Part 3.9 / M31, M34
3. PART 3: HARMONISED CLASSIFICATION AND LABELLING TABLE
|
Index No |
►M18 Chemical name ◄ |
EC No |
CAS No |
Classification |
Labelling |
Notes |
||||
|
Hazard Class and Category Code(s) |
Hazard statement Code(s) |
Pictogram, Signal Word Code(s) |
Hazard statement Code(s) |
Suppl. Hazard statement Code(s) |
||||||
|
005-007-00-2 |
boric acid; [1] boric acid [2] |
233-139-2 [1] 234-343-4 [2] |
10043-35-3 [1] 11113-50-1 [2] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
005-008-00-8 |
diboron trioxide |
215-125-8 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
|
005-011-00-4 |
tetraboron disodium heptaoxide, hydrate; [1] disodium tetraborate, anhydrous; [2] orthoboric acid, sodium salt; [3] disodium tetraborate decahydrate; [4] disodium tetraborate pentahydrate [5] |
235-541-3 [1] 215-540-4 [2] 237-560-2 [3] 215-540-4 [4] 215-540-4 [5] |
12267-73-1 [1] 1330-43-4 [2] 13840-56-7 [3] 1303-96-4 [4] 12179-04-3 [5] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
11 |
|
014-001-00-9 |
trichlorosilane |
233-042-5 |
Flam. Liq. 1 Water-react. 1 Acute Tox. 3 Acute Tox. 4 Skin Corr. 1A Eye Dam. 1 |
H224 H260 H331 H302 H314 H318 |
GHS02 GHS06 GHS05 Dgr |
H224 H260 H331 H302 H314 |
EUH014 EUH029 EUH071 |
inhalation: ATE = 7,6 mg/L (vapour) oral: ATE = 1 000 mg/kg bw |
|
|
|
014-052-00-7 |
silanamine, 1,1,1-trimethyl-N-(trimethylsilyl)-, hydrolysis products with silica; pyrogenic, synthetic amorphous, nano, surface treated silicon dioxide |
272-697-1 |
STOT RE 2 |
H373 (lungs) (inhalation) |
GHS08 Wng |
H373 (lungs) (inhalation) |
EUH066 |
|
|
|
|
023-001-00-8 |
divanadium pentaoxide; vanadium pentoxide |
215-239-8 |
Muta. 2 Carc. 1B Repr. 2 Lact. Acute Tox. 3 Acute Tox. 2 STOT SE 3 STOT RE 1 Aquatic Chronic 2 |
H341 H350 H361fd H362 H301 H330 H335 H372 (respiratory tract, inhalation) H411 |
GHS06 GHS08 GHS09 Dgr |
H341 H350 H361fd H362 H301 H330 H335 H372 (respiratory tract, inhalation) H411 |
|
inhalation: ATE = 0,05 mg/L (dusts or mists) oral: ATE = 220 mg/kg bw |
|
|
|
035-005-00-7 |
ammonium bromide |
235-183-8 |
Repr. 1B Lact. STOT SE 3 STOT RE 1 Eye Irrit. 2 |
H360FD H362 H336 H372 (nervous system) H319 |
GHS08 GHS07 Dgr |
H360FD H362 H336 H372 (nervous system) H319 |
|
|
|
|
|
050-032-00-4 |
dibutyltin bis(2-ethylhexanoate) |
220-481-2 |
Muta. 2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (immune system) |
GHS08 Dgr |
H341 H360FD H372 (immune system) |
|
|
|
|
|
050-033-00-X |
dibutyltin di(acetate) |
213-928-8 |
Muta 2 Repr. 1B STOT RE 1 |
H341 H360FD H372 (immune system) |
GHS08 Dgr |
H341 H360FD H372 (immune system) |
|
|
|
|
|
052-001-00-0 |
tellurium |
236-813-4 |
Repr. 1B Lact. |
H360Df H362 |
GHS08 Dgr |
H360Df H362 |
|
|
|
|
|
052-002-00-6 |
tellurium dioxide |
231-193-1 |
Repr. 1B Lact. |
H360Df H362 |
GHS08 Dgr |
H360Df H362 |
|
|
|
|
|
056-005-00-3 |
barium diboron tetraoxide |
237-222-4 |
Repr. 1B Acute Tox. 4 Acute Tox. 3 |
H360FD H332 H301 |
GHS08 GHS06 Dgr |
