofuran-3-yl)[4-(3-dibutylaminopropoxy)phenyl]methanone |
444-800-1 |
Flam. Liq. 3 Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H302 H373** H315 H318 H317 H400 H410 |
GHS02 GHS05 GHS08 GHS07 GHS09 Dgr |
H226 H302 H373** H315 H318 H317 H410 |
|
M=10 |
|
|
|
606-139-00-9 |
(S)-4-(3,4-dichlorophenyl)-3,4-dihydro-2H-naphthalen-1-one |
444-830-5 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
606-140-00-4 |
2-hydroxy-1-(4-(4-(2-hydroxy-2-methylpropionyl)benzyl)phenyl)-2-methylpropan-1-one |
444-860-9 |
STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H373** H400 H410 |
GHS08 GHS09 Wn |
H373** H410 |
|
|
|
|
|
606-141-00-X |
sodium 3-(methoxycarbonyl)-4-oxo-3,4,5,6-tetrahydro-2-pyridinolate |
418-410-7 |
— |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
606-142-00-5 |
reaction mass of: (1RS, 2SR,7SR, 8SR, E) 9 and 10-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one; (1RS, 2SR, 7SR, 8SR, Z)-10-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one; (1RS, 2SR, 7SR, 8SR, Z)-9-ethylidene-3-oxatricyclo[6.2.1.0(2,7)]undecan-4-one |
434-290-9 |
— |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
606-143-00-0 |
abamectin (combination of avermectin B1a and avermectin B1b) (ISO) [1] avermectin B1a (purity ≥ 80 %); [2] |
_ [1] 265-610-3 [2] |
71751-41-2 [1] 65195-55-3 [2] |
Repr. 2 Acute Tox. 2 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H300 H330 H372 (nervous system) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361d H300 H330 H372 (nervous system) H410 |
|
STOT RE 1; H372: C ≥ 5 % STOT RE 2; H373: 0,5 % ≤C< 5 % M = 10 000 |
|
|
606-144-00-6 |
acequinocyl (ISO); 3-dodecyl-1,4-dioxo-1,4-dihydronaphthalen-2-yl acetate |
— |
Skin Sens. 1 STOT SE 1 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H370 (lung) (inhalation) H373 (blood system) H400 H410 |
GHS07 GHS08 GHS09 Dgr |
H317 H370 (lung) (inhalation) H373 (blood system) H410 |
|
M = 1 000 |
|
|
|
606-145-00-1 |
sulcotrione (ISO); 2-[2-chloro-4-(methylsulfonyl)benzoyl]cyclohexane-1,3-dione |
|
Repr. 2 STOT RE 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H361d H373 (kidneys) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H373 (kidneys) H317 H410 |
|
M = 1 M = 10 |
|
|
|
606-146-00-7 |
tralkoxydim (ISO); 2-(N-ethoxypropanimidoyl)-3-hydroxy-5-mesitylcyclohex-2-en-1-one |
— |
Carc. 2 Acute Tox. 4 Aquatic Chronic 2 |
H351 H302 H411 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H411 |
|
|
|
|
|
606-147-00-2 |
cycloxydim (ISO); 2-(N-ethoxybutanimidoyl)-3-hydroxy-5-(tetrahydro-2H-thiopyran-3-yl)cyclohex-2-en-1-one |
405-230-9 |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
|
606-148-00-8 |
carvone (ISO); 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one; [1] d-carvone; (5S)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one; [2] l-carvone; (5R)-2-methyl-5-(prop-1-en-2-yl)cyclohex-2-en-1-one [3] |
202-759-5 [1] 218-827-2 [2] 229-352-5 [3] |
99-49-0 [1] 2244-16-8 [2] 6485-40-1 [3] |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
606-149-00-3 |
tembotrione (ISO); 2-{2-chloro-4-(methylsulfonyl)-3-[(2,2,2-trifluoroethoxy)methyl]benzoyl}cyclohexane-1,3-dione |
— |
Repr. 2 STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H373 (eyes, kidneys, liver) H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H373 (eyes, kidneys, liver) H317 H410 |
|
M = 100 M = 10 |
|
|
|
606-150-00-9 |
clethodim (ISO); (5RS)-2-{(1EZ)-1-[(2E)-3-chloroallyloxyimino]propyl}-5-[(2RS)-2-(ethylthio)propyl]-3-hydroxycyclohex-2-en-1-one |
— |
Acute Tox. 4 Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
EUH066 |
|
|
|
|
606-151-00-4 |
anthraquinone |
201-549-0 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
606-152-00-X |
(5-chloro-2-methoxy-4-methyl-3-pyridyl)(4,5,6-trimethoxy-o-tolyl)methanone; pyriofenone |
— |
Carc. 2 Aquatic Chronic 1 |
H351 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 1 |
|
|
|
606-153-00-5 |
benzophenone |
204-337-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
606-154-00-0 |
quinoclamine (ISO); 2-amino-3-chloro-1,4-naphthoquinone |
220-529-2 |
Carc. 2 Repr. 2 Acute Tox. 4 STOT RE 2 Eye Irrit. 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d H302 H373 (blood system, kidneys) H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361d H302 H373 (blood system, kidneys) H319 H317 H410 |
|
oral: ATE = 500 mg/kg bw M = 10 M = 10 |
|
|
|
606-155-00-6 |
cinnamaldehyde; 3-phenylprop-2-enal; cinnamic aldehyde; cinnamal; [1] (2E)-3-phenylprop-2-enal [2] |
203-213-9 [1] - [2] |
104-55-2 [1] 14371-10-9 [2] |
Skin Sens. 1A |
H317 |
GHS07 Wng |
H317 |
|
►C9 Skin Sens. 1A; H317: C ≥ 0,01 % ◄ |
|
|
607-001-00-0 |
formic acid … % |
200-579-1 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 90 % Skin Corr. 1B; H314: 10 % ≤ C < 90 % Skin Irrit. 2; H315: 2 % ≤C < 10 % Eye Irrit. 2; H319: 2 %≤ <10 % |
B |
|
|
607-002-00-6 |
acetic acid … % |
200-580-7 |
Flam. Liq. 3 Skin Corr. 1A |
H226 H314 |
GHS02 GHS05 Dgr |
H226 H314 |
|
Skin Corr. 1A; H314: C ≥90 % Skin Corr. 1B; H314: 25 %≤ C <90 % Skin Irrit. 2; H315: 10 % ≤C <25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B |
|
|
607-003-00-1 |
chloroacetic acid |
201-178-4 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H331 H311 H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H400 |
|
STOT SE 3; H335: C≥ 5 % |
|
|
|
607-004-00-7 |
TCA (ISO); trichloroacetic acid |
200-927-2 |
Skin Corr. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
STOT SE 3; H335: C ≥ 1 % |
|
|
|
607-005-00-2 |
TCA-sodium (ISO); sodium trichloroacetate |
211-479-2 |
STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H400 H410 |
GHS07 GHS09 Wng |
H335 H410 |
|
|
|
|
|
607-006-00-8 |
oxalic acid |
205-634-3 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
* |
|
|
|
607-007-00-3 |
salts of oxalic acid (with the exception of those specified elsewhere in this Annex) |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
* |
A |
|
607-008-00-9 |
acetic anhydride |
203-564-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H226 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H226 H332 H302 H314 |
|
Skin Corr. 1B; H314: C ≥ 2 % Skin Irrit. 2; H315: 5 % ≤C < 25 % Eye Dam. 1; H318: 5 % ≤ C < 25 % Eye Irrit. 2; H319: 1 % ≤C < 5 % STOT SE 3; H335: C ≥ 5 % |
|
|
|
607-009-00-4 |
phthalic anhydride |
201-607-5 |
Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H335 H315 H318 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H335 H315 H318 H334 H317 |
|
|
|
|
|
607-010-00-X |
propionic anhydride |
204-638-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
|
|
607-011-00-5 |
acetyl chloride |
200-865-6 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
EUH014 |
|
|
|
|
607-012-00-0 |
benzoyl chloride |
202-710-8 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H332 H312 H302 H314 H317 |
GHS05 GHS07 Dgr |
H332 H312 H302 H314 H317 |
|
|
|
|
|
607-013-00-6 |
dimethyl carbonate |
210-478-4 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
607-014-00-1 |
methyl formate |
203-481-7 |
Flam. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H224 H332 H302 H319 H335 |
GHS02 GHS07 Dgr |
H224 H332 H302 H319 H335 |
|
|
|
|
|
607-015-00-7 |
ethyl formate |
203-721-0 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H225 H332 H302 H319 H335 |
GHS02 GHS07 Dgr |
H225 H332 H302 H319 H335 |
|
|
|
|
|
607-016-00-2 |
propyl formate; [1] isopropyl formate [2] |
203-798-0 [1] 210-901-2 [2] |
110-74-7 [1] 625-55-8 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 STOT SE 3 |
H225 H319 H335 H336 |
GHS02 GHS07 Dgr |
H225 H319 H335 H336 |
|
|
C |
|
607-017-00-8 |
butyl formate; [1] tert-butyl formate; [2] isobutyl formate [3] |
209-772-5 [1] 212-105-0 [2] 208-818-1 [3] |
592-84-7 [1] 762-75-4 [2] 542-55-2 [3] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H335 |
GHS02 GHS07 Dgr |
H225 H319 H335 |
|
|
C |
|
607-018-00-3 |
isopentyl formate; [1] 2-methylbutyl formate [2] |
203-769-2 [1] 252-343-2 [2] |
110-45-2 [1] 35073-27-9 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H335 |
GHS02 GHS07 Dgr |
H225 H319 H335 |
|
|
C |
|
607-019-00-9 |
methyl chloroformate |
201-187-3 |
Flam. Liq. 2 Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H225 H330 H312 H302 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H330 H312 H302 H314 |
|
|
|
|
|
607-020-00-4 |
ethyl chloroformate |
208-778-5 |
Flam. Liq. 2 Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H225 H330 H302 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H330 H302 H314 |
|
|
|
|
|
607-021-00-X |
methyl acetate |
201-185-2 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
|
607-022-00-5 |
ethyl acetate |
205-500-4 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
|
|
|
607-023-00-0 |
vinyl acetate |
203-545-4 |
Flam. Liq. 2 Carc. 2 Acute Tox. 4 STOT SE 3 |
H225 H351 H332 H335 |
GHS02 GHS08 GHS07 Dgr |
H225 H351 H332 H335 |
|
|
D |
|
|
607-024-00-6 |
propyl acetate; [1] isopropyl acetate [2] |
203-686-1 [1] 203-561-1 [2] |
109-60-4 [1] 108-21-4 [2] |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
EUH066 |
|
C |
|
607-025-00-1 |
n-butyl acetate |
204-658-1 |
Flam. Liq. 3 STOT SE 3 |
H226 H336 |
GHS02 GHS07 Wng |
H226 H336 |
EUH066 |
|
|
|
|
607-026-00-7 |
sec-butyl acetate; [1] isobutyl acetate; [2] tert-butyl acetate [3] |
203-300-1 [1] 203-745-1 [2] 208-760-7 [3] |
105-46-4 [1] 110-19-0 [2] 540-88-5 [3] |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
EUH066 |
|
C |
|
607-027-00-2 |
methyl propionate |
209-060-4 |
Flam. Liq. 2 Acute Tox. 4 * |
H225 H332 |
GHS02 GHS07 Dgr |
H225 H332 |
|
|
|
|
|
607-028-00-8 |
ethyl propionate |
203-291-4 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
607-029-00-3 |
n-butyl propionate; [1] sec-butyl propionate; [2] iso-butyl propionate [3] |
209-669-5 [1] -[2] 208-746-0 [3] |
590-01-2 [1] 591-34-4 [2] 540-42-1 [3] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
607-030-00-9 |
propyl propionate |
203-389-7 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H332 |
GHS02 GHS07 Wng |
H226 H332 |
|
|
|
|
|
607-031-00-4 |
butyl butyrate |
203-656-8 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
|
607-032-00-X |
ethyl acrylate |
205-438-8 |
Flam. Liq. 2 Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H225 H331 H312 H302 H335 H315 H319 H317 |
GHS02 GHS06 Dgr |
H225 H331 H312 H302 H335 H315 H319 H317 |
|
