Appendix 6 / Entry 30 – Reproductive toxicants: Category 1 B
Appendix 6
Entry 30 – Reproductive toxicants: Category 1 B
|
Substances |
Index No |
EC No |
CAS No |
Notes |
|
Dibutyltin hydrogen borate |
005-006-00-7 |
401-040-5 |
|
|
|
Boric acid; [1] |
005-007-00-2 |
233-139-2 [1] |
10043-35-3 [1] |
|
|
Boric acid, crude natural, containing not more than 85 % of H3BO3 calculated on the dry weight; [2] |
234-343-4 [2] |
11113-50-1 [2] |
||
|
Diboron trioxide; Boric oxide |
005-008-00-8 |
215-125-8 |
|
|
|
Disodium tetraborate, anhydrous; |
005-011-00-4 |
|
|
|
|
Boric acid, disodium salt; [1] |
215-540-4 [1] |
1330-43-4 [1] |
||
|
Tetraboron disodium heptaoxide, hydrate; [2] |
235-541-3 [2] |
12267-73-1 [2] |
||
|
Orthoboric acid, sodium salt; [3] |
237-560-2 [3] |
13840-56-7 [3] |
||
|
Disodium tetraborate decahydrate; Borax decahydrate |
005-011-01-1 |
215-540-4 |
|
|
|
Disodium tetraborate pentahydrate; Borax pentahydrate |
005-011-02-9 |
215-540-4 |
|
|
|
Sodium perborate; [1] |
005-017-00-7 |
239-172-9 [1] |
15120-21-5 [1] |
|
|
Sodium peroxometaborate; [2] |
231-556-4 [2] |
7632-04-4 [2] |
||
|
Sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
|
|
||
|
Sodium perborate; [1] |
005-017-01-4 |
239-172-9 [1] |
15120-21-5 [1] |
|
|
Sodium peroxometaborate; [2] |
231-556-4 [2] |
7632-04-4 [2] |
||
|
Sodium peroxoborate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
|
|
||
|
Perboric acid (H3BO2(O2)), monosodium salt trihydrate; [1] |
005-018-00-2 |
239-172-9 [1] |
13517-20-9 [1] |
|
|
Perboric acid, sodium salt, tetrahydrate; [2] |
234-390-0 [2] |
37244-98-7 [2] |
||
|
Perboric acid (HBO(O2)), sodium salt, tetrahydrate; [3] |
231-556-4 [3] |
10486-00-7 [3] |
||
|
Sodium peroxoborate hexahydrate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
|
|
||
|
Perboric acid (H3BO2(O2)), monosodium salt, trihydrate; [1] |
005-018-01-X |
239-172-9 [1] |
13517-20-9 [1] |
|
|
Perboric acid, sodium salt, tetrahydrate; [2] |
234-390-0 [2] |
37244-98-7 [2] |
||
|
Perboric acid (HBO(O2)), sodium salt, tetrahydrate; [3] |
231-556-4 [3] |
10486-00-7 [3] |
||
|
Sodium peroxoborate hexahydrate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
|
|
||
|
Perboric acid, sodium salt; [1] |
005-019-00-8 |
234-390-0 [1] |
11138-47-9 [1] |
|
|
Perboric acid, sodium salt, monohydrate; [2] |
234-390-0 [2] |
12040-72-1 [2] |
||
|
Perboric acid (H3BO2(O2)), monosodium salt, monohydrate; [3] |
231-556-4 [3] |
10332-33-9 [3] |
||
|
Sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
|
|
||
|
Perboric acid, sodium salt; [1] |
005-019-01-5 |
234-390-0 [1] |
11138-47-9 [1] |
|
|
Perboric acid, sodium salt, monohydrate; [2] |
234-390-0 [2] |
12040-72-1 [2] |
||
|
Perboric acid (H3BO2(O2)), monosodium salt, monohydrate; [3] |
231-556-4 [3] |
10332-33-9 [3] |
||
|
Sodium peroxoborate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
|
|
||
|
Disodium octaborate anhydrous; [1] Disodium octaborate tetrahydrate [2] |
005-020-00-3 |
234-541-0 [1] 234-541-0 [2] |
12008-41-2 [1] 12280-03-4 [2] |
|
|
Linuron (ISO) 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
006-021-00-1 |
206-356-5 |
►M5 — ◄ |
|
|
Mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt |
006-076-00-1 |
- |
|
|
|
6-(2-Chloroethyl)-6(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane; etacelasil |
014-014-00-X |
253-704-7 |
|
|
|
Flusilazole (ISO); bis(4-fluorophenyl)-(methyl)-(1H-1,2,4-triazol-1-ylmethyl)-silane |