H360FD H332 H301 |
|
inhalation: ATE = 1,5 mg/L (dusts or mists) oral: ATE = 100 mg/kg bw |
|
|
|
601-024-00-X |
Cumene |
202-704-5 |
Flam. Liq. 3 Carc. 1B Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H226 H350 H304 H335 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H304 H335 H411 |
|
|
|
|
|
601-097-00-8 |
Propylbenzene |
203-132-9 |
Flam. Liq. 3 Asp. Tox. 1 STOT SE 3 Aquatic Chronic 2 |
H226 H304 H335 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H304 H335 H411 |
|
|
|
|
|
603-014-00-0 |
2-butoxyethanol; ethylene glycol monobutyl ether |
203-905-0 |
Acute Tox. 3 Acute Tox. 4 Skin Irrit. 2 Eye Irrit. 2 |
H331 H302 H315 H319 |
GHS06 Dgr |
H331 H302 H315 H319 |
|
inhalation: ATE = 3 mg/L (Vapours) oral: ATE = 1 200 mg/kg bw |
|
|
|
603-107-00-6 |
2-(2-methoxyethoxy)ethanol; diethylene glycol monomethyl ether |
203-906-6 |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
Repr. 1B; H360D: C ≥ 3 % |
|
|
|
603-243-00-6 |
2,2-dimethylpropan-1-ol, tribromo derivative; 3-bromo-2,2-bis(bromomethyl)propan-1-ol |
253-057-0 |
Carc. 1B Muta. 2 |
H350 H341 |
GHS08 Dgr |
H350 H341 |
|
|
|
|
|
604-030-00-0 |
4,4'-isopropylidenediphenol; bisphenol A |
201-245-8 |
Repr. 1B STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360F H335 H318 H317 H400 H410 |
GHS08 GHS07 GHS05 GHS09 Dgr |
H360F H335 H318 H317 H410 |
|
M = 1 M = 10 |
|
|
|
604-096-00-0 |
piperonyl butoxide (ISO); 2-(2-butoxyethoxy)ethyl 6-propylpiperonyl ether |
200-076-7 |
STOT SE 3 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H335 H319 H400 H410 |
GHS07 GHS09 Wng |
H335 H319 H410 |
EUH066 |
M = 1 M = 1 |
|
|
|
604-097-00-6 |
2,4,6-tri-tert-butylphenol |
211-989-5 |
Repr. 1B Acute Tox. 4 STOT RE 2 Skin Sens. 1B |
H360D H302 H373 (liver) H317 |
GHS08 GHS07 Dgr |
H360D H302 H373 (liver) H317 |
|
oral: ATE = 500 mg/kg bw |
|
|
|
604-098-00-1 |
4,4'-sulphonyldiphenol; bisphenol S |
201-250-5 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
|
606-153-00-5 |
benzophenone |
204-337-6 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
|
606-154-00-0 |
quinoclamine (ISO); 2-amino-3-chloro-1,4-naphthoquinone |
220-529-2 |
Carc. 2 Repr. 2 Acute Tox. 4 STOT RE 2 Eye Irrit. 2 Skin Sens. 1A Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d H302 H373 (blood system, kidneys) H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361d H302 H373 (blood system, kidneys) H319 H317 H410 |
|
oral: ATE = 500 mg/kg bw M = 10 M = 10 |
|
|
|
607-111-00-9 |
2-ethyl-2-[[(1-oxoallyl)oxy]methyl]-1,3-propanediyl diacrylate; 2,2-bis(acryloyloxymethyl)butyl acrylate; trimethylolpropane triacrylate |
239-701-3 |
Carc. 2 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H315 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H315 H319 H317 H410 |
|
M = 1 M = 1 |
D |
|
|
607-230-00-6 |
2-ethylhexanoic acid and its salts, with the exception of those specified elsewhere in this Annex |
- |
- |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
|
A, X, 12 |
|