inhalation: ATE = 9 mg/L (vapours) dermal: ATE = 1 800 mg/kg bw oral: ATE = 1 120 mg/kg bw STOT SE 3; H335: C ≥ 5 % Skin Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % |
D |
|
|
607-033-00-5 |
n-butyl methacrylate |
202-615-1 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H226 H319 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H317 |
|
|
D |
|
|
607-034-00-0 |
methyl acrylate; methyl propenoate |
202-500-6 |
Flam. Liq. 2 Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 |
H225 H331 H312 H302 H335 H315 H319 H317 |
GHS02 GHS06 Dgr |
H225 H331 H312 H302 H335 H315 H319 H317 |
|
inhalation: ATE = 3 mg/L (vapours) dermal: ATE = 1 100 mg/kg bw oral: ATE = 500 mg/kg bw |
D |
|
|
607-035-00-6 |
methyl methacrylate; methyl 2-methylprop-2-enoate; methyl 2-methylpropenoate |
201-297-1 |
Flam. Liq. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H335 H315 H317 |
|
|
D |
|
|
607-036-00-1 |
2-methoxyethyl acetate; methylglycol acetate |
203-772-9 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H360FD H332 H312 H302 |
GHS08 GHS07 Dgr |
H360FD H332 H312 H302 |
|
|
|
|
|
607-037-00-7 |
2-ethoxyethyl acetate; ethylglycol acetate |
203-839-2 |
Flam. Liq. 3 Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H226 H360FD H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H226 H360FD H332 H312 H302 |
|
|
|
|
|
607-038-00-2 |
2-butoxyethyl acetate; butylglycol acetate |
203-933-3 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 |
GHS07 Wng |
H332 H312 |
|
|
|
|
|
607-039-00-8 |
2,4-D (ISO); 2,4-dichlorophenoxyacetic acid |
202-361-1 |
Acute Tox. 4 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H335 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H335 H318 H317 H412 |
|
|
|
|
|
607-040-00-3 |
salts of 2,4-D |
— |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
A |
|
607-041-00-9 |
2,4,5-T (ISO); 2,4,5-trichlorophenoxy acetic acid |
202-273-3 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
|
|
|
607-042-00-4 |
salts and esters of 2,4,5-T; salts and esters of 2,4,5-trichlorophenoxy acetic acid |
— |
— |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H410 |
|
|
A |
|
607-043-00-X |
dicamba (ISO); 2,5-dichloro-6-methoxybenzoic acid; 3,6-dichloro-2-methoxybenzoic acid |
217-635-6 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H302 H318 H412 |
GHS05 GHS07 Dgr |
H302 H318 H412 |
|
|
|
|
|
607-044-00-5 |
3,6-dichloro-o-anisic acid, compound with dimethylamine (1:1); [1] potassium 3,6-dichloro-o-anisate[2] |
218-951-7 [1] 233-002-7 [2] |
2300-66-5 [1] 10007-85-9 [2] |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
607-045-00-0 |
dichlorprop (ISO); 2-(2,4-dichlorophenoxy)propionic acid |
204-390-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H312 H302 H315 H318 |
GHS05 GHS07 Dgr |
H312 H302 H315 H318 |
|
|
|
|
|
607-046-00-6 |
salts of dichlorprop |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
A |
|
607-047-00-1 |
fenoprop (ISO); 2-(2,4,5-trichlorophenoxy)propionic acid |
202-271-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
607-048-00-7 |
salts of fenoprop; salts of 2-(2,4,5-trichlorophenoxy)propionic acid |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
A |
|
607-049-00-2 |
mecoprop (ISO); 2-(4-chloro-o-tolyloxy)propionic acid; (RS)-2-(4-chloro-o-tolyloxy)propionic acid; [1] 2-(4-chloro-2-methylphenoxy)propionic acid [2] |
230-386-8 [1] 202-264-4 [2] |
7085-19-0 [1] 708519-0 [2] |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
M=100 |
|
|
607-050-00-8 |
salts of mecoprop |
— |
— |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
A |
|
607-051-00-3 |
MCPA (ISO); 4-chloro-o-tolyloxyacetic acid |
202-360-6 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H318 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H410 |
|
|
|
|
|
607-052-00-9 |
salts and esters of MCPA |
— |
— |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
|
A |
|
607-053-00-4 |
MCPB (ISO); 4-(4-chloro-o-tolyloxy) butyric acid |
202-365-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-054-00-X |
salts and esters of MCPB |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
A |
|
607-055-00-5 |
endothal-sodium (ISO); disodium 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylate |
204-959-8 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H301 H312 H319 H335 H315 |
GHS06 Dgr |
H301 H312 H319 H335 H315 |
|
|
|
|
|
607-056-00-0 |
warfarin (ISO); 4-hydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-one; [1] (S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone; [2] (R)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone [3] |
201-377-6 [1] 226-907-3 [2] 226-908-9 [3] |
81-81-2 [1] [2] [3] |
Repr. 1A Acute Tox. 1 Acute Tox. 1 Acute Tox. 2 STOT RE 1 Aquatic Chronic 2 |
H360D H330 H310 H300 H372 (blood) H411 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (blood) H411 |
|
Repr. 1A; H360D: C ≥ 0,003 % STOT RE 1; H372 (blood): C ≥ 0,5 % STOT RE 2; H373 (blood): 0,05 % ≤ C < 0,5 % |
|
|
607-057-00-6 |
coumachlor (ISO); 3-[1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxycoumarin |
201-378-1 |
STOT RE 2 * Aquatic Chronic 3 |
H373 ** H412 |
GHS08 Wng |
H373 ** H412 |
|
|
|
|
|
607-058-00-1 |
coumafuryl (ISO); fumarin; (RS)-3-(1-(2-furyl)-3-oxobutyl)4-hydroxycoumarin; 4-hydroxy-3-[3-oxo-1-(2-furyl)butyl]coumarin |
204-195-5 |
Acute Tox. 3 * STOT RE 1 Aquatic Chronic 3 |
H301 H372 ** H412 |
GHS06 GHS08 Dgr |
H301 H372 ** H412 |
|
|
|
|
|
607-059-00-7 |
coumatetralyl (ISO); 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)coumarin |
227-424-0 |
Repr. 1B Acute Tox. 2 Acute Tox. 3 Acute Tox. 2 STOT RE 1 Aquatic Chronic 1 |
H360D H330 H311 H300 H372 (blood) H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H311 H300 H372 (blood) H410 |
|
Repr. 1B; H360D: C ≥ 0,003 % STOT RE 1; H372 (blood): C ≥ 1,0 % STOT RE 2; H373 (blood) 0,1 % ≤ C < 1,0 % M = 10 |
|
|
|
607-060-00-2 |
dicoumarol; 4,4'-dihydroxy-3,3'-methylenebis(2H-chromen-2-one) |
200-632-9 |
STOT RE 1 Acute Tox. 4 * Aquatic Chronic 2 |
H372 ** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H372 ** H302 H411 |
|
|
|
|
|
607-061-00-8 |
acrylic acid; prop-2-enoic acid |
201-177-9 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H226 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H332 H312 H302 H314 H400 |
|
STOT SE 3; H335: C ≥ 1 % |
D |
|
|
607-062-00-3 |
n-butyl acrylate |
205-480-7 |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H226 H319 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H319 H335 H315 H317 |
|
|
D |
|
|
607-063-00-9 |
isobutyric acid |
201-195-7 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
607-064-00-4 |
benzyl chloroformate |
207-925-0 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
607-065-00-X |
bromoacetic acid |
201-175-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1A Skin Sens. 1 Aquatic Acute 1 |
H331 H311 H301 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H331 H311 H301 H314 H317 H400 |
|
|
|
|
|
607-066-00-5 |
dichloroacetic acid |
201-207-0 |
Skin Corr. 1A Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
|
|
|
|
607-067-00-0 |
dichloroacetyl chloride |
201-199-9 |
Skin Corr. 1A Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
|
|
|
|
607-068-00-6 |
iodoacetic acid |
200-590-1 |
Acute Tox. 3 * Skin Corr. 1A |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
|
|
|
|
607-069-00-1 |
ethyl bromoacetate |
203-290-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
|
607-070-00-7 |
ethyl chloroacetate |
203-294-0 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H331 H311 H301 H400 |
GHS06 GHS09 Dgr |
H331 H311 H301 H400 |
|
|
|
|
|
607-071-00-2 |
ethyl methacrylate |
202-597-5 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H225 H319 H335 H315 H317 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 H317 |
|
|
D |
|
|
607-072-00-8 |
2-hydroxyethyl acrylate |
212-454-9 |
Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 |
H311 H314 H317 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H314 H317 H400 |
|
* Skin Sens. 1; H317: C ≥ 0,2 % |
D |
|
|
607-073-00-3 |
4-CPA (ISO); 4-chlorophenoxyacetic acid |
204-581-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-074-00-9 |
chlorfenac(ISO); 2,3,6-trichlorophenylacetic acid |
201-599-3 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-075-00-4 |
chlorfenprop-methyl; methyl 2-chloro-3-(4-chlorophenyl)propionate |
238-413-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
607-076-00-X |
dodine(ISO); dodecylguanidinium acetate |
219-459-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H315 H410 |
|
|
|
|
|
607-077-00-5 |
erbon (ISO); 2-(2,4,5-trichlorophenoxy)ethyl2,2-dichloropropionate |
— |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-078-00-0 |
fluenetil (ISO); 2-fluoroethyl biphenyl-4-ylacetate |
— |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
|
607-079-00-6 |
kelevan (ISO); ethyl 5-(perchloro-5-hydroxypentacyclo[5,3,0,02,6,03,9,04,8]decan-5-yl)-4-oxopentanoate; ethyl 5-(1,2,3,5,6,7,8,9,10,10-decachloro-4-hydroxypentacyclo(5,2,1,02,6,03,9,05,8)dec-4-yl)-4-oxovalerate |
— |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H311 H302 H411 |
GHS06 GHS09 Dgr |
H311 H302 H411 |
|
|
|
|
|
607-080-00-1 |
chloroacetyl chloride |
201-171-6 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Skin Corr. 1A Aquatic Acute 1 |
H331 H311 H301 H372 ** H314 H400 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H331 H311 H301 H372 ** H314 H400 |
EUH014 EUH029 |
|
|
|
|
607-081-00-7 |
fluoroacetic acid |
205-631-7 |
Acute Tox. 2 * Aquatic Acute 1 |
H300 H400 |
GHS06 GHS09 Dgr |
H300 H400 |
|
|
|
|
|
607-082-00-2 |
fluoroacetates, soluble |
— |
— |
Acute Tox. 2 * Aquatic Acute 1 |
H300 H400 |
GHS06 GHS09 Dgr |
H300 H400 |
|
|
A |
|
607-083-00-8 |
2,4-DB (ISO); 4-(2,4-dichlorophenoxy)butyric acid |
202-366-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-084-00-3 |
salts of 2,4-DB |
— |
— |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 2 |
H302 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H411 |
|
|
A |
|
607-085-00-9 |
benzyl benzoate |
204-402-9 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-086-00-4 |
diallyl phthalate |
205-016-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-088-00-5 |
methacrylic acid; 2-methylpropenoic acid |
201-204-4 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
STOT SE 3; H335: C ≥ 1 % |
D |
|
|