014-017-00-6 |
— |
►M5 — ◄ |
|
|
A mixture of: 4-[[bis-(4-fluorophenyl)-methylsilyl]methyl]-4H-1,2,4-triazole; 1-[[bis-(4-fluorophenyl)methyl-silyl]methyl]-1H-1,2,4-triazole |
014-019-00-7 |
403-250-2 |
— |
►M5 — ◄ |
|
(4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane |
014-036-00-X |
405-020-7 |
|
|
|
Tris(2-methoxyethoxy)vinylsilane; 6-(2-methoxyethoxy)-6-vinyl-2,5,7,10-tetraoxa-6-silaundecane |
014-050-00-6 |
213-934-0 |
|
|
|
Tris(2-chloroethyl)phosphate |
015-102-00-0 |
204-118-5 |
|
|
|
Glufosinate ammonium (ISO); Ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate |
015-155-00-X |
278-636-5 |
|
|
|
Trixylyl phosphate |
015-201-00-9 |
246-677-8 |
|
|
|
Diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide |
015-203-00-X |
278-355-8 |
|
|
|
benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate |
015-204-00-5 |
479-100-5 |
|
|
|
benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) |
015-205-00-0 |
278-305-5 |
|
|
|
reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyl(diethylamino)diphenylphosphonium 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenolate (1:1) |
015-206-00-6 |
- |
- |
|
|
reaction mass of 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol and benzyltriphenylphosphonium, salt with 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol (1:1) |
015-207-00-1 |
- |
- |
|
|
Dimethyl propylphosphonate |
015-208-00-7 |
242-555-3 |
|
|
|
Potassium dichromate |
024-002-00-6 |
231-906-6 |
►M5 — ◄ |
|
|
Ammonium dichromate |
024-003-00-1 |
232-143-1 |
►M5 — ◄ |
|
|
Sodium dichromate |
024-004-00-7 |
234-190-3 |
|
|
|
▼M14 ————— |
||||
|
Sodium chromate |
024-018-00-3 |
231-889-5 |
►M5 — ◄ |
|
|
Cobalt |
027-001-00-9 |
231-158-0 |
|
|
|
Cobalt dichloride |
027-004-00-5 |
231-589-4 |
|
|
|
Cobalt sulfate |
027-005-00-0 |
233-334-2 |
|
|
|
Cobalt acetate |
027-006-00-6 |
200-755-8 |
|
|
|
Cobalt nitrate |
027-009-00-2 |
233-402-1 |
|
|
|
Cobalt carbonate |
027-010-00-8 |
208-169-4 |
|
|
|
Nickel tetracarbonyl |
028-001-00-1 |
236-669-2 |
|
|
|
Nickel dihydroxide; [1] |
028-008-00-X |
235-008-5 [1] |
12054-48-7 [1] |
|
|
Nickel hydroxide; [2] |
234-348-1 [2] |
11113-74-9 [2] |
||
|
Nickel sulfate |
028-009-00-5 |
232-104-9 |
|
|
|
Nickel carbonate; |
028-010-00-0 |
|
|
|
|
Basic nickel carbonate; |
|
|
||
|
Carbonic acid, nickel (2+) salt; [1] |
222-068-2 [1] |
3333-67-3 [1] |
||
|
Carbonic acid, nickel salt; [2] |
240-408-8 [2] |
16337-84-1 [2] |
||
|
[μ-[carbonato(2-)-O:O′]]dihydroxy trinickel; [3] |
265-748-4 [3] |
65405-96-1 [3] |
||
|
[carbonato(2-)]tetrahydroxytrinickel; [4] |
235-715-9 [4] |
12607-70-4 [4] |
||
|
Nickel dichloride |
028-011-00-6 |
231-743-0 |
|
|
|
Nickel dinitrate; [1] |
028-012-00-1 |
236-068-5 [1] |
13138-45-9 [1] |
|
|
Nitric acid, nickel salt; [2] |
238-076-4 [2] |
14216-75-2 [2] |
||
|
Slimes and sludges, copper electrolytic refining, decopperised, nickel sulfate |
028-014-00-2 |
295-859-3 |
|
|
|
Nickel diperchlorate; Perchloric acid, nickel (II) salt |
028-016-00-3 |
237-124-1 |
|
|
|
Nickel dipotassium bis(sulfate); [1] |
028-017-00-9 |
237-563-9 [1] |
13842-46-1 [1] |
|
|
Diammonium nickel bis(sulfate); [2] |
239-793-2 [2] |
15699-18-0 [2] |
||
|
Nickel bis(sulfamidate); Nickel sulfamate |
028-018-00-4 |
237-396-1 |
|
|
|
Nickel bis(tetrafluoroborate) |
028-019-00-X |
238-753-4 |
|
|
|
Nickel diformate; [1] |
028-021-00-0 |
222-101-0 [1] |
3349-06-2 [1] |