607-253-00-1 |
cyfluthrin (ISO); α-cyano-4-fluoro-3-phenoxybenzyl-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
269-855-7 |
Lact. Acute Tox. 2 Acute Tox. 2 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H362 H330 H300 H370 (nervous system) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H362 H330 H300 H370 (nervous system) H410 |
|
inhalation: ATE = 0,14 mg/L (dusts or mists) oral: ATE = 14 mg/kg bw M = 1 000 000 M = 1 000 000 |
|
|
|
607-254-00-7 |
beta-cyfluthrin (ISO); reaction mass of rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate and rel-(R)-cyano(4-fluoro-3-phenoxyphenyl)methyl (1S,3R)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
- |
Lact. Acute Tox. 2 Acute Tox. 2 STOT SE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H362 H330 H300 H370 (nervous system) H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H362 H330 H300 H370 (nervous system) H410 |
|
inhalation: ATE = 0,081 mg/L (dusts or mists) oral: ATE = 11 mg/kg bw M = 1 000 000 M = 1 000 000 |
|
|
|
607-734-00-6 |
pentapotassium 2,2',2",2"',2""-(ethane-1,2-diylnitrilo)pentaacetate |
404-290-3 |
Repr. 1B Acute Tox. 4 STOT RE 2 Eye Irrit. 2 |
H360D H332 H373 (inhalation) H319 |
GHS08 GHS07 Dgr |
H360D H332 H373 (inhalation) H319 |
|
Repr. 1B; H360D: C ≥ 3 % inhalation: ATE = 1,5 mg/L (dusts or mists) |
|
|
|
607-735-00-1 |
N-carboxymethyliminobis(ethylenenitrilo)tetra(acetic acid) |
200-652-8 |
Repr. 1B Acute Tox. 4 STOT RE 2 Eye Irrit. 2 |
H360D H332 H373 (inhalation) H319 |
GHS08 GHS07 Dgr |
H360D H332 H373 (inhalation) H319 |
|
Repr. 1B; H360D: C ≥ 3 % inhalation: ATE = 1,5 mg/L (dusts or mists) |
|
|
|
607-736-00-7 |
pentasodium (carboxylatomethyl)iminobis(ethylenenitrilo)tetraacetate |
205-391-3 |
Repr. 1B Acute Tox. 4 STOT RE 2 |
H360D H332 H373 (inhalation) |
GHS08 GHS07 Dgr |
H360D H332 H373 (inhalation) |
|
Repr. 1B; H360D: C ≥ 3 % inhalation: ATE = 1,5 mg/L (dusts or mists) |
|
|
|
607-756-00-6 |
exo-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl acrylate; isobornyl acrylate |
227-561-6 |
Skin Sens. 1A |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
|
607-757-00-1 |
daminozide (ISO); 4-(2,2-dimethylhydrazino)-4-oxobutanoic acid; N-dimethylaminosuccinamic acid |
216-485-9 |
Carc. 2 |
H351 |
GHS08 Wng |
H351 |
|
|
|
|
|
607-758-00-7 |
4,4'-oxydi(benzenesulphonohydrazide) |
201-286-1 |
Self-react. D Aquatic Acute 1 Aquatic Chronic 1 |
H242 H400 H410 |
GHS02 GHS09 Dgr |
H242 H410 |
|
M = 1 M = 1 |
|
|
|
607-759-00-2 |
toluene-4-sulphonohydrazide |
216-407-3 |
Self-react. D |
H242 |
GHS02 Dgr |
H242 |
|
|
|
|
|
607-760-00-8 |
2-[N-ethyl-4-[(5-nitrothiazol-2-yl)azo]-m-toluidino]ethyl acetate; C.I. Disperse Blue 124 |
239-203-6 |
Skin Sens. 1A |
H317 |
GHS07 Wng |
H317 |
|
Skin Sens. 1A; H317: C ≥ 0,001 % |
|
|
|
607-761-00-3 |
Perfluoroheptanoic acid; tridecafluoroheptanoic acid |
206-798-9 |
Repr. 1B STOT RE 1 |
H360D H372 (liver) |
GHS08 Dgr |
H360D H372 (liver) |
|
|
|
|
|
607-762-00-9 |