607-089-00-0 |
propionic acid … % |
201-176-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H319 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % STOT SE 3; H335: C ≥ 10 % |
B |
|
|
607-090-00-6 |
thioglycolic acid |
200-677-4 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B |
H331 H311 H301 H314 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 |
|
* |
|
|
|
607-091-00-1 |
trifluoroacetic acid . . . % |
200-929-3 |
Acute Tox. 4 * Skin Corr. 1A Aquatic Chronic 3 |
H332 H314 H412 |
GHS05 GHS07 Dgr |
H332 H314 H412 |
|
* |
B |
|
|
607-092-00-7 |
methyl lactate; [1] methyl (±)-lactate; [2] methyl (R)-lactate; [3] methyl (S)-(-)-lactate [4] |
208-930-0 [1] 218-449-8 [2] 241-420-6 [3] 248-704-9 [4] |
547-64-8 [1] 2155-30-8 [2] 17392-83-5 [3] 27871-49-4 [4] |
Flam. Liq. 3 Eye Irrit. 2 STOT SE 3 |
H226 H319 H335 |
GHS02 GHS07 Wng |
H226 H319 H335 |
|
|
C |
|
607-093-00-2 |
propionyl chloride |
201-170-0 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
EUH014 |
|
B D |
|
|
607-094-00-8 |
peracetic acid . . . % |
201-186-8 |
Flam. Liq. 3 Org. Perox. D **** Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H226 H242 H332 H312 H302 H314 H400 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H242 H332 H312 H302 H314 H400 |
|
* STOT SE 3; H335: C ≥ 1 % |
B D |
|
|
607-095-00-3 |
maleic acid |
203-742-5 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H302 H319 H335 H315 H317 |
GHS07 Wng |
H302 H319 H335 H315 H317 |
|
Skin Sens. 1; H317: C ≥0,1 % |
|
|
|
607-096-00-9 |
maleic anhydride |
203-571-6 |
Acute Tox. 4 STOT RE 1 Skin Corr. 1B Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1A |
H302 H372 (respiratory system) (inhalation) H314 H318 H334 H317 |
GHS07 GHS08 GHS05 Dgr |
H302 H372 (respiratory system) (inhalation) H314 H334 H317 |
EUH071 |
Skin Sens. 1A; H317: C ≥ 0,001 % |
|
|
|
607-097-00-4 |
benzene-1,2,4-tricarboxylic acid 1,2-anhydride; trimellitic anhydride |
209-008-0 |
STOT SE 3 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H335 H318 H334 H317 |
GHS08 GHS05 GHS07 Dgr |
H335 H318 H334 H317 |
|
|
|
|
|
607-098-00-X |
benzene-1,2:4,5-tetracarboxylic dianhydride; benzene-1,2:4,5-tetracarboxylic dianhydride; pyromellitic dianhydride |
201-898-9 |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
|
|
|
607-099-00-5 |
1,2,3,6-tetrahydrophthalic anhydride; [1] cis-1,2,3,6-tetrahydrophthalicanhydride; [2] 3,4,5,6-tetrahydrophthalic anhydride; [3] tetrahydrophthalic anhydride [4] |
201-605-4 [1] 213-308-7 [2] 219-374-3 [3] 247-570-9 [4] |
85-43-8 [1] 935-79-5 [2] 2426-02-0 [3] 26266-63-7 [4] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H334 H317 H412 |
GHS08 GHS05 Dgr |
H318 H334 H317 H412 |
|
|
C |
|
607-100-00-9 |
benzophenone-3,3',4,4'-tetracarboxylic dianhydride; 4,4'-carbonyldi(phthalic anhydride) |
219-348-1 |
Eye Irrit. 2 STOT SE 3 |
H319 H335 |
GHS07 Wng |
H319 H335 |
|
Eye Irrit 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
|
607-101-00-4 |
1,4,5,6,7,7-hexachlorobicyclo [2,2,1]hept-5-ene-2,3-dicarboxylicanhydride chlorendic anhydride |
204-077-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
Skin Irrit.2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
|
607-102-00-X |
cyclohexane-1,2-dicarboxylic anhydride; [1] cis-cyclohexane-1,2-dicarboxylicanhydride; [2] trans-cyclohexane-1,2-dicarboxylic anhydride [3] |
201-604-9 [1] 236-086-3 [2] 238-009-9 [3] |
85-42-7 [1] 13149-00-3 [2] 14166-21-3 [3] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-103-00-5 |
succinic anhydride |
203-570-0 |
Acute Tox. 4 Skin Corr. 1 Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H302 H314 H318 H334 H317 |
GHS07 GHS05 GHS08 Dgr |
H302 H314 H334 H317 |
EUH071 |
|
|
|
|
607-104-00-0 |
cyclopentane-1,2,3,4-tetracarboxylic dianhydride |
227-964-7 |
Eye Irrit. 2 STOT SE 3 |
H319 H335 |
GHS07 Wng |
H319 H335 |
|
Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
|
607-105-00-6 |
8,9,10-trinorborn-5-ene-2,3-dicarboxylic anhydride; [1] 1,2,3,6-tetrahydro-3,6-methanophthalic anhydride; [2] (1α,2α,3β,6β)-1,2,3,6-tetrahydro-3,6-methanophthalic anhydride [3] |
204-957-7 [1] 212-557-9 [2] 220-384-5 [3] |
129-64-6 [1] 826-62-0 [2] 2746-19-2 [3] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-106-00-1 |
8,9-dinorborn-5-ene-2,3-dicarboxylic anhydride |
— |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Resp. Sens. 1 |
H302 H319 H335 H315 H334 |
GHS08 GHS07 Dgr |
H302 H319 H335 H315 H334 |
|
STOT SE 3; H335: C ≥ 10 % |
C |
|
|
607-107-00-7 |
2-ethylhexyl acrylate |
203-080-7 |
STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H335 H315 H317 |
GHS07 Wng |
H335 H315 H317 |
|
|
D |
|
|
607-108-00-2 |
2-hydroxy-1-methylethylacrylate; [1] 2-hydroxypropylacrylate; [2] acrylic acid, monoester with propane-1,2-diol [3] |
220-852-9 [1] 213-663-8 [2] 247-118-0 [3] |
2918-23-2 [1] 999-61-1 [2] 25584-83-2 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H331 H311 H301 H314 H317 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 H317 |
|
* Skin Sens. 1; H317:C ≥0,2 % |
C D |
|
607-109-00-8 |
hexamethylene diacrylate; hexane-1,6-diol diacrylate |
235-921-9 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-110-00-3 |
pentaerythritol triacrylate |
222-540-8 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-111-00-9 |
2-ethyl-2-[[(1-oxoallyl)oxy]methyl]-1,3-propanediyl diacrylate; 2,2-bis(acryloyloxymethyl)butyl acrylate; trimethylolpropane triacrylate |
239-701-3 |
Carc. 2 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H315 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H315 H319 H317 H410 |
|
M = 1 M = 1 |
D |
|
|
607-112-00-4 |
2,2-dimethyltrimethylene diacrylate; neopentyl glycol diacrylate |
218-741-5 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H311 H319 H315 H317 |
GHS06 Dgr |
H311 H319 H315 H317 |
|
* |
D |
|
|
607-113-00-X |
isobutyl methacrylate |
202-613-0 |
Flam. Liq. 3 STOT SE 3 Skin Irrit. 2 Skin Sens. 1B |
H226 H335 H315 H317 |
GHS02 GHS07 Wng |
H226 H335 H315 H317 |
|
|
D |
|
|
607-114-00-5 |
ethylene dimethacrylate |
202-617-2 |
STOT SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
|
STOT SE 3; H335: C ≥ 10 % |
D |
|
|
607-115-00-0 |
isobutyl acrylate |
203-417-8 |
Flam. Liq. 3 Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 |
H226 H332 H312 H315 H317 |
GHS02 GHS07 Wng |
H226 H332 H312 H315 H317 |
|
|
D |
|
|
607-116-00-6 |
cyclohexyl acrylate |
221-319-3 |
STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H335 H315 H411 |
GHS07 GHS09 Wng |
H335 H315 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
D |
|
|
607-117-00-1 |
2,3-epoxypropyl acrylate; glycidyl acrylate |
203-440-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H331 H311 H301 H314 H317 |
GHS06 GHS05 Dgr |
H331 H311 H301 H314 H317 |
|
* Skin Sens. 1; H317:C ≥0,2 % |
D |
|
|
607-118-00-7 |
1-methyltrimethylene diacrylate; 1,3-butylene glycol diacrylate |
243-105-9 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H314 H317 |
GHS05 GHS07 Dgr |
H312 H314 H317 |
|
|
D |
|
|
607-119-00-2 |
tetramethylene diacrylate; 1,4-butyleneglycol diacrylate |
213-979-6 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H312 H314 H317 |
GHS05 GHS07 Dgr |
H312 H314 H317 |
|
|
D |
|
|
607-120-00-8 |
2,2'-oxydiethyl diacrylate; diethylene glycol diacrylate |
223-791-6 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H311 H319 H315 H317 |
GHS06 Dgr |
H311 H319 H315 H317 |
|
* Skin Sens. 1; H317:C≥0,2 % |
D |
|
|
607-121-00-3 |
8,9,10-trinorborn-2-yl acrylate |
— |
Acute Tox. 4 * Skin Irrit. 2 Skin Sens. 1 |
H312 H315 H317 |
GHS07 Wng |
H312 H315 H317 |
|
|
D |
|
|
607-122-00-9 |
pentaerythritol tetraacrylate |
225-644-1 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-123-00-4 |
2,3-epoxypropyl methacrylate; glycidyl methacrylate |
203-441-9 |
Carc. 1B Muta. 2 Repr. 1B Acute Tox. 3 Acute Tox. 4 STOT SE 3 STOT RE 1 Eye Dam. 1 Skin Corr. 1C Skin Sens. 1 |
H350 H341 H360F H311 H302 H335 H372 (respiratory tract) (inhalation) H318 H314 H317 |
GHS08 GHS06 GHS05 Dgr |
H350 H341 H360F H311 H302 H335 H372 (respiratory tract) (inhalation) H314 H317 |
|
|
D |
|
|
607-124-00-X |
2-hydroxyethyl methacrylate |
212-782-2 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-125-00-5 |
2-hydroxypropyl methacrylate; [1] 3-hydroxypropyl methacrylate[2] |
213-090-3 [1] 220-426-2 [2] |
923-26-2 [1] 2761-09-3 [2] |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
C D |
|
607-126-00-0 |
2,2'-(ethylenedioxy)diethyl diacrylate; triethylene glycol diacrylate |
216-853-9 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-127-00-6 |
2-diethylaminoethyl methacrylate |
203-275-7 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H332 H319 H315 H317 |
GHS07 Wng |
H332 H319 H315 H317 |
|
|
D |
|
|
607-128-00-1 |
2-tert-butylaminoethyl methacrylate |
223-228-4 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
D |
|
|
607-129-00-7 |
ethyl lactate; ethyl DL-lactate; [1] ethyl (S)-2-hydroxypropionate; ethyl L-lactate; ethyl-(S)-lactate [2] |
202-598-0 [1] 211-694-1 [2] |
97-64-3 [1] 687-47-8 [2] |
Flam. Liq. 3 STOT SE 3 Eye Dam. 1 |
H226 H335 H318 |
GHS02 GHS05 GHS07 Dgr |
H226 H335 H318 |
|
|
C |
|
607-130-00-2 |
pentyl acetate; [1] isopentyl acetate; [2] 1-methylbutyl acetate; [3] 2-methylbutyl acetat; [4] 2(or 3)-methylbutyl acetate [5] |
211-047-3 [1] 204-662-3 [2] 210-946-8 [3] 210-843-8 [4] 282-263-3 [5] |
628-63-7 [1] 123-92-2 [2] 626-38-0 [3] 624-41-9 [4] 84145-37-9 [5] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
EUH066 |
|
C |
|
607-131-00-8 |
isopentyl propionate; [1] pentyl propionate; [2] 2-methylbutyl propionate [3] |
203-322-1 [1] 210-852-7 [2] 219-449-0 [3] |
105-68-0 [1] 624-54-4 [2] 2438-20-2 [3] |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
C |
|
607-132-00-3 |
2-dimethylaminoethyl methacrylate |
220-688-8 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H312 H302 H319 H315 H317 |
GHS07 Wng |
H312 H302 H319 H315 H317 |
|
|
D |
|
|
607-133-00-9 |
monoalkylor monoaryl or monoalkylaryl esters of acrylic acid with the exception of those specified elsewhere in this Annex |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H335 H315 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
A |
|
607-134-00-4 |
monoalkyl or monoaryl or monoalkyaryl esters of methacrylic acid with the exception of those specified elsewhere in this Annex |
— |