|
|
Formic acid, nickel salt; [2] |
239-946-6 [2] |
15843-02-4 [2] |
||
|
Formic acid, copper nickel salt; [3] |
268-755-0 [3] |
68134-59-8 [3] |
||
|
Nickel di(acetate); [1] |
028-022-00-6 |
206-761-7 [1] |
373-02-4 [1] |
|
|
Nickel acetate; [2] |
239-086-1 [2] |
14998-37-9 [2] |
||
|
Nickel dibenzoate |
028-024-00-7 |
209-046-8 |
|
|
|
Nickel bis(4-cyclohexylbutyrate) |
028-025-00-2 |
223-463-2 |
|
|
|
Nickel (II) stearate; Nickel (II) octadecanoate |
028-026-00-8 |
218-744-1 |
|
|
|
Nickel dilactate |
028-027-00-3 |
— |
|
|
|
Nickel (II) octanoate |
028-028-00-9 |
225-656-7 |
|
|
|
Nickel difluoride; [1] |
028-029-00-4 |
233-071-3 [1] |
10028-18-9 [1] |
|
|
Nickel dibromide; [2] |
236-665-0 [2] |
13462-88-9 [2] |
||
|
Nickel diiodide; [3] |
236-666-6 [3] |
13462-90-3 [3] |
||
|
Nickel potassium fluoride; [4] |
- [4] |
11132-10-8 [4] |
||
|
Nickel hexafluorosilicate |
028-030-00-X |
247-430-7 |
|
|
|
Nickel selenate |
028-031-00-5 |
239-125-2 |
|
|
|
Nickel dithiocyanate |
028-046-00-7 |
237-205-1 |
|
|
|
Nickel dichromate |
028-047-00-2 |
239-646-5 |
|
|
|
Nickel dichlorate; [1] |
028-053-00-5 |
267-897-0 [1] |
67952-43-6 [1] |
|
|
Nickel dibromate; [2] |
238-596-1 [2] |
14550-87-9 [2] |
||
|
Ethyl hydrogen sulfate, nickel (II) salt; [3] |
275-897-7 [3] |
71720-48-4 [3] |
||
|
Nickel (II) trifluoroacetate; [1] |
028-054-00-0 |
240-235-8 [1] |
16083-14-0 [1] |
|
|
Nickel (II) propionate; [2] |
222-102-6 [2] |
3349-08-4 [2] |
||
|
Nickel bis(benzenesulfonate); [3] |
254-642-3 [3] |
39819-65-3 [3] |
||
|
Nickel (II) hydrogen citrate; [4] |
242-533-3 [4] |
18721-51-2 [4] |
||
|
Citric acid, ammonium nickel salt; [5] |
242-161-1 [5] |
18283-82-4 [5] |
||
|
Citric acid, nickel salt; [6] |
245-119-0 [6] |
22605-92-1 [6] |
||
|
Nickel bis(2-ethylhexanoate); [7] |
224-699-9 [7] |
4454-16-4 [7] |
||
|
2-Ethylhexanoic acid, nickel salt; [8] |
231-480-1 [8] |
7580-31-6 [8] |
||
|
Dimethylhexanoic acid nickel salt; [9] |
301-323-2 [9] |
93983-68-7 [9] |
||
|
Nickel (II) isooctanoate; [10] |
249-555-2 [10] |
29317-63-3 [10] |
||
|
Nickel isooctanoate; [11] |
248-585-3 [11] |
27637-46-3 [11] |
||
|
Nickel bis(isononanoate); [12] |
284-349-6 [12] |
84852-37-9 [12] |
||
|
Nickel (II) neononanoate; [13] |
300-094-6 [13] |
93920-10-6 [13] |
||
|
Nickel (II) isodecanoate; [14] |
287-468-1 [14] |
85508-43-6 [14] |
||
|
Nickel (II) neodecanoate; [15] |
287-469-7 [15] |
85508-44-7 [15] |
||
|
Neodecanoic acid, nickel salt; [16] |
257-447-1 [16] |
51818-56-5 [16] |
||
|
Nickel (II) neoundecanoate; [17] |
300-093-0 [17] |
93920-09-3 [17] |
||
|
Bis(d-gluconato-O1,O2)nickel; [18] |
276-205-6 [18] |
71957-07-8 [18] |
||
|
Nickel 3,5-bis(tert-butyl)-4-hydroxybenzoate (1:2); [19] |
258-051-1 [19] |
52625-25-9 [19] |
||
|
Nickel (II) palmitate; [20] |
237-138-8 [20] |
13654-40-5 [20] |
||
|
(2-ethylhexanoato-O)(isononanoato-O)nickel; [21] |
287-470-2 [21] |
85508-45-8 [21] |
||
|
(isononanoato-O)(isooctanoato-O)nickel; [22] |
287-471-8 [22] |
85508-46-9 [22] |
||
|
(isooctanoato-O)(neodecanoato-O)nickel; [23] |
284-347-5 [23] |
84852-35-7 [23] |
||
|
(2-ethylhexanoato-O)(isodecanoato-O)nickel; [24] |
284-351-7 [24] |
84852-39-1 [24] |
||
|
(2-ethylhexanoato-O)(neodecanoato-O)nickel; [25] |
285-698-7 [25] |
85135-77-9 [25] |
||
|
(isodecanoato-O)(isooctanoato-O)nickel; [26] |
285-909-2 [26] |
85166-19-4 [26] |
||
|
(isodecanoato-O)(isononanoato-O)nickel; [27] |
284-348-0 [27] |