methyl N-(isopropoxycarbonyl)-L-valyl-(3RS)-3-(4-chlorophenyl)-β-alaninate; valifenalate |
— |
Carc. 2 Aquatic Chronic 2 |
H351 H411 |
GHS08 GHS09 Wng |
H351 H411 |
|
|
|
|
|
607-763-00-4 |
6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid, sodium and tris(2-hydroxyethyl)ammonium salts |
— |
— |
Repr. 1B Eye Irrit. 2 |
H360FD H319 |
GHS08 GHS07 Dgr |
H360FD H319 |
|
|
|
|
607-764-00-X |
6-[(C10-C13)-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
— |
Repr. 1B Eye Irrit. 2 |
H360FD H319 |
GHS08 GHS07 Dgr |
H360FD H319 |
|
|
|
|
|
607-765-00-5 |
6-[C12-18-alkyl-(branched, unsaturated)-2,5-dioxopyrrolidin-1-yl]hexanoic acid |
— |
— |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
|
|
|
608-032-00-2 |
acetamiprid (ISO); (1E)-N-[(6-chloropyridin-3-yl)methyl]-N’-cyano-N-methylethanimidamide; (E)-N1-[(6-chloro-3-pyridyl)methyl]-N2-cyano-N1-methylacetamidine |
— |
Repr. 2 Acute Tox. 3 Aquatic Chronic 1 Aquatic Acute 1 |
H361d H301 H410 H400 |
GHS08 GHS06 GHS09 Dgr |
H361d H301 H410 |
|
oral: ATE = 140 mg/kg bw M = 10 M = 10 |
|
|
|
609-042-00-X |
pendimethalin (ISO); N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidene |
254-938-2 |
Repr. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H361d H400 H410 |
GHS08 GSH09 Wng |
H361d H410 |
|
M = 100 M = 10 |
|
|
|
613-012-00-1 |
bentazone (ISO); 3-isopropyl-2,1,3-benzothiadiazine-4-one-2,2-dioxide |
246-585-8 |
Repr. 2 Acute Tox. 4 Eye Irrit. 2 Skin Sens. 1 |
H361d H302 H319 H317 |
GHS08 GHS07 Wng |
H361d H302 H319 H317 |
|
oral: ATE = 1 600 mg/kg bw |
|
|
|
613-341-00-0 |
clofentezine (ISO); 3,6-bis(o-chlorophenyl)-1,2,4,5-tetrazine |
277-728-2 |
Aquatic Chronic 1 |
H410 |
GHS09 Wng |
H410 |
|
M = 1 |
|
|
|
613-342-00-6 |
theophylline; 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
200-385-7 |
Repr. 1B |
H360D |
GHS08 Dgr |
H360D |
|
|
|
|
|
613-343-00-1 |
pyridalyl (ISO); 2,6-dichloro-4-(3,3-dichloroallyloxy)phenyl 3-[5-(trifluoromethyl)-2-pyridyloxy]propyl ether |
— |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 1 000 M = 100 |
|
|
|
613-344-00-7 |
Pyridine-2-thiol 1-oxide, sodium salt; pyrithione sodium; sodium pyrithione |
223-296-5; 240-062-8 |
Acute Tox. 3 Acute Tox. 3 Acute Tox. 4 STOT RE 1 Skin Irrit. 2 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 2 |
H331 H311 H302 H372 (nervous system) H315 H319 H317 H400 H411 |
GHS06 GHS08 GHS09 Dgr |
H331 H311 H302 H372 (nervous system) H315 H319 H317 H410 |
EUH070 |
inhalation: ATE = 0,5 mg/L (dusts or mists) dermal: ATE = 790 mg/kg bw oral: ATE = 500 mg/kg bw M = 100 |
|
|
|
613-345-00-2 |
1,3,5-triazine-2,4,6-triamine; melamine |
203-615-4 |
Carc. 2 STOT RE 2 |
H351 H373 (urinary tract) |
GHS08 Wng |
H351 H373 (urinary tract) |
|
|
|
|
|
615-046-00-2 |
1,3-bis(1-isocyanato-1-methylethyl)benzene; [m-TMXDI] |
220-474-4 |
Resp. Sens. 1 Skin Sens. 1A |
H334 H317 |
GHS08 Dgr |
H334 H317 |
|
|
|
|
|
615-047-00-8 |
1,3-bis(isocyanatomethyl)benzene; [m-XDI] |
222-852-4 |
Resp. Sens. 1 Skin Sens. 1A |