— |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOTSE 3; H335: C ≥ 10 % |
A |
|
607-135-00-X |
butyric acid |
203-532-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
607-136-00-5 |
butyryl chloride |
205-498-5 |
Flam. Liq. 2 Skin Corr. 1B |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
|
607-137-00-0 |
methyl acetoacetate |
203-299-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-138-00-6 |
butyl chloroformate; chloroformic acid butyl ester |
209-750-5 |
Flam. Liq. 3 Acute Tox. 3 * Skin Corr. 1B |
H226 H331 H314 |
GHS02 GHS06 GHS05 Dgr |
H226 H331 H314 |
|
|
|
|
|
607-139-00-1 |
2-chloropropionic acid |
209-952-3 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
|
607-140-00-7 |
isobutyryl chloride |
201-194-1 |
Flam. Liq. 2 Skin Corr. 1A |
H225 H314 |
GHS02 GHS05 Dgr |
H225 H314 |
|
|
|
|
|
607-141-00-2 |
oxydiethylene bis(chloroformate) |
203-430-9 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H302 H315 H318 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H315 H318 H411 |
|
|
|
|
|
607-142-00-8 |
propyl chloroformate; chloroformic acid propylester; n-propyl chloroformate |
203-687-7 |
Flam. Liq. 2 Acute Tox. 3 * Skin Corr. 1B |
H225 H331 H314 |
GHS02 GHS06 GHS05 Dgr |
H225 H331 H314 |
|
|
|
|
|
607-143-00-3 |
valeric acid |
203-677-2 |
Skin Corr. 1B Aquatic Chronic 3 |
H314 H412 |
GHS05 Dgr |
H314 H412 |
|
|
|
|
|
607-144-00-9 |
adipic acid |
204-673-3 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-145-00-4 |
methanesulphonic acid |
200-898-6 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
607-146-00-X |
fumaric acid |
203-743-0 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-147-00-5 |
oxalic acid diethylester; diethyl oxalate |
202-464-1 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
|
607-148-00-0 |
guanidinium chloride; guanadine hydrochloride |
200-002-3 |
Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H302 H319 H315 |
GHS07 Wng |
H302 H319 H315 |
|
|
|
|
|
607-149-00-6 |
urethane (INN); ethyl carbamate |
200-123-1 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
607-150-00-1 |
endothal (ISO); 7-oxabicyclo(2,2,1)heptane-2,3-dicarboxylic acid |
205-660-5 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H301 H312 H319 H335 H315 |
GHS06 Dgr |
H301 H312 H319 H335 H315 |
|
|
|
|
|
607-151-00-7 |
propargite (ISO); 2-(4-tert-butylphenoxy)cyclohexyl prop-2-ynyl sulphite |
219-006-1 |
Carc. 2 Acute Tox. 3 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H331 H315 H318 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H351 H331 H315 H318 H410 |
|
M = 10 |
|
|
|
607-152-00-2 |
2,3,6-TBA (ISO); 2,3,6-trichlorobenzoic acid |
200-026-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-153-00-8 |
benazolin (ISO); 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid |
223-297-0 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
|
607-154-00-3 |
ethyl N-benzoyl-N-(3,4-dichlorophenyl)-DL-alaninate; benzoylprop-ethyl (ISO) |
244-845-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-155-00-9 |
3-(3-amino-5-(1-methylguanidino)-1-oxopentylamino-6-(4-amino-2-oxo-2,3-dihydro-pyrimidin-1-yl)-2,3-dihydro-(6H)-pyran-2-carboxylic acid; blasticidin-s |
— |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
|
607-156-00-4 |
chlorfenson (ISO); 4-chlorophenyl 4-chlorobenzenesulfonate |
201-270-4 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
607-157-00-X |
difenacoum (ISO); 3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin |
259-978-4 |
Repr. 1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (blood) H410 |
|
Repr. 1B; H360D: C ≥ 0,003 % STOT RE 1; H372 (blood): C ≥ 0,02 % STOT RE 2; H373 (blood): 0,002 % ≤ C < 0,02 % M = 10 M = 10 |
|
|
|
607-158-00-5 |
sodium salt of chloroacetic acid; sodium chloroacetate |
223-498-3 |
Acute Tox. 3 * Skin Irrit. 2 Aquatic Acute 1 |
H301 H315 H400 |
GHS06 GHS09 Dgr |
H301 H315 H400 |
|
|
|
|
|
607-159-00-0 |
chlorobenzilate (ISO); ethyl 2,2-di(4-chlorophenyl)-2-hydroxyacetate; ethyl 4,4'-dichlorobenzilate |
208-110-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-160-00-6 |
isobutyl 2-(4-(4-chlorophenoxy)phenoxy)propionate; clofop-isobutyl (ISO) |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-161-00-1 |
diethanolamine salt of 4-CPA |
— |
— |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
607-162-00-7 |
dalapon; 2,2-dichloropropionic acid; [1] dalapon-sodium; sodium 2,2-dichloropropionate[2] |
200-923-0 [1] 204-828-5 [2] |
75-99-0 [1] 127-20-8 [2] |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
607-163-00-2 |
3-acetyl-6-methyl-2H-pyran-2,4(3H)-dione; dehydracetic acid |
208-293-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-164-00-8 |
sodium 1-(3,4-dihydro-6-methyl-2,4-dioxo-2H-pyran-3-ylidene)ethonolate; sodium dehydracetate |
224-580-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-165-00-3 |
diclofop-methyl (ISO)methyl 2-(4-(2,4-dichlorophenoxy)phenoxy)propionate; methyl (RS)-2-[4-(2,4-dichlorophenoxy)phenoxy]propionate; |
257-141-8 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
|
607-166-00-9 |
medinoterb acetate (ISO); 6-tert-butyl-3-methyl-2,4-dinitrophenyl acetate |
219-634-6 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
|
|
607-167-00-4 |
sodium 3-chloroacrylate |
— |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
|
607-168-00-X |
dipropyl 6,7-methylenedioxy-1,2,3,4-tetrahydro-3-methylnaphthalene-1,2-dicarboxylate; propylisome |
— |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H302 H400 H410 |
GHS06 GHS09 Dgr |
H311 H302 H410 |
|
|
|
|
|
607-169-00-5 |
sodium fluoroacetate |
200-548-2 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H330 H310 H300 H400 |
GHS06 GHS09 Dgr |
H330 H310 H300 H400 |
|
|
|
|
|
607-170-00-0 |
bis(1,2,3-trithiacyclohexyldimethylammonium) oxalate; thiocyclam-oxalate |
250-859-2 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
|
607-172-00-1 |
brodifacoum (ISO); 4-hydroxy-3-(3-(4′-bromo-4-biphenylyl)-1,2,3,4-tetrahydro-1-naphthyl)coumarin |
259-980-5 |
Repr. 1A Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (blood) H410 |
|
Repr. 1A; H360D: C ≥ 0,003 % STOT RE 1; H372 (blood): C ≥ 0,02 % STOT RE 2; H373 (blood): 0,002 % ≤ C < 0,02 % M = 10 M = 10 |
|
|
|
607-173-00-7 |
dimethyl (3-methyl-4-(5-nitro-3-ethoxycarbonyl-2-thienyl)azo)phenylnitrilodipropionate |
400-460-6 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-174-00-2 |
reaction mass of dodecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate and tetradecyl 3-(2,2,4,4-tetramethyl-21-oxo-7-oxa-3,20-diazadispiro(5,1,11,2)henicosan-20-yl)propionate |
400-580-9 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-175-00-8 |
methyl 2-(2-nitrobenzylidene)acetoacetate |
400-650-9 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-176-00-3 |
reaction mass of α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-hydroxypoly(oxyethylene) and α-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyl-ω-3-(3-(2H-benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl)propionyloxypoly(oxyethylene) |
400-830-7 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-177-00-9 |
tribenuron-methyl (ISO); methyl 2-[N-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)-N-methylcarbamoylsulfamoyl]benzoate |
401-190-1 |
STOT RE 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H373 H317 H410 |
|
M = 100 M = 100 |
|
|
|
607-178-00-4 |
methyl α-((4,6-dimethoxypyrimidin-2-yl)ureidosulphonyl)-o-toluate |
401-340-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-179-00-X |
(benzothiazol-2-ylthio)succinic acid |
401-450-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-180-00-5 |
potassium 2-hydroxycarbazole-1-carboxylate |
401-630-2 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Aquatic Chronic 3 |
H302 H319 H335 H412 |
GHS07 Wng |
H302 H319 H335 H412 |
|
|
|
|
|
607-181-00-0 |
3,5-dichloro-2,4-difluorobenzoyl fluoride |
401-800-6 |
Acute Tox. 3 * Skin Corr. 1B Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H331 H314 H302 H317 H412 |
GHS06 GHS05 Dgr |
H331 H314 H302 H317 H412 |
EUH029 |
|
|
|
|
607-182-00-6 |
methyl 3-sulphamoyl-2-thenoate |
402-050-2 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-183-00-1 |
zinc 2-hydroxy-5-C13-18 alkylbenzoate |
402-280-3 |
— |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 2 |
H319 H315 H411 |
GHS07 GHS09 Wng |
H319 H315 H411 |
|
|
|
|
607-184-00-7 |
S-(3-trimethoxysilyl)propyl 19-isocyanato-11-(6-isocyanatohexyl)-10,12-dioxo-2,9,11,13-tetraazanonadecanethioate |
402-290-8 |
Flam. Liq. 3 Resp. Sens. 1 Skin Sens. 1 |
H226 H334 H317 |
GHS02 GHS08 Dgr |
H226 H334 H317 |
|
|
|
|
|
607-185-00-2 |
ethyl trans-3-dimethylaminoacrylate |
402-650-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-186-00-8 |
quinclorac (ISO); 3,7-dichloroquinoline-8-carboxylic acid |
402-780-1 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-187-00-3 |
bis(2,2,6,6-tetramethyl-4-piperidyl) succinate |
402-940-0 |
Eye Irrit. 2 Aquatic Chronic 3 |
H319 H412 |
GHS07 Wng |
H319 H412 |
|
|
|
|
|
607-188-00-9 |
hydrogen sodium N-carboxylatoethyl-N-octadec-9-enylmaleamate |
402-970-4 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-189-00-4 |
trimethylenediaminetetraacetic acid |
400-400-9 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
|
607-190-00-X |
methyl acrylamidomethoxyacetate (containing ≥ 0,1 % acrylamid) |
401-890-7 |
Carc. 1B Muta. 1B Acute Tox. 4 * Eye Irrit. 2 |
H350 H340 H302 H319 |
GHS08 GHS07 Dgr |
H350 H340 H302 H319 |
|
|
|
|
|
607-191-00-5 |
isobutyl 3,4-epoxybutyrate |
401-920-9 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
|
607-192-00-0 |
disodium N-carboxymethyl-N-(2-(2-hydroxyethoxy)ethyl)glycinate |
402-360-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-194-00-1 |
propylene carbonate |
203-572-1 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-195-00-7 |
2-methoxy-1-methylethyl acetate |
203-603-9 |
Flam. Liq. 3 |
H226 |
GHS02 Wng |
H226 |
|
|
|
|
|
607-196-00-2 |
heptanoic acid |
203-838-7 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
|
607-197-00-8 |
nonanoic acid |
203-931-2 |
Skin Irrit. 2 Eye Irrit. 2 Aquatic Chronic 3 |
H315 H319 H412 |
GHS07 Wng |
H315 H319 H412 |
|
|
|
|
|
607-198-00-3 |
propyl 3,4,5-trihydroxybenzoate |
204-498-2 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
|
607-199-00-9 |
octyl 3,4,5-trihydroxybenzoate |
213-853-0 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