84852-36-8 [27] |
||
|
(isononanoato-O)(neodecanoato-O)nickel; [28] |
287-592-6 [28] |
85551-28-6 [28] |
||
|
Fatty acids, C6-19-branched, nickel salts; [29] |
294-302-1 [29] |
91697-41-5 [29] |
||
|
Fatty acids, C8-18 and C18-unsaturated, nickel salts; [30] |
283-972-0 [30] |
84776-45-4 [30] |
||
|
2,7-Naphthalenedisulfonic acid, nickel(II) salt; [31] |
- [31] |
72319-19-8 [31] |
||
|
Gallium arsenide |
031-001-00-4 |
215-114-8 |
|
|
|
Ammonium bromide |
035-005-00-7 |
235-183-8 |
|
|
|
Cadmium fluoride |
048-006-00-2 |
232-222-0 |
►M5 — ◄ |
|
|
Cadmium chloride |
048-008-00-3 |
233-296-7 |
►M5 — ◄ |
|
|
Cadmium sulphate |
048-009-00-9 |
233-331-6 |
►M5 — ◄ |
|
|
Tributyltin compounds, except those specified elsewhere in Annex VI to Regulation (EC) No 1272/2008 |
050-008-00-3 |
— |
— |
|
|
Dichlorodioctylstannane |
050-021-00-4 |
222-583-2 |
|
|
|
Dibutyltin dichloride; (DBTC) |
050-022-00-X |
211-670-0 |
|
|
|
2-ethylhexyl 10-ethyl-4,4-dioctyl-7-oxo-8-oxa-3,5-dithia-4-stannatetradecanoate |
050-027-00-7 |
239-622-4 |
|
|
|
Dibutyltin dilaurate; dibutyl[bis(dodecanoyloxy)]stannane |
050-030-00-3 |
201-039-8 |
|
|
|
Dioctyltin dilaurate; [1] stannane, dioctyl-, bis(coco acyloxy) derivs. [2] |
050-031-00-9 |
222-883-3 [1] 293-901-5 [2] |
3648-18-8 [1] 91648-39-4 [2] |
|
|
Dibutyltin bis(2-ethylhexanoate) |
050-032-00-4 |
220-481-2 |
|
|
|
Dibutyltin di(acetate) |
050-033-00-X |
213-928-8 |
|
|
|
Dibutyltin maleate |
050-034-00-5 |
201-077-5 |
|
|
|
Dibutyltin oxide |
050-035-00-0 |
212-449-1 |
|
|
|
Tellurium |
052-001-00-0 |
236-813-4 |
|
|
|
Tellurium dioxide |
052-002-00-6 |
231-193-1 |
|
|
|
Barium diboron tetraoxide |
056-005-00-3 |
237-222-4 |
|
|
|
Mercury |
080-001-00-0 |
231-106-7 |
|
|
|
Benzo[a]pyrene; benzo[d,e,f]chrysene |
601-032-00-3 |
200-028-5 |
|
|
|
1-Bromopropane Propyl bromide n-Propyl bromide |
602-019-00-5 |
203-445-0 |
|
|
|
1,2,3-Trichloropropane |
602-062-00-X |
202-486-1 |
D |
|
|
Diphenylether; octabromo derivate |
602-094-00-4 |
251-087-9 |
|
|
|
2-Methoxyethanol; ethylene glycol monomethyl ether; methylglycol |
603-011-00-4 |
203-713-7 |
|
|
|
2-Ethoxyethanol; ethylene glycol monoethyl ether; ethylglycol |
603-012-00-X |
203-804-1 |
|
|
|
Ethylene oxide; oxirane |
603-023-00-X |
200-849-9 |
|
|
|
1,2-Dimethoxyethane ethylene glycol dimethyl ether EGDME |
603-031-00-3 |
203-794-9 |
|
|
|
Tetrahydro-2-furyl-methanol; tetrahydrofurfuryl alcohol |
603-061-00-7 |
202-625-6 |
|
|
|
2,3-Epoxypropan-1-ol; glycidol oxiranemethanol |
603-063-00-8 |
209-128-3 |
►M5 — ◄ |
|
|
7-Oxa-3-oxiranylbicyclo[4.1.0]heptane; 1,2-epoxy-4-epoxyethylcyclohexane; 4-vinylcyclohexene diepoxide |
603-066-00-4 |
203-437-7 |
|
|
|
2-Methoxypropanol |
603-106-00-0 |
216-455-5 |
|
|
|
2-(2-methoxyethoxy)ethanol; diethylene glycol monomethyl ether |
603-107-00-6 |
203-906-6 |
|
|
|
Bis(2-methoxyethyl) ether |
603-139-00-0 |
203-924-4 |
|
|
|
R-2,3-epoxy-1-propanol |
603-143-002 |
404-660-4 |
►M5 — ◄ |
|
|
1,2-Bis(2-methoxyethoxy)ethane TEGDME; Triethylene glycol dimethyl ether; Triglyme |
603-176-00-2 |
203-977-3 |
|
|
|
2-(2-aminoethylamino)ethanol (AEEA) |
603-194-00-0 |
203-867-5 |
|
|
|
1,2-Diethoxyethane |
603-208-00-5 |
211-076-1 |
|
|
|
Ethanol, 2,2'-iminobis-, N-(C13-15 branched and linear alkyl) derivs. |
603-236-00-8 |
308-208-6 |
|
|
|
Ipconazole (ISO); (1RS,2SR,5RS;1RS,2SR,5SR)-2-(4-chlorobenzyl)-5-isopropyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