H334 H317 |
GHS08 Dgr |
H334 H317 |
|
Skin Sens. 1A; H317: C ≥ 0,001 % |
|
|
|
615-048-00-3 |
2,4,6-triisopropyl-m-phenylene diisocyanate |
218-485-4 |
Resp. Sens. 1 Skin Sens. 1 |
H334 H317 |
GHS08 Dgr |
H334 H317 |
|
|
|
|
|
615-049-00-9 |
1,5-naphthylene diisocyanate [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
221-641-4 |
STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1A Aquatic Chronic 3 |
H335 H315 H319 H334 H317 H412 |
GHS07 GHS08 Dgr |
H335 H315 H319 H334 H317 H412 |
|
|
|
|
|
615-050-00-4 |
1,5-naphthylene diisocyanate [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
221-641-4 |
Acute Tox. 2 STOT SE 3 Skin Irrit. 2 Eye Irrit. 2 Resp. Sens. 1 Skin Sens. 1A Aquatic Chronic 3 |
H330 H335 H315 H319 H334 H317 H412 |
GHS06 GHS08 Dgr |
H330 H335 H315 H319 H334 H317 H412 |
|
inhalation: ATE = 0,27 mg/L (dusts or mists) |
|
|
|
616-164-00-7 |
dimoxystrobin (ISO); (2E)-2-{2-[(2,5-dimethylphenoxy)methyl]phenyl}-2-(methoxyimino)-N-methylacetamide; (E)-2-(methoxyimino)-N-methyl-2-[α-(2,5-xylyloxy)-o-tolyl]acetamide |
|
Carc. 2 Repr. 2 Acute Tox. 4 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H361d H332 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H361d H332 H410 |
|
inhalation: ATE = 1,3 mg/L (dusts or mists) M = 100 M = 100 |
|
|
|
616-237-00-3 |
fluopicolide (ISO); 2,6-dichloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridylmethyl]benzamide |
— |
Repr. 2 |
H361d |
GHS08 Wng |
H361d |
|
|
|
|
|
616-238-00-9 |
N-(2-nitrophenyl)phosphoric triamide |
477-690-9 |
Repr. 1B STOT RE 2 |
H360Fd H373 (kidneys) |
GHS08 Dgr |
H360Fd H373 (kidneys) |
|
|
|
|
|
616-239-00-4 |
N-(5-chloro-2-isopropylbenzyl)-N-cyclopropyl-3-(difluoromethyl)-5-fluoro-1-methyl-1H-pyrazole-4-carboxamide; isoflucypram |
— |
Repr. 2 Acute Tox. 4 Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H361f H332 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f H332 H317 H410 |
|
inhalation: ATE = 2,2 mg/L (dusts or mists) M = 10 M = 1 |
|
|
|
616-240-00-X |
Reaction mass of 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9RS)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide and 3-(difluoromethyl)-1-methyl-N-[(1RS,4SR,9SR)-1,2,3,4-tetrahydro-9-isopropyl-1,4-methanonaphthalen-5-yl]pyrazole-4-carboxamide [≥ 78 % syn isomers ≤ 15 % anti isomers relative content]; isopyrazam |
— |
Carc. 2 Repr. 1B Skin Sens. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H351 H360D H317 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D H317H410 |
|
Repr. 1B; H360D: C ≥ 3 % M = 10 M = 10 |
|
|
|
650-058-00-1 |
Margosa, ext. [from the kernels of Azadirachta indica extracted with water and further processed with organic solvents] |
283-644-7 |
Repr. 2 Skin Sens. 1 Aquatic Chronic 1 |
H361d H317 H410 |
GHS08 GHS07 GHS09 Wng |
H361d H317 H410 |
|
M = 10 |
|
|
|
(*1)
ATEs for oral and dermal exposure routes are expressed in mg/kg bw, which stands for milligram per kilogram bodyweight. |
||||||||||