|
607-200-00-2 |
dodecyl 3,4,5-trihydroxybenzoate |
214-620-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-201-00-8 |
thiocarbonyl chloride |
207-341-6 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H331 H302 H319 H335 H315 |
GHS06 Dgr |
H331 H302 H319 H335 H315 |
|
|
|
|
|
607-203-00-9 |
2-ethylhexyl[[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]acetate |
279-452-8 |
Repr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H360D *** H317 H412 |
GHS08 GHS07 Dgr |
H360D *** H317 H412 |
|
|
|
|
|
607-204-00-4 |
(chlorophenyl)(chlorotolyl)methane, mixed isomers |
400-140-6 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-205-00-X |
methyl chloroacetate |
202-501-1 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * STOT SE 3 Skin Irrit. 2 Eye Dam. 1 |
H226 H331 H301 H335 H315 H318 |
GHS02 GHS06 GHS05 Dgr |
H226 H331 H301 H335 H315 H318 |
|
|
|
|
|
607-206-00-5 |
isopropyl chloroacetate |
203-301-7 |
Flam. Liq. 3 Acute Tox. 3 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H226 H301 H319 H335 H315 |
GHS02 GHS06 Dgr |
H226 H301 H319 H335 H315 |
|
|
|
|
|
607-207-00-0 |
haloxyfop-etotyl (ISO); 2-ethoxyethyl 2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate; haloxyfop-(2-ethoxyethyl) |
402-560-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-208-00-6 |
4,8,12-trimethyltrideca-3,7,11-trienoic acid, mixed isomers |
403-000-2 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
|
607-209-00-1 |
reaction mass of O, O'-diisopropyl (pentathio)dithioformate and O, O'-diisopropyl (trithio)dithioformate and O, O'-diisopropyl (tetrathio)dithioformate |
403-030-6 |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
607-210-00-7 |
methyl acrylamidoglycolate (containing ≥ 0,1 % acrylamide) |
403-230-3 |
Carc. 1B Muta. 1B Skin Corr. 1B Skin Sens. 1 |
H350 H340 H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H350 H340 H314 H317 |
|
|
|
|
|
607-211-00-2 |
methyl 3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionate |
403-270-1 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-212-00-8 |
poly(oxypropylenecarbonyl-co-oxy(ethylethylene)carbonyl), containing 27 % hydroxyvalerate |
403-300-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-213-00-3 |
ethyl 3,3-bis(tert-pentylperoxy)butyrate |
403-320-2 |
Org. Perox. D**** Flam. Liq. 3 Aquatic Chronic 2 |
H242 H226 H411 |
GHS02 GHS09 Dgr |
H242 H226 H411 |
|
|
|
|
|
607-214-00-9 |
N, N-hydrazinodiacetic acid |
403-510-5 |
Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H301 H373 ** H317 H412 |
GHS06 GHS08 Dgr |
H301 H373 ** H317 H412 |
|
|
|
|
|
607-215-00-4 |
3-(3-tert-butyl-4-hydroxyphenyl)propionic acid |
403-920-4 |
Acute Tox. 4 * Eye Irrit. 2 |
H302 H319 |
GHS07 Wng |
H302 H319 |
|
|
|
|
|
607-216-00-X |
glutamic acid, reaction products with N-(C12-14-alkyl)propylenediamine |
403-950-8 |
— |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H330 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H330 H302 H314 H400 |
|
|
|
|
607-217-00-5 |
2-ethoxyethyl 2-(4-(2,6-dihydro-2,6-dioxo-7-phenyl-1,5-dioxaindacen-3-yl)phenoxy)acetate |
403-960-2 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-218-00-0 |
dichlorprop-P (ISO); (+)-R-2-(2,4-dichlorophenoxy)propionic acid |
403-980-1 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
|
607-219-00-6 |
bis(2-ethylhexyl) dithiodiacetate |
404-510-8 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
|
607-221-00-7 |
6-docosyloxy-1-hydroxy-4-(1-(4-hydroxy-3-methylphenanthren-1-yl)-3-oxo-2-oxaphenalen-1-yl)naphthalene-2-carboxylic acid |
404-550-6 |
— |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
607-222-00-2 |
6-(2,3-dimethylmaleimido)hexyl methacrylate |
404-870-6 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-223-00-8 |
transfluthrin (ISO); 2,3,5,6-tetrafluorobenzyl (1R,3S)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
405-060-5 |
Carc. 2 Acute Tox. 4 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H370 (nervous system) H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H370 (nervous system) H410 |
EUH066 |
oral: ATE = 580 mg/kg bw M = 1 000 M = 1 000 |
|
|
|
607-224-00-3 |
methyl 2-(3-nitrobenzylidene)acetoacetate |
405-270-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
607-225-00-9 |
3-azidosulfonylbenzoic acid |
405-310-3 |
Self-React. C **** STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H241 H373 ** H318 H317 |
GHS02 GHS08 GHS05 GHS07 Dgr |
H241 H373 ** H318 H317 |
|
|
|
|
|
607-226-00-4 |
reaction mass of 2-acryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate and 2-methacryloyloxyethyl hydrogen cyclohexane-1,2-dicarboxylate |
405-360-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H315 H318 H317 H412 |
GHS05 GHS07 Dgr |
H315 H318 H317 H412 |
|
|
|
|
607-227-00-X |
potassium 2-amino-2-methylpropionate octahydrate |
405-560-3 |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
|
607-228-00-5 |
bis(2-methoxyethyl) phthalate |
204-212-6 |
Repr. 1B |
H360Df |
GHS08 Dgr |
H360Df |
|
|
|
|
|
607-229-00-0 |
diethylcarbamoyl chloride |
201-798-5 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H351 H332 H302 H319 H335 H315 |
GHS08 GHS07 Wng |
H351 H332 H302 H319 H335 H315 |
|
|
|
|
|
607-230-00-6 |
2-ethylhexanoic acid and its salts, with the exception of those specified elsewhere in this Annex |
- |
- |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
|
A, X, 12 |
|
607-231-00-1 |
clopyralid (ISO); 3,6-dichloropyridine-2-carboxylic acid |
216-935-4 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-232-00-7 |
pyridate (ISO); O-(6-chloro-3-phenylpyridazin-4-yl) S-octyl thiocarbonate |
259-686-7 |
Acute Tox. 4 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H317 H410 |
|
oral: ATE = 500 mg/kg bw M = 1 M = 10 |
|
|
|
607-233-00-2 |
hexyl acrylate |
219-698-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H335 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H411 |
|
|
|
|
|
607-234-00-8 |
flurenol (ISO); 9-hydroxy-9H-fluorene-9-carboxylic acid |
207-397-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-235-00-3 |
mecrilate; methyl 2-cyanoacrylate |
205-275-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-236-00-9 |
ethyl 2-cyanoacrylate |
230-391-5 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-237-00-4 |
benzyl 2-chloro-4-(trifluoromethyl)thiazole-5-carboxylate; flurazole |
276-942-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-238-00-X |
tau-fluvalinate (ISO); cyano-(3-phenoxyphenyl)methyl N-[2-chloro-4-(trifluoromethyl)phenyl]-D-valinate |
— |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H315 H400 H410 |
GHS07 GHS09 Wng |
H302 H315 H410 |
|
|
|
|
|
607-239-00-5 |
fenpropathrin (ISO); α-cyano-3-phenoxybenzyl 2,2,3,3-tetramethylcyclopropanecarboxylate |
254-485-0 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H312 H410 |
|
|
|
|
|
607-240-00-0 |
cis-1,2,3,6-tetrahydro-4-methylphthalic anhydride; [1] 1,2,3,6-tetrahydro-4-methylphthalic anhydride; [2] 1,2,3,6-tetrahydro-3-methylphthalic anhydride; [3] tetrahydromethylphthalicanhydride; [4] 1,2,3,6-tetrahydromethylphthalic anhydride; [5] tetrahydro-4-methylphthalicanhydride; [6] 2,3,5,6-tetrahydro-2-methylphthalic anhydride [7] |
216-906-6 [1] 222-323-8 [2] 226-247-6 [3] 234-290-7 [4] 247-830-1 [5] 251-823-9 [6] 255-853-3 [7] |
1694-82-2 [1] 3425-89-6 [2] 5333-84-6 [3] 11070-44-3 [4] 26590-20-5 [5] 34090-76-1 [6] 42498-58-8 [7] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-241-00-6 |
hexahydro-4-methylphthalic anhydride; [1] hexahydromethylphthalic anhydride; [2] hexahydro-1-methylphthalic anhydride; [3] hexahydro-3-methylphthalicanhydride [4] |
243-072-0 [1] 247-094-1 [2] 256-356-4 [3] 260-566-1 [4] |
19438-60-9 [1] 25550-51-0 [2] 48122-14-1 [3] 57110-29-9 [4] |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
H318 H334 H317 |
GHS08 GHS05 Dgr |
H318 H334 H317 |
|
|
C |
|
607-242-00-1 |
tetrachlorophthalic anhydride |
204-171-4 |
Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H317 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H318 H334 H317 H410 |
|
|
|
|
|
607-243-00-7 |
sodium 3,6-dichloro-o-anisate; [1] 3,6-dichloro-o-anisic acid, compound with 2,2'-iminodiethanol (1:1); [2] 3,6-dichloro-o-anisic acid, compound with 2-aminoethanol (1:1) [3] |
217-846-3 [1] 246-590-5 [2] 258-527-9 [3] |
1982-69-0 [1] 25059-78-3 [2] 53404-28-7 [3] |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-244-00-2 |
isooctyl acrylate |
249-707-8 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-245-00-8 |
tert-butyl acrylate |
216-768-7 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H225 H332 H312 H302 H335 H315 H317 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H312 H302 H335 H315 H317 H411 |
|
|
D |
|
|
607-246-00-3 |
allyl methacrylate; 2-methyl-2-propenoic acid 2-propenyl ester |
202-473-0 |
Flam. Liq. 3 Acute Tox. 2 Acute Tox. 3 Acute Tox. 4 Aquatic Acute 1 |
H226 H330 H311 H302 H400 |
GHS02 GHS06 GHS09 Dgr |
H226 H330 H311 H302 H400 |
|
inhalation: ATE = 1,5 mg/L (vapours) dermal: ATE = 300 mg/kg bw oral: ATE = 400 mg/kg bw |
|
|
|
607-247-00-9 |
dodecyl methacrylate |
205-570-6 |
STOT SE 3 |
H335 |
GHS07 Wng |
H335 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-248-00-4 |
naptalam-sodium (ISO); sodium N-naphth-1-ylphthalamate |
205-073-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-249-00-X |
(1-methyl-1,2-ethanediyl)bis[oxy(methyl-2,1-ethanediyl)] diacrylate |
256-032-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H319 H335 H315 H317 H411 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H411 |
|
STOT SE 3; H335: C ≥ 10 % |
|
|
|
607-250-00-5 |
4H-3,1-benzoxazine-2,4(1H)-dione |
204-255-0 |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
|
607-251-00-0 |
2-methoxypropyl acetate |
274-724-2 |
Flam. Liq. 3 Repr. 1B STOT SE 3 |
H226 H360D *** H335 |
GHS02 GHS08 GHS07 Dgr |
H226 H360D *** H335 |
|
|
|
|
|
607-252-00-6 |
lambda-cyhalothrin (ISO); reaction mass of (S)-α-cyano-3-phenoxybenzyl(Z)-(1R)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate and (R)-α-cyano-3-phenoxybenzyl (Z)-(1S)-cis-3-(2-chloro-3,3,3-trifluoropropenyl)-2,2-dimethylcyclopropanecarboxylate (1:1) |
415-130-7 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H312 H410 |
|
M=10000 |
|
|
|
607-253-00-1 |
cyfluthrin (ISO); α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
269-855-7 |