603-237-00-3 |
- |
|
|
|
Bis(2-(2-methoxyethoxy)ethyl)ether; tetraglyme |
603-238-00-9 |
205-594-7 |
|
|
|
Reaction mass of 1-(2,3-epoxypropoxy)-2,2-bis ((2,3-epoxypropoxy)methyl) butane and 1-(2,3-epoxypropoxy)-2-((2,3-epoxypropoxy)methyl)-2-hydroxymethyl butane |
603-244-00-1 |
- |
- |
|
|
4,4'-isobutylethylidenediphenol; 2,2-bis (4'-hydroxyphenyl)-4-methylpentane |
604-024-00-8 |
401-720-1 |
|
|
|
Bisphenol A; 4,4′-isopropylidenediphenol |
604-030-00-0 |
201-245-8 |
|
|
|
(E)-3-[1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenol |
604-073-00-5 |
428-010-4 |
|
|
|
Phenol, dodecyl-, branched; [1] Phenol, 2-dodecyl-, branched; [2] Phenol, 3-dodecyl-, branched; [3] Phenol, 4-dodecyl-, branched; [4] Phenol, (tetrapropenyl) derivatives [5] |
604-092-00-9 |
310-154-3 [1] - [2] - [3] - [4] - [5] |
121158-58-5 [1] - [2] - [3] 210555-94-5 [4] 74499-35-7 [5] |
|
|
6,6'-Di-tert-butyl-2,2'-methylenedi-p-cresol; [DBMC] |
604-095-00-5 |
204-327-1 |
|
|
|
2,4,6-tri-tert-butylphenol |
604-097-00-6 |
211-989-5 |
|
|
|
4,4'-sulphonyldiphenol; bisphenol S |
604-098-00-1 |
201-250-5 |
|
|
|
4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]diphenol; bisphenol AF |
604-099-00-7 |
216-036-7 |
|
|
|
2-(4-tert-butylbenzyl)propionaldehyde |
605-041-00-3 |
201-289-8 |
|
|
|
Chlorophacinone (ISO);2-[(4-chlorophenyl)(phenyl)acetyl]-1H-indene-1,3(2H)-dione |
606-014-00-9 |
223-003-0 |
|
|
|
N-methyl-2-pyrrolidone; 1-Methyl-2-pyrrolidone |
606-021-00-7 |
212-828-1 |
|
|
|
2-methyl-1-(4-methylthiophenyl)-2-morpholinopropan-1-one |
606-041-00-6 |
400-600-6 |
|
|
|
2-benzyl-2-dimethylamino-4'-morpholinobutyrophenone |
606-047-00-9 |
404-360-3 |
|
|
|
Tetrahydrothiopyran-3-carboxaldehyde |
606-062-00-0 |
407-330-8 |
|
|
|
2-Butyryl-3-hydroxy-5-thiocyclohexan-3-yl-cyclohex-2-en-1-one |
606-100-00-6 |
425-150-8 |
|
|
|
Cyclic 3-(1,2-ethanediylacetale)-estra-5(10),9(11)-diene-3,17-dione |
606-131-00-5 |
427-230-8 |
|
|
|
2-Methoxyethyl acetate; ethylene glycol monomethyl ether acetate; methylglycol acetate |
607-036-00-1 |
203-772-9 |
|
|
|
2-Ethoxyethyl acetate; ethylene glycol monoethyl ether acetate; ethylglycol acetate |
607-037-00-7 |
203-839-2 |
|
|
|
Coumatetralyl (ISO); 4-hydroxy-3-(1,2,3,4-tetrahydro-1-naphthyl)coumarin |
607-059-00-7 |
227-424-0 |
|
|
|
2,3-epoxypropyl methacrylate; glycidyl methacrylate |
607-123-00-4 |
203-441-9 |
|
|
|
Difenacoum (ISO); 3-(3-biphenyl-4-yl-1,2,3,4-tetrahydro-1-naphthyl)-4-hydroxycoumarin |
607-157-00-X |
259-978-4 |
|
|
|
2-Ethylhexyl 3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl methyl thio acetate |
607-203-00-9 |
279-452-8 |
|
|
|
Bis(2-Methoxyethyl) phthalate |
607-228-00-5 |
204-212-6 |
|
|
|
2-ethylhexanoic acid and its salts, with the exception of those specified elsewhere in Annex VI to Regulation (EC) No 1272/2008 |
607-230-00-6 |
— |
— |
|
|
2-Methoxypropyl acetate |
607-251-00-0 |
274-724-2 |
|
|
|
Fluazifop-butyl (ISO); butyl (RS)-2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate |
607-304-00-8 |
274-125-6 |
|
|
|
Vinclozolin (ISO); N-3,5-Dichlorophenyl-5-methyl-5-vinyl-1,3-oxazolidine-2,4-dione |
607-307-00-4 |
256-599-6 |
|
|
|
Methoxyacetic acid |
607-312-00-1 |
210-894-6 |
►M5 — ◄ |
|
|
Bis(2-ethylhexyl) phthalate; di-(2-ethylhexyl) phthalate; DEHP |
607-317-00-9 |
204-211-0 |
|
|
|
Dibutyl phthalate; DBP |
607-318-00-4 |
201-557-4 |
|
|
|
(+/-) tetrahydrofurfuryl (R)-2-[4-(6-chloroquinoxalin-2-yloxy)phenyloxy]propionate |
607-373-00-4 |
414-200-4 |
►M5 — ◄ |
|
|
Flocoumafen (ISO); reaction mass of: cis-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin and trans-4-hydroxy-3-(1,2,3,4-tetrahydro-3-(4-(4-trifluoromethylbenzyloxy)phenyl)-1-naphthyl)coumarin |
607-375-00-5 |
421-960-0 |
|
|
|
1,2-benzenedicarboxylic acid, dipentylester, branched and linear [1] |
607-426-00-1 |
284-032-2 [1] |
84777-06-0 [1] |
|
|
n-pentyl-isopentylphthalate [2] |
|
[2] |
[2] |
|
|
di-n-pentyl phthalate [3] |
|
205-017-9 [3] |
131-18-0 [3] |
|
|
Diisopentylphthalate [4] |
|
210-088-4 [4] |
605-50-5 [4] |
|
|
Benzyl butyl phthalate BBP |
607-430-00-3 |
201-622-7 |
|
|
|
1,2-Benzenedicarboxylic acid di-C7-11-branched and linear alkylesters |
607-480-00-6 |
271-084-6 |
|
|
|
1,2-Benzenedicarboxylic acid; Di-C6-8-branched alkylesters, C7-rich |
607-483-00-2 |
276-158-1 |
|
|
|
A mixture of: disodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-hydroxy-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate; trisodium 4-(3-ethoxycarbonyl-4-(5-(3-ethoxycarbonyl-5-oxido-1-(4-sulfonatophenyl)pyrazol-4-yl)penta-2,4-dienylidene)-4,5-dihydro-5-oxopyrazol-1-yl)benzenesulfonate |
607-487-00-4 |
402-660-9 |
— |
|
|
Diisobutyl phthalate |
607-623-00-2 |
201-553-2 |
|
|
|
Perfluorooctane sulfonic acid; |
607-624-00-8 |
|
|
|
|
4-tert-butylbenzoic acid |
607-698-00-1 |
202-696-3 |
|
|
|
Heptadecafluorooctane-1-sulfonic acid; [1] |
217-179-8 [1] |
1763-23-1 [1] |
||
|
Potassium perfluorooctanesulfonate; |
|
|
||
|
Potassium heptadecafluorooctane-1-sulfonate; [2] |
220-527-1 [2] |
2795-39-3 [2] |
||
|
Diethanolamine perfluorooctane sulfonate; [3] |
274-460-8 [3] |
70225-14-8 [3] |
||
|
Ammonium perfluorooctane sulfonate; |
|
|
||
|
Ammonium heptadecafluorooctanesulfonate; [4] |
249-415-0 [4] |
29081-56-9 [4] |
||
|
Lithium perfluorooctane sulfonate; |
|
|
||
|
Lithium heptadecafluorooctanesulfonate; [5] |
249-644-6 [5] |
29457-72-5 [5] |
||
|
Dihexyl phthalate |
607-702-00-1 |
201-559-5 |
|
|
|
Ammoniumpentadecafluorooctanoate |
607-703-00-7 |
223-320-4 |
|
|
|
Perfluorooctanoic acid |
607-704-00-2 |
206-397-9 |
|
|
|
1,2-benzenedicarboxylic acid, dihexyl ester, branched and linear |
607-710-00-5 |
271-093-5 |
|
|
|
Bromadiolone (ISO); 3-[3-(4′-bromobiphenyl-4-yl)-3-hydroxy-1-phenylpropyl]-4-hydroxy-2H-chromen-2-one |
607-716-00-8 |
249-205-9 |
|
|
|
Difethialone (ISO); 3-[3-(4′-bromobiphenyl-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxy-2H-1-benzothiopyran-2-one |
607-717-00-3 |
— |
|
|
|
Perfluorononan-1-oic acid [1] and its sodium [2] and ammonium [3] salts |
607-718-00-9 |
206-801-3 [1] - [2] - [3] |
375-95-1 [1] 21049-39-8 [2] 4149-60-4 [3] |
|
|
Dicyclohexyl phthalate |
607-719-00-4 |
201-545-9 |
|
|
|
Nonadecafluorodecanoic acid; [1] ammonium nonadecafluorodecanoate; [2] sodium nonadecafluorodecanoate [3] |
607-720-00-X |
206-400-3 [1] 221-470-5 [2] [3] |
335-76-2 [1] 3108-42-7 [2] 3830-45-3 [3] |
|
|
Pentapotassium 2,2',2",2"’,2""-(ethane-1,2-diylnitrilo)pentaacetate |
607-734-00-6 |
404-290-3 |
|
|
|
N-carboxymethyliminobis(ethylenenitrilo)tetra (acetic acid) |
607-735-00-1 |
200-652-8 |
|
|
|
Pentasodium(carboxylatomethyl)iminobis (ethylenenitrilo)tetraacetate |
607-736-00-7 |
205-391-3 |
|
|
|
Diisohexyl phthalate |
607-737-00-2 |
276-090-2 |
|
|
|
Diisooctyl phthalate |
607-740-00-9 |
248-523-5 |
|
|
|
2-methoxyethyl acrylate |
607-744-00-0 |