Lact. Acute Tox. 2 Acute Tox. 2 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H362 H330 H300 H370 (nervous system) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H362 H330 H300 H370 (nervous system) H410 |
|
inhalation: ATE = 0,14 mg/L (dusts or mists) oral: ATE = 14 mg/kg bw M = 1 000 000 M = 1 000 000 |
|
|
|
607-254-00-7 |
beta-cyfluthrin (ISO); reaction mass of rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate and rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
- |
Lact. Acute Tox. 2 Acute Tox. 2 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H362 H330 H300 H370 (nervous system) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H362 H330 H300 H370 (nervous system) H410 |
|
inhalation: ATE = 0,081 mg/L (dusts or mists) oral: ATE = 11 mg/kg bw M = 1 000 000 M = 1 000 000 |
|
|
|
607-255-00-2 |
fluroxypyr (ISO);4-amino-3,5-dichloro-6-fluoro-2-pyridyloxyacetic acid |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-256-00-8 |
azoxystrobin (ISO); methyl (E)-2-{2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl}-3-methoxyacrylate |
— |
Acute Tox. 3 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H400 H410 |
GHS06 GHS09 Dgr |
H331 H410 |
|
inhalation: ATE = 0,7 mg/L (dusts or mists) M = 10 M = 10 |
|
|
|
607-257-00-3 |
isopropyl propionate |
211-300-8 |
Flam. Liq. 2 |
H225 |
GHS02 Dgr |
H225 |
|
|
|
|
|
607-258-00-9 |
dodecyl 3-(2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-1-yl)-3-(4-methoxybenzoyl)acetamido)-4-chlorobenzoate |
403-990-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-259-00-4 |
methyl 2R,3S-(-)-3-(4-methoxyphenyl)oxiranecarboxylate |
404-130-2 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
607-260-00-X |
ethyl 2-(3-nitrobenzylidene)acetoacetate |
404-490-0 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
607-261-00-5 |
iso(C10-C14)alkyl (3,5-di-tert-butyl-4-hydroxyphenyl)methylthioacetate |
404-800-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-262-00-0 |
7-chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid |
405-050-0 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
|
607-263-00-6 |
potassium iron(III) 1,3-propanediamine-N, N,N',N'-tetraacetate hemihydrate |
405-680-6 |
— |
Self-heat. 2 **** Aquatic Chronic 2 |
H252 H411 |
GHS02 GHS09 Wng |
H252 H411 |
|
|
|
|
607-264-00-1 |
2-chloro-4-(methylsulfonyl)benzoic acid |
406-520-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-265-00-7 |
ethyl-2-chloro-2,2-diphenylacetate |
406-580-5 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
607-266-00-2 |
reaction mass of: hydroxyaluminium bis[2-hydroxy-3,5-di-tert-butylbenzoate]; 3,5-di-tert-butyl-salicylic acid |
406-890-0 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-267-00-8 |
tert-butyl (5S,6R,7R)-3-bromomethyl-5,8-dioxo-7-(2-(2-phenylacetamido)-5-thia-1-azabicyclo[4.2.0] oct-2-ene-2-carboxylate |
407-620-4 |
Resp. Sens. 1 Skin Sens. 1 Aquatic Chronic 3 |
H334 H317 H412 |
GHS08 Dgr |
H334 H317 H412 |
|
|
|
|
|
607-268-00-3 |
2-methylpropyl (R)-2-hydroxypropanoate |
407-770-0 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
|
607-269-00-9 |
(R)-2-(4-hydroxyphenoxy)propanoic acid |
407-960-3 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-270-00-4 |
3,9-bis(2-(3-(3-tert-butyl-4-hydroxy-5-methylphenyl)propionyloxy-1,1-dimethylethyl)-2,4,8,10-tetraoxaspiro[5.5]undecane |
410-730-5 |
Acute Tox. 4 * |
H312 |
GHS07 Wng |
H312 |
|
|
|
|
|
607-271-00-X |
2-isopropyl-5-methylcyclohexyloxycarbonyloxy-2-hydroxypropane |
417-420-9 |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
|
607-272-00-5 |
fluroxypyr-meptyl (ISO); methylheptyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate; [1] fluroxypyr-butometyl (ISO); 2-butoxy-1-methylethyl, O-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy) acetate [2] |
279-752-9 [1] -[2] |
81406-37-3 [1] 154486-27-8 [2] |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-273-00-0 |
ammonium 7-(2,6-dimethyl-8-(2,2-dimethylbutyryloxy)-1,2,6,7,8,8a-hexahydro-1-naphthyl)-3,5-dihydroxyheptanoate |
404-520-2 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-274-00-6 |
2-(N-benzyl-N-methylamino)ethyl 3-amino-2-butenoate |
405-350-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-275-00-1 |
sodium benzoyloxybenzene-4-sulfonate |
405-450-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-276-00-7 |
bis[(1-methylimidazol)-(2-ethyl-hexanoate)], zinc complex |
405-635-0 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
607-277-00-2 |
reaction mass of: 2-(hexylthio)ethylamine hydrochloride; sodium propionate |
405-720-2 |
— |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
607-278-00-8 |
reaction mass of isomers of: sodium phenethylnaphthalenesulfonate; sodium naphthylethylbenzenesulfonate |
405-760-0 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
607-279-00-3 |
reaction mass of n-octadecylaminodiethyl bis(hydrogen maleate); n-octadecylaminodiethyl hydrogen maleate hydrogenphthalate |
405-960-8 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-280-00-9 |
sodium 4-chloro-1-hydroxybutane-1-sulfonate |
406-190-5 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
|
|
|
607-281-00-4 |
reaction mass of branched and linear C7-C9 alkyl 3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]propionates |
407-000-3 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-282-00-X |
2-acetoxymethyl-4-benzyloxybut-1-yl acetate |
407-140-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-283-00-5 |
E-ethyl-4-oxo-4-phenylcrotonate |
408-040-4 |
Acute Tox. 4 * Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H315 H318 H317 H410 |
|
|
|
|
|
607-284-00-0 |
reaction mass of: sodium 3,3'-(1,4-phenylenebis(carbonylimino-3,1-propanediylimino))bis(10-amino-6,13-dichloro-4,11-triphenodioxazinedisulfonate); lithium 3,3'-(1,4-phenylenebis-(carbonylimino-3,1-propanediyl-imino))bis(10-amino-6,13-dichloro)-4,11-triphenodioxazinedisulfonate (9:1) |
410-040-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-285-00-6 |
reaction mass of: 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonic acid; sodium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate; potassium 7-(((3-aminophenyl)sulfonyl)amino)-naphthalene-1,3-disulfonate |
410-065-0 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
|
|
|
|
|
607-286-00-1 |
reaction mass of: sodium/potassium 7-[[[3-[[4-((2-hydroxy-naphthyl)azo)phenyl]azo]phenyl]sulfonyl]amino]-naphthalene-1,3-disulfonate |
410-070-8 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
607-287-00-7 |
O'-methyl O-(1-methyl-2-methacryloyloxy-ethyl)-1,2,3,6-tetrahydrophthalate |
410-140-8 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-288-00-2 |
tetrasodium (c-(3-(1-(3-(e-6-dichloro-5-cyanopyrimidin-f-yl(methyl)amino)propyl)-1,6-dihydro-2-hydroxy-4-methyl-6-oxo-3-pyridylazo)-4-sulfonatophenylsulfamoyl)phthalocyanine-a, b,d-trisulfonato(6-))nickelato II, where a is 1 or 2 or 3 or 4,b is 8 or 9 or 10 or 11,c is 15 or 16 or 17 or 18, d is 22 or 23 or 24 or 25 and where e and f together are 2 and 4 or 4 and 2 respectively |
410-160-7 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
|
607-289-00-8 |
3-(3-(4-(2,4-bis(1,1-dimethylpropyl)phenoxy)butylaminocarbonyl-4-hydroxy-1-naphthalenyl)thio)propanoic acid |
410-370-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-290-00-3 |
reaction mass (ratio not known) of: ammonium 1-C14-C18-alkyloxycarbonyl-2-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate; ammonium 2-C14-C18-alkyloxycarbonyl-1-(3-allyloxy-2-hydroxypropoxycarbonyl)ethane-1-sulfonate |
410-540-2 |
— |
Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H315 H317 H410 |
|
|
|
|
607-291-00-9 |
dodecyl-ω-(C5/C6-cycloalkyl)alkyl carboxylate |
410-630-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-292-00-4 |
reaction mass of: [1-(methoxymethyl)-2-(C12-alkoxy)-ethoxy]acetic acid; [1-(methoxymethyl)-2-(C14-alkoxy)-ethoxy]acetic acid |
410-640-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
607-293-00-X |
reaction mass of: N-aminoethylpiperazonium mono-2,4,6-trimethylnonyldiphenyl ether di-sulfonate; N-aminoethylpiperazonium di-2,4,6-trimethylnonyldiphenyl ether di-sulfonate |
410-650-0 |
— |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H411 |
|
|
|
|
607-294-00-5 |
sodium 2-benzoyloxy-1-hydroxyethane-sulfonate |
410-680-4 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-295-00-0 |
reaction mass of: tetrasodium phosphonoethane-1,2-dicarboxylate; hexasodium phosphonobutane-1,2,3,4-tetracarboxylate |
410-800-5 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-296-00-6 |
reaction mass of: pentaerythriol tetraesters with heptanoic acid and 2-ethylhexanoic acid |
410-830-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-297-00-1 |
(E-E)-3,3'-(1,4-phenylenedimethylidene)bis(2-oxobornane-10-sulfonic acid) |
410-960-6 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-298-00-7 |
2-(trimethylammonium)ethoxycarboxybenzene-4-sulfonate |
411-010-3 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-299-00-2 |
methyl 3-(acetylthio)-2-methyl-propanoate |
411-040-7 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
|
607-300-00-6 |
trisodium [2-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-5-(b-sulfamoyl-c, d-sulfonatophthalocyanin-a-yl-K4, N29, N30, N31, N32-sulfonylamino)benzoato(5-)]cuprate(II) where a =1,2,3,4 b = 8,9,10,11 c = 15,16,17,18 d = 22,23,24,25 |
411-430-7 |
— |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
607-301-00-1 |
reaction mass of: dodecanoic acid; poly(1-7)lactate esters of dodecanoic acid |
411-860-5 |
— |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
607-302-00-7 |
reaction mass of: tetradecanoic acid; poly(1-7)lactate esters of tetradecanoic acid |
411-910-6 |
— |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
607-303-00-2 |
1-cyclopropyl-6,7-difluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid |
413-760-7 |
Repr. 2 Aquatic Chronic 3 |
H361f *** H412 |
GHS08 Wng |
H361f *** H412 |
|
|
|
|
|
607-304-00-8 |
fluazifop-butyl (ISO); butyl (RS)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate |
274-125-6 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360D *** H400 H410 |
GHS08 GHS09 Dgr |
H360D *** H410 |
|
|
|
|
|
607-305-00-3 |
fluazifop-P-butyl (ISO); butyl (R)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate |
— |
Repr. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d *** H400 H410 |
GHS08 GHS09 Wng |
H361d *** H410 |
|
|
|
|
|
607-306-00-9 |
chlozolinate (ISO); ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-oxazolidine-5-carboxylate |
282-714-4 |
Carc. 2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
|
|
|
|
|
607-307-00-4 |
vinclozolin (ISO); N-3,5-dichlorophenyl-5-methyl-5-vinyl-1,3-oxazolidine-2,4-dione |
256-599-6 |
Carc. 2 Repr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H351 H360FD H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360FD H317 H411 |
|
|
|
|
|
607-308-00-X |
esters of 2,4-D |
— |
— |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
A |
|
607-309-00-5 |
carfentrazone-ethyl (ISO); ethyl (RS)-2-chloro-3-[2-chloro-4-fluoro-5-[4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]propionate |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-310-00-0 |
kresoxim-methyl (ISO); methyl (E)-2-methoxyimino-[2-(o-tolyloxymethyl)phenyl]acetate |
— |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
|
607-311-00-6 |
benazolin-ethyl; ethyl 4-chloro-2-oxo-2H-benzothiazole-3-acetate |
246-591-0 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-312-00-1 |
methoxyacetic acid |
210-894-6 |
Repr. 1B Acute Tox. 4 * Skin Corr. 1B |
H360FD H302 H314 |
GHS08 GHS05 GHS07 Dgr |
H360FD H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
607-313-00-7 |
neodecanoyl chloride |
254-875-0 |
Acute Tox. 2 * Acute Tox. 4 * Skin Corr. 1B |
H330 H302 H314 |
GHS06 GHS06 Dgr |
H330 H302 H314 |
|
STOT SE 3; H335: C ≥ 5 % |
|
|
|
607-314-00-2 |
ethofumesate (ISO); (RS)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate |
247-525-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 1 M = 1 |
|
|
|
607-315-00-8 |
glyphosate (ISO); N-(phosphonomethyl)glycine |
213-997-4 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
|
607-316-00-3 |
glyphosate-trimesium; glyphosate-trimethylsulfonium |
— |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-317-00-9 |
bis(2-ethylhexyl) phthalate; di-(2-ethylhexyl) phthalate; DEHP |
204-211-0 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
607-318-00-4 |
dibutyl phthalate; DBP |
201-557-4 |
Repr. 1B Aquatic Acute 1 |
H360Df H400 |
GHS08 GHS09 Dgr |
H360Df H400 |
|
|
|
|
|
607-319-00-X |
deltamethrin (ISO); (S)-α-cyano-3-phenoxybenzyl(1R, 3R)-3-(2,2-dibromovinyl)-2,2-dimethylcyclopropanecarboxylate |
258-256-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
M=1000000 |
|
|
|
607-320-00-5 |
bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate |
413-930-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
607-321-00-0 |
(S)-methyl-2-chloropropionate |
412-470-8 |
Flam. Liq. 3 STOT RE 2 * Eye Irrit. 2 |
H226 H373 ** H319 |
GHS02 GHS08 Wng |
H226 H373 ** H319 |
|
|
|
|
|
607-322-00-6 |
4-(4,4-dimethyl-3-oxo-pyrazolidin-1-yl)-benzoic acid |
413-120-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-323-00-1 |
2-(1-(2-hydroxy-3,5-di-tert-pentyl-phenyl)ethyl)-4,6-di-tert-pentylphenyl acrylate |
413-850-6 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-324-00-7 |
reaction mass of: N, N-di(hydrogenated alkyl C14-C18)phtalamic acid; dihydrogenated alkyl (C14-C18)amine |
413-800-3 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-325-00-2 |
(S)-2-chloropropionic acid |
411-150-5 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
|
607-326-00-8 |
reaction mass of: isobutyl hydrogen 2-(α-2,4,6-trimethylnon-2-enyl)succinate; isobutyl hydrogen 2-(ß-2,4,6-trimetyhylnon-2-enyl)succinate |
410-720-0 |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
|
607-327-00-3 |
2-(2-iodoethyl)-1,3-propanediol diacetate |
411-780-0 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-328-00-9 |
methyl 4-bromomethyl-3-methoxybenzoate |
410-310-1 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
607-329-00-4 |
reaction mass of: sodium 2-(C12-18-n-alkyl)amino-1,4-butandioate; sodium 2-octadecenyl-amino-1,4-butandioate |
411-250-9 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-330-00-X |
(S)-2,3-dihydro-1H-indole-2-carboxylic acid |
410-860-2 |
Repr. 2 STOT RE 2 * Skin Sens. 1 |
H361f *** H373 ** H317 |
GHS08 GHS07 Wng |
H361f *** H373 ** H317 |
|
|
|
|
|
607-331-00-5 |
reaction mass of: bis(2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-1,10-decanedioate; 1,8-bis[(2,2,6,6-tetramethyl-4-((2,2,6,6-tetramethyl-1-octyloxypiperidin-4-yl)-decan-1,10-dioyl)piperidin-1-yl)oxy]octane |
406-750-9 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-332-00-0 |
cyclopentyl chloroformate |
411-460-0 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H226 H331 H302 H373 ** H318 H317 |
GHS02 GHS06 GHS08 GHS05 Dgr |
H226 H331 H302 H373 ** H318 H317 |
|
|
|
|
|
607-333-00-6 |
reaction mass of: dodecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate; tetradecyl N-(2,2,6,6-tetramethylpiperidin-4-yl)-β-alaninate |
405-670-1 |
— |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H410 |
|
|
|
|
607-334-00-1 |
ethyl 1-ethyl-6,7,8-trifluoro-1,4-dihydro-4-oxoquinoline-3-carboxylate |
405-880-3 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
607-335-00-7 |
methyl (R)-2-(4-(3-chloro-5-trifluoromethyl-2-pyridyloxy)phenoxy)propionate |
406-250-0 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
|
607-336-00-2 |
4-methyl-8-methylenetricyclo[3.3.1.13,7]dec-2-yl acetate |
406-560-6 |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H315 H317 H411 |
GHS07 GHS09 Wng |
H315 H317 H411 |
|
|
|
|
|
607-337-00-8 |
di-tert-(C12-14)-alkylammonium 2-benzothiazolylthiosuccinate |
406-052-4 |
Flam. Liq. 3 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H226 H302 H315 H318 H411 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H226 H302 H315 H318 H411 |
|
|
|
|
|
607-338-00-3 |
2-methylpropyl 2-hydroxy-2-methylbut-3-enoate |
406-235-9 |
Eye Irrit. 2 Skin Irrit. 2 |
H319 H315 |
GHS07 Wng |
H319 H315 |
|
|
|
|
|
607-339-00-9 |
2,3,4,5-tetrachlorobenzoylchloride |
406-760-3 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
|
607-340-00-4 |
1,3-bis(4-benzoyl-3-hydroxyphenoxy)prop-2-yl acetate |
406-990-4 |
— |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
607-341-00-X |
(9S)-9-amino-9-deoxyerythromycin |
406-790-7 |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
|
607-342-00-5 |
4-chlorobutyl veratrate |
410-950-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-343-00-0 |
4,7-methanooctahydro-1H-indene-diyldimethyl bis(2-carboxybenzoate) |
407-410-2 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-344-00-6 |
reaction mass of: 3-(N-(3-dimethylaminopropyl)-(C4-8)perfluoroalkylsulfonamido)propionic acid; N-[dimethyl-3-(C4-8-perfluoroalkylsulfonamido)propylammonium propionate; 3-(N-(3-dimethyl-propylammonium)-(C4-8)perfluoroalkylsulfonamido)propionic acid propionate |
407-810-7 |
— |
STOT RE 2 * |
H373 ** |
GHS08 Wng |
H373 ** |
|
|
|
|
607-345-00-1 |
potassium 2-(2,4-dichlorophenoxy)-(R)-propionate |
413-580-9 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
|
607-346-00-7 |
3-icosyl-4-henicosylidene-2-oxetanone |
401-210-9 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-347-00-2 |
sodium (R)-2-(2,4-dichlorophenoxy)propionate |
413-340-3 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
|
607-348-00-8 |
magnesium bis((R)-2-(2,4-dichlorophenoxy)propionate) |
413-360-2 |
— |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
607-349-00-3 |
mono-(tetrapropylammonium)hydrogen 2,2'-dithiobisbenzoate |
411-270-8 |
— |
Aquatic Chronic 3 |
H412 |
|
H412 |
|
|
|
|
607-350-00-9 |
bis(4-(1,2-bis(ethoxycarbonyl)ethylamino)-3-methylcyclohexyl)methane |
412-060-9 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
|
607-351-00-4 |
methyl O-(4-amino-3,5-dichloro-6-fluoropyridin-2-yloxy)acetate |
407-550-4 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-352-00-X |
4,4'-oxydiphthalic anhydride |
412-830-4 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-353-00-5 |
reaction mass of: ethyl exo-tricyclo[5.2.1.02,6]decane-endo-2-carboxylate; ethyl endo-tricyclo[5.2.1.02,6]decane-exo-2-carboxylate |
407-520-0 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
|
607-354-00-0 |
ethyl 2-cyclohexylpropionate |
412-280-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-355-00-6 |
p-tolyl 4-chlorobenzoate |
411-530-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
|
607-356-00-1 |
ethyl trans-2,2,6-trimethylcyclohexanecarboxylate |
412-540-8 |
— |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
607-357-00-7 |
reaction mass of: trans-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran; cis-4-acetoxy-4-methyl-2-propyl-tetrahydro-2H-pyran |
412-450-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-358-00-2 |
(1S,3S,5R,6R)-(4-nitrophenylmethyl)-1-dioxo-6-phenylacetamido-penam-3-carboxylate |
412-670-5 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
|
607-359-00-8 |
(1S,4R,6R,7R)-(4-nitrophenylmethyl)3-methylene-1-oxo-7-phenylacetamido-cepham-4-carboxylateido-penam-3-carboxylate |
412-800-0 |
Resp. Sens. 1 |
H334 |
GHS08 Dgr |
H334 |
|
|
|
|
|
607-360-00-3 |
sodium 3-acetoacetylamino-4-methoxytolyl-6-sulfonate |
411-680-7 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-361-00-9 |
methyl (R)-2-(4-hydroxyphenoxy)propionate |
411-950-4 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
|
607-362-00-4 |
reaction mass of: (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)hexadec-4-enoate; (3-methoxy)propylammonium/ [tris-(2-hydroxyethyl)]ammonium 2-(2-(bis(2-hydroxyethyl)amino)ethoxycarbonylmethyl)tetradec-4-enoate; (3-methoxy)propylammonium/[tris-(2-hydroxyethyl)]ammonium 2-(3-methoxypropylcarbamoylmethyl)hexadec-4-enoate; (3-methoxy)propylammonium/ [tris-(2-hydroxyethyl)]ammonium 2-(3-methoxypropylcarbamoylmethyl)tetradec-4-enoate |
413-500-2 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 2 |
H315 H318 H411 |
GHS05 GHS09 Dgr |
H315 H318 H411 |
|
|
|
|
607-363-00-X |
methyl-3-methoxyacrylate |
412-900-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-364-00-5 |
3-phenyl-7-[4-(tetrahydrofurfuryloxy)phenyl]-1,5-dioxa-s-indacen-2,6-dione |
413-330-9 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
|
607-365-00-0 |
2-(2-amino-1,3-thiazol-4-yl)-(Z)-2-methoxyiminoacetyl chloride hydrochloride |
410-620-7 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 |
H302 H314 H317 |
GHS05 GHS07 Dgr |
H302 H314 H317 |
|
|
|
|
|
607-366-00-6 |