221-499-3 |
|
|
|
Perfluoroheptanoic acid; tridecafluoroheptanoic acid |
607-761-00-3 |
206-798-9 |
|
|
|
6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid, sodium and tris(2-hydroxyethyl)ammonium salts |
607-763-00-4 |
— |
— |
|
|
6-[(C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
607-764-00-X |
— |
|
|
|
6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
607-765-00-5 |
— |
— |
|
|
Nitrobenzene |
609-003-00-7 |
202-716-0 |
|
|
|
Dinocap (ISO); (RS)-2,6-dinitro-4-octylphenyl crotonates and (RS)-2,4-dinitro-6-octylphenyl crotonates in which ‘octyl’ is a reaction mass of 1-methylheptyl, 1-ethylhexyl and 1-propylpentyl groups |
609-023-00-6 |
254-408-0 |
|
|
|
Binapacryl (ISO); 2-sec-butyl-4,6-dinitrophenyl-3-methylcrotonate |
609-024-00-1 |
207-612-9 |
|
|
|
Dinoseb; 6-sec-butyl-2,4-dinitrophenol |
609-025-00-7 |
201-861-7 |
|
|
|
Salts and esters of dinoseb, except those specified elsewhere in Annex VI to Regulation (EC) No 1272/2008 |
609-026-00-2 |
— |
— |
|
|
Dinoterb; 2-tert-butyl-4,6-dinitrophenol |
609-030-00-4 |
215-813-8 |
|
|
|
Salts and esters of dinoterb |
609-031-00-X |
|
|
|
|
Nitrofen (ISO); 2,4 dichlorophenyl 4-nitrophenyl ether |
609-040-00-9 |
217-406-0 |
|
|
|
Methyl-ONN-azoxymethyl acetate; methyl azoxy methyl acetate |
611-004-00-2 |
209-765-7 |
|
|
|
2-[2-hydroxy-3-(2-chlorophenyl)carbamoyl-1-naphthylazo]-7-[2-hydroxy-3-(3-methylphenyl)carbamoyl-1-naphthylazo]fluoren-9-one |
611-131-00-3 |
420-580-2 |
— |
|
|
Azafenidin |
611-140-00-2 |
— |
|
|
|
Chloro-N,N-dimethylformiminium chloride |
612-250-00-3 |
425-970-6 |
|
|
|
7-Methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one; [containing ≥ 0,5 % formamide (EC No 200-842-0)] |
612-253-01-7 |
429-400-7 |
|
|
|
Triflumizole (ISO); (1E)-N-[4-chloro-2-(trifluoromethyl)phenyl]-1-(1H-imidazol-1-yl)-2-propoxyethanimine |
612-289-00-6 |
— |
|
|
|
1,4-Benzenediamine, N,N-mixed Ph and tolyl derivs.; |
612-298-00-5 |
273-227-8 |
|
|
|
Tridemorph (ISO); 2,6-dimethyl-4-tridecylmorpholine |
613-020-00-5 |
246-347-3 |
|
|
|
Ethylene thiourea; imidazolidine-2-thione; 2-imidazoline-2-thiol |
613-039-00-9 |
202-506-9 |
|
|
|
Carbendazim (ISO) methyl benzimidazol-2-ylcarbamate |
613-048-00-8 |
234-232-0 |
|
|
|
Benomyl (ISO) methyl 1-(butylcarbamoyl)benzimidazol-2-ylcarbamate |
613-049-00-3 |
241-775-7 |
|
|
|
Dimethomorph (ISO); (E,Z)-4-(3-(4-chlorophenyl)-3-(3,4-dimethoxyphenyl)acryloyl)morpholine |
613-102-00-0 |
404-200-2 |
|
|
|
1,2,4-Triazole |
613-111-00-X |
206-022-9 |
|
|
|
Cycloheximide |
613-140-00-8 |
200-636-0 |
|
|
|
Flumioxazin (ISO); 2-[7-fluoro-3-oxo-4- (prop-2-yn-1-yl)-3,4-dihydro-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3 (2H)-dione |
613-166-00-X |
— |
|
|
|
(2RS,3RS)-3-(2-Chlorophenyl)-2-(4-fluorophenyl)-[(1H-1,2,4-triazol-1-yl)-methyl]oxirane |
613-175-00-9 |
406-850-2 |
|
|
|
Epoxiconazole (ISO); (2RS,3SR)-3-(2-chlorophenyl)-2-(4-fluorophenyl)-[(1H-1,2,4-triazol-1-yl)methyl]oxirane |
613-175-00-9 |
406-850-2 |
|
|
|
3-Ethyl-2-methyl-2-(3-methylbutyl)-1,3-oxazolidine |
613-191-00-6 |
421-150-7 |
|
|
|
A mixture of: 1,3,5-tris(3-aminomethylphenyl)-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione; a mixture of oligomers of 3,5-bis(3-aminomethylphenyl)-1-poly[3,5-bis(3-aminomethylphenyl)-2,4,6-trioxo-1,3,5-(1H,3H,5H)-triazin-1-yl]-1,3,5-(1H,3H,5H)-triazine-2,4,6-trione |
613-199-00-X |
421-550-1 |
— |
|
|
propiconazole (ISO); (2RS,4RS;2RS,4SR)-1-{[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl}-1H-1,2,4-triazole |
613-205-00-0 |
262-104-4 |
|
|
|
Ketoconazole; 1-[4-[4-[[(2SR,4RS)-2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]ethanone |
613-283-00-6 |
265-667-4 |
|
|
|
Potassium 1-methyl-3-morpholinocarbonyl-4-[3-(1-methyl-3-morpholinocarbonyl-5-oxo-2-pyrazolin-4-ylidene)-1-propenyl]pyrazole-5-olate; [containing ≥ 0,5 % N,N-dimethylformamide (EC No 200-679-5)] |
613-286-01-X |
418-260-2 |
|
|
|
Imidazole |
613-319-00-0 |
206-019-2 |
|
|
|
Triadimenol (ISO); (1RS,2RS;1RS,2SR)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol; α-tert-butyl-β-(4-chlorophenoxy)-1H-1,2,4-triazole-1-ethanol |
613-322-00-7 |
259-537-6 |
|
|
|
Quinolin-8-ol; 8-hydroxyquinoline |
613-324-00-8 |
205-711-1 |
|
|
|
Thiacloprid (ISO); (Z)-3-(6-chloro-3-pyridylmethyl)-1,3-thiazolidin-2-ylidenecyanamide; {(2Z)-3-[(6-chloropyridin-3-yl)methyl]-1,3-thiazolidin-2-ylidene}cyanamide |
613-325-00-3 |
— |
|
|
|
1-vinylimidazole |
613-328-00-X |
214-012-0 |
|
|
|
Halosulfuron-methyl (ISO); methyl 3-chloro-5-{[(4,6dimethoxypyrimidin-2yl)carbamoyl]sulfamoyl}-1-methyl1H-pyrazole-4-carboxylate |
613-329-00-5 |
- |
|
|
|
2-methylimidazole |
613-330-00-0 |
211-765-7 |
|
|
|
Pyrithione zinc; (T-4)-bis[1-(hydroxy-.kappa.O)pyridine-2(1H)-thionato-.kappa.S]zinc |
613-333-00-7 |
236-671-3 |
|
|
|
Flurochloridone (ISO); 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
613-334-00-2 |
262-661-3 |
|
|
|
3-Methylpyrazole |
613-339-00-X |
215-925-7 |
|
|
|
Theophylline; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
613-342-00-6 |
200-385-7 |
|
|
|
4-methylimidazole |
613-349-00-4 |
212-497-3 |
|
|
|
N, N-dimethylformamide; dimethyl formamide |
616-001-00-X |
200-679-5 |
|
|
|
N, N-Dimethylacetamide |
616-011-00-4 |
204-826-4 |
►M5 — ◄ |
|
|
Formamide |
616-052-00-8 |
200-842-0 |
|
|
|
N-methylacetamide |
616-053-00-3 |
201-182-6 |
|
|
|
N-methylformamide |
616-056-00-X |
204-624-6 |
►M5 — ◄ |
|
|
N-[6,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-6-oxo-1H-purin-2-yl]acetamide |
616-148-00-X |
424-550-1 |
|
|
|
N,N-(dimethylamino)thioacetamide hydrochloride |
616-180-00-4 |
435-470-1 |
|
|
|
N-ethyl-2-pyrrolidone; 1-ethylpyrrolidin-2-one |
616-208-00-5 |
220-250-6 |
|
|
|
Carbetamide (ISO); (R)-1-(ethylcarbamoyl)ethyl carbanilate; (2R)-1-(ethylamino)-1-oxopropan-2-yl phenylcarbamate |
616-223-00-7 |
240-286-6 |
|
|
|
N-(2-nitrophenyl)phosphoric triamide |
616-238-00-9 |
477-690-9 |
|
|
|
Reaction mass of 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9RS)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide and 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9SR)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide [> 78 % syn isomers < 15 % anti isomers relative content]; isopyrazam |
616-240-00-X |
- |
|
|
|
Bis(α,α-dimethylbenzyl) peroxide |
617-006-00-X |
201-279-3 |
|
|
|
Pitch, coal tar, high-temp.; (The residue from the distillation of high temperature coal tar. A black solid with an approximate softening point from 30 °C to 180 °C (86 °F to 356 °F). Composed primarily of a complex mixture of three or more membered condensed ring aromatic hydrocarbons.) |
648-055-00-5 |
266-028-2 |
|
|
|
Cyproconazole (ISO); (2RS,3RS;2RS,3SR)-2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol |
650-032-00-X |
— |
|
|
|
Dibutylbis(pentane-2,4-dionato-O,O')tin |
650-056-00-0 |
245-152-0 |
|
|