3,5-dimethylbenzoyl chloride |
413-010-9 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
|
607-367-00-1 |
potassium bis(N-carboxymethyl)-N-methyl-glycinato-(2-)N, O,O, N)-ferrate-(1-)monohydrate |
411-640-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-368-00-7 |
1-(N,N-dimethylcarbamoyl)-3-tert-butyl-5-carbethoxymethylthio-1H-1,2,4-triazole |
411-650-3 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H410 |
|
|
|
|
|
607-369-00-2 |
reaction mass of: trans-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid; cis-(2R)-5-acetoxy-1,3-oxathiolane-2-carboxylic acid |
411-660-8 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H302 H315 H318 H317 |
GHS05 GHS07 Dgr |
H302 H315 H318 H317 |
|
|
|
|
|
607-370-00-8 |
2-[[2-(acetyloxy)-3-(1,1-dimethyl-ethyl)-5-methylphenyl]methyl]-6-(1,1-dimethylethyl)-4-methylphenol |
412-210-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-371-00-3 |
3-ethyl 5-methyl 4-(2-chlorophenyl)-1,4-dihydro-2-[2-(1,3-dihydro-1,3-dioxo-(2)isoindol-2-yl)-ethoxymethyl]-6-methyl-3,5-pyridinedicarboxylate |
413-410-3 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-372-00-9 |
ethoxylated bisphenol A di-(norbornene carboxylate) |
412-410-0 |
— |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-373-00-4 |
quizalofop-P-tefuryl (ISO); (+/–) tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenyloxy]propionate |
414-200-4 |
Carc. 2 Repr. 2 Acute Tox. 4 STOT RE 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361fd H302 H373 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361fd H302 H373 H410 |
|
M = 1 M = 1 |
|
|
|
607-374-00-X |
5-amino-2,4,6-triiodo-1,3-benzenedicarbonyldichloride |
417-220-1 |
Skin Sens. 1 Aquatic Chronic 2 |
H317 H411 |
GHS07 GHS09 Wng |
H317 H411 |
|
|
|
|
|
607-375-00-5 |
flocoumafen (ISO); reaction mass of: cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin and trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin |
421-960-0 |
Repr. 1B Acute Tox. 1 Acute Tox. 1 Acute Tox. 1 STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360D H330 H310 H300 H372 (blood) H400 H410 |
GHS08 GHS06 GHS09 Dgr |
H360D H330 H310 H300 H372 (blood) H410 |
|
Repr. 1B; H360D: C ≥ 0,003 % STOT RE 1; H372 (blood): C ≥ 0,05 % STOT RE 2; H373 (blood): 0,005 % ≤ C < 0,05 % M = 10 M = 10 |
|
|
|
607-376-00-0 |
benzyl 2,4-dibromobutanoate |
420-710-8 |
Repr. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f *** H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f *** H315 H317 H410 |
|
|
|
|
|
607-377-00-6 |
trans-4-cyclohexyl-L-proline monohydrochloride |
419-160-1 |
Repr. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H361f *** H302 H315 H318 H317 |
GHS08 GHS05 GHS07 Dgr |
H361f *** H302 H315 H318 H317 |
|
|
|
|
|
607-378-00-1 |
ammonium (Z)-α-methoxyimino-2-furylacetate |
405-990-1 |
Flam. Sol. 2 |
H228 |
GHS02 Dgr |
H228 |
|
|
T |
|
|
607-379-00-7 |
reaction mass of: 2-[N-(2-hydroxyethyl)stearamido]ethyl stearate; sodium [bis[2-(stearoyloxy)ethyl]amino]methylsulfonate; sodium [bis(2-hydroxyethyl)amino]methylsulfonate; N, N-bis(2-hydroxyethyl)stearamide |
401-230-8 |
|
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
607-380-00-2 |
reaction mass of: ammonium-1,2-bis(hexyloxycarbonyl)ethanesulfonate; ammonium-1-hexyloxycarbonyl-2-octyloxycarbonylethanesulfonate; ammonium-2-hexyloxycarbonyl-1-octyloxycarbonylethanesulfonate |
407-320-3 |
— |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
607-381-00-8 |
reaction mass of triesters of 2,2-bis(hydroxymethyl)butanol with C7-alkanoic acids and 2-ethylhexanoic acid |
413-710-4 |
— |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
607-382-00-3 |
2-((4-amino-2-nitrophenyl)amino)benzoic acid |
411-260-3 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
|
607-383-00-9 |
reaction mass of: 2,2,6,6-tetramethylpiperidin-4-yl-hexadecanoate; 2,2,6,6-tetramethylpiperidin-4-yl-octadecanoate |
415-430-8 |
Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H318 H317 H410 |
|
|
|
|
|
607-384-00-4 |
reaction mass of: esters of C14-C15 branched alcohols with 3,5-di-t-butyl-4-hydroxyphenyl propionic acid; C15 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate; C13 branched and linear alkyl 3,5-bis(1,1-dimethylethyl)-4-hydroxybenzenepropanoate |
413-750-2 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-385-00-X |
copolymer of vinyl-alcohol and vinyl acetate partially acetilized with 4-(2-(4-formylphenyl)ethenyl)-1-methylpyridinium methylsulfate |
414-590-6 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-386-00-5 |
reaction mass of: tetradecanoic acid (42,5-47,5 %); poly(1-7)lactate esters of tetradecanoic acid (52,5-57,5 %) |
412-580-6 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
607-387-00-0 |
reaction mass of: dodecanoic acid (35-40 %); poly(1-7)lactate esters of dodecanoic acid (60-65 %) |
412-590-0 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
607-388-00-6 |
4-ethylamino-3-nitrobenzoic acid |
412-090-2 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 3 |
H302 H317 H412 |
GHS07 Wng |
H302 H317 H412 |
|
|
|
|
|
607-389-00-1 |
trisodium N, N-bis(carboxymethyl)-3-amino-2-hydroxypropionate |
414-130-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
|
607-390-00-7 |
1,2,3,4-tetrahydro-6-nitro-quinoxaline |
414-270-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
|
607-391-00-2 |
dimethylcyclopropane-1,1-dicarboxylate |
414-240-2 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-392-00-8 |
2-phenoxyethyl 4-((5-cyano-1,6-dihydro-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)azo)benzoate |
414-260-1 |
Aquatic Chronic 4 |
H413 |
— |
H413 |
|
|
|
|
|
607-393-00-3 |
3-(cis-1-propenyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
415-750-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-394-00-9 |
5-methylpyrazine-2-carboxylic acid |
413-260-9 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
|
607-395-00-4 |
reaction mass of: sodium 1-tridecyl-4-allyl-(2 or 3)-sulfobutanedioate; sodium 1-dodecyl-4-allyl-(2 or 3)-sulfobutanedioate |
410-230-7 |
— |
Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 2 |
H314 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H314 H317 H411 |
|
|
|
|
607-396-00-X |
bis(1,2,2,6,6-pentamethyl-4-piperidinyl) 2-(4-methoxybenzylidene)malonate |
414-840-4 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-397-00-5 |
reaction mass of: Ca salicylates (branched C10-14 and C18-30 alkylated); Ca phenates (branched C10-14 and C18-30 alkylated); Ca sulfurised phenates(branched C10-14 and C18-30 alkylated) |
415-930-6 |
— |
Repr. 2 Skin Sens. 1 |
H361f*** H317 |
GHS08 GHS07 Wng |
H361f*** H317 |
|
|
|
|
607-398-00-0 |
ethyl N-(5-chloro-3-(4-(diethylamino)-2-methylphenylimino)-4-methyl-6-oxo-1,4-cyclohexadienyl)carbamate |
414-820-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-399-00-6 |
2,2-dimethyl 3-methyl-3-butenyl propanoate |
415-610-6 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
|
607-400-00-X |
methyl 3-[[(dibutylamino)thioxomethyl]thio]propanoate |
414-400-1 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
|
607-401-00-5 |
ethyl 3-hydroxy-5-oxo-3-cyclohexene-1-carboxylate |
414-450-4 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
|
607-402-00-0 |
methyl N-(phenoxycarbonyl)-L-valinate |
414-500-5 |
Aquatic Chronic 3 |
H412 |
— |
H412 |
|
|
|
|
|
607-403-00-6 |
reaction mass of: bis(1S,2S,4S)-(1-benzyl-4-tert-butoxycarboxamido-2-hydroxy-5-phenyl)pentylammonium succinate; isopropyl alcohol |
414-810-0 |
— |
STOT RE 2 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H318 H410 |
|
|
|
|
607-404-00-1 |
reaction mass of: ((Z)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid; di-((E)-3,7-dimethyl-2,6-octadienyl) butandioate; di-((Z)-3,7-dimethyl-2,6-octadienyl) butandioate; (Z)-3,7-dimethyl-2,6-octadienyl butandioate; ((E)-3,7-dimethyl-2,6-octadienyl)oxycarbonylpropanoic acid |
415-190-4 |
— |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
607-405-00-7 |
2-hexyldecyl-p-hydroxybenzoate |
415-380-7 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
|
607-406-00-2 |
potassium 2,5-dichlorobenzoate |
415-700-5 |
Acute Tox. 4 * Eye Dam. 1 |
H302 H318 |
GHS05 GHS07 Dgr |
H302 H318 |
|
|
|
|
|
607-407-00-8 |
ethyl 2-carboxy-3-(2-thienyl)propionate |
415-680-8 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H315 H318 H317 |
GHS05 GHS07 Dgr |
H315 H318 H317 |
|
|
|
|
|
607-408-00-3 |
potassium N-(4-fluorophenyl)glycinate |
415-710-1 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H373 ** H318 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H373 ** H318 H317 H412 |
|
|
|
|
|
607-409-00-9 |
reaction mass of: (3R)-[1S-(1α,2α, 6β-((2S)-2-methyl-1-oxo-butoxy)-8aγ)hexahydro-2,6-dimethyl-1-naphthalene]-3,5-dihydroxyheptanoic acid; inert biomass from Aspergillus terreus |
415-840-7 |
— |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
607-410-00-4 |
mono[2-(dimethylamino)ethyl]monohydrogen-2-(hexadec-2-enyl)butanedioate and/or mono[2-(dimethylamino)ethyl]monohydrogen-3-(hexadec-2-enyl)butanedioate |
415-880-5 |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H410 |
|
|
|
|
|
607-411-00-X |
oxiranemethanol, 4-methylbenzene-sulfonate, (S)- |
417-210-7 |
Carc. 1B Muta. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H350 H341 H318 H317 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H350 H341 H318 H317 H411 |
|
|
|
|
|
607-412-00-5 |
ethyl 2-(1-cyanocyclohexyl)acetate |
415-970-4 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373 ** H412 |
GHS08 GHS07 Wng |
H302 H373 ** H412 |
|
|
|
|
|
607-413-00-0 |
trans-4-phenyl-L-proline |
416-020-1 |
Repr. 2 Skin Sens. 1 |
H361f *** H317 |
GHS08 GHS07 Wng |
H361f *** H317 |
|
|
|
|
|
▼M18 ————— |
||||||||||
|
607-415-00-1 |
poly-(methyl methacrylate)-co-(butylmethacrylate)-co-(4-acryloxybutyl-isopropenyl-α, α-dimethylbenzyl carbamate)-co-(maleicanhydride) |
419-590-1 |
— |
Flam. Sol. 1 Skin Sens. 1 |
H228 H317 |
GHS02 GHS07 Dgr |
H228 H317 |
|
|
T |
|
607-416-00-7 |
4-(2-carboxymethylthio)ethoxy-1-hydroxy-5-isobutyloxycarbonylamino-N-(3-dodecyloxypropyl)-2-naphthamide |
420-730-7 |
— |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
607-417-00-2 |
3-chloropropyl chloroformiate |
425-770-9 |
Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 |
H331 H302 H373** H315 H318 H317 |
GHS06 GHS05 GHS08 Dgr |
H331 H302 H373** H315 H318 H317 |
|
|
< | |